function usage()
{
- echo "bench_nitdoc [options]* benchname"
+ echo "bench_nitdoc [options]* git-ref"
echo " -v: verbose mode"
echo " -n count: number of execution for each bar (default: $count)"
echo " --dry: Do not run the commands, just reuse the data and generate the graph"
esac
done
-NOTSKIPED="$*"
+REF="$*"
-if test -z "$NOTSKIPED"; then
+if test -z "$REF"; then
usage
fi
tests=(../tests/test_prog ../lib/standard/kernel.nit ../lib/standard)
mkdir -p $basedir
- prepare_res $basedir/orig.dat "origin/master" "nitdoc.orig"
+ prepare_res $basedir/orig.dat $REF "nitdoc.orig"
for path in ${tests[@]}; do
run_gen $basedir ./nitdoc.orig $path
done
src/benitlux_serial.nit:
../../bin/nitserial -o $@ src/benitlux_web.nit
+
+bin/report: $(shell ../../bin/nitls -M src/report.nit)
+ ../../bin/nitc -o bin/report src/report.nit
+
+report: bin/report
+ bin/report
return events
end
+ # List known beers
+ #
+ # Return `null` on error.
+ fun beers: nullable Array[Beer]
+ do
+ var stmt = select("name, desc FROM beers")
+ if stmt == null then return null
+ return [for row in stmt do row.to_beer]
+ end
+
+ # Days where `beer` was available, all known days if `beer == null`
+ #
+ # Return `null` on error.
+ fun days(beer: nullable Beer): nullable Array[String]
+ do
+ var stmt
+ if beer == null then
+ stmt = select("DISTINCT day FROM daily")
+ else
+ stmt = select("""
+DISTINCT day FROM daily WHERE beer=(SELECT ROWID FROM beers WHERE name="{{{beer.name}}}")""")
+ end
+
+ if stmt == null then return null
+ return [for row in stmt do row[0].to_s]
+ end
+
# All the subscribers to the mailing list
fun subscribers: Array[String]
do
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+import benitlux_model
+import benitlux_db
+
+# Sort beers by their availability
+class BeerComparator
+ super Comparator
+
+ # 1st sorting priority
+ var map1: HashMap[COMPARED, Comparable]
+
+ # 2nd sorting priority
+ var map2: HashMap[COMPARED, Comparable]
+
+ # Key compare
+ redef fun compare(a, b) do return if map1[a] == map1[b] then
+ map2[a] <=> map2[b]
+ else map1[a] <=> map1[b]
+end
+
+# Use the local DB
+var db_path = "benitlux_sherbrooke.db"
+var db = new DB.open(db_path)
+
+# All known beers
+var beers = db.beers
+assert beers != null
+print "{beers.length} known beers"
+
+# All days
+var all_days = db.days
+assert all_days != null
+print "{all_days.length} days, from {all_days.first} to {all_days.last}"
+
+# Beers availability by days
+var beer2days = new HashMap[Beer, Array[String]]
+for beer in beers do
+ var days = db.days(beer)
+ assert days != null
+ default_comparator.sort days
+ beer2days[beer] = days
+end
+
+# Sort beers by their availability and first date of appearance
+var availability = new HashMap[Beer, Int]
+var appearances = new HashMap[Beer, String]
+for beer in beers do
+ var days = beer2days[beer]
+ if days.not_empty then
+ appearances[beer] = days.first
+ availability[beer] = -days.length # Opposite for inverse sort
+ else
+ appearances[beer] = "err"
+ availability[beer] = 1
+ end
+end
+
+# Sort by availability then appearance
+var sorter: Comparator = new BeerComparator(availability, appearances)
+sorter.sort beers
+
+# List all beers
+print "\nBeers:"
+for beer in beers do
+ var days = beer2days[beer]
+
+ # Skip never-available beers, usually name errors
+ if days.is_empty then continue
+
+ var from = days.first
+ if from == all_days.first then from = " ... "
+
+ var to = days.last
+ if to == all_days.last then to = " ... "
+
+ print "- {days.length}\t{from} {to}\t{beer.name}: {beer.desc}"
+end
+
+# Sort by appearance then availability
+sorter = new BeerComparator(appearances, availability)
+sorter.sort beers
+
+# Display the batch graph
+print "\nBatches:"
+
+# Compute `column_width` days from all the known days
+var column_width = 70
+var days_sample = [for i in column_width.times do all_days[i*all_days.length/column_width]]
+
+for beer in beers do
+ var days = beer2days[beer]
+
+ # Skip never-available beers, usually name errors
+ if days.is_empty then continue
+
+ # Print a line looking like: " ############ ###### ######## : Beer"
+ for s in days_sample do printn if days.has(s) then "#" else " "
+ print ": {beer.name}"
+end
+
+db.close
import friendz
import mnit_android
import android::landscape
-import android::audio
-import android::assets_and_resources
+
redef class App
# Zoom applied for the device display from the game logic coordinates
var zoom = 1.0
end
redef class AndroidPointerEvent
- redef fun is_motion do return not just_went_down
+ redef fun is_motion do return is_move
redef fun x do return super / app.zoom
redef fun y do return super / app.zoom
import friendz
import mnit_linux
-import linux::audio
redef class Display
redef fun wanted_width do return app.screen_width
var auth = get_github_oauth
if auth == "" then
- print "Not github token, please configure one with"
+ print "Warning: no github oauth token, you can configure one with"
print " git config --add github.oauthtoken MYOAUTHTOKEN"
- return
end
var curl = new GithubCurl(auth, "Merge-o-matic (privat/nit)")
-all: bins tests
-
-bins:
+all:
mkdir -p bin
../../bin/nitc --dir bin src/svg_to_png_and_nit.nit src/svg_to_icons.nit
-check: tests
-tests: test-dino test-app
+check: test-dino test-app
test-app: bin/svg_to_png_and_nit
make -C tests/app
end
svg_file.close
- assert page_width != -1
- assert page_height != -1
+ if page_width == -1 or page_height == -1 then
+ stderr.write "Source drawing file '{drawing}' doesn't look like an SVG file\n"
+ exit 1
+ end
# Query Inkscape
var prog = "inkscape"
-/gen
+gen/*
src/javap_lexer.nit
src/javap_parser.nit
src/javap_test_parser.nit
+src/serial.nit
+tests/*.nit
+tmp/*
-all: nitcc grammar bin/jwrapper
+all: bin/jwrapper
-nitcc:
+../nitcc/src/nitcc:
make -C ../nitcc
-grammar:
+src/javap_test_parser.nit: ../nitcc/src/nitcc grammar/javap.sablecc
../nitcc/src/nitcc grammar/javap.sablecc
mkdir -p src gen
- mv *.nit src/
+ mv javap_*.nit src/
mv javap* gen/
-bin/jwrapper:
+src/serial.nit: $(shell ../../bin/nitls -M src/jwrapper.nit)
+ ../../bin/nitserial -o src/serial.nit -d project src/jwrapper.nit
+
+bin/jwrapper: src/javap_test_parser.nit src/serial.nit $(shell ../../bin/nitls -M src/jwrapper.nit) ../../bin/nitc
mkdir -p bin
- ../../bin/nitc src/jwrapper.nit -o bin/jwrapper
+ ../../bin/nitc src/jwrapper.nit -o bin/jwrapper -m src/serial.nit
clean:
rm -f bin/javap_test_parser bin/jwrapper
rm -f gen/*
rm src/javap_lexer.nit src/javap_parser.nit src/javap_test_parser.nit
-.PHONY: grammar bin/jwrapper
+check: bin/jwrapper tests/wildcards.javap
+ mkdir -p tmp
+ bin/jwrapper -v -u stub -o tests/statics.nit tests/statics.javap
+ ../../bin/nitpick -q tests/statics.nit
+ bin/jwrapper -v -u comment -o tests/generics.nit tests/generics.javap
+ ../../bin/nitpick -q tests/generics.nit
+ bin/jwrapper -v -u comment -o tests/long.nit tests/long.javap
+ ../../bin/nitpick -q tests/long.nit
+ bin/jwrapper -v -u comment -o tests/inits.nit tests/inits.javap
+ ../../bin/nitpick -q tests/inits.nit
+ bin/jwrapper -v -u comment -o tests/testjvm.nit tests/testjvm.javap
+ ../../bin/nitpick -q tests/testjvm.nit
+ bin/jwrapper -v -u comment -o tests/many.nit tests/many.javap
+ ../../bin/nitpick -q tests/many.nit
+ bin/jwrapper -v -u comment -o tests/wildcards.nit tests/wildcards.javap
+ ../../bin/nitpick -q tests/wildcards.nit
+ make -C examples/queue/ check
+ make -C examples/java_api/ check
+
+check-libs: bin/jwrapper
+ # This config dependent rule must be tweaked according to each system
+
+ # The full local Java standard library
+ bin/jwrapper -v -u comment -o tests/rt_full.nit /usr/lib/jvm/default-java/jre/lib/rt.jar
+ echo "+ Disabled functions: `grep '# fun' tests/rt_full.nit | wc -l` / `grep '^ fun' tests/rt_full.nit | wc -l`"
+ nitpick tests/rt_full.nit
+
+ # Only the `java` namespace of the standard library to avoid conflicts with other libs
+ bin/jwrapper -v -u comment -o tests/rt.nit /usr/lib/jvm/default-java/jre/lib/rt.jar -r ^java
+ echo "+ Disabled functions: `grep '# fun' tests/rt.nit | wc -l` / `grep '^ fun' tests/rt.nit | wc -l`"
+ nitpick tests/rt.nit
+
+ # tools.jar, not using the standard library because of conflicts on sun.tools.jar.*
+ bin/jwrapper -v -u comment -o tests/java_tools.nit /usr/lib/jvm/default-java/lib/tools.jar -i tests/rt.nit
+ sed -i -e "s/import java/import java\nimport rt/" tests/java_tools.nit
+ echo "+ Disabled functions: `grep '# fun' tests/java_tools.nit | wc -l` / `grep '^ fun' tests/java_tools.nit | wc -l`"
+ nitpick tests/java_tools.nit
+
+ # SableCC using the standard Java library
+ bin/jwrapper -v -u comment -o tests/sablecc.nit ~/apps/sablecc-3-beta.3.altgen.20041114/lib/sablecc.jar -i tests/rt.nit
+ sed -i -e "s/import java/import java\nimport rt/" tests/sablecc.nit
+ echo "+ Disabled functions: `grep '# fun' tests/sablecc.nit | wc -l` / `grep '^ fun' tests/sablecc.nit | wc -l`"
+ nitpick tests/sablecc.nit
+
+ make -C examples/android_api/ check
--- /dev/null
+android_api.nit
+java_api.nit
+java_api.jwrapper.bin
+tmp/
--- /dev/null
+ANDROID_JAR ?= ~/sdks/android-sdk/platforms/android-10/android.jar
+
+all: android_api.nit
+
+java_api.nit:
+ mkdir -p tmp
+ ../../bin/jwrapper -vv -u comment -o java_api.nit -r "^(java|javax|junit|org)" $(ANDROID_JAR) -i ../../../../lib/java/collections.nit --save-model
+ echo "+ Disabled functions: `grep '#\s*fun' $@ | wc -l` / `grep '^\s*fun' $@ | wc -l`"
+
+android_api.nit: java_api.nit
+ ../../bin/jwrapper -vv -u comment -o android_api.nit -r "^(android|com.android)" -i java_api.nit $(ANDROID_JAR) -i ../../../../lib/java/collections.nit -m java_api.jwrapper.bin
+ echo "+ Disabled functions: `grep '#\s*fun' $@ | wc -l` / `grep '^\s*fun' $@ | wc -l`"
+
+ # Insert an import between the 2 modules
+ sed -i -e "s/import java/import java\nimport java_api/" android_api.nit
+
+check: android_api.nit
+ ../../../../bin/nitpick android_api.nit
+
+.PHONY: android_api.nit java_api.nit
--- /dev/null
+java_api.nit
+api_user
+api_user.res
+api_user.jar
+tmp/
--- /dev/null
+RT_JAR ?= /usr/lib/jvm/default-java/jre/lib/rt.jar
+
+all: api_user
+
+java_api.nit:
+ mkdir -p tmp
+ ../../bin/jwrapper -vv -u comment -o java_api.nit $(RT_JAR) \
+ -r "^java.(lang|util|io)" -i ../../../../lib/java/collections.nit
+ echo "+ Disabled functions: `grep '#\s*fun' $@ | wc -l` / `grep '^\s*fun' $@ | wc -l`"
+
+api_user: java_api.nit
+ # Using --semi-global makes it much faster
+ time -f "%E k:%S u:%U" ../../../../bin/nitc -v api_user.nit --semi-global
+
+check: api_user
+ ./api_user > api_user.res
+ diff api_user.sav api_user.res
+
+full_java_api.nit:
+ mkdir -p tmp
+ ../../bin/jwrapper -vv -u comment -o full_java_api.nit $(RT_JAR) \
+ -r "^(java|org)" -i ../../../../lib/java/collections.nit
+ echo "+ Disabled functions: `grep '#\s*fun' $@ | wc -l` / `grep '^\s*fun' $@ | wc -l`"
+
+ # Force compilation of the Java code
+ echo 'fun foo in "Java" `{ `}; foo' >> full_java_api.nit
+
+ # This may take a while...
+ time -f "%E k:%S u:%U" ../../../../bin/nitc -v full_java_api.nit --no-cc
+
+ # Don't compile the C, only the Java
+ make -C nit_compile Nit_full_java_api.class
+
+.PHONY: api_user java_api.nit
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+import java_api
+
+# Get a Java string
+var str = java_lang_integer_to_string_int(5678)
+
+# Do some Java side printing
+java_lang_system_out.println_int 1234
+java_lang_system_out.println_String str
+
+# Test a generic list
+var list = new Java_util_ArrayList
+
+print "List is empty? {list.is_empty}"
+print "List size {list.size}"
+
+list.add str
+print "List is empty? {list.is_empty}"
+print "List size {list.size}"
+
+var str_back = list.get(0)
+java_lang_system_out.println_String str_back.to_string
+
+list.clear
+print "List is empty? {list.is_empty}"
+print "List size {list.size}"
--- /dev/null
+1234
+5678
+List is empty? true
+List size 0
+List is empty? false
+List size 1
+5678
+List is empty? true
+List size 0
--- /dev/null
+Queue.class
+queue.nit
+user_test
+user_test.res
+user_test.jar
--- /dev/null
+# Nit test program
+user_test: queue.nit $(shell ../../../../bin/nitls -M user_test.nit) ../../../../bin/nitc ../../bin/jwrapper
+ CLASSPATH=`pwd` ../../../../bin/nitc user_test.nit
+
+ # Manually add our class file to the Jar for easy access
+ jar -uf user_test.jar Queue.class
+
+# Compiled Java class
+Queue.class: Queue.java
+ javac Queue.java
+
+# The Nit wrapper to the Java class
+queue.nit: Queue.class
+ ../../bin/jwrapper Queue.class -o queue.nit -p "Java" -i auto
+
+# Test
+check: user_test
+ # Execute test
+ ./user_test > user_test.res
+
+ # Compare the result with the expected
+ diff user_test.sav user_test.res
--- /dev/null
+/*
+* This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+*/
+
+import java.util.*;
+
+public class Queue
+{
+ // function pointer
+ public native void printError( String errorMsg );
+
+ // internal list
+ private LinkedList<String> list;
+
+ public Queue()
+ {
+ list = new LinkedList<String>();
+ }
+
+ public void push( String element )
+ {
+ System.out.print( "From java, pushing " );
+ System.out.print( element );
+ System.out.print( "\n" );
+ list.addLast( element );
+ }
+
+ public String pop() // knows where is native printError
+ {
+ String element;
+
+ try
+ {
+ element = list.removeFirst();
+ }
+ catch ( NoSuchElementException e )
+ {
+ printError( "From java, empty queue." );
+ element = null;
+ throw e;
+ }
+
+ System.out.print( "From java, popping " );
+ System.out.print( element );
+ System.out.print( "\n" );
+
+ return element;
+ }
+}
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+import queue
+
+var queue = new JavaQueue
+queue.push "one".to_java_string
+queue.push "two".to_java_string
+queue.push "tree".to_java_string
+print queue.pop
+print queue.pop
+print queue.pop
--- /dev/null
+From java, pushing one
+From java, pushing two
+From java, pushing tree
+From java, popping one
+one
+From java, popping two
+two
+From java, popping tree
+tree
Grammar javap;
+// ---
Lexer
-identifier = ('a'..'z'|'A'..'Z'|'_'|'$') ('a'..'z'|'A'..'Z'|'_'|'$'|'0'..'9')*;
+identifier = ('a'..'z'|'A'..'Z'|'_'|'$') ('a'..'z'|'A'..'Z'|'_'|'-'|'$'|'0'..'9')*;
blank = (' '|'\n'|'\t'|'\r')+;
separator = ('.'|'/');
+brackets = '[]';
+wildcard = '?';
+compiled_from = 'Compiled from "' (Any-'"')* '"';
+dots = '...';
+// ---
Parser
Ignored blank;
-multi_files = compiled_from? class_declaration;
+// ---
+// Class and properties
-compiled_from = 'Compiled from "' identifier+ '.java"';
+files = file+;
+file = compiled_from? class_declaration;
class_declaration = modifier* class_or_interface full_class_name
extends_declaration? implements_declaration? throws_declaration?
'{' property_declaration* '}';
+modifier
+ = 'public'|'private'|'protected'|'static'|'final'|'native'
+ |'synchronized'|'abstract'|'threadsafe'|'transient'|'volatile'|'strictfp';
+
class_or_interface = 'class'|'interface';
-modifier = 'public'|'private'|'protected'|'static'|'final'|'native'|'synchronized'|'abstract'|'threadsafe'|'transient'|'volatile';
-type = type_specifier '[]'*;
-type_specifier = 'boolean'|'byte'|'char'|'short'|'int'|'float'|'long'|'double' | type_ref;
+implements_declaration = 'implements' types;
+extends_declaration = 'extends' types;
+throws_declaration = 'throws' types?;
+
+property_declaration
+ = {method:} modifier* generic_parameters? type identifier '(' types? ')' throws_declaration? ';'
+ | {constructor:} modifier* generic_parameters? full_class_name '(' types? ')' throws_declaration? ';'
+ | {attribute:} modifier* type identifier brackets* throws_declaration? ';'
+ | {static:} modifier* '{' '}' ';'
+ | ';';
+
+// ---
+// Types
-type_ref = full_class_name | generic_identifier 'extends' full_class_name | '?';
-type_refs = {tail:} type_refs ',' type_ref | {head:} type_ref;
+type = base_type brackets* dots?;
-generic_param = '<' generic_parameter_list '>';
-generic_parameter_list = {tail:} generic_parameter_list ',' parameter | {head:} parameter;
-generic_identifier = full_class_name | '?';
+types
+ = {tail:} types ',' type
+ | {head:} type;
-full_class_name = full_class_name separator class_name | class_name;
-class_name = identifier generic_param?;
+base_type
+ = {primitive:} primitive_base_type
+ | {class:} full_class_name
+ | {extends:} generic_identifier 'extends' type_bound
+ | {super:} generic_identifier 'super' type_bound
+ | {wildcard:} wildcard
+ | {void:} 'void';
-interface_name = full_class_name;
-interface_list = {tail:} interface_list ',' interface_name | {head:} interface_name;
+primitive_base_type = 'boolean'|'byte'|'char'|'short'|'int'|'float'|'long'|'double';
-parameter = type '...'?;
-parameter_list_comp = {tail:} parameter_list_comp ',' parameter | {head:} parameter;
-parameter_list = parameter_list_comp;
+type_bound
+ = {tail:} type_bound '&' full_class_name
+ | {head:} full_class_name;
-exception = type;
-exception_list = exception_list ',' exception | exception;
+generic_identifier
+ = {class:} full_class_name
+ | {wildcard:} wildcard;
-statement = variable_declaration | statement_block | ';';
-statement_block = '{' statement* '}';
+class_name = identifier generic_parameters?;
-variable_id = identifier '[]'*;
-method_id = identifier;
+full_class_name
+ = {tail:} full_class_name separator class_name
+ | {head:} class_name;
-property_declaration = method_declaration | constructor_declaration | variable_declaration | static_declaration | ';';
-variable_declaration = modifier* type variable_id throws_declaration? ';';
-method_declaration = modifier* generic_param? type method_id '(' parameter_list? ')' throws_declaration? ';';
-constructor_declaration = modifier* full_class_name '(' parameter_list? ')' throws_declaration? ';';
-implements_declaration = 'implements' interface_list*;
-extends_interface_declaration = 'extends' interface_list*;
-extends_declaration = 'extends' type;
-static_declaration = modifier* '{' '}' ';';
-throws_declaration = 'throws' exception_list?;
+generic_parameters = '<' types '>';
# This file is part of NIT (http://www.nitlanguage.org).
#
# Copyright 2014 Frédéric Vachon <fredvac@gmail.com>
+# Copyright 2015 Alexis Laferrière <alexis.laf@xymus.net>
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
class CodeGenerator
- var with_attributes: Bool
- var comment_unknown_types: Bool
- var file_out: FileWriter
- var java_class: JavaClass
- var nb_params: Int
- var module_name: nullable String = null
+ # Path to the output file
+ var file_name: String
- init (file_name: String, jclass: JavaClass, with_attributes, comment: Bool)
- do
- file_out = new FileWriter.open(file_name)
+ # Model of Java class being wrapped
+ var model: JavaModel
- var nit_ext = ".nit"
- if file_name.has_suffix(nit_ext) then
- # Output file ends with .nit, we expect it to be a valid name
- module_name = file_name.strip_extension(nit_ext)
+ # Comment out methods with unknown (unwrapped) types
+ var comment_unknown_types: Bool
- # Otherwise, it may be anything so do not declare a module
- end
+ # Generate stub classes for unknown types used in the generated module
+ var stub_for_unknown_types: Bool
+
+ # Output file
+ var file_out: Writer = new FileWriter.open(file_name) is lazy, writable
- self.java_class = jclass
- self.with_attributes = with_attributes
- self.comment_unknown_types = comment
+ # Name of the Nit module to generate
+ var module_name: nullable String is lazy do
+ if file_name.file_extension == "nit" then
+ # Output file ends with .nit, we expect it to be a valid name
+ return file_name.basename(".nit")
+ else return null
end
+ # Generate the Nit module into `file_out`
fun generate
do
- var jclass = self.java_class
+ # License
+ file_out.write license
- var class_content = new Array[String]
- class_content.add(gen_class_header(jclass.class_type))
+ # Module declaration
+ var module_name = module_name
+ if module_name != null then file_out.write "module {module_name} is no_warning(\"useless-superclass\")\n"
+ file_out.write "\n"
+
+ # All importations
+ var imports = new HashSet[String]
+ imports.add "import java\n"
+ for key, jclass in model.classes do
+ for import_ in jclass.imports do imports.add "import android::{import_}\n"
+ end
+ file_out.write imports.join("\n")
+ file_out.write "\n"
- if with_attributes then
- for id, jtype in jclass.attributes do class_content.add(gen_attribute(id, jtype))
+ # Sort classes from top-level classes (java.lang.Object) to leaves
+ var standard_classes = new Array[JavaClass]
+ for name, jclass in model.classes do
+ if not jclass.class_type.is_anonymous then standard_classes.add jclass
end
+ var linearized = model.class_hierarchy.linearize(standard_classes)
+
+ for jclass in linearized do
+ # Skip classes with an invalid name at the Java language level
+ if jclass.class_type.extern_equivalent.has("-") then continue
+
+ generate_class_header(jclass)
+
+ if not sys.opt_no_properties.value then
+
+ for id, signatures in jclass.local_intro_methods do
+ for signature in signatures do
+ assert not signature.is_static
+ generate_method(jclass, id, id, signature.return_type, signature.params)
+ file_out.write "\n"
+ end
+ end
- for id, methods_info in jclass.methods do
- for method_info in methods_info do
- var nid = id
- if methods_info.length > 1 then nid += "{methods_info.index_of(method_info)}"
- class_content.add gen_method(id, nid, method_info.return_type, method_info.params)
+ # Constructors
+ for constructor in jclass.constructors do
+ var complex = jclass.constructors.length != 1 and constructor.params.not_empty
+ var base_name = if complex then "from" else ""
+ var name = jclass.nit_name_for(base_name, constructor.params, complex, false, local_only=true)
+
+ generate_constructor(jclass, constructor, name)
+ end
+
+ # Attributes
+ for id, attribute in jclass.attributes do if not attribute.is_static then
+ generate_getter_setter(jclass, id, attribute)
+ end
end
- end
- class_content.add("\nend\n")
- var wrappers = new Array[String]
- for jtype in jclass.unknown_types do
- if jtype == jclass.class_type then continue
- wrappers.add("\n")
- wrappers.add(gen_unknown_class_header(jtype))
- end
+ # JNI services
+ generate_jni_services jclass.class_type
- var imports = new Array[String]
- imports.add("import mnit_android\n")
- for import_ in jclass.imports do
- imports.add("import android::{import_}\n")
- end
+ # Close the class
+ file_out.write "end\n\n"
- file_out.write(gen_licence)
+ if not sys.opt_no_properties.value then
- var module_name = module_name
- if module_name != null then file_out.write "module {module_name}\n"
+ # Static functions as top-level methods
+ var static_functions_prefix = jclass.class_type.extern_name.to_snake_case
+ for id, signatures in jclass.methods do
+ for signature in signatures do if signature.is_static then
+ var nit_id = static_functions_prefix + "_" + id
+ generate_method(jclass, id, nit_id, signature.return_type, signature.params, is_static=true)
+ file_out.write "\n"
+ end
+ end
+
+ # Static attributes as top-level getters and setters
+ for id, attribute in jclass.attributes do if attribute.is_static then
+ generate_getter_setter(jclass, id, attribute)
+ end
+ end
+
+ # Primitive arrays
+ for d in [1..opt_arrays.value] do
+ generate_primitive_array(jclass, d)
+ end
+ end
+
+ if stub_for_unknown_types then
+ for jtype, nit_type in model.unknown_types do
+ generate_unknown_class_header(jtype)
+ file_out.write "\n"
+ end
+ end
- file_out.write("\n")
- file_out.write(imports.join(""))
- file_out.write("\n")
- file_out.write(class_content.join(""))
- file_out.write(wrappers.join(""))
+ file_out.close
end
- fun gen_licence: String
+ # Serialize `model` to a file next to `file_name`
+ fun write_model_to_file
do
- return """
+ if not sys.opt_save_model.value then return
+
+ # Write the model to file next to the Nit module
+ var model_path = file_name.strip_extension + ".jwrapper.bin"
+ var model_stream = model_path.to_path.open_wo
+ var serializer = new BinarySerializer(model_stream)
+ serializer.serialize model
+ model_stream.close
+ end
+
+ # License for the header of the generated Nit module
+ var license = """
# This file is part of NIT (http://www.nitlanguage.org).
#
# Licensed under the Apache License, Version 2.0 (the "License");
# limitations under the License.
# This code has been generated using `jwrapper`
-"""
- end
+""" is writable
- fun gen_class_header(jtype: JavaType): String
+ private fun generate_class_header(java_class: JavaClass)
do
- var temp = new Array[String]
- temp.add("extern class Native{jtype.id} in \"Java\" `\{ {jtype} `\}\n")
- temp.add("\tsuper JavaObject\n\n")
+ var java_type = java_class.class_type
+ var nit_type = model.java_to_nit_type(java_type)
- return temp.join("")
- end
+ var super_java_types = new HashSet[JavaType]
+ super_java_types.add_all java_class.extends
+ super_java_types.add_all java_class.implements
- fun gen_unknown_class_header(jtype: JavaType): String
- do
- var nit_type: NitType
- if jtype.extern_name.has_generic_params then
- nit_type = jtype.extern_name.generic_params.first
- else
- nit_type = jtype.extern_name
+ var supers = new Array[String]
+ var effective_supers = 0
+ for java_super in super_java_types do
+ var nit_super = model.java_to_nit_type(java_super)
+
+ # Comment out unknown types
+ var c = ""
+ if not nit_super.is_known and comment_unknown_types then c = "# "
+
+ supers.add "{c}super {nit_super}"
+ if c != "# " then effective_supers += 1
+ end
+
+ if effective_supers == 0 then
+ if java_class.class_type.package_name == "java.lang.Object" or
+ not model.knows_the_object_class then
+ supers.add "super JavaObject"
+ else supers.add "super Java_lang_Object"
end
- var temp = new Array[String]
- temp.add("extern class {nit_type} in \"Java\" `\{ {jtype.to_package_name} `\}\n")
- temp.add("\tsuper JavaObject\n\nend\n")
+ file_out.write """
+# Java class: {{{java_type}}}
+extern class {{{nit_type}}} in "Java" `{ {{{java_type.extern_equivalent}}} `}
+ {{{supers.join("\n\t")}}}
- return temp.join("")
+"""
end
- fun gen_attribute(jid: String, jtype: JavaType): String
+ private fun generate_unknown_class_header(jtype: JavaType)
do
- return "\tvar {jid.to_nit_method_name}: {jtype.to_nit_type}\n"
+ var nit_type = jtype.extern_name
+
+ file_out.write "extern class {nit_type} in \"Java\" `\{ {jtype.extern_equivalent} `\}\n"
+ file_out.write "\tsuper JavaObject\n\nend\n"
end
- fun gen_method(jmethod_id: String, nmethod_id: String, jreturn_type: JavaType, jparam_list: Array[JavaType]): String
+ private fun generate_method(java_class: JavaClass, java_method_id, method_id: String,
+ java_return_type: JavaType, java_params: Array[JavaType], is_static: nullable Bool)
do
- var java_params = ""
- var nit_params = ""
+ var java_args = new Array[String]
+ var nit_params = new Array[String]
var nit_id = "arg"
var nit_id_no = 0
- var nit_types = new Array[NitType]
- var comment = ""
+ var c = ""
# Parameters
- for i in [0..jparam_list.length[ do
- var jparam = jparam_list[i]
- var nit_type = jparam.to_nit_type
-
- if not nit_type.is_complete then
- if jparam.is_wrapped then
- java_class.imports.add nit_type.mod.as(not null)
- else
- if comment_unknown_types then
- comment = "#"
- else
- nit_type = jparam.extern_name
- java_class.unknown_types.add(jparam)
- end
- end
- end
-
- var cast = ""
+ for jparam in java_params do
+ var nit_type = model.java_to_nit_type(jparam)
- if not jparam.is_collection then cast = jparam.param_cast
+ if not nit_type.is_known and comment_unknown_types then c = "#"
+ if jparam.is_vararg then c = "#"
- nit_types.add(nit_type)
- nit_type.arg_id = "{nit_id}{nit_id_no}"
-
- if i == jparam_list.length - 1 then
- java_params += "{cast}{nit_id}{nit_id_no}"
- nit_params += "{nit_id}{nit_id_no}: {nit_type}"
- else
- java_params += "{cast}{nit_id}{nit_id_no}" + ", "
- nit_params += "{nit_id}{nit_id_no}: {nit_type}, "
- end
+ java_args.add "{jparam.param_cast}{nit_id}{nit_id_no}"
+ nit_params.add "{nit_id}{nit_id_no}: {nit_type}"
nit_id_no += 1
end
# Method identifier
- var method_id = nmethod_id.to_nit_method_name
+ method_id = method_id.to_nit_method_name
+ method_id = java_class.nit_name_for(method_id, java_params, java_class.methods[java_method_id].length > 1, is_static == true)
+
+ # Build the signature
var nit_signature = new Array[String]
+ nit_signature.add "fun {method_id}"
+ if not java_params.is_empty then nit_signature.add "({nit_params.join(", ")})"
+
+ # Return value
+ var return_type = null
+ if not java_return_type.is_void then
+ return_type = model.java_to_nit_type(java_return_type)
- nit_signature.add "\tfun {method_id}"
+ if not return_type.is_known and comment_unknown_types then c = "#"
+ if java_return_type.is_vararg then c = "#"
- if not jparam_list.is_empty then
- nit_signature.add "({nit_params})"
+ nit_signature.add ": " + return_type.to_s
end
- var return_type = null
+ # Build the call in Java
+ var java_call
+ if is_static == true then
+ java_call = java_class.class_type.package_name
+ else java_call = "self"
+ java_call += ".{java_method_id}({java_args.join(", ")})"
+
+ if return_type != null then java_call = "return {java_return_type.return_cast}" + java_call
+
+ # Tabulation
+ var t = "\t"
+ if is_static == true then t = ""
+ var ct = c+t
+
+ # Write
+ file_out.write """
+{{{t}}}# Java implementation: {{{java_return_type}}} {{{java_class}}}.{{{java_method_id}}}({{{java_params.join(", ")}}})
+{{{ct}}}{{{nit_signature.join}}} in "Java" `{
+{{{ct}}} {{{java_call}}};
+{{{ct}}}`}
+"""
+ end
- if not jreturn_type.is_void then
- return_type = jreturn_type.to_nit_type
-
- if not return_type.is_complete then
- if jreturn_type.is_wrapped then
- java_class.imports.add return_type.mod.as(not null)
- else
- if comment_unknown_types then
- comment = "#"
- else
- return_type = jreturn_type.extern_name
- java_class.unknown_types.add(jreturn_type)
- end
- end
+ # Generate getter and setter to access an attribute, of field
+ private fun generate_getter_setter(java_class: JavaClass, java_id: String,
+ attribute: JavaAttribute)
+ do
+ var java_type = attribute.java_type
+ var nit_type = model.java_to_nit_type(java_type)
+
+ var nit_id = java_id
+ if attribute.is_static then nit_id = java_class.class_type.extern_name.to_snake_case + "_" + nit_id
+ nit_id = nit_id.to_nit_method_name
+ nit_id = java_class.nit_name_for(nit_id, [java_type], false, attribute.is_static)
+
+ var c = ""
+ if not nit_type.is_known and comment_unknown_types then c = "#"
+ if java_type.is_vararg then c = "#"
+
+ var recv
+ if attribute.is_static then
+ recv = java_class.class_type.package_name
+ else recv = "self"
+
+ # Tabulation
+ var t = "\t"
+ if attribute.is_static then t = ""
+ var ct = c+t
+
+ file_out.write """
+{{{t}}}# Java getter: {{{java_class}}}.{{{java_id}}}
+{{{ct}}}fun {{{nit_id}}}: {{{nit_type}}} in "Java" `{
+{{{ct}}} return {{{recv}}}.{{{java_id}}};
+{{{ct}}}`}
+
+{{{t}}}# Java setter: {{{java_class}}}.{{{java_id}}}
+{{{ct}}}fun {{{nit_id}}}=(value: {{{nit_type}}}) in "Java" `{
+{{{ct}}} {{{recv}}}.{{{java_id}}} = value;
+{{{ct}}}`}
+
+"""
+ end
+
+ # Generate getter and setter to access an attribute, of field
+ private fun generate_constructor(java_class: JavaClass, constructor: JavaConstructor, name: String)
+ do
+ var c = ""
+ var nit_params_s = ""
+ var java_params_s = ""
+
+ if constructor.params.not_empty then
+ var nit_params = new Array[String]
+ var java_params = new Array[String]
+ var param_id = 'a'
+ for java_type in constructor.params do
+
+ java_params.add "{java_type.param_cast}{param_id}"
+
+ var nit_type = model.java_to_nit_type(java_type)
+ nit_params.add "{param_id}: {nit_type}"
+ param_id = param_id.successor(1)
+
+ if not nit_type.is_known and comment_unknown_types then c = "#"
+ if java_type.is_vararg then c = "#"
end
- nit_signature.add ": {return_type} "
+ nit_params_s = "(" + nit_params.join(", ") + ")"
+ java_params_s = java_params.join(", ")
end
- var temp = new Array[String]
+ file_out.write """
+ # Java constructor: {{{java_class}}}
+{{{c}}} new {{{name}}}{{{nit_params_s}}} in "Java" `{
+{{{c}}} return new {{{java_class.class_type.package_name}}}({{{java_params_s}}});
+{{{c}}} `}
- temp.add(comment + nit_signature.join(""))
+"""
+ end
- # FIXME : This huge `if` block is only necessary to copy primitive arrays as long as there's no better way to do it
- if comment == "#" then
- temp.add(" in \"Java\" `\{\n{comment}\t\tself.{jmethod_id}({java_params});\n{comment}\t`\}\n")
- # Methods with return type
- else if return_type != null then
- temp.add(" in \"Java\" `\{\n{comment}\t\treturn {jreturn_type.return_cast}self.{jmethod_id}({java_params});\n{comment}\t`\}\n")
- # Methods without return type
- else if jreturn_type.is_void then
- temp.add(" in \"Java\" `\{\n{comment}\t\tself.{jmethod_id}({java_params});\n{comment}\t`\}\n")
- # No copy
- else
- temp.add(" in \"Java\" `\{\n{comment}\t\tself.{jmethod_id}({java_params});\n{comment}\t`\}\n")
- end
+ private fun generate_primitive_array(java_class: JavaClass, dimensions: Int)
+ do
+ var base_java_type = java_class.class_type
+ var java_type = base_java_type.clone
+ java_type.array_dimension = dimensions
+
+ var base_nit_type = model.java_to_nit_type(base_java_type)
+ var nit_type = model.java_to_nit_type(java_type)
+
+ file_out.write """
+# Java primitive array: {{{java_type}}}
+extern class {{{nit_type}}} in "Java" `{ {{{java_type.extern_equivalent}}} `}
+ super AbstractJavaArray[{{{base_nit_type}}}]
+
+ # Get a new array of the given `size`
+ new(size: Int) in "Java" `{ return new {{{base_java_type}}}[(int)size]; `}
- return temp.join("")
+ redef fun [](i) in "Java" `{ return self[(int)i]; `}
+
+ redef fun []=(i, e) in "Java" `{ self[(int)i] = e; `}
+
+ redef fun length in "Java" `{ return self.length; `}
+
+"""
+ generate_jni_services(java_type)
+ file_out.write """
+end
+
+"""
+ end
+
+ # Generate JNI related services
+ #
+ # For now, mostly avoid issue #845, but more services could be generated as needed.
+ private fun generate_jni_services(java_type: JavaType)
+ do
+ var nit_type = model.java_to_nit_type(java_type)
+
+ file_out.write """
+ redef fun new_global_ref import sys, Sys.jni_env `{
+ Sys sys = {{{nit_type}}}_sys(self);
+ JNIEnv *env = Sys_jni_env(sys);
+ return (*env)->NewGlobalRef(env, self);
+ `}
+
+ redef fun pop_from_local_frame_with_env(jni_env) `{
+ return (*jni_env)->PopLocalFrame(jni_env, self);
+ `}
+"""
end
end
+redef class Sys
+ # List of Nit keywords
+ #
+ # These may also be keywords in Java, but there they would be used capitalized.
+ private var nit_keywords = new HashSet[String].from(["abort", "abstract", "and", "assert",
+ "break", "class", "continue", "do", "else", "end", "enum", "extern", "false", "implies",
+ "import", "init", "interface", "intrude", "if", "in", "is", "isa", "isset", "for", "label",
+ "loop", "module", "new", "not", "null", "nullable", "or", "package", "private",
+ "protected", "public", "return", "self", "super", "then", "true", "type", "var", "while",
+
+ # Top-level methods
+ "class_name", "get_time", "hash", "inspect", "inspect_head", "is_same_type",
+ "is_same_instance", "object_id", "output", "output_class_name", "sys", "to_s",
+
+ # Pointer or JavaObject methods
+ "free"])
+
+ # Name of methods used at the top-level
+ #
+ # Used by `JavaClass::nit_name_for` with static properties.
+ private var top_level_used_names = new HashSet[String]
+
+ # Option to _not_ generate properties (static or from classes)
+ var opt_no_properties = new OptionBool("Do not wrap properties, only classes and basic services", "-n", "--no-properties")
+
+ # Should the model be serialized to a file?
+ var opt_save_model = new OptionBool("Save the model next to the generated Nit module", "-s", "--save-model")
+end
+
redef class String
+
# Convert the Java method name `self` to the Nit style
#
# * Converts to snake case
fun to_nit_method_name: String
do
var name = self.to_snake_case
- if name.has_prefix("get_") then
- name = name.substring_from(4)
- else if name.has_prefix("set_") then
- name = name.substring_from(4) + "="
+
+ # Strip the '_' prefix
+ while name.has_prefix("_") do name = name.substring(1, name.length-1)
+
+ # Escape Nit keywords
+ if nit_keywords.has(name) then name += "_"
+
+ # If the name starts by something other than a letter, prefix with `java_`
+ if not name.chars.first.is_letter then name = "java_" + name
+
+ name = name.replace("$", "_")
+
+ return name
+ end
+end
+
+redef class JavaClass
+ # Property names used in this class
+ private var used_names = new HashSet[String] is serialize
+
+ # Get an available property name for the Java property with `name` and parameters
+ #
+ # If `use_parameters_name` then expect that there will be conflicts,
+ # so use the types of `parameters` to build the name.
+ private fun nit_name_for(name: String, parameters: Array[JavaType], use_parameters_name: Bool, is_static: Bool, local_only: nullable Bool): String
+ do
+ # Append the name of each parameter
+ if use_parameters_name then
+ for param in parameters do
+ var id = param.id
+ id += "Array"*param.array_dimension
+ name += "_" + id
+ end
+ end
+
+ # Set of sets of property names, local or top-level
+ var local_used_names
+ var used_names
+ if is_static then
+ # Top-level methods
+ local_used_names = sys.top_level_used_names
+ used_names = sys.top_level_used_names
+ else if local_only == true then
+ # Local only: constructors
+ local_used_names = self.used_names
+ used_names = self.used_names
+ else
+ # Avoid conflicts with all super classes
+ local_used_names = self.used_names
+ used_names = new HashSet[String]
+ for sup in in_hierarchy.greaters do
+ used_names.add_all sup.used_names
+ end
+ end
+
+ # As a last resort, append numbers to the name
+ var base_name = name
+ var count = 1
+ while used_names.has(name) do
+ name = base_name + count.to_s
+ count += 1
end
+ local_used_names.add name
return name
end
end
# This file is part of NIT (http://www.nitlanguage.org).
#
# Copyright 2014 Frédéric Vachon <fredvac@gmail.com>
+# Copyright 2015 Alexis Laferrière <alexis.laf@xymus.net>
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
import jtype_converter
intrude import model
+# Visitor of the AST generated from javap output
class JavaVisitor
super Visitor
- var converter: JavaTypeConverter
+ # Model of all the analyzed classes
+ var model: JavaModel
- var java_class = new JavaClass
- var declaration_type: nullable String = null
- var declaration_element: nullable String = null
- var class_type: JavaType
-
- var variable_id = ""
- var variable_type: JavaType
-
- var is_generic_param = false
- var is_generic_id = false
- var generic_id = ""
- var gen_params_index = 0
-
- # Used to resolve generic return types (T -> foo.faz.Bar)
- var generic_map = new HashMap[String, Array[String]]
-
- var is_primitive_array = false
-
- var method_id = ""
- var method_return_type: JavaType
- var method_params = new Array[JavaType]
- var param_index = 0
+ # Java class in construction
+ var java_class: JavaClass is noinit
redef fun visit(n) do n.accept_visitor(self)
-
- init(converter: JavaTypeConverter)
- do
- self.converter = converter
- self.class_type = new JavaType(self.converter)
- self.method_return_type = new JavaType(self.converter)
- self.variable_type = new JavaType(self.converter)
- super
- end
-
- # Add the identifier from `token` to the current context
- fun add_identifier(token: NToken)
- do
- if declaration_type == "variable" then
- if declaration_element == "type" then
- variable_type.identifier.add(token.text)
- end
- else if declaration_type == "method" then
- if declaration_element == "return_type" then
- method_return_type.identifier.add(token.text)
- else if declaration_element == "parameter_list" then
- method_params[param_index].identifier.add(token.text)
- end
- end
- end
end
redef class Node
- fun accept_visitor(v: JavaVisitor) do visit_children(v)
-end
-
-redef class Nidentifier
- redef fun accept_visitor(v)
- do
- if v.declaration_type == "class_header" then
-
- if v.declaration_element == "id" then
- v.class_type.identifier.add(self.text)
- end
-
- else if v.declaration_type == "variable" then
-
- if v.declaration_element == "id" then
- v.variable_id += self.text
- else if v.declaration_element == "type" then
- if v.is_generic_param then
- v.variable_type.generic_params[v.gen_params_index].identifier.add(self.text)
- else
- v.variable_type.identifier.add(self.text)
- end
- end
-
- else if v.declaration_type == "method" then
-
- if v.declaration_element == "id" then
- v.method_id = self.text
- else if v.declaration_element == "return_type" then
- if self.text == "void" then
- v.method_return_type.is_void = true
- else if v.is_generic_param then
- v.method_return_type.generic_params[v.gen_params_index].identifier.add(self.text)
- else
- v.method_return_type.identifier.add(self.text)
- end
- else if v.declaration_element == "parameter_list" then
- if v.is_generic_param then
- v.method_params[v.param_index].generic_params[v.gen_params_index].identifier.add(self.text)
- else
- v.method_params[v.param_index].identifier.add(self.text)
- end
-
- # Creates a map to resolve generic return types
- # Exemple : public **<T extends android/os/Bundle>** T foo();
- else if v.is_generic_param then
- if v.is_generic_id then
- v.generic_id = self.text
- v.generic_map[self.text] = new Array[String]
-
- if not v.method_return_type.has_unresolved_types then v.method_return_type.has_unresolved_types = true
- else
- v.generic_map[v.generic_id].add(self.text)
- end
- end
-
- end
-
- super
- end
-end
-
-# Primitive array node
-redef class N_39d_91d_93d_39d
- redef fun accept_visitor(v)
- do
- if v.declaration_type == "variable" then
- if v.declaration_element == "type" then
- if v.is_generic_param then
- v.variable_type.generic_params[v.gen_params_index].array_dimension += 1
- else
- v.variable_type.array_dimension += 1
- end
- end
-
- else if v.declaration_type == "method" then
-
- if v.declaration_element == "return_type" then
- if v.is_generic_param then
- v.method_return_type.generic_params[v.gen_params_index].array_dimension += 1
- else
- v.method_return_type.array_dimension += 1
- end
- else if v.declaration_element == "parameter_list" then
- if v.is_generic_param then
- v.method_params[v.param_index].generic_params[v.gen_params_index].array_dimension += 1
- else
- v.method_params[v.param_index].array_dimension += 1
- end
- end
-
- end
-
- super
- end
-end
-
-redef class N_39dchar_39d
- redef fun accept_visitor(v) do v.add_identifier self
-end
-
-redef class N_39dboolean_39d
- redef fun accept_visitor(v) do v.add_identifier self
-end
-
-redef class N_39dfloat_39d
- redef fun accept_visitor(v) do v.add_identifier self
+ private fun accept_visitor(v: JavaVisitor) do visit_children(v)
end
-redef class N_39ddouble_39d
- redef fun accept_visitor(v) do v.add_identifier self
-end
-
-redef class N_39dbyte_39d
- redef fun accept_visitor(v) do v.add_identifier self
-end
-
-redef class N_39dshort_39d
- redef fun accept_visitor(v) do v.add_identifier self
-end
-
-redef class N_39dint_39d
- redef fun accept_visitor(v) do v.add_identifier self
-end
-
-redef class N_39dlong_39d
- redef fun accept_visitor(v) do v.add_identifier self
-end
-
-# #
-# C L A S S H E A D E R #
-# #
+# ---
+# Class Header
redef class Nclass_declaration
redef fun accept_visitor(v)
do
- v.declaration_type = "class_header"
- v.declaration_element = "id"
- super
+ var jtype = n_full_class_name.to_java_type
- # Exit class declaration
- v.declaration_type = null
- v.declaration_element = null
+ v.java_class = new JavaClass(jtype)
+ v.model.add_class v.java_class
- v.java_class.class_type = v.class_type
+ # Visit all properties
+ super
end
end
redef class Nextends_declaration
redef fun accept_visitor(v)
do
- v.declaration_element = "extends"
- super
- v.declaration_element = null
+ v.java_class.extends.add_all n_types.to_a
end
end
redef class Nimplements_declaration
redef fun accept_visitor(v)
do
- v.declaration_element = "implements"
- super
- v.declaration_element = null
+ v.java_class.implements.add_all n_types.to_a
end
end
-# #
-# P R O P E R T Y D E C L A R A T I O N S #
-# #
+# ---
+# Properties
# Method declaration
-redef class Nmethod_declaration
+redef class Nproperty_declaration_method
redef fun accept_visitor(v)
do
- v.declaration_type = "method"
- super
- v.declaration_type = null
-
- if v.method_return_type.has_unresolved_types then v.method_return_type.resolve_types(v.generic_map)
- v.java_class.add_method(v.method_id, v.method_return_type, v.method_params)
-
- v.method_params.clear
- v.method_id = ""
- v.method_return_type = new JavaType(v.converter)
+ var is_static = false
+ var modifiers = n_modifier
+ if modifiers != null then is_static = modifiers.has_static
+
+ var id = n_identifier.text
+ var return_jtype = n_type.to_java_type
+
+ # Generic parameters
+ var n_params = n_generic_parameters
+ var generic_params
+ if n_params != null then
+ generic_params = n_params.n_types.to_a
+ else generic_params = new Array[JavaType]
+
+ # Collect parameters
+ var n_types = n_types
+ var params
+ if n_types != null then
+ params = n_types.to_a
+ else params = new Array[JavaType]
+
+ var method = new JavaMethod(is_static, return_jtype, params, generic_params)
+ v.java_class.methods[id].add method
end
end
# Constructor declaration
-redef class Nconstructor_declaration
+redef class Nproperty_declaration_constructor
redef fun accept_visitor(v)
do
- v.declaration_type = "constructor"
- super
- v.declaration_type = null
+ # Collect parameters
+ var n_types = n_types
+ var params
+ if n_types != null then
+ params = n_types.to_a
+ else params = new Array[JavaType]
+
+ # Generic parameters
+ var n_params = n_generic_parameters
+ var generic_params
+ if n_params != null then
+ generic_params = n_params.n_types.to_a
+ else generic_params = new Array[JavaType]
+
+ var method = new JavaConstructor(params, generic_params)
+ v.java_class.constructors.add method
end
end
# Variable property declaration
-redef class Nvariable_declaration
+redef class Nproperty_declaration_attribute
redef fun accept_visitor(v)
do
- v.declaration_type = "variable"
- super
- v.declaration_type = null
+ var id = n_identifier.text
+ var jtype = n_type.to_java_type
+
+ # Manually count the array depth as it is after the id
+ var brackets = n_brackets
+ if brackets != null then jtype.array_dimension += brackets.children.length
- v.java_class.attributes[v.variable_id] = v.variable_type
+ var is_static = false
+ var modifiers = n_modifier
+ if modifiers != null then is_static = modifiers.has_static
- v.variable_id = ""
- v.variable_type = new JavaType(v.converter)
+ v.java_class.attributes[id] = new JavaAttribute(is_static, jtype)
end
end
# Static property declaration
-redef class Nstatic_declaration
+redef class Nproperty_declaration_static
redef fun accept_visitor(v)
do
- v.declaration_type = "static"
- super
- v.declaration_type = null
+ # TODO
end
end
-# Identifier of a variable
-redef class Nvariable_id
- redef fun accept_visitor(v)
+# ---
+# Services
+
+redef class Ntype
+ private fun to_java_type: JavaType
do
- v.declaration_element = "id"
- super
- v.declaration_element = null
+ var jtype = n_base_type.to_java_type
+
+ var brackets = n_brackets
+ if brackets != null then jtype.array_dimension += brackets.children.length
+
+ var dots = n_dots
+ if dots != null then jtype.is_vararg = true
+
+ return jtype
end
end
-# Identifier of the method
-redef class Nmethod_id
- redef fun accept_visitor(v)
+redef class Nbase_type
+ private fun to_java_type: JavaType
do
- v.declaration_element = "id"
- super
- v.declaration_element = null
+ # By default, everything is bound by object
+ var jtype = new JavaType
+ jtype.identifier.add_all(["java", "lang", "object"])
+ return jtype
end
end
-redef class Ntype
- redef fun accept_visitor(v)
+redef class Nbase_type_class
+ redef fun to_java_type do return n_full_class_name.to_java_type
+end
+
+redef class Nbase_type_primitive
+ redef fun to_java_type
do
- if v.declaration_type == "variable" and v.declaration_element != "id" then
- v.declaration_element = "type"
- end
+ # All the concrete nodes under this production are tokens
+ for node in depth do
+ if not node isa NToken then continue
- if v.declaration_type == "method" and v.declaration_element == null then
- # Makes sure it is not the generic return type definition
- if not (v.method_return_type.identifier.is_empty and v.is_generic_param) then
- v.declaration_element = "return_type"
- end
+ var jtype = new JavaType
+ jtype.identifier.add node.text
+ return jtype
end
- super
-
- if v.declaration_element == "variable" then
- v.declaration_element = null
- end
+ abort
end
end
-redef class Ngeneric_param
- redef fun accept_visitor(v)
+redef class Nbase_type_void
+ redef fun to_java_type
do
- # Ignore the weird generic return type declaration
- if v.declaration_type == "method" then
- if v.declaration_element == null then
- v.is_generic_param = true
- else
- v.is_generic_param = true
- v.gen_params_index = 0
-
- if v.declaration_element == "return_type" then
- v.method_return_type.generic_params = new Array[JavaType]
- else if v.declaration_element == "parameter_list" then
- v.method_params[v.param_index].generic_params = new Array[JavaType]
- end
- end
- else if v.declaration_type == "variable" then
- if v.declaration_element == "type" then
- v.is_generic_param = true
- v.gen_params_index = 0
- v.variable_type.generic_params = new Array[JavaType]
- end
- end
+ var jtype = new JavaType
+ jtype.is_void = true
+ return jtype
+ end
+end
- super
+redef class Nbase_type_extends
+ redef fun to_java_type do return n_generic_identifier.to_java_type
+end
- v.declaration_element = null
- v.is_generic_param = false
+redef class Nbase_type_super
+ redef fun to_java_type
+ do
+ var bounds = n_type_bound.to_a
+
+ # Java use more than one lower bound,
+ # it can't be translated statically to Nit,
+ # so we use the only the first one.
+ # This may cause problems on complex generic types,
+ # but these cases can be handled manually.
+ return bounds.first
end
end
redef class Ngeneric_identifier
- redef fun accept_visitor(v)
- do
- if v.declaration_type == "method" then
- if v.declaration_element == null then
- v.is_generic_id = true
- end
- end
-
- super
-
- v.is_generic_id = false
+ private fun to_java_type: JavaType is abstract
+end
- end
+redef class Ngeneric_identifier_class
+ redef fun to_java_type do return n_full_class_name.to_java_type
end
-redef class Nparameter_list
- redef fun accept_visitor(v)
+redef class Ngeneric_identifier_wildcard
+ redef fun to_java_type
do
- v.declaration_element = "parameter_list"
- v.param_index = 0
- super
- v.declaration_element = null
- v.param_index = 0
+ var jtype = new JavaType
+ jtype.identifier.add_all(["java", "lang", "Object"])
+ return jtype
end
end
-redef class Nparameter
- redef fun accept_visitor(v)
+redef class Nfull_class_name
+ # All the identifiers composing this class name
+ private fun to_a: Array[String] is abstract
+
+ # Access `n_class_name` on both alternatives
+ private fun n_class_name_common: Nclass_name is abstract
+
+ private fun to_java_type: JavaType
do
- if v.declaration_type == "method" then
- if v.declaration_element == "parameter_list" then
- if v.is_generic_param then
- v.method_params[v.param_index].generic_params.add(new JavaType(v.converter))
+ var jtype = new JavaType
+ jtype.identifier = to_a
- super
+ # Generic parameters
+ var n_params = n_class_name_common.n_generic_parameters
+ if n_params != null then jtype.generic_params = n_params.n_types.to_a
- v.gen_params_index += 1
- else
- v.method_params.add(new JavaType(v.converter))
+ return jtype
+ end
+end
- super
+redef class Nfull_class_name_head
+ redef fun n_class_name_common do return n_class_name
- v.param_index += 1
- end
- else if v.declaration_element == "return_type" and v.is_generic_param then
+ redef fun to_a do return [n_class_name.n_identifier.text]
+end
- v.method_return_type.generic_params.add(new JavaType(v.converter))
+redef class Nfull_class_name_tail
+ redef fun n_class_name_common do return n_class_name
- super
+ redef fun to_a
+ do
+ var a = n_full_class_name.to_a
+ a.add n_class_name.n_identifier.text
+ return a
+ end
+end
- v.gen_params_index += 1
+redef class Ntypes
+ # Get the types composing this list of parameters
+ #
+ # This is used both on methods signatures and type parameters.
+ private fun to_a: Array[JavaType] is abstract
+end
- # For generic return type definition
- else if v.declaration_element == null then
- super
- end
- else if v.declaration_type == "variable" then
- if v.declaration_element == "type" and v.is_generic_param then
- v.variable_type.generic_params.add(new JavaType(v.converter))
+redef class Ntypes_head
+ redef fun to_a do return [n_type.to_java_type]
+end
- super
+redef class Ntypes_tail
+ redef fun to_a
+ do
+ var a = n_types.to_a
+ a.add n_type.to_java_type
+ return a
+ end
+end
- v.gen_params_index += 1
- end
- else
- super
+redef class Nodes
+ private fun has_static: Bool
+ do
+ for modifier in depth do
+ if modifier isa NToken and modifier.text == "static" then return true
end
+
+ return false
+ end
+end
+
+redef class Ntype_bound
+ # Get the types composing this bound
+ private fun to_a: Array[JavaType] is abstract
+end
+
+redef class Ntype_bound_head
+ redef fun to_a do return [n_full_class_name.to_java_type]
+end
+
+redef class Ntype_bound_tail
+ redef fun to_a
+ do
+ var a = n_type_bound.to_a
+ a.add n_full_class_name.to_java_type
+ return a
end
end
# This file is part of NIT (http://www.nitlanguage.org).
#
# Copyright 2014 Frédéric Vachon <fredvac@gmail.com>
+# Copyright 2015 Alexis Laferrière <alexis.laf@xymus.net>
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# Services to convert java type to nit type and get casts if needed
module jtype_converter
+import opts
+
+redef class Sys
+ # Converter between Java and Nit type
+ var converter = new JavaTypeConverter is lazy
+
+ # Option to treat base Java objects as an equivalent to those in Nit?
+ #
+ # This concerns `Byte, Integer, Float, etc`.
+ var opt_cast_objects = new OptionBool("Convert base objects as their primitive equivalent", "-c")
+end
+
class JavaTypeConverter
var type_map = new HashMap[String, String]
do
# Java type to nit type
type_map["byte"] = "Int"
- type_map["Byte"] = "Int"
type_map["short"] = "Int"
- type_map["Short"] = "Int"
type_map["int"] = "Int"
- type_map["Integer"] = "Int"
type_map["long"] = "Int"
- type_map["Long"] = "Int"
type_map["char"] = "Char"
- type_map["Character"] = "Char"
type_map["float"] = "Float"
- type_map["Float"] = "Float"
type_map["double"] = "Float"
- type_map["Double"] = "Float"
type_map["boolean"] = "Bool"
- type_map["Boolean"] = "Bool"
- type_map["Object"] = "JavaObject"
- type_map["String"] = "JavaString"
- type_map["CharSequence"] = "JavaString"
-
# Cast if the type is given as a parameter
param_cast_map["byte"] = "(byte)"
- param_cast_map["Byte"] = "(Byte)"
param_cast_map["short"] = "(short)"
- param_cast_map["Short"] = "(short)"
param_cast_map["float"] = "(float)"
- param_cast_map["Float"] = "(float)"
param_cast_map["int"] = "(int)"
- param_cast_map["Integer"] = "(int)"
- # Cast if the type is given as a return value
- return_cast_map["CharSequence"] = "(String)"
+ if opt_cast_objects.value then
+ type_map["Byte"] = "Int"
+ type_map["Short"] = "Int"
+ type_map["Integer"] = "Int"
+ type_map["Long"] = "Int"
+ type_map["Character"] = "Char"
+ type_map["Float"] = "Float"
+ type_map["Double"] = "Float"
+ type_map["Boolean"] = "Bool"
+ type_map["CharSequence"] = "JavaString"
+
+ param_cast_map["Byte"] = "(Byte)"
+ param_cast_map["Short"] = "(short)"
+ param_cast_map["Float"] = "(float)"
+ param_cast_map["Integer"] = "(int)"
+
+ # Cast if the type is given as a return value
+ return_cast_map["CharSequence"] = "(String)"
+ end
end
fun to_nit_type(java_type: String): nullable String
do
return self.param_cast_map.get_or_default(java_type, "")
end
-
+
fun cast_as_return(java_type: String): String
do
return self.return_cast_map.get_or_default(java_type, "")
# This file is part of NIT (http://www.nitlanguage.org).
#
# Copyright 2014 Frédéric Vachon <fredvac@gmail.com>
+# Copyright 2015 Alexis Laferrière <alexis.laf@xymus.net>
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# See the License for the specific language governing permissions and
# limitations under the License.
-# jwrapper is a Nit extern class generator `in "Java"`.
-# It takes a .class file and output a Nit file. For further details on installation and usage, refer to the README file.
+# jwrapper wraps Java classes in extern Nit classes
+#
+# This tool takes class file, Jar archives and javap files as input,
+# and it outputs a Nit source file.
+# For further details on installation and usage, refer to the README file.
#
# Here's an overview of the project design :
# * Grammar and lexer : `grammar/javap.sablecc`
# * The `javap_visitor` implements the visitor that extracts data from the AST
# * The `code_generator` takes these data and converts it to Nit code via the `jtype_converter` module and generate the output Nit file.
-# * The `types` contains data structures used to represent the data
+# * The `model` contains data structures used to represent the data
# * The `jwrapper` module implements the user interface
module jwrapper
import opts
+import performance_analysis
+
import javap_test_parser
import code_generator
import javap_visitor
var opts = new OptionContext
-var opt_attr = new OptionBool("Generate attributes", "-a", "--with-attributes")
-var opt_comment = new OptionBool("Comment methods/attributes containing unknown types", "-c", "--comment")
-var opt_wrap = new OptionBool("Create extern classes wrapping unknown types (Default)", "-w", "--wrap")
+var opt_unknown = new OptionEnum(["comment", "stub", "ignore"], "How to deal with unknown types", 0, "-u")
+var opt_verbose = new OptionCount("Verbosity", "-v")
+var opt_output = new OptionString("Output file", "-o")
+var opt_regex = new OptionString("Regex pattern to filter classes in Jar archives", "-r")
var opt_help = new OptionBool("Show this help message", "-h", "--help")
-opts.add_option(opt_attr, opt_comment, opt_wrap, opt_help)
-
-opts.parse(args)
-
-if opt_wrap.value and opt_comment.value then
- print "Error: Can't use both '-c' and '-w'"
- exit 1
-end
+opts.add_option(opt_output, opt_unknown, opt_extern_class_prefix, opt_libs, opt_regex, opt_cast_objects, opt_arrays, opt_save_model, opt_load_models, opt_no_properties, opt_verbose, opt_help)
+opts.parse args
-if not opts.errors.is_empty or opts.rest.length != 2 or opt_help.value then
- print "USAGE: jwrapper [OPTIONS] class_file nit_file"
- print "Options:"
+if opts.errors.not_empty or opts.rest.is_empty or opt_help.value then
+ print """
+Usage: jwrapper [options] file [other_file [...]]
+Input files: bytecode Java class (.class), Jar archive (.jar) or javap output (.javap)
+Options:"""
opts.usage
if opt_help.value then exit 0
exit 1
end
-var dot_class = opts.rest[0]
-var out_file = opts.rest[1]
+var out_file = opt_output.value
+if out_file == null then out_file = "out.nit"
if not "javap".program_is_in_path then
- print "ERROR: 'javap' not found."
+ print "Error: 'javap' must be in PATH"
exit 1
end
-var javap = new ProcessReader("javap", "-public", dot_class)
+var regex = null
+var regex_code = opt_regex.value
+if regex_code != null then
+ regex = regex_code.to_re
+ var error = regex.compile
+ if error != null then
+ print_error "Regex Error: {error}"
+ exit 1
+ end
+end
+
+# List of bytecode Java classes and javap output files
+var class_files = new Array[String]
+var javap_files = new Array[String]
+var clock = new Clock
+
+# Sort through input files passed as arguments
+for input in opts.rest do
+ var ext = input.file_extension
+ if ext == "class" then
+ class_files.add input
+ else if ext == "javap" then
+ javap_files.add input
+ else if ext == "jar" then
+ clock.lapse
+
+ var out_dir = "tmp"
+ if not out_dir.file_exists then out_dir.mkdir
+
+ if opt_verbose.value > 0 then print "# Extracting {input}"
+
+ # Extract all files
+ var cmd = "cd {out_dir}; jar -xf {input}"
+ var status = system(cmd)
+ if status != 0 then
+ print_error "Warning: Failed to extract Jar archive '{input}'"
+ continue
+ end
+
+ # List .class files
+ var javap = new ProcessReader("jar", "-tf", input)
+ var output = javap.read_all
+ javap.wait
+ for path in output.split("\n") do
+ if path.file_extension == "class" then
+
+ # Filter out the classes that do not answer to the Regex
+ if regex != null and not path.has(regex) then continue
+
+ class_files.add out_dir / path
+ end
+ end
+ javap.close
+
+ sys.perfs["jar extract"].add clock.lapse
+ else
+ print_error "Warning: Unsupported file extension for input file '{input}'"
+ end
+end
-var p = new TestParser_javap
-var tree = p.work(javap.read_all)
+if class_files.is_empty and javap_files.is_empty then
+ print_error "Error: No valid input files, quitting"
+ exit 1
+end
+var model = new JavaModel
var converter = new JavaTypeConverter
-var visitor = new JavaVisitor(converter)
-visitor.enter_visit(tree)
+# Concatenated javap output for all the target files
+var javap_output = ""
+
+# Parse and analyze all the classes at once
+if class_files.not_empty then
-var generator = new CodeGenerator(out_file, visitor.java_class, opt_attr.value, opt_comment.value)
+ if opt_verbose.value > 0 then print "# Running javap on {class_files.length} Java classes"
+ clock.lapse
+
+ # Run javap of the class file
+ class_files.unshift "-public"
+ var javap = new ProcessReader("javap", class_files...)
+ javap_output += javap.read_all
+ javap.wait
+ javap.close
+ var status = javap.status
+
+ if status != 0 then
+ print_error "Warning: javap failed to parse all class files, is it a valid class file?"
+ exit 1
+ end
+
+ sys.perfs["javap"].add clock.lapse
+end
+
+# Concatenate the preprocessed javap outputs
+for class_file in javap_files do
+ if opt_verbose.value > 0 then print "# Using the preprocessed file {class_file}"
+
+ var ext = class_file.file_extension
+ assert ext == "javap"
+
+ javap_output += class_file.to_path.read_all
+end
+
+if opt_verbose.value > 0 then print "# Parsing javap output"
+if opt_verbose.value > 1 then javap_output.write_to_file "tests/javap.javap"
+
+# Lexer
+var lexer = new Lexer_javap(javap_output)
+var parser = new Parser_javap
+var tokens = lexer.lex
+parser.tokens.add_all tokens
+sys.perfs["core lexer"].add clock.lapse
+
+# Parser
+var root_node = parser.parse
+if root_node isa NError then
+ print_error "Warning: Parsing failed with {root_node.message}:{root_node.position or else ""}"
+ exit 1
+end
+sys.perfs["core parser"].add clock.lapse
+
+# Build model
+if opt_verbose.value > 0 then print "# Building model"
+assert root_node isa NStart
+var visitor = new JavaVisitor(model)
+visitor.enter_visit root_node
+sys.perfs["core model"].add clock.lapse
+
+# Resolve types
+model.resolve_types
+sys.perfs["core resolve"].add clock.lapse
+
+# Build class hierarchy
+model.build_class_hierarchy
+sys.perfs["core hierarchy"].add clock.lapse
+
+if opt_verbose.value > 0 then print "# Generating Nit code"
+
+# Generate the Nit module
+var use_comment = opt_unknown.value == 0
+var use_stub = opt_unknown.value == 1
+var generator = new CodeGenerator(out_file, model, use_comment, use_stub)
generator.generate
+sys.perfs["code generator"].add clock.lapse
+
+# Write the model to a file, for use by subsequent passes
+generator.write_model_to_file
+sys.perfs["writing model"].add clock.lapse
+
+if opt_verbose.value > 1 then
+ print "# Performance Analysis:"
+ print sys.perfs
+
+ print "# {model.unknown_types.length} unknown types:"
+ var c = 0
+ for id, ntype in model.unknown_types do
+ print "* {id}"
+ c += 1
+ if c > 100 then
+ print "* ..."
+ break
+ end
+ end
+end
# This file is part of NIT (http://www.nitlanguage.org).
#
# Copyright 2014 Frédéric Vachon <fredvac@gmail.com>
+# Copyright 2015 Alexis Laferrière <alexis.laf@xymus.net>
#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# See the License for the specific language governing permissions and
# limitations under the License.
-# Contains the java and nit type representation used to convert java to nit code
-module model
+# Model of the parsed Java classes and their corresponding Nit types
+module model is serialize
+
+import more_collections
+import opts
+import poset
+import binary::serialization
import jtype_converter
class JavaType
- private var converter: JavaTypeConverter
+ super Cloneable
+
+ # Identifiers composing the namespace and class name
+ #
+ # An array of all the names that would be separated by `.`.
+ # Each name may contain `$`.
var identifier = new Array[String]
+
var generic_params: nullable Array[JavaType] = null
+
+ # Is this a void return type?
var is_void = false
+ # Is this type a vararg?
+ var is_vararg = false is writable
+
+ # Is this type based on an anonymous class?
+ var is_anonymous: Bool is lazy do
+ for id in identifier do
+ for part in id.split("$") do
+ if part.chars.first.is_digit then return true
+ end
+ end
+ return false
+ end
+
# Has some generic type to be resolved (T extends foo => T is resolved to foo)
var has_unresolved_types = false
fun is_primitive_array: Bool do return array_dimension > 0
fun has_generic_params: Bool do return not generic_params == null
- fun full_id: String do return identifier.join(".")
- fun id: String do return identifier.last.replace("$", "")
-
- init(converter: JavaTypeConverter) do self.converter = converter
fun return_cast: String do return converter.cast_as_return(self.id)
return converter.cast_as_param(self.id)
end
- fun to_nit_type: NitType
+ # Name to give an extern class wrapping this type
+ fun extern_name: String
do
- var nit_type: NitType
- var type_id = null
-
- if not is_primitive_array then
- type_id = converter.to_nit_type(self.id)
+ var name
+ var prefix = extern_class_prefix
+ if prefix == null then
+ # Use the namespace, e.g. java.lang.String -> Java_lang_String
+ assert not identifier.is_empty
+ if identifier.length == 1 then
+ name = identifier.last
+ else
+ var first = identifier.first
+ var last = identifier.last
+ var mid = identifier.subarray(1, identifier.length-2)
+ name = first.simple_capitalized + "_"
+ if mid.not_empty then name += mid.join("_") + "_"
+ name += last
+ end
+ else
+ # Use the prefix and the short class name
+ # e.g. given the prefix Native: java.lang.String -> NativeString
+ name = prefix + id
end
- if type_id == null then
- nit_type = self.extern_name
- nit_type.is_complete = false
- else
- nit_type = new NitType(type_id)
+ if is_primitive_array then
+ name += "_" + "Array" * array_dimension
end
- if not self.has_generic_params then return nit_type
+ name = name.replace("-", "_")
+ name = name.replace("$", "_")
+ return name
+ end
+
+ # Short name of the class, mangled to remove `$` (e.g. `Set`)
+ fun id: String do return identifier.last.replace("$", "")
- nit_type.generic_params = new Array[NitType]
+ # Full name of this class as used in an importation (e.g. `java.lang.Set`)
+ fun package_name: String do return identifier.join(".")
- for param in generic_params do
- var nit_param = param.to_nit_type
+ # Name of this class for the extern declaration in Nit (e.g. `java.lang.Set[]`)
+ fun extern_equivalent: String do return package_name + "[]" * array_dimension
- nit_type.generic_params.add(nit_param)
+ # Full name of this class with arrays and generic values (e.g. `java.lang.Set<E>[]`)
+ redef fun to_s do
+ var id = self.package_name
- if not nit_param.is_complete then nit_type.is_complete = false
+ if self.is_primitive_array then
+ id += "[]" * array_dimension
+ else if self.has_generic_params then
+ var params = [for param in generic_params do param.to_s]
+ id += "<{params.join(", ")}>"
end
- return nit_type
+ return id
end
- fun is_iterable: Bool do return iterable.has(self.id)
+ # Get a copy of `self`
+ redef fun clone
+ do
+ var jtype = new JavaType
+ jtype.identifier = identifier
+ jtype.generic_params = generic_params
+ jtype.is_void = is_void
+ jtype.is_vararg = is_vararg
+ jtype.array_dimension = array_dimension
+ return jtype
+ end
- fun is_collection: Bool do return is_primitive_array or collections_list.has(self.id)
+ # Comparison based on fully qualified named
+ redef fun ==(other) do return other isa JavaType and
+ self.package_name == other.package_name and
+ self.array_dimension == other.array_dimension
- fun is_wrapped: Bool do return find_extern_class != null
+ redef fun hash do return self.package_name.hash
+end
- fun extern_name: NitType
- do
- if is_wrapped then return new NitType.with_module(find_extern_class.as(not null).first, find_extern_class.as(not null).second)
+class NitType
+ # Nit class name
+ var identifier: String
- var name
- if is_primitive_array then
- # Primitive arrays have a special naming convention
- name = "Native" + extern_class_name.join("").capitalized + "Array"
- else
- name = "Native" + extern_class_name.join("")
- end
+ # If this NitType was found in `lib/android`, contains the module name to import
+ var mod: nullable NitModule
- var nit_type = new NitType(name)
- nit_type.is_complete = false
- return nit_type
- end
+ # Is this type known, wrapped and available in Nit?
+ var is_known: Bool = true
- fun to_cast(jtype: String, is_param: Bool): String
- do
- if is_param then
- return converter.cast_as_param(jtype)
- end
+ redef fun to_s do return identifier
+end
- return converter.cast_as_return(jtype)
- end
+# Model of a single Java class
+class JavaClass
+ # Type of this class
+ var class_type: JavaType
- redef fun to_s: String
- do
- var id = self.full_id
+ # Attributes of this class
+ var attributes = new HashMap[String, JavaAttribute]
- if self.is_primitive_array then
- for i in [0..array_dimension[ do
- id += "[]"
- end
- else if self.has_generic_params then
- var gen_list = new Array[String]
+ # Methods of this class organized by their name
+ var methods = new MultiHashMap[String, JavaMethod]
- for param in generic_params do
- gen_list.add(param.to_s)
- end
+ # Methods signatures introduced by this class
+ var local_intro_methods = new MultiHashMap[String, JavaMethod]
- id += "<{gen_list.join(", ")}>"
- end
+ # Constructors of this class
+ var constructors = new Array[JavaConstructor]
- return id
- end
+ # Importations from this class
+ var imports = new HashSet[NitModule]
- # To fully qualified package name
- # Cuts the primitive array `[]`
- fun to_package_name: String
- do
- var str = self.to_s
- var len = str.length
+ # Interfaces implemented by this class
+ var implements = new HashSet[JavaType]
- return str.substring(0, len - (2*array_dimension))
- end
+ # Super classes of this class
+ var extends = new HashSet[JavaType]
+
+ # Position of self in `model.class_hierarchy`
+ var in_hierarchy: nullable POSetElement[JavaClass] = null is noserialize
- fun resolve_types(conversion_map: HashMap[String, Array[String]])
+ redef fun to_s do return class_type.to_s
+
+ # Resolve the types in `other` in the context of this class
+ private fun resolve_types_of(other: JavaClass)
do
- if identifier.length == 1 then
- var resolved_id = conversion_map.get_or_null(self.id)
- if resolved_id != null then self.identifier = new Array[String].from(resolved_id)
+ # Methods
+ for mid, method in other.methods do
+ for signature in method do
+ self.resolve(signature.return_type, signature.generic_params)
+ for param in signature.params do self.resolve(param, signature.generic_params)
+ end
end
- if self.has_generic_params then
- for params in generic_params do params.resolve_types(conversion_map)
+ # Constructors
+ for signature in other.constructors do
+ for param in signature.params do self.resolve(param, signature.generic_params)
+ end
+
+ # Attributes
+ for aid, attribute in other.attributes do
+ self.resolve attribute.java_type
end
end
- private fun extern_class_name: Array[String]
+ # Resolve `java_type` in the context of this class
+ #
+ # Replace, in place, parameter types by their bound.
+ private fun resolve(java_type: JavaType, property_generic_params: nullable Array[JavaType])
do
- var class_name = new Array[String]
- class_name.add(self.id)
+ # Skip types with a full package name
+ if java_type.identifier.length != 1 then return
+
+ # Skip primitive types
+ if converter.type_map.keys.has(java_type.id) then return
+
+ # Gather the generic parameters of the method, then the class
+ var params = new Array[JavaType]
+ if property_generic_params != null then params.add_all property_generic_params
+ var class_generic_params = class_type.generic_params
+ if class_generic_params != null then params.add_all class_generic_params
+
+ # Skip if there is not parameters usable to resolve
+ if params.is_empty then return
+
+ for param in params do
+ if param.identifier == java_type.identifier then
+ # Found a marching parameter type
+ # TODO use a more precise bound
+ java_type.identifier = ["java", "lang", "Object"]
+ return
+ end
+ end
+ end
- if not self.has_generic_params then return class_name
+ redef fun hash do return class_type.hash
+ redef fun ==(o) do return o isa JavaClass and o.class_type == class_type
+end
- class_name.add "Of"
+# Model of all the Java class analyzed in one run
+class JavaModel
- for param in generic_params do class_name.add_all param.extern_class_name
+ # Classes analyzed in this pass
+ var classes = new HashMap[String, JavaClass]
- return class_name
- end
+ # All classes, from this pass and from other passes
+ var all_classes: HashMap[String, JavaClass] is noserialize, lazy do
+ var classes = new HashMap[String, JavaClass]
+ classes.recover_with self.classes
- # Search inside `lib/android` directory for already wrapped classes
- # If found, contains the class identifier and the Nit Module name
- var find_extern_class: nullable Couple[String, NitModule] is lazy do
-
- var regex = "extern class [a-zA-Z1-9]\\\+[ ]\\\+in[ ]\\\+\"Java\"[ ]*`\{[ ]*" + self.to_s + "\\\+[ ]*`\}"
- var nit_dir = "NIT_DIR".environ
- var grep = new ProcessReader("grep", "-r", regex, nit_dir/"lib/android/", nit_dir/"lib/java/")
- var to_eat = ["private", "extern", "class"]
+ for model_path in sys.opt_load_models.value do
+ if not model_path.file_exists then
+ print_error "Error: model file '{model_path}' does not exist"
+ continue
+ end
- var output = grep.read_line
+ var file = model_path.to_path.open_ro
+ var d = new BinaryDeserializer(file)
+ var model = d.deserialize
+ file.close
- var output_class = output.substring_from(output.index_of(':') + 1)
- var tokens = output_class.split(" ")
+ if d.errors.not_empty then
+ print_error "Error: failed to deserialize model file '{model_path}' with: {d.errors.join(", ")}"
+ continue
+ end
- var nclass_name = ""
+ if not model isa JavaModel then
+ print_error "Error: model file contained a '{if model == null then "null" else model.class_name}'"
+ continue
+ end
- for token in tokens do
- if to_eat.has(token) then continue
- nclass_name = token
- break
+ classes.recover_with model.classes
end
- if nclass_name == "" then return null
-
- var str = output.substring(0, output.search(".nit").from)
- str = str.substring_from(str.last_index_of('/') + 1)
- var mod = new NitModule(str)
-
- return new Couple[String, NitModule](nclass_name, mod)
+ return classes
end
- # Comparison based on fully qualified named and generic params
- # Ignores primitive array so `a.b.c[][] == a.b.c`
- redef fun ==(other)
+ # Does this model have access to the `java.lang.Object`?
+ var knows_the_object_class: Bool = all_classes.keys.has("java.lang.Object") is lazy
+
+ # Add a class in `classes`
+ fun add_class(jclass: JavaClass)
do
- if other isa JavaType then
- return self.repr == other.repr
- end
- return false
+ var key = jclass.class_type.package_name
+ classes[key] = jclass
end
- redef fun hash do return self.repr.hash
+ # Unknown types, not already wrapped and not in this pass
+ var unknown_types = new HashMap[JavaType, NitType] is noserialize
- private fun repr: String
- do
- var id = self.full_id
+ # Wrapped types, or classes analyzed in this pass
+ var known_types = new HashMap[JavaType, NitType] is noserialize
- if self.has_generic_params then
- var gen_list = new Array[String]
+ # Get the `NitType` corresponding to the `JavaType`
+ #
+ # Also registers types so they can be reused and
+ # to keep track of unknown types.
+ fun java_to_nit_type(jtype: JavaType): NitType
+ do
+ # Check cache
+ if known_types.keys.has(jtype) then return known_types[jtype]
+ if unknown_types.keys.has(jtype) then return unknown_types[jtype]
+
+ # Is it a compatible primitive type?
+ if not jtype.is_primitive_array then
+ var name = converter.to_nit_type(jtype.id)
+ if name != null then
+ # We got a Nit equivalent
+ var nit_type = new NitType(name)
+ known_types[jtype] = nit_type
+ return nit_type
+ end
+ end
- for param in generic_params do
- gen_list.add(param.to_s)
+ # Is being wrapped in this pass?
+ var key = jtype.package_name
+ if classes.keys.has(key) then
+ if jtype.array_dimension <= opt_arrays.value then
+ var nit_type = new NitType(jtype.extern_name)
+ known_types[jtype] = nit_type
+ return nit_type
end
+ end
- id += "<{gen_list.join(", ")}>"
+ # Search in lib
+ var nit_type = find_extern_class[jtype.extern_equivalent]
+ if nit_type != null then
+ known_types[jtype] = nit_type
+ return nit_type
end
- return id
+ # Unknown type
+ nit_type = new NitType(jtype.extern_name)
+ nit_type.is_known = false
+ unknown_types[jtype] = nit_type
+ return nit_type
end
- var collections_list: Array[String] is lazy do return ["List", "ArrayList", "LinkedList", "Vector", "Set", "SortedSet", "HashSet", "TreeSet", "LinkedHashSet", "Map", "SortedMap", "HashMap", "TreeMap", "Hashtable", "LinkedHashMap"]
- var iterable: Array[String] is lazy do return ["ArrayList", "Set", "HashSet", "LinkedHashSet", "LinkedList", "Stack", "TreeSet", "Vector"]
- var maps: Array[String] is lazy do return ["Map", "SortedMap", "HashMap", "TreeMap", "Hashtable", "LinkedHashMap"]
-end
+ # Resolve the types in methods and attributes of this class
+ fun resolve_types
+ do
+ for id, java_class in classes do
+ java_class.resolve_types_of java_class
+
+ # Ask nester classes for resolve too
+ var matches = id.search_all("$")
+ for match in matches do
+ var nester_name = id.substring(0, match.from)
+ if classes.keys.has(nester_name) then
+ var nester = classes[nester_name]
+ nester.resolve_types_of java_class
+ end
+ end
+ end
+ end
-class NitType
- var identifier: String
- var arg_id: String
- var generic_params: nullable Array[NitType] = null
+ # Specialization hierarchy of `classes`
+ var class_hierarchy = new POSet[JavaClass] is noserialize
- # If this NitType was found in `lib/android`, contains the module name to import
- var mod: nullable NitModule
+ # Fill `class_hierarchy`
+ fun build_class_hierarchy
+ do
+ var object_type = new JavaType
+ object_type.identifier = ["java","lang","Object"]
- # Returns `true` if all types have been successfully converted to Nit type
- var is_complete: Bool = true
+ # Fill POSet
+ for name, java_class in all_classes do
+ # Skip anonymous classes
+ if java_class.class_type.is_anonymous then continue
- fun has_generic_params: Bool do return not generic_params == null
+ java_class.in_hierarchy = class_hierarchy.add_node(java_class)
- fun id: String do return identifier
+ # Collect explicit super classes
+ var super_classes = new Array[JavaType]
+ super_classes.add_all java_class.implements
+ super_classes.add_all java_class.extends
- init (id: String)
- do
- self.identifier = id
- end
+ # Remove unavailable super classes
+ for super_type in super_classes.reverse_iterator do
+ # Is the super class available?
+ if not all_classes.keys.has(super_type.package_name) then super_classes.remove(super_type)
+ end
- init with_generic_params(id: String, gen_params: String...)
- do
- self.init(id)
- self.generic_params = new Array[NitType]
- for param in gen_params do self.generic_params.add new NitType(param)
- end
+ # If the is no explicit supers, add `java.lang.Object` (if it is known)
+ if super_classes.is_empty and java_class.class_type != object_type and
+ knows_the_object_class then
+ super_classes.add object_type
+ end
- init with_module(id: String, mod: NitModule)
- do
- self.init(id)
- self.mod = mod
- end
+ for super_type in super_classes do
+ # Is the super class available?
+ if not all_classes.keys.has(super_type.package_name) then continue
- redef fun to_s: String
- do
- var id = self.identifier
+ var super_class = all_classes[super_type.package_name]
+ class_hierarchy.add_edge(java_class, super_class)
+ end
+ end
- if self.has_generic_params then
- var gen_list = new Array[String]
+ # Flatten classes from the top one (Object like)
+ var linearized = class_hierarchy.linearize(class_hierarchy)
- for param in generic_params do
- gen_list.add(param.to_s)
- end
+ # Methods intro
+ for java_class in linearized do
+ var greaters = java_class.in_hierarchy.greaters
- id += "[{gen_list.join(", ")}]"
- end
+ for mid, signatures in java_class.methods do
+ for signature in signatures do
+ if signature.is_static then continue
- return id
- end
-end
+ # Check if this signature exists in a parent
+ for parent in greaters do
+ if parent == java_class then continue
-class JavaClass
- var class_type = new JavaType(new JavaTypeConverter)
- var attributes = new HashMap[String, JavaType]
+ if not parent.methods.keys.has(mid) then continue
- # Methods of this class organized by their name
- var methods = new HashMap[String, Array[JavaMethod]]
+ if parent.methods[mid].has(signature) then continue label
+ end
- var unknown_types = new HashSet[JavaType]
- var imports = new HashSet[NitModule]
+ # This is an introduction! register it
+ java_class.local_intro_methods[mid].add signature
- fun add_method(id: String, return_type: JavaType, params: Array[JavaType])
- do
- var signatures = methods.get_or_default(id, new Array[JavaMethod])
- signatures.add(new JavaMethod(return_type, new Array[JavaType].from(params)))
- methods[id] = signatures
+ end label
+ end
+ end
end
end
+# A property to a Java class
+abstract class JavaProperty
+
+ # Is this property marked static?
+ var is_static: Bool
+end
+
# A Java method, with its signature
class JavaMethod
+ super JavaProperty
+
# Type returned by the method
var return_type: JavaType
# Type of the arguments of the method
var params: Array[JavaType]
+
+ # Generic parameters of this method
+ var generic_params: Array[JavaType]
+
+ redef fun ==(o) do return o isa JavaMethod and o.is_static == is_static and o.params == params
+ redef fun hash do return params.hash
+end
+
+# An attribute in a Java class
+class JavaAttribute
+ super JavaProperty
+
+ # Type of the attribute
+ var java_type: JavaType
+end
+
+# A Java method, with its signature
+class JavaConstructor
+ # Type of the parameters of this constructor
+ var params: Array[JavaType]
+
+ # Generic parameters of this constructor
+ var generic_params: Array[JavaType]
end
# A Nit module, use to import the referenced extern classes
class NitModule
+ # Relative path to the module
+ var path: String
+
# Name of the module
- var name: String
+ var name: String is lazy do return path.basename(".nit")
- redef fun ==(other): Bool do return self.to_s == other.to_s
- redef fun to_s: String do return self.name
- redef fun hash: Int do return self.name.hash
+ redef fun to_s do return self.name
+ redef fun ==(other) do return other isa NitModule and self.path == other.path
+ redef fun hash do return self.path.hash
+end
+
+redef class Sys
+ # Collection of Java classes already wrapped in the library
+ #
+ # * The key uses `JavaType.to_s`.
+ # * The value is the corresponding `NitType`.
+ var find_extern_class: DefaultMap[String, nullable NitType] is lazy do
+ var map = new DefaultMap[String, nullable NitType](null)
+ var modules = new HashMap[String, NitModule]
+
+ var lib_paths = opt_libs.value
+ if lib_paths == null then lib_paths = new Array[String]
+
+ if lib_paths.has("auto") then
+ lib_paths.remove "auto"
+ var nit_dir = "NIT_DIR".environ
+ if nit_dir.is_empty then
+ # Simple heuristic to find the Nit lib
+ var dir = sys.program_name.dirname / "../../../lib/"
+ dir = dir.simplify_path
+ if dir.file_exists then lib_paths.add dir.simplify_path
+ end
+ end
+
+ if lib_paths.is_empty then return map
+
+ # Use grep to find all extern classes implemented in Java
+ var grep_regex = "extern class [a-zA-Z0-9_]\\\+[ ]\\\+in[ ]\\\+\"Java\""
+ var grep_args = ["-r", "--with-filename", grep_regex]
+ grep_args.add_all lib_paths
+
+ var grep = new ProcessReader("grep", grep_args...)
+ var lines = grep.read_lines
+ grep.close
+ grep.wait
+
+ # Sort out the modules, Nit class names and Java types
+ var regex = """(.+):\\s*extern +class +([a-zA-Z0-9_]+) *in *"Java" *`\\{(.+)`\\}""".to_re
+ for line in lines do
+ var matches = line.search_all(regex)
+ for match in matches do
+ var path = match[1].to_s
+ var nit_name = match[2].to_s
+ var java_name = match[3].to_s.trim
+
+ # Debug code
+ # print "+ Found {nit_name}: {java_name} at {path}"
+
+ var mod = modules.get_or_null(path)
+ if mod == null then
+ mod = new NitModule(path)
+ modules[path] = mod
+ end
+
+ map[java_name] = new NitType(nit_name, mod)
+ end
+ end
+
+ return map
+ end
+
+ # Option to set `extern_class_prefix`
+ var opt_extern_class_prefix = new OptionString("Prefix to extern classes (By default uses the full namespace)", "-p")
+
+ # Prefix used to name extern classes, if `null` use the full namespace
+ var extern_class_prefix: nullable String is lazy do return opt_extern_class_prefix.value
+
+ # Libraries to search for existing wrappers
+ var opt_libs = new OptionArray("Paths to libraries with wrappers of Java classes ('auto' to use the full Nit lib)", "-i")
+
+ # Generate the primitive array version of each class up to the given depth
+ var opt_arrays = new OptionInt("Depth of the primitive array for each wrapped class (default: 1)", 1, "-a")
+
+ # Generate the primitive array version of each class up to the given depth
+ var opt_load_models = new OptionArray("Saved models to search for super-classes", "-m")
+end
+
+redef abstract class Text
+ # Get a copy of `self` where the first letter is capitalized
+ fun simple_capitalized: String
+ do
+ if is_empty then return to_s
+
+ var c = chars.first.to_upper
+ var s = c.to_s + substring_from(1)
+ return s
+ end
end
--- /dev/null
+public abstract class android.os.asynctask<params, progress, result> {
+ public android.os.asynctask();
+ public final android.os.asynctask$status getstatus();
+ public final result get(long, java.util.concurrent.timeunit) throws java.lang.interruptedexception, java.util.concurrent.executionexception, java.util.concurrent.timeoutexception;
+ public final android.os.asynctask<params, progress, result> execute(params...);
+}
--- /dev/null
+public class org.example.ClassA {
+ public org.example.ClassA();
+ public org.example.ClassA(long);
+ public org.example.ClassA(java.lang.Object);
+}
--- /dev/null
+
+class com.sun.xml.internal.bind.v2.model.impl.RuntimeElementInfoImpl$RuntimePropertyImpl extends com.sun.xml.internal.bind.v2.model.impl.ElementInfoImpl<java.lang.reflect.Type, java.lang.Class, java.lang.reflect.Field, java.lang.reflect.Method>.PropertyImpl implements com.sun.xml.internal.bind.v2.model.runtime.RuntimeElementPropertyInfo, com.sun.xml.internal.bind.v2.model.runtime.RuntimeTypeRef {
+}
--- /dev/null
+public class org.example.ClassA {
+ public org.example.ClassB Foo(org.example.ClassC);
+ public org.example.ClassB Bar(org.example.ClassC);
+ public org.example.ClassB an_attribute;
+}
+public class org.example.ClassB extends org.example.ClassA {
+ public org.example.ClassA Foo(org.example.ClassC);
+}
--- /dev/null
+public final class com.oracle.net.Sdp {
+ public static java.net.Socket openSocket() throws java.io.IOException;
+ public static java.net.ServerSocket openServerSocket() throws java.io.IOException;
+ public static java.nio.channels.SocketChannel openSocketChannel() throws java.io.IOException;
+ public static java.nio.channels.ServerSocketChannel openServerSocketChannel() throws java.io.IOException;
+}
+public class com.sun.activation.registries.LogSupport {
+ public static void log(java.lang.String);
+ public static void log(java.lang.String, java.lang.Throwable);
+ public static boolean isLoggable();
+}
+public class com.sun.activation.registries.MailcapTokenizer {
+ public static final int UNKNOWN_TOKEN;
+}
+public final class com.sun.beans.TypeResolver {
+ public com.sun.beans.TypeResolver();
+ public static java.lang.reflect.Type resolveInClass(java.lang.Class<?>, java.lang.reflect.Type);
+}
--- /dev/null
+Compiled from "TestJvm.java"
+public class test_jvm.TestJvm {
+ public test_jvm.TestJvm();
+ public test_jvm.Test2 getTest();
+ public boolean isBool();
+ public char getC();
+ public int getI();
+ public float getF();
+}
--- /dev/null
+public abstract class android.net.Uri implements android.os.Parcelable, java.lang.Comparable<android.net.Uri> {
+ public <T extends java/lang/Object> com.sun.jmx.mbeanserver.MXBeanSupport(T, java.lang.Class<T>) throws javax.management.NotCompliantMBeanException;
+
+ public static <T extends java/lang/Object & java/lang/Comparable<? super T>> T max(java.util.Collection<? extends T>);
+
+ public <T extends java/lang/Object> com.sun.jmx.mbeanserver.MXBeanSupport(T, java.lang.Class<T>) throws javax.management.NotCompliantMBeanException;
+
+ public strictfp double doubleValue();
+}
var text = self["text"]
if text isa JsonArray then
- return text.join("")
+ return text.join
else
return "UNDEFINED"
end
# A finite automaton
class Automaton
# The start state
- var start: State
+ var start: State is noinit
# State that are accept states
var accept = new Array[State]
* `wiki.name`: Displayed name
* `wiki.desc`: Long description
* `wiki.logo`: Logo image url
-* `wiki.root_url`: Base url used to resolve links
* `wiki.root_dir`: Absolute path of base directory
* `wiki.source_dir`: Source directory (relative path from `wiki.root_dir`)
* `wiki.out_dir`: Output directory (relative)
Be sure to set `wiki.rsync_dir` in order to correctly push your changes.
When using `--rsync`, keep in mind that the rendered output must be configured
-to work on the web server and set `wiki.root_url` accordingly.
+to work on the web server.
wiki.name=MyWiki
wiki.desc=proudly powered by nit
wiki.logo=assets/logo.png
-wiki.root_url=http://localhost/
wiki.root_dir=/full/path/to/your/wiki/root/dir
wiki.name=nitiwiki
wiki.desc=proudly powered by nit
wiki.logo=assets/logo.png
-wiki.root_url=http://moz-code.org/nitiwiki/
wiki.root_dir=.
wiki.rsync_dir=moz-code.org:nitiwiki/
var opt_verbose = new OptionCount("Verbose level", "-v")
var opt_config = new OptionString("Path to config.ini file", "-c", "--config")
var opt_init = new OptionBool("Initialize a new wiki in the current directory", "--init")
-var opt_status = new OptionBool("Display wiki status", "-s", "--status")
+var opt_status = new OptionBool("Display wiki status", "--status")
var opt_render = new OptionBool("Render the out directory from markdown sources", "-r", "--render")
var opt_force = new OptionBool("Force render even if source files are unchanged", "-f", "--force")
var opt_clean = new OptionBool("Clean the output directory", "--clean")
print "You can initialize nitiwiki manually by copying the default skeletton here."
exit 1
end
- sys.system "cp -R {tpl}/* ."
+ sys.system "cp -R -- {tpl.escape_to_sh}/* ."
print "Initialized new nitiwiki."
print "Set wiki settings by editing {config_filename}."
exit 0
# Synchronize local output with the distant `WikiConfig::rsync_dir`.
fun sync do
var root = expand_path(config.root_dir, config.out_dir)
- sys.system "rsync -vr --delete {root}/ {config.rsync_dir}"
+ var rsync_dir = config.rsync_dir
+ if rsync_dir == "" then
+ message("Error: configure `wiki.rsync_dir` to use rsync.", 0)
+ return
+ end
+ sys.system "rsync -vr --delete -- {root.escape_to_sh}/ {rsync_dir.escape_to_sh}"
end
# Pull data from git repository.
fun fetch do
- sys.system "git pull {config.git_origin} {config.git_branch}"
+ sys.system "git pull {config.git_origin.escape_to_sh} {config.git_branch.escape_to_sh}"
end
# Analyze wiki files from `dir` to build wiki entries.
print "nitiWiki"
print "name: {config.wiki_name}"
print "config: {config.ini_file}"
- print "url: {config.root_url}"
print ""
if root_section.is_dirty then
print "There is modified files:"
path = path.simplify_path
if entries.has_key(path) then return entries[path].as(WikiSection)
var root = expand_path(config.root_dir, config.source_dir)
- var name = path.basename("")
+ var name = path.basename
var section = new WikiSection(self, name)
entries[path] = section
if path == root then return section
private fun try_load_config do
var cfile = wiki.expand_path(wiki.config.root_dir, src_path, wiki.config_filename)
if not cfile.file_exists then return
- wiki.message("Custom config for section {name}", 1)
+ wiki.message("Custom config for section {name}", 2)
config = new SectionConfig(cfile)
end
# * default: ``
var wiki_logo: String is lazy do return value_or_default("wiki.logo", "")
- # Root url of the wiki.
- #
- # * key: `wiki.root_url`
- # * default: `http://localhost/`
- var root_url: String is lazy do return value_or_default("wiki.root_url", "http://localhost/")
-
# Markdown extension recognized by this wiki.
#
# We allow only one kind of extension per wiki.
var src = expand_path(config.root_dir, config.assets_dir)
var out = expand_path(config.root_dir, config.out_dir)
if need_render(src, expand_path(out, config.assets_dir)) then
- if src.file_exists then sys.system "cp -R {src} {out}"
+ if src.file_exists then sys.system "cp -R -- {src.escape_to_sh} {out.escape_to_sh}"
end
end
if is_new then
out_full_path.mkdir
else
- sys.system "touch {out_full_path}"
+ sys.system "touch -- {out_full_path.escape_to_sh}"
end
if has_source then
- wiki.message("Render section {out_path}", 1)
+ wiki.message("Render section {name} -> {out_path}", 1)
copy_files
end
var index = self.index
if index isa WikiSectionIndex then
- wiki.message("Render auto-index for section {out_path}", 1)
+ wiki.message("Render auto-index for section {name} -> {out_path}", 1)
index.is_dirty = true
add_child index
end
var src = wiki.expand_path(dir, name)
var out = wiki.expand_path(out_full_path, name)
if not wiki.need_render(src, out) then continue
- sys.system "cp -R {src} {out_full_path}"
+ sys.system "cp -R -- {src.escape_to_sh} {out_full_path.escape_to_sh}"
end
end
redef fun render do
super
if not is_dirty and not wiki.force_render then return
- wiki.message("Render article {name}", 2)
var file = out_full_path
+ wiki.message("Render article {name} -> {file}", 1)
file.dirname.mkdir
tpl_page.write_to_file file
end
redef class WikiEntry
- # Absolute url to `self` once generated.
- # If you use this, the generated files will hard-code `root_url`
- fun url: String do return wiki.config.root_url / href
-
# Relative path to `self` from the target root_url
fun href: String do return breadcrumbs.join("/")
# Article used to contextualize links.
var context: WikiEntry
- redef fun add_wikilink(v, link, name, comment) do
+ redef fun add_wikilink(v, token) do
+ var wiki = v.processor.as(NitiwikiMdProcessor).wiki
+ var target: nullable WikiEntry = null
var anchor: nullable String = null
+ var link = token.link
+ if link == null then return
+ var name = token.name
v.add "<a "
if not link.has_prefix("http://") and not link.has_prefix("https://") then
- var wiki = v.processor.as(NitiwikiMdProcessor).wiki
- var target: nullable WikiEntry = null
if link.has("#") then
var parts = link.split_with("#")
link = parts.first
if name == null then name = target.title
link = target.href_from(context)
else
- var loc = context.src_path or else context.name
- wiki.message("Warning: unknown wikilink `{link}` (in {loc})", 0)
+ wiki.message("Warning: unknown wikilink `{link}` (in {context.src_path.as(not null)})", 0)
v.add "class=\"broken\" "
end
end
append_value(v, link)
if anchor != null then append_value(v, "#{anchor}")
v.add "\""
+ var comment = token.comment
if comment != null and not comment.is_empty then
v.add " title=\""
append_value(v, comment)
#
# Used to load achievements from storage.
init from_json(game: Game, json: JsonObject) do
- self.game = game
- id = json["id"].to_s
- name = json["name"].to_s
- desc = json["desc"].to_s
- reward = json["reward"].as(Int)
+ init(game, json["id"].to_s, json["name"].to_s, json["desc"].to_s, json["reward"].as(Int))
end
redef fun to_json do
#
# Used to load events from json storage.
init from_json(game: Game, json: JsonObject) do
- self.game = game
+ init(game, json["kind"].to_s, json["data"].as(JsonObject))
internal_id = json["internal_id"].to_s
- kind = json["kind"].to_s
time = new ISODate.from_string(json["time"].to_s)
- data = json["data"].as(JsonObject)
end
redef fun to_json do
#
# Used to load players from saved data.
init from_json(game: Game, json: JsonObject) do
- self.game = game
- name = json["name"].to_s
+ init(game, json["name"].to_s)
nitcoins = json["nitcoins"].as(Int)
end
"-involves:{player.name}"
var issues = new ArraySet[Issue]
- issues.add_all game.repo.search_issues(q).as(not null)
- issues.add_all game.repo.search_issues(q2).as(not null)
+ var rq = game.repo.search_issues(q)
+ if rq != null then issues.add_all rq
+ var rq2 = game.repo.search_issues(q2)
+ if rq2 != null then issues.add_all rq2
if issues.is_empty then
add "<em>No pull request or issue to review yet...</em>"
return
var q2 = "is:open sort:updated-asc assignee:{player.name}"
var issues = new ArraySet[Issue]
- issues.add_all game.repo.search_issues(q).as(not null)
- issues.add_all game.repo.search_issues(q2).as(not null)
+ var rq = game.repo.search_issues(q)
+ if rq != null then issues.add_all rq
+ var rq2 = game.repo.search_issues(q2)
+ if rq2 != null then issues.add_all rq2
if issues.is_empty then
add "<em>No work to do yet...</em>"
return
do
var code_lines = new Array[String]
for line in lines do code_lines.add(line.text)
- var code = code_lines.join("")
+ var code = code_lines.join
code = code.replace("\n","\\l").replace("\"","\\\"").replace("\\n","|n").replace("/","\\/").replace("\r","")
# the last one is a hack
dfa_state = -1
else
var c = string[sp].ascii
+ if c >= 255 then c = 255
sp += 1
var cr = _cr
# Inits `self` from a float `value`.
init from_float(value: Float) do
- self.value = (value * 100.0).to_i
+ init((value * 100.0).to_i)
end
redef fun to_s do return "{value / 100}.{value % 100}$"
module rss_downloader
import curl
+import dom
redef class Sys
# Lazy man's verbose option
# Exception where we ignore uniqueness and can be downloaded again (may be empty)
var unique_exceptions: Array[Pattern]
+
+ # XML tag used for pattern recognition
+ fun tag_title: String do return "title"
+
+ # XML tag of the link to act upon
+ fun tag_link: String do return "link"
+
+ # Are the feeds at `rss_source_urls` compressed?
+ var compressed: nullable Bool
+
+ # Action to apply on each selected RSS element
+ fun act_on(element: Element)
+ do
+ var local_path = download_destination_folder.to_s / element.title
+ element.download_to(local_path)
+ end
end
# An element from an RSS feed
var elements = new HashSet[Element]
for rss_url in config.rss_source_urls do
var rss = rss_url.fetch_rss_content
+ if config.compressed == true then rss = rss.gunzip
elements.add_all rss.to_rss_elements
end
if sys.verbose then
print "\n# {matches.length} matching elements:"
- print matches.join("\n")
+ print "* " + matches.join("\n* ")
print "\n# Downloading..."
end
for element in matches do
- var local_path = config.download_destination_folder.to_s / element.title
var unique_id = element.unique_id(config)
- if local_path.to_path.exists then
- # Do not redownload a file (we assume that the file name is unique by itself)
- if sys.verbose then print "File exists, skipping {element}"
- continue
- else if history.has(unique_id) then
+ if history.has(unique_id) then
# Do not download a file that is not unique according to `unique_id`
if not element.is_unique_exception(config) then
# We make some exceptions
- if sys.verbose then print "File in log, skipping {element}"
+ if sys.verbose then print "- Skipping {element}"
continue
end
end
# Download element
- if sys.verbose then print "Fetching {element} as {local_path}"
- element.download_to(local_path)
+ if sys.verbose then print "+ Acting on {element}"
+
+ tool_config.act_on element
# Add `unique_id` to log
history.add unique_id
end
for dir in source_folder.files do if dir.stat.is_dir then
- folder_names.add dir.to_s
+ folder_names.add dir.filename
end
end
# Get this RSS feed content as an `Array[Element]`
fun to_rss_elements: Array[Element]
do
- var title_re = "<title><![^/]*</title>".to_re
- var link_re = "<link>[^<]*download[^<]*</link>".to_re
-
- var title_prefix_len = "<title><![CDATA[".length
- var title_suffix_len = "]]</title>".length+1
-
- var titles = search_all(title_re)
- var links = search_all(link_re)
-
- if sys.verbose then print "\n# Found {titles.length} titles and {links.length} links"
- assert titles.length == links.length
+ var xml = to_xml
+ if xml isa XMLError then
+ print_error "RSS Parse Error: {xml.message}:{xml.location or else "null"}"
+ return new Array[Element]
+ end
+ var items = xml["rss"].first["channel"].first["item"]
var elements = new Array[Element]
- for i in titles.length.times do
- var title = titles[i].to_s.substring(title_prefix_len, titles[i].length - title_prefix_len - title_suffix_len)
- var link = links[i].to_s.substring(6, links[i].length - 6 - 7)
+ for item in items do
+ var title = item[tool_config.tag_title].first.as(XMLStartTag).data
+ var link = item[tool_config.tag_link].first.as(XMLStartTag).data
+
elements.add new Element(title, link)
end
if sys.verbose then
print "# Found elements:"
- print elements.join("\n")
+ print "* " + elements.join("\n* ")
end
return elements
end
+
+ # Expand the Lempel-Ziv encoded `self`
+ fun gunzip: String
+ do
+ var proc = new ProcessDuplex("gunzip", new Array[String]...)
+ var res = proc.write_and_read(self)
+ assert proc.status == 0 else print_error "gunzip failed: {proc.last_error or else "Unknown"}"
+ return res
+ end
end
# Implement this method in your module to configure this tool
--- /dev/null
+*_lexer.nit
+*_parser.nit
+
+*.dot
+*.out
+simplan
--- /dev/null
+NITC=../../bin/nitc
+NITCC=../nitcc/src/nitcc
+
+all: simplan
+
+simplan: simplan.nit simplan_parser.nit
+ ${NITC} simplan.nit
+
+check: simplan
+ ./simplan prob1.txt | tee plan1.txt.out
+ ./simplan prob1.txt plan1.txt
+ diff plan1.txt plan1.txt.out
+
+simplan_parser.nit: ${NITCC} simplan.sablecc
+ ${NITCC} simplan.sablecc
+
+${NITCC}:
+ ${MAKE} -C ../nitcc
--- /dev/null
+# 50 locations
+# 216 roads
+# 1 robot
+# 3 parcels
+# 1 goal
+# size of the problem: 6250000
+SimplePlan {
+Drive(r0,l28,l13);
+Drive(r0,l13,l45);
+Drive(r0,l45,l30);
+Drive(r0,l30,l14);
+Load(r0,b1);
+Drive(r0,l14,l42);
+Drive(r0,l42,l25);
+Load(r0,b2);
+Drive(r0,l25,l20);
+Drive(r0,l20,l21);
+Drive(r0,l21,l1);
+Drive(r0,l1,l2);
+Drive(r0,l2,l49);
+Unload(r0,b1);
+Drive(r0,l49,l2);
+Drive(r0,l2,l34);
+Drive(r0,l34,l18);
+Drive(r0,l18,l22);
+Drive(r0,l22,l23);
+Unload(r0,b2);
+Drive(r0,l23,l43);
+Drive(r0,l43,l27);
+Load(r0,b0);
+Drive(r0,l27,l43);
+Drive(r0,l43,l7);
+Drive(r0,l7,l10);
+Drive(r0,l10,l42);
+Drive(r0,l42,l46);
+Drive(r0,l46,l30);
+Drive(r0,l30,l47);
+Unload(r0,b0);
+}
+# plan in 31 steps; cost=3613.363
+
+# solver infos: steps=63740 nodes=165751 todo=95238 n=374949 (bf=5.882) mem=228651 last=#63740/165750 d=31 f=3613.363 g=3613.363 h=0.0: l47,l47,l49,l23
--- /dev/null
+# 50 locations
+# 216 roads
+# 1 robot
+# 4 parcels
+# 1 goal
+# size of the problem: 312500000
+SimplePlan {
+Drive(r0,l28,l13);
+Drive(r0,l13,l29);
+Drive(r0,l29,l24);
+Drive(r0,l24,l9);
+Drive(r0,l9,l25);
+Load(r0,b2);
+Load(r0,b3);
+Drive(r0,l25,l10);
+Drive(r0,l10,l7);
+Drive(r0,l7,l23);
+Unload(r0,b2);
+Drive(r0,l23,l43);
+Drive(r0,l43,l27);
+Load(r0,b0);
+Drive(r0,l27,l43);
+Drive(r0,l43,l7);
+Drive(r0,l7,l10);
+Drive(r0,l10,l42);
+Drive(r0,l42,l46);
+Drive(r0,l46,l30);
+Drive(r0,l30,l47);
+Unload(r0,b0);
+Drive(r0,l47,l30);
+Drive(r0,l30,l14);
+Load(r0,b1);
+Unload(r0,b3);
+Drive(r0,l14,l26);
+Drive(r0,l26,l10);
+Drive(r0,l10,l7);
+Drive(r0,l7,l22);
+Drive(r0,l22,l18);
+Drive(r0,l18,l34);
+Drive(r0,l34,l2);
+Drive(r0,l2,l49);
+Unload(r0,b1);
+}
+# plan in 35 steps; cost=3817.866
+
+# solver infos: steps=642940 nodes=1735072 todo=1028967 n=3826575 (bf=5.952) mem=2275189 last=#642940/1735070 d=35 f=3817.866 g=3817.866 h=0.0: l49,l47,l49,l23,l14
--- /dev/null
+Locations {
+ l0 54.0 157.0;
+ l1 142.0 322.0;
+ l2 17.625145191109436 362.7287804981639;
+ l3 8.752924683883949 652.4538767470752;
+ l4 280.29942326716036 112.84657877925903;
+ l5 280.07476562437296 316.83759171242434;
+ l6 352.0 383.0;
+ l7 427.7973423614033 534.5569693075433;
+ l8 645.0 50.0;
+ l9 594.1567879434075 207.08971743408088;
+ l10 551.1448100068717 396.37036744450734;
+ l11 689.6923649366455 606.8179646038893;
+ l12 798.2444364374692 172.9460838932327;
+ l13 1041.0 208.0;
+ l14 730.0 503.0;
+ l15 764.0 650.0;
+ l16 109.0 106.0;
+ l17 176.23541418756668 217.45343995171842;
+ l18 174.0 449.0;
+ l19 185.86325364192228 636.4256578638509;
+ l20 456.0 158.0;
+ l21 251.036774762431 216.80730259283249;
+ l22 279.0 486.0;
+ l23 376.78872928105346 637.727566657247;
+ l24 649.5978269032476 173.14673180434525;
+ l25 522.0 293.0;
+ l26 621.0 484.0;
+ l27 665.0 673.0;
+ l28 993.0 58.0;
+ l29 759.1098336783851 230.9431550946424;
+ l30 784.6590413371292 406.09174619635155;
+ l31 846.7583112657318 585.1443328897806;
+ l32 189.0 71.0;
+ l33 70.0 287.0;
+ l34 52.0 454.0;
+ l35 19.0 573.0;
+ l36 283.82289949208706 56.855981241276524;
+ l37 394.0 316.0;
+ l38 243.0 381.0;
+ l39 259.50875035171345 689.0999806128916;
+ l40 593.1572931438346 143.91140279750383;
+ l41 674.0 289.0;
+ l42 633.0542256736045 382.3427298569007;
+ l43 493.32885850446525 649.6309903737257;
+ l44 824.0 43.0;
+ l45 896.7591861159066 286.66409701463397;
+ l46 703.024710767699 376.0847997537542;
+ l47 822.5827054085579 548.0316713994954;
+ l48 49.81730069726453 28.577354623284567;
+ l49 9.259029707623585 256.40948013940505;
+}
+Roads {
+l0 l16;
+l0 l17;
+l0 l48;
+l1 l17;
+l1 l18;
+l1 l2;
+l1 l21;
+l1 l38;
+l1 l5;
+l1 l6;
+l10 l25;
+l10 l26;
+l10 l41;
+l10 l42;
+l10 l7;
+l11 l15;
+l11 l27;
+l11 l43;
+l12 l29;
+l13 l28;
+l13 l29;
+l13 l44;
+l13 l45;
+l14 l26;
+l14 l30;
+l14 l42;
+l14 l46;
+l15 l27;
+l16 l17;
+l16 l32;
+l16 l48;
+l17 l20;
+l17 l21;
+l17 l32;
+l17 l4;
+l17 l5;
+l18 l22;
+l18 l34;
+l18 l38;
+l18 l5;
+l18 l6;
+l19 l23;
+l19 l3;
+l19 l35;
+l19 l39;
+l2 l33;
+l2 l34;
+l2 l49;
+l20 l21;
+l20 l25;
+l20 l32;
+l20 l36;
+l20 l37;
+l20 l4;
+l20 l40;
+l20 l41;
+l20 l5;
+l20 l6;
+l20 l8;
+l20 l9;
+l21 l32;
+l21 l4;
+l21 l5;
+l22 l23;
+l22 l38;
+l22 l6;
+l22 l7;
+l23 l39;
+l23 l43;
+l23 l7;
+l24 l29;
+l24 l40;
+l24 l8;
+l24 l9;
+l25 l41;
+l25 l42;
+l25 l9;
+l26 l30;
+l26 l42;
+l27 l43;
+l28 l44;
+l29 l45;
+l3 l35;
+l30 l45;
+l30 l46;
+l30 l47;
+l31 l47;
+l32 l48;
+l33 l34;
+l33 l49;
+l36 l4;
+l37 l38;
+l37 l5;
+l37 l6;
+l37 l7;
+l38 l5;
+l38 l6;
+l38 l7;
+l39 l7;
+l40 l8;
+l40 l9;
+l41 l42;
+l41 l9;
+l42 l46;
+l43 l7;
+l45 l46;
+l5 l6;
+l6 l7;
+}
+Robots{
+ r0 l28;
+}
+Parcels{
+ b0 l27;
+ b1 l14;
+ b2 l25;
+}
+Goals{
+ b0 l47;
+ b1 l49;
+ b2 l23;
+}
--- /dev/null
+Locations {
+ l0 54.0 157.0;
+ l1 142.0 322.0;
+ l2 17.625145191109436 362.7287804981639;
+ l3 8.752924683883949 652.4538767470752;
+ l4 280.29942326716036 112.84657877925903;
+ l5 280.07476562437296 316.83759171242434;
+ l6 352.0 383.0;
+ l7 427.7973423614033 534.5569693075433;
+ l8 645.0 50.0;
+ l9 594.1567879434075 207.08971743408088;
+ l10 551.1448100068717 396.37036744450734;
+ l11 689.6923649366455 606.8179646038893;
+ l12 798.2444364374692 172.9460838932327;
+ l13 1041.0 208.0;
+ l14 730.0 503.0;
+ l15 764.0 650.0;
+ l16 109.0 106.0;
+ l17 176.23541418756668 217.45343995171842;
+ l18 174.0 449.0;
+ l19 185.86325364192228 636.4256578638509;
+ l20 456.0 158.0;
+ l21 251.036774762431 216.80730259283249;
+ l22 279.0 486.0;
+ l23 376.78872928105346 637.727566657247;
+ l24 649.5978269032476 173.14673180434525;
+ l25 522.0 293.0;
+ l26 621.0 484.0;
+ l27 665.0 673.0;
+ l28 993.0 58.0;
+ l29 759.1098336783851 230.9431550946424;
+ l30 784.6590413371292 406.09174619635155;
+ l31 846.7583112657318 585.1443328897806;
+ l32 189.0 71.0;
+ l33 70.0 287.0;
+ l34 52.0 454.0;
+ l35 19.0 573.0;
+ l36 283.82289949208706 56.855981241276524;
+ l37 394.0 316.0;
+ l38 243.0 381.0;
+ l39 259.50875035171345 689.0999806128916;
+ l40 593.1572931438346 143.91140279750383;
+ l41 674.0 289.0;
+ l42 633.0542256736045 382.3427298569007;
+ l43 493.32885850446525 649.6309903737257;
+ l44 824.0 43.0;
+ l45 896.7591861159066 286.66409701463397;
+ l46 703.024710767699 376.0847997537542;
+ l47 822.5827054085579 548.0316713994954;
+ l48 49.81730069726453 28.577354623284567;
+ l49 9.259029707623585 256.40948013940505;
+}
+Roads {
+l0 l16;
+l0 l17;
+l0 l48;
+l1 l17;
+l1 l18;
+l1 l2;
+l1 l21;
+l1 l38;
+l1 l5;
+l1 l6;
+l10 l25;
+l10 l26;
+l10 l41;
+l10 l42;
+l10 l7;
+l11 l15;
+l11 l27;
+l11 l43;
+l12 l29;
+l13 l28;
+l13 l29;
+l13 l44;
+l13 l45;
+l14 l26;
+l14 l30;
+l14 l42;
+l14 l46;
+l15 l27;
+l16 l17;
+l16 l32;
+l16 l48;
+l17 l20;
+l17 l21;
+l17 l32;
+l17 l4;
+l17 l5;
+l18 l22;
+l18 l34;
+l18 l38;
+l18 l5;
+l18 l6;
+l19 l23;
+l19 l3;
+l19 l35;
+l19 l39;
+l2 l33;
+l2 l34;
+l2 l49;
+l20 l21;
+l20 l25;
+l20 l32;
+l20 l36;
+l20 l37;
+l20 l4;
+l20 l40;
+l20 l41;
+l20 l5;
+l20 l6;
+l20 l8;
+l20 l9;
+l21 l32;
+l21 l4;
+l21 l5;
+l22 l23;
+l22 l38;
+l22 l6;
+l22 l7;
+l23 l39;
+l23 l43;
+l23 l7;
+l24 l29;
+l24 l40;
+l24 l8;
+l24 l9;
+l25 l41;
+l25 l42;
+l25 l9;
+l26 l30;
+l26 l42;
+l27 l43;
+l28 l44;
+l29 l45;
+l3 l35;
+l30 l45;
+l30 l46;
+l30 l47;
+l31 l47;
+l32 l48;
+l33 l34;
+l33 l49;
+l36 l4;
+l37 l38;
+l37 l5;
+l37 l6;
+l37 l7;
+l38 l5;
+l38 l6;
+l38 l7;
+l39 l7;
+l40 l8;
+l40 l9;
+l41 l42;
+l41 l9;
+l42 l46;
+l43 l7;
+l45 l46;
+l5 l6;
+l6 l7;
+}
+Robots{
+ r0 l28;
+}
+Parcels{
+ b0 l27;
+ b1 l14;
+ b2 l25;
+ b3 l25;
+}
+Goals{
+ b0 l47;
+ b1 l49;
+ b2 l23;
+ b3 l14;
+}
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# A simple planning problem solver using A* for a robot that delivers parcels.
+#
+# A map is made of `Location`s (with cartesian coordinates) connected with `Road`s.
+# Some parcels and a robot are placed on the map.
+#
+# The goal of the robot is to plan the delivery of the parcels to their destination in the most
+# efficient way knowing that:
+#
+# * the robot has a given speed to drive
+# * the loading and unloading of parcels take time
+# * the capacity of the robot is limited
+module simplan
+
+import ai::search
+
+private import simplan_lexer
+private import simplan_parser
+
+# The description of the planing problem to solve
+class PlanProblem
+ super SearchProblem[State, Action]
+
+ # Some parameters of the problem
+
+ # The speed on the road.
+ # Used for the action `Drive`
+ var speed = 1.0
+
+ # Cost of loading a parcel in a robot
+ # Used for the action `Load`
+ var duration_loading = 30.0
+
+ # Cost of unloading a parcel in a robot
+ # Used for the action `Unload`
+ var duration_unloading = 30.0
+
+ # How many parcels can a robot transport at the same time?
+ var capacity = 2
+
+ # The name of the robot
+ var robot_name = "r0"
+
+ # Locations on the map, by their names
+ var locations = new HashMap[String, Location]
+
+ # All the parcels, by their `id`
+ var parcels = new Array[Parcel]
+
+ # All the parcels, by their names
+ var parcel_by_name = new HashMap[String, Parcel]
+
+ # +infinite, used to initialize some floats with the maximum value.
+ private var infinite: Float = 1.0 / 0.0
+
+ # The starting state
+ redef var initial_state: State is noinit
+
+ # Parse and initialize a problem from description `text`
+ fun parse(text: String)
+ do
+ var l = new Lexer_simplan(text)
+ var p = new Parser_simplan
+ p.tokens.add_all l.lex
+ var n = p.parse
+ if n isa NError then
+ print n.message
+ exit 1
+ end
+ n = n.children.first.children.first.as(not null)
+ if n isa Nplan then
+ print "Error: expected a problem, got a plan."
+ exit 1
+ end
+ assert n isa Nproblem
+
+ # Load all locations
+ for n2 in n.n_locations.n_list.children do
+ var e = new Location(locations.length, n2.n_name.text, n2.n_x.text.to_f, n2.n_y.text.to_f)
+ assert not locations.has_key(e.name)
+ locations[e.name] = e
+ end
+ print "# {locations.length} locations"
+
+ # Load all roads
+ var nbr = 0
+ for n2 in n.n_roads.n_list.children do
+ var o = locations.get_or_null(n2.n_orig.text)
+ var d = locations.get_or_null(n2.n_dest.text)
+ assert o != null and d != null
+ var r = new Road(o,d)
+ o.roads.add(r)
+ r = new Road(d,o)
+ d.roads.add(r)
+ nbr += 2
+ end
+ print "# {nbr} roads"
+
+ # Compute all road durations
+ for e in locations.values do
+ e.durations = new Array[Float].filled_with(infinite, locations.length)
+ e.durations[e.id] = 0.0
+ for r in e.roads do
+ e.durations[r.dest.id] = r.distance / speed
+ end
+ end
+
+ # Close the duration relation between each pair of locations
+ for k in locations.values do
+ for i in locations.values do
+ for j in locations.values do
+ var d = i.durations[k.id] + k.durations[j.id]
+ if i.durations[j.id] > d then
+ i.durations[j.id] = d
+ end
+ end
+ end
+ end
+
+ # Load the robot
+ var robot = null
+ for n2 in n.n_robots.n_list.children do
+ var name = n2.n_name.text
+ robot = locations.get_or_null(n2.n_emplacement.text)
+ assert name == robot_name and robot != null
+ end
+ assert robot != null
+ print "# 1 robot"
+
+ # Load the parcels
+ var parcel_locations = new Array[nullable Location]
+ for n2 in n.n_parcels.n_list.children do
+ var name = n2.n_name.text
+ var e = locations.get_or_null(n2.n_emplacement.text)
+ assert e != null
+ var parcel = new Parcel(parcels.length, name, e, e)
+ parcels.add parcel
+ parcel_locations.add e
+ parcel_by_name[name] = parcel
+
+ end
+ print "# {parcels.length} parcels"
+
+ # Load the goal of parcels
+ for n2 in n.n_goal.n_list.children do
+ var parcel = parcel_by_name.get_or_null(n2.n_name.text)
+ var e = locations.get_or_null(n2.n_emplacement.text)
+ assert parcel != null and e != null
+ parcel.goal = e
+ end
+ print "# 1 goal"
+
+ print "# size of the problem: {locations.length.to_f.pow(parcels.length.to_f+1.0).to_precision(0)}"
+
+ initial_state = new State(self, robot, parcel_locations, 0)
+ end
+
+ # Parse a plan for a given problem
+ fun parse_plan(text: String): Plan
+ do
+ var l = new Lexer_simplan(text)
+ var p = new Parser_simplan
+ p.tokens.add_all l.lex
+ var n = p.parse
+ if n isa NError then
+ print n.message
+ exit 1
+ end
+ n = n.children.first.children.first.as(not null)
+ if n isa Nproblem then
+ print "Error: expected a plan, got a problem."
+ exit 1
+ end
+ assert n isa Nplan
+
+ var res = new Plan(self)
+ var e = initial_state
+ var cost = 0.0
+ for n2 in n.n_actions.children do
+ if n2 isa Naction_load then
+ var parcel = parcel_by_name.get_or_null(n2.n_parcel.text)
+ assert parcel != null
+ var a = new Load(self, parcel)
+ res.actions.add(a)
+ e = a.trans(e)
+ cost += a.cost
+ else if n2 isa Naction_unload then
+ var parcel = parcel_by_name.get_or_null(n2.n_parcel.text)
+ assert parcel != null
+ var a = new Unload(self, parcel)
+ res.actions.add(a)
+ e = a.trans(e)
+ cost += a.cost
+ else if n2 isa Naction_drive then
+ var o = locations.get_or_null(n2.n_orig.text)
+ var d = locations.get_or_null(n2.n_dest.text)
+ assert o != null and d != null
+ var road: nullable Road = null
+ for r in o.roads do if r.dest == d then
+ road = r
+ break
+ end
+ assert road != null
+ var a = new Drive(self, road)
+ res.actions.add(a)
+ e = a.trans(e)
+ cost += a.cost
+ else abort
+ end
+ print "# loaded plan in {res.actions.length} steps; cost = {cost}"
+ return res
+ end
+
+ redef fun actions(state)
+ do
+ var res = new Array[Action]
+
+ # Driving?
+ for road in state.robot.roads do
+ res.add(new Drive(self, road))
+ end
+
+ # Loading?
+ for i in [0..state.parcels.length[ do
+ if state.parcels[i] == state.robot and state.nb_parcels < self.capacity and self.parcels[i].goal != state.robot then
+ res.add(new Load(self, parcels[i]))
+ end
+ end
+
+ # Unloading?
+ for i in [0..state.parcels.length[ do
+ # Unloading is always a valid action,
+ # even if dropping a parcel outside of its goal is unlikely (but possible)
+ # to be a part of an optimal plan.
+ if state.parcels[i] == null then #and self.parcels[i].goal == state.robot then
+ res.add(new Unload(self, parcels[i]))
+ end
+ end
+
+ return res
+ end
+
+ redef fun apply_action(state, action) do return action.trans(state)
+
+ redef fun cost(state1, action, state2) do return action.cost
+
+ redef fun is_goal(state)
+ do
+ for i in [0..parcels.length[ do
+ if state.parcels[i] != parcels[i].goal then return false
+ end
+ return true
+ end
+
+ redef fun heuristic(state)
+ do
+ # Combination (maximum) of two heuristic:
+ # Heuristic 1: maximum driving time to take and deliver a single parcel
+ var max_for_one = 0.0
+ # Heuristic 2: driving time to take the nearest parcel, then deliver all parcels
+ var total_deliver_drive = 0.0
+ var min_take_one = infinite
+ # Total loading/unloading time (incompressible cost, added to both heuristics)
+ var total_load = 0.0
+
+ for i in [0..parcels.length[ do
+ # The parcel location
+ var c = state.parcels[i]
+
+ # Its goal location
+ var b = parcels[i].goal
+
+ # Parcel is fine, nothing to do.
+ if c == b then continue
+
+ # Driving time to take and deliver this parcel
+ var t = 0.0
+
+ # Current position of the parcel (somewhere or in the robot)
+ var current: Location
+
+ if c == null then
+ # The parcel is in the robot
+ current = state.robot
+ min_take_one = 0.0
+ else
+ # The parcel is somewhere
+ current = c
+ # So go get it.
+ var tt = state.robot.duration(c)
+ total_load += duration_loading
+
+ t += tt
+ if tt < min_take_one then min_take_one = tt
+ end
+
+ # Drive and unload the parcel
+ var td = current.duration(b)
+ total_load += duration_unloading
+
+ t += td
+ if t > max_for_one then max_for_one = t
+ total_deliver_drive += td
+ end
+
+ # Since one robot can transport several parcels at the same time,
+ # the best optimistic scenario is to deliver at full capacity
+ if min_take_one == infinite then min_take_one = 0.0
+ var res = min_take_one + total_deliver_drive / capacity.to_f
+
+ # Get best of both heuristics
+ if res < max_for_one then res = max_for_one
+
+ # Add incompressible (un)loading costs
+ res += total_load
+
+ return res
+ end
+
+ redef fun make_memory
+ do
+ var res = super
+ res.add new RBTreeMap[State, SearchNode[State, Action]]
+ res.add new BinTreeMap[State, SearchNode[State, Action]]
+ return res
+ end
+end
+
+# A node on the map
+class Location
+ # Indexed identifier, starting at 0
+ # Used to access locations in arrays.
+ var id: Int
+
+ # The name of the location, from the problem description
+ var name: String
+
+ # The x-coordinate of the location
+ var x: Float
+
+ # The y-coordinate of the location
+ var y: Float
+
+ # All roads from this location
+ var roads = new Array[Road]
+
+ # Drive duration to any other location on the map
+ fun duration(dest: Location): Float
+ do
+ return durations[dest.id]
+ end
+
+ private var durations = new Array[Float]
+
+ redef fun to_s do return "{id}({x}, {y})"
+end
+
+# A directed road segment between two locations
+class Road
+ # The origin
+ var orig: Location
+
+ # The destination
+ var dest: Location
+
+ # The distance according to the coordinates of the locations.
+ var distance: Float is noautoinit
+
+ init
+ do
+ var dx = orig.x-dest.x
+ var dy = orig.y-dest.y
+ distance = (dx*dx + dy*dy).sqrt
+ end
+end
+
+# A parcel to move
+class Parcel
+ # Indexed identifier, starting by 0
+ # Used to access parcels in arrays.
+ var id: Int
+ # The name of the parcel according to the problem description
+ # Used for output
+ var name: String
+ # The starting location
+ var start: Location
+ # The goal location
+ var goal: Location
+end
+
+
+# A plan on a problem
+class Plan
+ # The original problem
+ var problem: PlanProblem
+
+ # The sequence of actions in the plan
+ var actions = new Array[Action]
+
+ # Check and write the plan
+ fun dump(verbose: Bool)
+ do
+ var e = problem.initial_state
+ print "SimplePlan \{"
+ var cost = 0.0
+ if verbose then print "#{e} {cost}"
+ for a in actions do
+ print "{a}"
+ e = a.trans(e)
+ cost += a.cost
+ if verbose then
+ print "#{e} {cost}"
+ if a isa Drive then
+ print "#{a.road.orig} -- {a.road.dest}: {a.road.distance}"
+ end
+ end
+
+ end
+ print "\}"
+ if not problem.is_goal(e) then
+ print "# /!\\ Goal Failed"
+ end
+ print "# plan in {actions.length} steps; cost={cost}\n"
+ end
+end
+
+# A primitive movement
+abstract class Action
+ # The unitary cost of the action
+ fun cost: Float is abstract
+
+ # The state resulting to the application of the action
+ fun trans(e: State): State is abstract
+
+ # The original problem
+ var problem: PlanProblem
+end
+
+# A loading of a parcel
+class Load
+ super Action
+
+ # The loaded parcel
+ var parcel: Parcel
+
+ redef fun cost do return problem.duration_loading
+
+ redef fun to_s do return "Load({problem.robot_name},{parcel.name});"
+
+ redef fun trans(e)
+ do
+ var res = e.clone
+ assert res.parcels[parcel.id] == res.robot
+ res.parcels = res.parcels.clone
+ res.parcels[parcel.id] = null
+ assert res.nb_parcels < problem.capacity
+ res.nb_parcels += 1
+ return res
+ end
+end
+
+# A unloading of a parcel
+class Unload
+ super Action
+
+ # The unloaded parcel
+ var parcel: Parcel
+
+ redef fun cost do return problem.duration_unloading
+
+ redef fun to_s do return "Unload({problem.robot_name},{parcel.name});"
+
+ redef fun trans(e)
+ do
+ var res = e.clone
+ assert res.parcels[parcel.id] == null
+ res.parcels = res.parcels.clone
+ res.parcels[parcel.id] = res.robot
+ assert res.nb_parcels > 0
+ res.nb_parcels -= 1
+ return res
+ end
+end
+
+# A road driving
+class Drive
+ super Action
+
+ # The road drove on
+ var road: Road
+
+ redef fun cost do return road.distance / problem.speed
+
+ redef fun to_s do return "Drive({problem.robot_name},{road.orig.name},{road.dest.name});"
+
+ redef fun trans(e)
+ do
+ var res = e.clone
+ assert res.robot == road.orig
+ res.robot = road.dest
+ return res
+ end
+end
+
+# Where each robot and parcel are?
+class State
+ super Comparable
+ redef type OTHER: State
+
+ # The original problem
+ var problem: PlanProblem
+
+ # Where is the robot
+ var robot: Location
+
+ # Where each parcel is
+ # `null` if the parcel is loaded
+ var parcels: Array[nullable Location]
+
+ # Number of loaded parcels
+ # Must be consistent with `parcels`
+ var nb_parcels: Int
+
+ # Clone of the state
+ # Used by `Action::trans`
+ #
+ # Warning: the `parcels` array is not cloned for efficiency.
+ # You need to clone it if you mutate it
+ private fun clone: State
+ do
+ var res = new State(problem, robot, parcels, nb_parcels)
+ return res
+ end
+
+ redef fun hash
+ do
+ var res = hash_cache
+ if res != 0 then return res
+ res = robot.hash * 23 + parcels.hash * 7
+ hash_cache = res
+ return res
+ end
+
+ private var hash_cache = 0
+
+ redef fun ==(o)
+ do
+ if not o isa State then return false
+ return robot == o.robot and parcels == o.parcels
+ end
+
+ redef fun <(o) do return (self <=> o) < 0
+
+ redef fun <=>(o) do
+ var res = robot.id <=> o.robot.id
+ if res != 0 then return res
+ for i in [0..parcels.length[ do
+ var c = parcels[i]
+ var oc = o.parcels[i]
+ if c == oc then continue
+ if c == null then return -1
+ if oc == null then return 1
+ res = c.id <=> oc.id
+ if res != 0 then return res
+ end
+ return 0
+ end
+
+ redef fun to_s
+ do
+ var res = "{robot.name}"
+ for c in parcels do
+ res += ","
+ if c != null then
+ res += c.name
+ end
+ end
+ return res
+ end
+end
+
+# --configs
+var configs = false
+if not args.is_empty and args.first == "--configs" then
+ configs = true
+ args.shift
+end
+
+# Usage
+if args.is_empty then
+ print "Usage: plan [--configs] problem.txt [plan.txt]\nSearch, or apply, a plan to a problem."
+ exit 0
+end
+
+var problem = new PlanProblem
+
+# Load
+var problem_text = args.first.to_path.read_all
+problem.parse(problem_text)
+
+# Apply a plan
+if args.length == 2 then
+ var plan_text = args[1].to_path.read_all
+ var plan = problem.parse_plan(plan_text)
+ plan.dump(false)
+ exit 0
+end
+
+# run --configs?
+if configs then
+ problem.run_configs(100000)
+ exit 0
+end
+
+# Solve the plan
+var solver = problem.astar
+solver.memorize = true
+var res = solver.run
+if res == null then
+ print "No plan found :("
+ return
+end
+var plan = new Plan(problem)
+plan.actions.add_all res.plan
+plan.dump(false)
+print "# solver infos: {solver}"
--- /dev/null
+Grammar simplan;
+
+Lexer
+
+letter = 'a'..'z'|'a'..'Z';
+digit = '0'..'9';
+name = letter (letter|digit)*;
+nb = digit* '.' digit+ | digit+;
+
+eol = #10 | #13 | #10 #13;
+comment = '#' (Any-eol)* eol?;
+
+blank = #9 | #10 | #13 | ' ' | comment;
+
+Parser
+
+Ignored blank;
+
+file = problem | plan ;
+
+problem = locations roads robots parcels goal;
+locations = 'Locations' '{' [list:]location* '}';
+location = name [x:]nb [y:]nb ';';
+roads = 'Roads' '{' [list:]road* '}';
+road = [orig:]name [dest:]name ';' ;
+robots = 'Robots' '{' [list:]robot* '}';
+robot = name [emplacement:]name ';';
+parcels = 'Parcels' '{' [list:]parcel* '}';
+parcel = name [emplacement:]name ';';
+goal = 'Goals' '{' [list:]parcel* '}';
+
+plan = 'SimplePlan' '{' [actions:]action* '}';
+action =
+ {load:} 'Load' '(' [robot:]name ',' [parcel:]name ')' ';' |
+ {unload:} 'Unload' '(' [robot:]name ',' [parcel:]name ')' ';' |
+ {drive:} 'Drive' '(' [robot:]name ',' [orig:]name ',' [dest:]name ')' ';' ;
--- /dev/null
+src/*/*_serialize.nit
+src/client/drawing.nit
+config.json
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+all: bin/server bin/tinks
+
+# Client
+bin/tinks: assets/images/drawing.png src/client/client_serialize.nit $(shell ../../bin/nitls -M src/client/linux_client.nit)
+ ../../bin/nitc -o bin/tinks src/client/linux_client.nit -m src/client/client_serialize.nit
+
+src/client/client_serialize.nit: $(shell ../../bin/nitls -M src/client/client.nit)
+ ../../bin/nitserial -o src/client/client_serialize.nit src/client/client.nit
+
+assets/images/drawing.png: art/drawing.svg
+ ../inkscape_tools/bin/svg_to_png_and_nit art/drawing.svg -a assets/ -s src/client/ -x 2.0
+
+# Server
+bin/server: src/server/server_serialize.nit $(shell ../../bin/nitls -M src/server/dedicated.nit)
+ ../../bin/nitc -o bin/server src/server/dedicated.nit -m src/server/server_serialize.nit
+
+src/server/server_serialize.nit: $(shell ../../bin/nitls -M src/server/dedicated.nit)
+ ../../bin/nitserial -o src/server/server_serialize.nit src/server/dedicated.nit
+
+# Android
+bin/tinks.apk: assets/images/drawing.png src/client/client_serialize.nit res/drawable-ldpi/icon.png $(shell ../../bin/nitls -M src/client/android_client.nit)
+ ../../bin/nitc -o bin/tinks.apk src/client/android_client.nit -m src/client/client_serialize.nit --compile-dir nit_compile
+ adb install -r bin/tinks.apk
+
+res/drawable-ldpi/icon.png: art/icon.svg
+ ../inkscape_tools/bin/svg_to_icons art/icon.svg --android --out res/
+
+# Archive
+pub: assets/images/drawing.png src/client/client_serialize.nit bin/tinks.apk
+ ../../bin/nitc --no-stacktrace -o bin/tinks src/client/linux_client.nit -m src/client/client_serialize.nit
+ tar -czvf bin/tinks.tar.gz bin/tinks assets/
+ scp bin/tinks.tar.gz bin/tinks.apk xymus.net:/var/www/pub/
+
+.PHONY: pub
--- /dev/null
+Tinks! a multiplayer crossplatform action game with destructible procedurally generated worlds
+
+# Project description
+
+Each player controls a tank, opens fire from the turret and navigates between the terrain features.
+Explosions from turret fire and tank destruction have different forces and destroy the terrain.
+Each tank needs 4 hits to be destroyed.
+Destroyed tanks drop health powerups which can repair other tanks.
+
+The game is optimized for the multiplayer mode but one can play alone to practice.
+Upon launch, a client searches for server by broadcasting a UDP socket.
+A server may respond with its TCP connection port.
+If there is no answer, the client starts its own server which will accept other clients.
+
+The game logic is mostly event based.
+Only the events are passed to the clients at each frame, by serializing them to binary.
+So both the clients and the server keep the game knowledge.
+
+The world is different in each game, it is procedurally generated with an "unlimited" size.
+Each world feature is discovered only as needed by either the server or the clients.
+The server discovers the features affected by possible collisions and by explosions.
+The clients discover the features visible on screen.
+The clients and servers share the seed for the noise generator, so they discover the same features.
+Only the destroyed features and new powerups are passed to the clients by the server as events.
+
+# Modifications
+
+This game was developed quickly while aiming to keep it simple.
+It should be easy to add features as refinements on both the client and the server.
+
+# Usage
+
+Compile with: `make`
+
+Launch with: `bin/tinks`
+
+Compile for Android with: `make bin/tinks.apk`
+
+Launch a server with: `bin/server [server_port]`
+
+Connect to a precise server with: `bin/tinks server_address [server_port]`
+
+# Configuration on desktop
+
+You can configure the client by modifying the file `./config.json` created when you first launch the game.
+The fields `res_x` and `res_y` specify the resolution of the window.
+The field `play_sounds` should be clear enough.
--- /dev/null
+<?xml version="1.0" encoding="UTF-8" standalone="no"?>
+<!-- Created with Inkscape (http://www.inkscape.org/) -->
+
+<svg
+ xmlns:dc="http://purl.org/dc/elements/1.1/"
+ xmlns:cc="http://creativecommons.org/ns#"
+ xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#"
+ xmlns:svg="http://www.w3.org/2000/svg"
+ xmlns="http://www.w3.org/2000/svg"
+ xmlns:xlink="http://www.w3.org/1999/xlink"
+ xmlns:sodipodi="http://sodipodi.sourceforge.net/DTD/sodipodi-0.dtd"
+ xmlns:inkscape="http://www.inkscape.org/namespaces/inkscape"
+ width="728.41846"
+ height="519.99341"
+ id="svg2"
+ version="1.1"
+ inkscape:version="0.48.5 r10040"
+ sodipodi:docname="drawing.svg">
+ <defs
+ id="defs4">
+ <linearGradient
+ id="linearGradient4024">
+ <stop
+ id="stop4049"
+ offset="0"
+ style="stop-color:#e6e6e6;stop-opacity:0;" />
+ <stop
+ style="stop-color:#e6e6e6;stop-opacity:0.0397351;"
+ offset="0.5"
+ id="stop4051" />
+ <stop
+ id="stop3977"
+ offset="0.96052629"
+ style="stop-color:#e6e6e6;stop-opacity:0.76158941;" />
+ <stop
+ style="stop-color:#e6e6e6;stop-opacity:0;"
+ offset="1"
+ id="stop4028" />
+ </linearGradient>
+ <linearGradient
+ inkscape:collect="always"
+ id="linearGradient3927">
+ <stop
+ style="stop-color:#e6e6e6;stop-opacity:1;"
+ offset="0"
+ id="stop3929" />
+ <stop
+ style="stop-color:#e6e6e6;stop-opacity:0;"
+ offset="1"
+ id="stop3931" />
+ </linearGradient>
+ <linearGradient
+ id="linearGradient3909">
+ <stop
+ style="stop-color:#000000;stop-opacity:1;"
+ offset="0"
+ id="stop3911" />
+ <stop
+ style="stop-color:#000000;stop-opacity:0;"
+ offset="1"
+ id="stop3913" />
+ </linearGradient>
+ <inkscape:path-effect
+ is_visible="true"
+ id="path-effect4008"
+ effect="spiro" />
+ <inkscape:path-effect
+ effect="spiro"
+ id="path-effect4006"
+ is_visible="true" />
+ <inkscape:path-effect
+ is_visible="true"
+ id="path-effect4004"
+ effect="spiro" />
+ <inkscape:path-effect
+ is_visible="true"
+ id="path-effect3161"
+ effect="spiro" />
+ <inkscape:path-effect
+ effect="spiro"
+ id="path-effect3157"
+ is_visible="true" />
+ <linearGradient
+ id="linearGradient3771">
+ <stop
+ style="stop-color:#000000;stop-opacity:1;"
+ offset="0"
+ id="stop3773" />
+ <stop
+ id="stop3795"
+ offset="0.46052632"
+ style="stop-color:#000000;stop-opacity:1;" />
+ <stop
+ style="stop-color:#000000;stop-opacity:0"
+ offset="1"
+ id="stop3775" />
+ </linearGradient>
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient3771"
+ id="radialGradient3829"
+ gradientUnits="userSpaceOnUse"
+ gradientTransform="matrix(0,0.33243869,-1.4983791,0,690.78032,359.10278)"
+ cx="232.84016"
+ cy="159.23706"
+ fx="232.84016"
+ fy="159.23706"
+ r="33.324886" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient3771"
+ id="radialGradient3831"
+ gradientUnits="userSpaceOnUse"
+ gradientTransform="matrix(-0.35546222,0.09524581,-0.38780905,-1.4473231,590.56362,644.53452)"
+ cx="232.84016"
+ cy="159.23706"
+ fx="232.84016"
+ fy="159.23706"
+ r="33.324886" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient3771"
+ id="radialGradient3833"
+ gradientUnits="userSpaceOnUse"
+ gradientTransform="matrix(-0.23937237,-0.24458338,0.97464411,-0.99586156,344.03542,654.43573)"
+ cx="232.84016"
+ cy="159.23706"
+ fx="232.84016"
+ fy="159.23706"
+ r="33.324886" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient3771"
+ id="radialGradient3835"
+ gradientUnits="userSpaceOnUse"
+ gradientTransform="matrix(0.14945417,-0.27574285,1.3692459,0.49897051,192.06465,416.1818)"
+ cx="232.84016"
+ cy="159.23706"
+ fx="232.84016"
+ fy="159.23706"
+ r="33.324886" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient3771"
+ id="radialGradient3837"
+ gradientUnits="userSpaceOnUse"
+ gradientTransform="matrix(0.30945331,-0.10648859,0.38089919,1.4342744,310.38892,228.91286)"
+ cx="232.84016"
+ cy="159.23706"
+ fx="232.84016"
+ fy="159.23706"
+ r="33.324886" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient3771"
+ id="radialGradient3839"
+ gradientUnits="userSpaceOnUse"
+ gradientTransform="matrix(0.25321654,0.18876246,-0.76597563,1.034515,512.69634,219.42448)"
+ cx="232.84016"
+ cy="159.23706"
+ fx="232.84016"
+ fy="159.23706"
+ r="33.324886" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient3771"
+ id="radialGradient3841"
+ gradientUnits="userSpaceOnUse"
+ gradientTransform="matrix(-0.09974529,-0.26010206,1.1547951,-0.37245631,285.61183,551.09526)"
+ cx="232.84016"
+ cy="159.23706"
+ fx="232.84016"
+ fy="159.23706"
+ r="33.324886" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient3771"
+ id="radialGradient3843"
+ gradientUnits="userSpaceOnUse"
+ gradientTransform="matrix(-0.19843343,0.19551567,-0.80354002,-0.90917483,623.69734,531.37012)"
+ cx="232.84016"
+ cy="159.23706"
+ fx="232.84016"
+ fy="159.23706"
+ r="33.324886" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient3771"
+ id="radialGradient3845"
+ gradientUnits="userSpaceOnUse"
+ gradientTransform="matrix(0.09219417,0.25996074,-1.0629657,0.374089,596.78104,309.88047)"
+ cx="232.84016"
+ cy="159.23706"
+ fx="232.84016"
+ fy="159.23706"
+ r="33.324886" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient3771"
+ id="radialGradient3847"
+ gradientUnits="userSpaceOnUse"
+ gradientTransform="matrix(0.25446796,0.0279428,-0.13072229,0.92539534,408.33237,277.18662)"
+ cx="232.84016"
+ cy="159.23706"
+ fx="232.84016"
+ fy="159.23706"
+ r="33.324886" />
+ <filter
+ inkscape:collect="always"
+ id="filter3843"
+ color-interpolation-filters="sRGB">
+ <feGaussianBlur
+ inkscape:collect="always"
+ stdDeviation="0.46728973"
+ id="feGaussianBlur3845" />
+ </filter>
+ <filter
+ inkscape:collect="always"
+ id="filter3884"
+ color-interpolation-filters="sRGB">
+ <feGaussianBlur
+ inkscape:collect="always"
+ stdDeviation="0.12339844"
+ id="feGaussianBlur3886" />
+ </filter>
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient4946"
+ id="radialGradient4952"
+ cx="286.16666"
+ cy="1026.8622"
+ fx="286.16666"
+ fy="1026.8622"
+ r="53"
+ gradientUnits="userSpaceOnUse" />
+ <linearGradient
+ id="linearGradient4946">
+ <stop
+ style="stop-color:#e4e4ff;stop-opacity:0;"
+ offset="0"
+ id="stop4948" />
+ <stop
+ id="stop4956"
+ offset="0.47959185"
+ style="stop-color:#eeefff;stop-opacity:0.36078432;" />
+ <stop
+ id="stop4954"
+ offset="0.883753"
+ style="stop-color:#ebecff;stop-opacity:0.68421054;" />
+ <stop
+ style="stop-color:#f2f3ff;stop-opacity:0.36078432;"
+ offset="0.95870173"
+ id="stop4958" />
+ <stop
+ style="stop-color:#ebeeff;stop-opacity:0;"
+ offset="1"
+ id="stop4950" />
+ </linearGradient>
+ <radialGradient
+ r="53"
+ fy="1026.8622"
+ fx="286.16666"
+ cy="1026.8622"
+ cx="286.16666"
+ gradientUnits="userSpaceOnUse"
+ id="radialGradient8208"
+ xlink:href="#linearGradient4946"
+ inkscape:collect="always" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient4946"
+ id="radialGradient3936"
+ gradientUnits="userSpaceOnUse"
+ cx="286.16666"
+ cy="1026.8622"
+ fx="286.16666"
+ fy="1026.8622"
+ r="53" />
+ <inkscape:path-effect
+ effect="spiro"
+ id="path-effect3157-7"
+ is_visible="true" />
+ <inkscape:path-effect
+ effect="spiro"
+ id="path-effect3157-7-3"
+ is_visible="true" />
+ <inkscape:path-effect
+ effect="spiro"
+ id="path-effect3157-7-3-7"
+ is_visible="true" />
+ <inkscape:path-effect
+ is_visible="true"
+ id="path-effect4008-3"
+ effect="spiro" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient3927"
+ id="radialGradient3951"
+ gradientUnits="userSpaceOnUse"
+ gradientTransform="matrix(1,0,0,26.000001,-449.84036,-17710.121)"
+ cx="-126.19385"
+ cy="697.01298"
+ fx="-126.19385"
+ fy="697.01298"
+ r="2.6785715" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient3927"
+ id="radialGradient3953"
+ gradientUnits="userSpaceOnUse"
+ gradientTransform="matrix(1,0,0,26.000001,538.41022,-17546.303)"
+ cx="-126.19385"
+ cy="697.01298"
+ fx="-126.19385"
+ fy="697.01298"
+ r="2.6785715" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient3927-1"
+ id="radialGradient3953-2"
+ gradientUnits="userSpaceOnUse"
+ gradientTransform="matrix(1,0,0,26.000001,538.41022,-17546.303)"
+ cx="-126.19385"
+ cy="697.013"
+ fx="-126.19385"
+ fy="697.013"
+ r="2.6785715" />
+ <linearGradient
+ inkscape:collect="always"
+ id="linearGradient3927-1">
+ <stop
+ style="stop-color:#e6e6e6;stop-opacity:1;"
+ offset="0"
+ id="stop3929-1" />
+ <stop
+ style="stop-color:#e6e6e6;stop-opacity:0;"
+ offset="1"
+ id="stop3931-6" />
+ </linearGradient>
+ <radialGradient
+ r="2.6785715"
+ fy="697.013"
+ fx="-126.19385"
+ cy="697.013"
+ cx="-126.19385"
+ gradientTransform="matrix(3.849378,0,0,100.08383,1133.3239,-68702.357)"
+ gradientUnits="userSpaceOnUse"
+ id="radialGradient3203"
+ xlink:href="#linearGradient3927-1"
+ inkscape:collect="always" />
+ <linearGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient4024"
+ id="linearGradient4030"
+ x1="737.87946"
+ y1="555.55243"
+ x2="547.46301"
+ y2="555.55243"
+ gradientUnits="userSpaceOnUse" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient4024"
+ id="radialGradient4047"
+ cx="-768.57141"
+ cy="422.85056"
+ fx="-768.57141"
+ fy="422.85056"
+ r="220"
+ gradientUnits="userSpaceOnUse" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient4024"
+ id="radialGradient4055"
+ gradientUnits="userSpaceOnUse"
+ cx="-768.57141"
+ cy="422.85056"
+ fx="-768.57141"
+ fy="422.85056"
+ r="220" />
+ <linearGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient4024"
+ id="linearGradient3207"
+ x1="546.12756"
+ y1="554.87079"
+ x2="736.12756"
+ y2="554.87079"
+ gradientUnits="userSpaceOnUse" />
+ <linearGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient4024"
+ id="linearGradient3210"
+ gradientUnits="userSpaceOnUse"
+ x1="546.12756"
+ y1="554.87079"
+ x2="736.12756"
+ y2="554.87079" />
+ </defs>
+ <sodipodi:namedview
+ id="base"
+ pagecolor="#ffffff"
+ bordercolor="#666666"
+ borderopacity="1.0"
+ inkscape:pageopacity="0.0"
+ inkscape:pageshadow="2"
+ inkscape:zoom="0.98994949"
+ inkscape:cx="706.89916"
+ inkscape:cy="51.63157"
+ inkscape:document-units="px"
+ inkscape:current-layer="layer1"
+ showgrid="false"
+ inkscape:window-width="2558"
+ inkscape:window-height="1379"
+ inkscape:window-x="2560"
+ inkscape:window-y="27"
+ inkscape:window-maximized="1"
+ fit-margin-top="0"
+ fit-margin-left="0"
+ fit-margin-right="0"
+ fit-margin-bottom="0"
+ showguides="true"
+ inkscape:guide-bbox="true" />
+ <metadata
+ id="metadata7">
+ <rdf:RDF>
+ <cc:Work
+ rdf:about="">
+ <dc:format>image/svg+xml</dc:format>
+ <dc:type
+ rdf:resource="http://purl.org/dc/dcmitype/StillImage" />
+ <dc:title />
+ </cc:Work>
+ </rdf:RDF>
+ </metadata>
+ <g
+ inkscape:label="Layer 1"
+ inkscape:groupmode="layer"
+ id="layer1"
+ transform="translate(225.30099,-308.80528)">
+ <g
+ id="0tank_hit0"
+ inkscape:label="#g4051">
+ <g
+ inkscape:tile-y0="3.1002866"
+ inkscape:tile-x0="33.364892"
+ inkscape:tile-h="62.01872"
+ inkscape:tile-w="98.018719"
+ inkscape:tile-cy="34.109646"
+ inkscape:tile-cx="82.374251"
+ style="stroke:#000000;stroke-width:3.88934855;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ transform="matrix(0,0.52030001,-0.50822079,0,513.48903,211.52973)"
+ inkscape:label="#g3757"
+ id="0tank">
+ <rect
+ style="fill:#4a4a4a;fill-opacity:1;stroke:#000000;stroke-width:3.88934855;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ id="rect2985"
+ width="119.198"
+ height="192.86641"
+ x="188.89853"
+ y="354.48859" />
+ <rect
+ y="395.07166"
+ x="214.06789"
+ height="152.28334"
+ width="68.859299"
+ id="rect3755"
+ style="fill:#383838;fill-opacity:1;stroke:#000000;stroke-width:3.88934855;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none" />
+ </g>
+ </g>
+ <g
+ id="0turret"
+ inkscape:label="#g3769"
+ transform="matrix(0,0.5190835,-0.5190835,0,494.10916,184.75488)"
+ style="stroke:#000000;stroke-width:3.85294461;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none">
+ <rect
+ y="320.93359"
+ x="456.42859"
+ height="102.14286"
+ width="8.5714283"
+ id="rect3763"
+ style="fill:#383838;fill-opacity:1;stroke:#000000;stroke-width:4.81618083;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none" />
+ <path
+ transform="matrix(1.4059702,0,0,1.4059702,-139.83581,-163.85023)"
+ d="m 456.42857,438.79074 c 0,16.17405 -13.11166,29.28572 -29.28572,29.28572 -16.17405,0 -29.28571,-13.11167 -29.28571,-29.28572 0,-16.17405 13.11166,-29.28571 29.28571,-29.28571 16.17406,0 29.28572,13.11166 29.28572,29.28571 z"
+ sodipodi:ry="29.285715"
+ sodipodi:rx="29.285715"
+ sodipodi:cy="438.79074"
+ sodipodi:cx="427.14285"
+ id="path3761"
+ style="fill:#383838;fill-opacity:1;stroke:#000000;stroke-width:3.42552127;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ sodipodi:type="arc" />
+ <rect
+ y="309.50504"
+ x="453.21432"
+ height="23.571428"
+ width="15"
+ id="rect3765"
+ style="fill:#383838;fill-opacity:1;stroke:#000000;stroke-width:4.81618083;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none" />
+ <path
+ sodipodi:type="arc"
+ style="opacity:0;fill:#383838;fill-opacity:1;stroke:#000000;stroke-width:1.70015218;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ id="path3767"
+ sodipodi:cx="427.14285"
+ sodipodi:cy="438.79074"
+ sodipodi:rx="29.285715"
+ sodipodi:ry="29.285715"
+ d="m 456.42857,438.79074 c 0,16.17405 -13.11166,29.28572 -29.28572,29.28572 -16.17405,0 -29.28571,-13.11167 -29.28571,-29.28572 0,-16.17405 13.11166,-29.28571 29.28571,-29.28571 16.17406,0 29.28572,13.11166 29.28572,29.28571 z"
+ transform="matrix(1.5854423,0,0,5.0615034,-216.49604,-1767.8643)" />
+ </g>
+ <g
+ id="0splash"
+ inkscape:label="#g3762"
+ transform="translate(-46.972093,-37.778134)">
+ <use
+ height="285.1698"
+ width="301.58823"
+ transform="matrix(0.96592583,0.25881905,-0.25881905,0.96592583,141.29987,270.09432)"
+ id="use2990"
+ xlink:href="#0tank"
+ y="0"
+ x="0" />
+ <use
+ height="285.1698"
+ width="301.58823"
+ transform="translate(69.801501,249.32226)"
+ id="use2992"
+ xlink:href="#0turret"
+ y="0"
+ x="0" />
+ <text
+ sodipodi:linespacing="125%"
+ id="text2994"
+ y="644.93927"
+ x="244.55299"
+ style="font-size:52.50814056px;font-style:normal;font-weight:normal;line-height:125%;letter-spacing:0px;word-spacing:0px;fill:#e6e6e6;fill-opacity:1;stroke:none;font-family:Sans"
+ xml:space="preserve"><tspan
+ style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;fill:#e6e6e6;fill-opacity:1;font-family:Armalite Rifle;-inkscape-font-specification:Armalite Rifle"
+ y="644.93927"
+ x="244.55299"
+ id="tspan2996"
+ sodipodi:role="line">TINKS!</tspan></text>
+ </g>
+ <g
+ id="0blast"
+ transform="matrix(0.87926197,-0.47633853,0.47633853,0.87926197,-154.11696,190.35652)"
+ inkscape:label="#g3817"
+ style="opacity:0.58260869">
+ <path
+ inkscape:transform-center-x="-19.285714"
+ sodipodi:nodetypes="ssscs"
+ inkscape:connector-curvature="0"
+ id="path3768"
+ d="m 456.28998,448.19275 c -17.85254,0 -21.96774,-5.23151 -21.96774,-11.68489 0,-6.45338 4.1152,-11.68489 21.96774,-11.68489 17.85254,0 47.32488,5.23151 47.32488,11.68489 0,6.45338 -29.47234,11.68489 -47.32488,11.68489 z"
+ style="fill:url(#radialGradient3829);fill-opacity:1;stroke:none" />
+ <path
+ inkscape:transform-center-y="18.415015"
+ style="fill:url(#radialGradient3831);fill-opacity:1;stroke:none"
+ d="m 434.61303,443.5591 c -4.62058,-17.24423 -0.0918,-22.71807 6.80847,-24.56701 6.90032,-1.84893 13.55924,0.62719 18.17982,17.87142 4.62057,17.24422 6.65475,47.21118 -0.24557,49.06011 -6.90032,1.84894 -20.12215,-25.12029 -24.74272,-42.36452 z"
+ id="path3779"
+ inkscape:connector-curvature="0"
+ sodipodi:nodetypes="ssscs"
+ inkscape:transform-center-x="-2.8825555" />
+ <path
+ inkscape:transform-center-x="11.32163"
+ sodipodi:nodetypes="ssscs"
+ inkscape:connector-curvature="0"
+ id="path3783"
+ d="m 432.41411,433.04167 c 11.61247,-11.86526 18.05624,-10.75133 22.70297,-6.00346 4.64675,4.7479 5.7369,11.33193 -5.87556,23.19719 -11.61246,11.86525 -34.55016,27.60438 -39.19691,22.85648 -4.64676,-4.74792 10.75703,-28.18495 22.3695,-40.05021 z"
+ style="fill:url(#radialGradient3833);fill-opacity:1;stroke:none"
+ inkscape:transform-center-y="11.568106" />
+ <path
+ inkscape:transform-center-y="-4.6850987"
+ style="fill:url(#radialGradient3835);fill-opacity:1;stroke:none"
+ d="m 446.39826,420.37258 c 16.31397,5.94501 17.72256,11.65474 14.82136,17.0075 -2.90124,5.35278 -9.01372,8.32169 -25.32769,2.37668 -16.31396,-5.94502 -40.8944,-20.09882 -37.99316,-25.4516 2.90124,-5.35279 32.18552,0.1224 48.49949,6.06742 z"
+ id="path3787"
+ inkscape:connector-curvature="0"
+ sodipodi:nodetypes="ssscs"
+ inkscape:transform-center-x="17.139753" />
+ <path
+ inkscape:transform-center-x="3.00924"
+ sodipodi:nodetypes="ssscs"
+ inkscape:connector-curvature="0"
+ id="path3791"
+ d="m 452.92826,424.83328 c 4.53826,17.08875 0.71453,22.70369 -5.29261,24.77088 -6.00718,2.06718 -11.92309,-0.19619 -16.46134,-17.28495 -4.53824,-17.08875 -7.16054,-46.97597 -1.15336,-49.04315 6.00719,-2.06719 18.36907,24.46845 22.90731,41.55722 z"
+ style="fill:url(#radialGradient3837);fill-opacity:1;stroke:none"
+ inkscape:transform-center-y="-18.198804" />
+ <path
+ inkscape:transform-center-y="-12.480479"
+ style="fill:url(#radialGradient3839);fill-opacity:1;stroke:none"
+ d="m 460.68351,431.90825 c -9.12627,12.3258 -15.21478,12.19653 -20.13029,8.53222 -4.91549,-3.66431 -6.7966,-9.47604 2.32966,-21.80184 9.12627,-12.32581 28.17742,-29.70367 33.09293,-26.03937 4.9155,3.66431 -6.16604,26.9832 -15.2923,39.30899 z"
+ id="path3797"
+ inkscape:connector-curvature="0"
+ sodipodi:nodetypes="ssscs"
+ inkscape:transform-center-x="-8.4119042" />
+ <path
+ inkscape:transform-center-y="3.1646153"
+ style="fill:url(#radialGradient3841);fill-opacity:1;stroke:none"
+ d="m 439.60198,423.1028 c 13.75888,-4.43765 18.50013,-1.36738 20.4364,3.68175 1.93628,5.04916 0.33438,10.16525 -13.4245,14.60291 -13.75888,4.43765 -38.04278,7.67051 -39.97905,2.62135 -1.93628,-5.04918 19.20826,-16.46836 32.96715,-20.90601 z"
+ id="path3801"
+ inkscape:connector-curvature="0"
+ sodipodi:nodetypes="ssscs"
+ inkscape:transform-center-x="14.589202" />
+ <path
+ inkscape:transform-center-x="-9.326116"
+ sodipodi:nodetypes="ssscs"
+ inkscape:connector-curvature="0"
+ id="path3805"
+ d="m 444.76853,441.48398 c -9.57383,-10.83242 -8.65797,-16.40622 -4.80596,-20.20159 3.85203,-3.7954 9.1816,-4.37519 18.75544,6.45723 9.57382,10.83242 22.25634,31.79221 18.4043,35.5876 -3.85205,3.7954 -22.77995,-11.0108 -32.35378,-21.84324 z"
+ style="fill:url(#radialGradient3843);fill-opacity:1;stroke:none"
+ inkscape:transform-center-y="10.762037" />
+ <path
+ inkscape:transform-center-y="-3.1857099"
+ style="fill:url(#radialGradient3845);fill-opacity:1;stroke:none"
+ d="m 455.1382,438.09057 c -12.66478,4.45711 -17.03499,1.39354 -18.82467,-3.65284 -1.78971,-5.04642 -0.32118,-10.16477 12.3436,-14.62189 12.66477,-4.45709 35.0236,-7.72429 36.81329,-2.67787 1.78969,5.04643 -17.66744,16.4955 -30.33222,20.9526 z"
+ id="path3809"
+ inkscape:connector-curvature="0"
+ sodipodi:nodetypes="ssscs"
+ inkscape:transform-center-x="-13.427262" />
+ <path
+ inkscape:transform-center-x="-0.69416206"
+ sodipodi:nodetypes="ssscs"
+ inkscape:connector-curvature="0"
+ id="path3813"
+ d="m 456.06952,429.49566 c -1.5575,11.02568 -5.92106,13.12748 -10.86081,12.58505 -4.93981,-0.54242 -8.58528,-3.52369 -7.02779,-14.54938 1.55751,-11.02567 8.13326,-28.78799 13.07304,-28.24556 4.9398,0.54244 6.37306,19.1842 4.81556,30.20989 z"
+ style="fill:url(#radialGradient3847);fill-opacity:1;stroke:none"
+ inkscape:transform-center-y="-11.878046" />
+ </g>
+ <g
+ id="0explosion"
+ inkscape:label="#g3913"
+ transform="translate(0,-8.5862966)">
+ <g
+ style="fill:#fafbc0;fill-opacity:1"
+ id="g3849"
+ transform="matrix(1.0442033,-0.56569519,0.56569519,1.0442033,-270.03957,283.29403)"
+ inkscape:label="#g3817">
+ <path
+ inkscape:transform-center-x="-19.285714"
+ sodipodi:nodetypes="ssscs"
+ inkscape:connector-curvature="0"
+ id="path3851"
+ d="m 456.28998,448.19275 c -17.85254,0 -21.96774,-5.23151 -21.96774,-11.68489 0,-6.45338 4.1152,-11.68489 21.96774,-11.68489 17.85254,0 47.32488,5.23151 47.32488,11.68489 0,6.45338 -29.47234,11.68489 -47.32488,11.68489 z"
+ style="fill:#fafbc0;fill-opacity:1;stroke:none" />
+ <path
+ inkscape:transform-center-y="18.415015"
+ style="fill:#fafbc0;fill-opacity:1;stroke:none"
+ d="m 434.61303,443.5591 c -4.62058,-17.24423 -0.0918,-22.71807 6.80847,-24.56701 6.90032,-1.84893 13.55924,0.62719 18.17982,17.87142 4.62057,17.24422 6.65475,47.21118 -0.24557,49.06011 -6.90032,1.84894 -20.12215,-25.12029 -24.74272,-42.36452 z"
+ id="path3853"
+ inkscape:connector-curvature="0"
+ sodipodi:nodetypes="ssscs"
+ inkscape:transform-center-x="-2.8825555" />
+ <path
+ inkscape:transform-center-x="11.32163"
+ sodipodi:nodetypes="ssscs"
+ inkscape:connector-curvature="0"
+ id="path3855"
+ d="m 432.41411,433.04167 c 11.61247,-11.86526 18.05624,-10.75133 22.70297,-6.00346 4.64675,4.7479 5.7369,11.33193 -5.87556,23.19719 -11.61246,11.86525 -34.55016,27.60438 -39.19691,22.85648 -4.64676,-4.74792 10.75703,-28.18495 22.3695,-40.05021 z"
+ style="fill:#fafbc0;fill-opacity:1;stroke:none"
+ inkscape:transform-center-y="11.568106" />
+ <path
+ inkscape:transform-center-y="-4.6850987"
+ style="fill:#fafbc0;fill-opacity:1;stroke:none"
+ d="m 446.39826,420.37258 c 16.31397,5.94501 17.72256,11.65474 14.82136,17.0075 -2.90124,5.35278 -9.01372,8.32169 -25.32769,2.37668 -16.31396,-5.94502 -40.8944,-20.09882 -37.99316,-25.4516 2.90124,-5.35279 32.18552,0.1224 48.49949,6.06742 z"
+ id="path3857"
+ inkscape:connector-curvature="0"
+ sodipodi:nodetypes="ssscs"
+ inkscape:transform-center-x="17.139753" />
+ <path
+ inkscape:transform-center-x="3.00924"
+ sodipodi:nodetypes="ssscs"
+ inkscape:connector-curvature="0"
+ id="path3859"
+ d="m 452.92826,424.83328 c 4.53826,17.08875 0.71453,22.70369 -5.29261,24.77088 -6.00718,2.06718 -11.92309,-0.19619 -16.46134,-17.28495 -4.53824,-17.08875 -7.16054,-46.97597 -1.15336,-49.04315 6.00719,-2.06719 18.36907,24.46845 22.90731,41.55722 z"
+ style="fill:#fafbc0;fill-opacity:1;stroke:none"
+ inkscape:transform-center-y="-18.198804" />
+ <path
+ inkscape:transform-center-y="-12.480479"
+ style="fill:#fafbc0;fill-opacity:1;stroke:none"
+ d="m 460.68351,431.90825 c -9.12627,12.3258 -15.21478,12.19653 -20.13029,8.53222 -4.91549,-3.66431 -6.7966,-9.47604 2.32966,-21.80184 9.12627,-12.32581 28.17742,-29.70367 33.09293,-26.03937 4.9155,3.66431 -6.16604,26.9832 -15.2923,39.30899 z"
+ id="path3861"
+ inkscape:connector-curvature="0"
+ sodipodi:nodetypes="ssscs"
+ inkscape:transform-center-x="-8.4119042" />
+ <path
+ inkscape:transform-center-y="3.1646153"
+ style="fill:#fafbc0;fill-opacity:1;stroke:none"
+ d="m 439.60198,423.1028 c 13.75888,-4.43765 18.50013,-1.36738 20.4364,3.68175 1.93628,5.04916 0.33438,10.16525 -13.4245,14.60291 -13.75888,4.43765 -38.04278,7.67051 -39.97905,2.62135 -1.93628,-5.04918 19.20826,-16.46836 32.96715,-20.90601 z"
+ id="path3863"
+ inkscape:connector-curvature="0"
+ sodipodi:nodetypes="ssscs"
+ inkscape:transform-center-x="14.589202" />
+ <path
+ inkscape:transform-center-x="-9.326116"
+ sodipodi:nodetypes="ssscs"
+ inkscape:connector-curvature="0"
+ id="path3865"
+ d="m 444.76853,441.48398 c -9.57383,-10.83242 -8.65797,-16.40622 -4.80596,-20.20159 3.85203,-3.7954 9.1816,-4.37519 18.75544,6.45723 9.57382,10.83242 22.25634,31.79221 18.4043,35.5876 -3.85205,3.7954 -22.77995,-11.0108 -32.35378,-21.84324 z"
+ style="fill:#fafbc0;fill-opacity:1;stroke:none"
+ inkscape:transform-center-y="10.762037" />
+ <path
+ inkscape:transform-center-y="-3.1857099"
+ style="fill:#fafbc0;fill-opacity:1;stroke:none"
+ d="m 455.1382,438.09057 c -12.66478,4.45711 -17.03499,1.39354 -18.82467,-3.65284 -1.78971,-5.04642 -0.32118,-10.16477 12.3436,-14.62189 12.66477,-4.45709 35.0236,-7.72429 36.81329,-2.67787 1.78969,5.04643 -17.66744,16.4955 -30.33222,20.9526 z"
+ id="path3867"
+ inkscape:connector-curvature="0"
+ sodipodi:nodetypes="ssscs"
+ inkscape:transform-center-x="-13.427262" />
+ <path
+ inkscape:transform-center-x="-0.69416206"
+ sodipodi:nodetypes="ssscs"
+ inkscape:connector-curvature="0"
+ id="path3869"
+ d="m 456.06952,429.49566 c -1.5575,11.02568 -5.92106,13.12748 -10.86081,12.58505 -4.93981,-0.54242 -8.58528,-3.52369 -7.02779,-14.54938 1.55751,-11.02567 8.13326,-28.78799 13.07304,-28.24556 4.9398,0.54244 6.37306,19.1842 4.81556,30.20989 z"
+ style="fill:#fafbc0;fill-opacity:1;stroke:none"
+ inkscape:transform-center-y="-11.878046" />
+ </g>
+ <g
+ inkscape:label="#g3817"
+ transform="matrix(0.5300651,-0.28716178,0.28716178,0.5300651,80.281923,382.46863)"
+ id="g3891"
+ style="fill:#fa6b08;fill-opacity:1">
+ <path
+ style="fill:#fa6b08;fill-opacity:1;stroke:none"
+ d="m 456.28998,448.19275 c -17.85254,0 -21.96774,-5.23151 -21.96774,-11.68489 0,-6.45338 4.1152,-11.68489 21.96774,-11.68489 17.85254,0 47.32488,5.23151 47.32488,11.68489 0,6.45338 -29.47234,11.68489 -47.32488,11.68489 z"
+ id="path3893"
+ inkscape:connector-curvature="0"
+ sodipodi:nodetypes="ssscs"
+ inkscape:transform-center-x="-19.285714" />
+ <path
+ inkscape:transform-center-x="-2.8825555"
+ sodipodi:nodetypes="ssscs"
+ inkscape:connector-curvature="0"
+ id="path3895"
+ d="m 434.61303,443.5591 c -4.62058,-17.24423 -0.0918,-22.71807 6.80847,-24.56701 6.90032,-1.84893 13.55924,0.62719 18.17982,17.87142 4.62057,17.24422 6.65475,47.21118 -0.24557,49.06011 -6.90032,1.84894 -20.12215,-25.12029 -24.74272,-42.36452 z"
+ style="fill:#fa6b08;fill-opacity:1;stroke:none"
+ inkscape:transform-center-y="18.415015" />
+ <path
+ inkscape:transform-center-y="11.568106"
+ style="fill:#fa6b08;fill-opacity:1;stroke:none"
+ d="m 432.41411,433.04167 c 11.61247,-11.86526 18.05624,-10.75133 22.70297,-6.00346 4.64675,4.7479 5.7369,11.33193 -5.87556,23.19719 -11.61246,11.86525 -34.55016,27.60438 -39.19691,22.85648 -4.64676,-4.74792 10.75703,-28.18495 22.3695,-40.05021 z"
+ id="path3897"
+ inkscape:connector-curvature="0"
+ sodipodi:nodetypes="ssscs"
+ inkscape:transform-center-x="11.32163" />
+ <path
+ inkscape:transform-center-x="17.139753"
+ sodipodi:nodetypes="ssscs"
+ inkscape:connector-curvature="0"
+ id="path3899"
+ d="m 446.39826,420.37258 c 16.31397,5.94501 17.72256,11.65474 14.82136,17.0075 -2.90124,5.35278 -9.01372,8.32169 -25.32769,2.37668 -16.31396,-5.94502 -40.8944,-20.09882 -37.99316,-25.4516 2.90124,-5.35279 32.18552,0.1224 48.49949,6.06742 z"
+ style="fill:#fa6b08;fill-opacity:1;stroke:none"
+ inkscape:transform-center-y="-4.6850987" />
+ <path
+ inkscape:transform-center-y="-18.198804"
+ style="fill:#fa6b08;fill-opacity:1;stroke:none"
+ d="m 452.92826,424.83328 c 4.53826,17.08875 0.71453,22.70369 -5.29261,24.77088 -6.00718,2.06718 -11.92309,-0.19619 -16.46134,-17.28495 -4.53824,-17.08875 -7.16054,-46.97597 -1.15336,-49.04315 6.00719,-2.06719 18.36907,24.46845 22.90731,41.55722 z"
+ id="path3901"
+ inkscape:connector-curvature="0"
+ sodipodi:nodetypes="ssscs"
+ inkscape:transform-center-x="3.00924" />
+ <path
+ inkscape:transform-center-x="-8.4119042"
+ sodipodi:nodetypes="ssscs"
+ inkscape:connector-curvature="0"
+ id="path3903"
+ d="m 460.68351,431.90825 c -9.12627,12.3258 -15.21478,12.19653 -20.13029,8.53222 -4.91549,-3.66431 -6.7966,-9.47604 2.32966,-21.80184 9.12627,-12.32581 28.17742,-29.70367 33.09293,-26.03937 4.9155,3.66431 -6.16604,26.9832 -15.2923,39.30899 z"
+ style="fill:#fa6b08;fill-opacity:1;stroke:none"
+ inkscape:transform-center-y="-12.480479" />
+ <path
+ inkscape:transform-center-x="14.589202"
+ sodipodi:nodetypes="ssscs"
+ inkscape:connector-curvature="0"
+ id="path3905"
+ d="m 439.60198,423.1028 c 13.75888,-4.43765 18.50013,-1.36738 20.4364,3.68175 1.93628,5.04916 0.33438,10.16525 -13.4245,14.60291 -13.75888,4.43765 -38.04278,7.67051 -39.97905,2.62135 -1.93628,-5.04918 19.20826,-16.46836 32.96715,-20.90601 z"
+ style="fill:#fa6b08;fill-opacity:1;stroke:none"
+ inkscape:transform-center-y="3.1646153" />
+ <path
+ inkscape:transform-center-y="10.762037"
+ style="fill:#fa6b08;fill-opacity:1;stroke:none"
+ d="m 444.76853,441.48398 c -9.57383,-10.83242 -8.65797,-16.40622 -4.80596,-20.20159 3.85203,-3.7954 9.1816,-4.37519 18.75544,6.45723 9.57382,10.83242 22.25634,31.79221 18.4043,35.5876 -3.85205,3.7954 -22.77995,-11.0108 -32.35378,-21.84324 z"
+ id="path3907"
+ inkscape:connector-curvature="0"
+ sodipodi:nodetypes="ssscs"
+ inkscape:transform-center-x="-9.326116" />
+ <path
+ inkscape:transform-center-x="-13.427262"
+ sodipodi:nodetypes="ssscs"
+ inkscape:connector-curvature="0"
+ id="path3909"
+ d="m 455.1382,438.09057 c -12.66478,4.45711 -17.03499,1.39354 -18.82467,-3.65284 -1.78971,-5.04642 -0.32118,-10.16477 12.3436,-14.62189 12.66477,-4.45709 35.0236,-7.72429 36.81329,-2.67787 1.78969,5.04643 -17.66744,16.4955 -30.33222,20.9526 z"
+ style="fill:#fa6b08;fill-opacity:1;stroke:none"
+ inkscape:transform-center-y="-3.1857099" />
+ <path
+ inkscape:transform-center-y="-11.878046"
+ style="fill:#fa6b08;fill-opacity:1;stroke:none"
+ d="m 456.06952,429.49566 c -1.5575,11.02568 -5.92106,13.12748 -10.86081,12.58505 -4.93981,-0.54242 -8.58528,-3.52369 -7.02779,-14.54938 1.55751,-11.02567 8.13326,-28.78799 13.07304,-28.24556 4.9398,0.54244 6.37306,19.1842 4.81556,30.20989 z"
+ id="path3911"
+ inkscape:connector-curvature="0"
+ sodipodi:nodetypes="ssscs"
+ inkscape:transform-center-x="-0.69416206" />
+ </g>
+ </g>
+ <g
+ id="0trees0"
+ inkscape:label="#g3941"
+ transform="matrix(1.107328,0,0,1.1095558,-38.012453,-58.538853)"
+ style="fill:#006700;fill-opacity:1;stroke-width:2.25541931;stroke-miterlimit:4;stroke-dasharray:none;stroke:#000000;stroke-opacity:1">
+ <path
+ sodipodi:type="arc"
+ style="fill:#006700;fill-opacity:1;stroke:#000000;stroke-width:4.13688339;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ id="path3048"
+ sodipodi:cx="192.43405"
+ sodipodi:cy="260.92615"
+ sodipodi:rx="16.162441"
+ sodipodi:ry="16.162441"
+ d="m 208.59649,260.92615 c 0,8.92627 -7.23617,16.16244 -16.16244,16.16244 -8.92627,0 -16.16244,-7.23617 -16.16244,-16.16244 0,-8.92627 7.23617,-16.16244 16.16244,-16.16244 8.92627,0 16.16244,7.23617 16.16244,16.16244 z"
+ transform="matrix(0.5451977,0,0,0.5451977,291.97568,422.78751)" />
+ <path
+ transform="matrix(0.68940331,0,0,0.68940331,266.90724,398.15942)"
+ d="m 208.59649,260.92615 c 0,8.92627 -7.23617,16.16244 -16.16244,16.16244 -8.92627,0 -16.16244,-7.23617 -16.16244,-16.16244 0,-8.92627 7.23617,-16.16244 16.16244,-16.16244 8.92627,0 16.16244,7.23617 16.16244,16.16244 z"
+ sodipodi:ry="16.162441"
+ sodipodi:rx="16.162441"
+ sodipodi:cy="260.92615"
+ sodipodi:cx="192.43405"
+ id="path3050"
+ style="fill:#006700;fill-opacity:1;stroke:#000000;stroke-width:3.27155277;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ sodipodi:type="arc" />
+ <path
+ sodipodi:type="arc"
+ style="fill:#006700;fill-opacity:1;stroke:#000000;stroke-width:2.86759308;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ id="path3052"
+ sodipodi:cx="192.43405"
+ sodipodi:cy="260.92615"
+ sodipodi:rx="16.162441"
+ sodipodi:ry="16.162441"
+ d="m 208.59649,260.92615 c 0,8.92627 -7.23617,16.16244 -16.16244,16.16244 -8.92627,0 -16.16244,-7.23617 -16.16244,-16.16244 0,-8.92627 7.23617,-16.16244 16.16244,-16.16244 8.92627,0 16.16244,7.23617 16.16244,16.16244 z"
+ transform="matrix(0.78652,0,0,0.78652,256.07519,365.36388)" />
+ </g>
+ <g
+ id="0debris0"
+ inkscape:label="#g3050"
+ transform="matrix(1.1877783,0,0,1.1877783,-69.131812,-104.67586)"
+ style="stroke:#000000;stroke-opacity:1;stroke-width:2.10476989;stroke-miterlimit:4;stroke-dasharray:none">
+ <rect
+ style="fill:#383838;fill-opacity:1;stroke:#000000;stroke-width:2.10476989;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ id="rect3066"
+ width="29.531679"
+ height="29.531681"
+ x="426.64539"
+ y="558.90302" />
+ </g>
+ <path
+ inkscape:label="#path3047"
+ sodipodi:nodetypes="sssssssss"
+ inkscape:connector-curvature="0"
+ id="0rock0"
+ d="m 522.32863,577.10507 c -2.27422,4.40554 -4.35831,9.03612 -6.09035,12.89275 -4.13585,9.20893 -2.62256,6.94931 -13.92781,4.82827 -2.12702,-0.39906 -5.53885,-1.82088 -12.65516,-5.25248 -5.66496,-2.73173 -5.45406,-3.06229 -5.24196,-12.68064 0.10915,-4.95091 5.82107,-3.7086 9.05982,-6.95386 3.23874,-3.24526 3.89516,-10.97927 8.8373,-10.97927 4.94216,0 11.36852,0.85183 12.65518,5.2525 1.586,5.42446 9.62748,8.50603 7.36298,12.89273 z"
+ style="fill:#7f6b41;fill-opacity:1;stroke:#000000;stroke-width:2.5;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none" />
+ <g
+ style="fill:#006700;fill-opacity:1;stroke-width:2.25541931;stroke-miterlimit:4;stroke-dasharray:none;stroke:#000000;stroke-opacity:1"
+ transform="matrix(1.107328,0,0,1.1095558,-38.012453,-10.603516)"
+ inkscape:label="#g3941"
+ id="0trees1">
+ <path
+ sodipodi:type="arc"
+ style="fill:#006700;fill-opacity:1;stroke:#000000;stroke-width:3.75593998;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ id="path3066"
+ sodipodi:cx="192.43405"
+ sodipodi:cy="260.92615"
+ sodipodi:rx="16.162441"
+ sodipodi:ry="16.162441"
+ d="m 208.59649,260.92615 c 0,8.92627 -7.23617,16.16244 -16.16244,16.16244 -8.92627,0 -16.16244,-7.23617 -16.16244,-16.16244 0,-8.92627 7.23617,-16.16244 16.16244,-16.16244 8.92627,0 16.16244,7.23617 16.16244,16.16244 z"
+ transform="matrix(0.60049397,0,0,0.60049397,293.62091,411.22436)" />
+ <path
+ sodipodi:type="arc"
+ style="fill:#006700;fill-opacity:1;stroke:#000000;stroke-width:2.71756777;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ id="path3062"
+ sodipodi:cx="192.43405"
+ sodipodi:cy="260.92615"
+ sodipodi:rx="16.162441"
+ sodipodi:ry="16.162441"
+ d="m 208.59649,260.92615 c 0,8.92627 -7.23617,16.16244 -16.16244,16.16244 -8.92627,0 -16.16244,-7.23617 -16.16244,-16.16244 0,-8.92627 7.23617,-16.16244 16.16244,-16.16244 8.92627,0 16.16244,7.23617 16.16244,16.16244 z"
+ transform="matrix(0.82994041,0,0,0.82994041,241.49806,357.05217)" />
+ <path
+ transform="matrix(0.47243244,0,0,0.47243244,315.3327,456.40843)"
+ d="m 208.59649,260.92615 c 0,8.92627 -7.23617,16.16244 -16.16244,16.16244 -8.92627,0 -16.16244,-7.23617 -16.16244,-16.16244 0,-8.92627 7.23617,-16.16244 16.16244,-16.16244 8.92627,0 16.16244,7.23617 16.16244,16.16244 z"
+ sodipodi:ry="16.162441"
+ sodipodi:rx="16.162441"
+ sodipodi:cy="260.92615"
+ sodipodi:cx="192.43405"
+ id="path3080"
+ style="fill:#006700;fill-opacity:1;stroke:#000000;stroke-width:4.77405681;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ sodipodi:type="arc" />
+ <path
+ transform="matrix(0.5451977,0,0,0.5451977,290.35037,425.76127)"
+ d="m 208.59649,260.92615 c 0,8.92627 -7.23617,16.16244 -16.16244,16.16244 -8.92627,0 -16.16244,-7.23617 -16.16244,-16.16244 0,-8.92627 7.23617,-16.16244 16.16244,-16.16244 8.92627,0 16.16244,7.23617 16.16244,16.16244 z"
+ sodipodi:ry="16.162441"
+ sodipodi:rx="16.162441"
+ sodipodi:cy="260.92615"
+ sodipodi:cx="192.43405"
+ id="path3060"
+ style="fill:#006700;fill-opacity:1;stroke:#000000;stroke-width:4.13688339;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ sodipodi:type="arc" />
+ </g>
+ <g
+ id="0trees2"
+ inkscape:label="#g3941"
+ transform="matrix(1.107328,0,0,1.1095558,-38.012453,34.362374)"
+ style="fill:#006700;fill-opacity:1;stroke-width:2.25541931;stroke-miterlimit:4;stroke-dasharray:none;stroke:#000000;stroke-opacity:1">
+ <path
+ sodipodi:type="arc"
+ style="fill:#006700;fill-opacity:1;stroke:#000000;stroke-width:2.66417172;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ id="path3076"
+ sodipodi:cx="192.43405"
+ sodipodi:cy="260.92615"
+ sodipodi:rx="16.162441"
+ sodipodi:ry="16.162441"
+ d="m 208.59649,260.92615 c 0,8.92627 -7.23617,16.16244 -16.16244,16.16244 -8.92627,0 -16.16244,-7.23617 -16.16244,-16.16244 0,-8.92627 7.23617,-16.16244 16.16244,-16.16244 8.92627,0 16.16244,7.23617 16.16244,16.16244 z"
+ transform="matrix(0.8465743,0,0,0.8465743,238.7901,354.32672)" />
+ <path
+ transform="matrix(0.55580797,0,0,0.55580797,295.32041,436.67318)"
+ d="m 208.59649,260.92615 c 0,8.92627 -7.23617,16.16244 -16.16244,16.16244 -8.92627,0 -16.16244,-7.23617 -16.16244,-16.16244 0,-8.92627 7.23617,-16.16244 16.16244,-16.16244 8.92627,0 16.16244,7.23617 16.16244,16.16244 z"
+ sodipodi:ry="16.162441"
+ sodipodi:rx="16.162441"
+ sodipodi:cy="260.92615"
+ sodipodi:cx="192.43405"
+ id="path3074"
+ style="fill:#006700;fill-opacity:1;stroke:#000000;stroke-width:4.05791106;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ sodipodi:type="arc" />
+ <path
+ transform="matrix(0.49018786,0,0,0.49018786,315.12079,441.00333)"
+ d="m 208.59649,260.92615 c 0,8.92627 -7.23617,16.16244 -16.16244,16.16244 -8.92627,0 -16.16244,-7.23617 -16.16244,-16.16244 0,-8.92627 7.23617,-16.16244 16.16244,-16.16244 8.92627,0 16.16244,7.23617 16.16244,16.16244 z"
+ sodipodi:ry="16.162441"
+ sodipodi:rx="16.162441"
+ sodipodi:cy="260.92615"
+ sodipodi:cx="192.43405"
+ id="path3082"
+ style="fill:#006700;fill-opacity:1;stroke:#000000;stroke-width:4.60113253;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ sodipodi:type="arc" />
+ <path
+ transform="matrix(0.58738416,0,0,0.58738416,284.26157,422.44023)"
+ d="m 208.59649,260.92615 c 0,8.92627 -7.23617,16.16244 -16.16244,16.16244 -8.92627,0 -16.16244,-7.23617 -16.16244,-16.16244 0,-8.92627 7.23617,-16.16244 16.16244,-16.16244 8.92627,0 16.16244,7.23617 16.16244,16.16244 z"
+ sodipodi:ry="16.162441"
+ sodipodi:rx="16.162441"
+ sodipodi:cy="260.92615"
+ sodipodi:cx="192.43405"
+ id="path3078"
+ style="fill:#006700;fill-opacity:1;stroke:#000000;stroke-width:3.83976869;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ sodipodi:type="arc" />
+ </g>
+ <path
+ style="fill:#6b5830;fill-opacity:1;stroke:#000000;stroke-width:2.5;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ d="m 522.32863,625.04041 c -2.27422,4.40554 -4.35831,9.03612 -6.09035,12.89273 -4.13585,9.20895 -2.62256,6.94933 -13.92781,4.82829 -2.12702,-0.39906 -5.53885,-1.82089 -12.65516,-5.25249 -5.66496,-2.73173 -5.45406,-3.06228 -5.24196,-12.68063 0.10915,-4.95091 5.82107,-3.7086 9.05982,-6.95386 3.23874,-3.24526 3.89516,-10.97928 8.8373,-10.97928 4.94216,0 11.36852,0.85184 12.65518,5.2525 1.586,5.42446 9.62748,8.50604 7.36298,12.89274 z"
+ id="0rock1"
+ inkscape:connector-curvature="0"
+ sodipodi:nodetypes="sssssssss"
+ inkscape:label="#path3047" />
+ <path
+ inkscape:label="#path3047"
+ sodipodi:nodetypes="sssssssss"
+ inkscape:connector-curvature="0"
+ id="0rock2"
+ d="m 522.32863,675.94518 c -2.27422,4.40555 -4.35831,9.03613 -6.09035,12.89275 -4.13585,9.20893 -2.62256,6.94932 -13.92781,4.82828 -2.12702,-0.39905 -5.53885,-1.82089 -12.65516,-5.25248 -5.66496,-2.73174 -5.45406,-3.06228 -5.24196,-12.68065 0.10915,-4.9509 5.82107,-3.7086 9.05982,-6.95386 3.23874,-3.24525 3.89516,-10.97927 8.8373,-10.97927 4.94216,0 11.36852,0.85184 12.65518,5.2525 1.586,5.42446 9.62748,8.50604 7.36298,12.89273 z"
+ style="fill:#686358;fill-opacity:1;stroke:#000000;stroke-width:2.5;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none" />
+ <g
+ inkscape:label="#g3050"
+ id="0debris1"
+ transform="matrix(1.1877783,0,0,1.1877783,-69.131812,-56.740523)"
+ style="stroke:#000000;stroke-opacity:1;stroke-width:2.10476989;stroke-miterlimit:4;stroke-dasharray:none">
+ <rect
+ y="558.90302"
+ x="426.64539"
+ height="29.531681"
+ width="29.531679"
+ id="rect3070"
+ style="fill:#4a4a4a;fill-opacity:1;stroke:#000000;stroke-width:2.10476989;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none" />
+ </g>
+ <g
+ transform="matrix(1.1877783,0,0,1.1877783,-69.131812,-7.1083607)"
+ id="0debris5"
+ inkscape:label="#g3050"
+ style="stroke:#000000;stroke-opacity:1;stroke-width:2.10476989;stroke-miterlimit:4;stroke-dasharray:none">
+ <rect
+ style="fill:#4a4a4a;fill-opacity:1;stroke:#000000;stroke-width:2.10476989;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ id="rect3074"
+ width="29.531679"
+ height="29.531681"
+ x="426.64539"
+ y="558.90302" />
+ <rect
+ y="569.69788"
+ x="437.44034"
+ height="14.370327"
+ width="14.370327"
+ id="rect3087"
+ style="fill:#383838;fill-opacity:1;stroke:#000000;stroke-width:2.10476989;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none" />
+ </g>
+ <g
+ style="stroke:#000000;stroke-width:3.85294461;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ transform="matrix(0,0.5190835,-0.5190835,0,66.89581,389.68202)"
+ inkscape:label="#g3757"
+ id="0stencils0">
+ <rect
+ style="opacity:0;fill:#4a4a4a;fill-opacity:1;stroke:#000000;stroke-width:3.85294461;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ id="rect3068"
+ width="119.198"
+ height="192.86641"
+ x="188.89853"
+ y="354.48859" />
+ <path
+ sodipodi:type="star"
+ style="opacity:0.8;fill:#e6e6e6;fill-opacity:1;stroke:none;filter:url(#filter3843)"
+ id="path3073"
+ sodipodi:sides="5"
+ sodipodi:cx="113.57143"
+ sodipodi:cy="-49.473057"
+ sodipodi:r1="10.714286"
+ sodipodi:r2="5.4156551"
+ sodipodi:arg1="3.1415927"
+ sodipodi:arg2="3.7699112"
+ inkscape:flatsided="false"
+ inkscape:rounded="0"
+ inkscape:randomized="0"
+ d="m 102.85714,-49.473057 6.33293,-3.183242 1.07046,-7.006649 4.98443,5.039297 6.99451,-1.147105 -3.25239,6.297699 3.25239,6.2977 -6.99451,-1.147106 -4.98443,5.039297 -1.07046,-7.006649 z"
+ transform="matrix(0,-1.7122825,1.9264723,0,343.806,568.95452)"
+ inkscape:transform-center-x="2.3547626" />
+ </g>
+ <g
+ id="0stencils1"
+ inkscape:label="#g3757"
+ transform="matrix(0,0.5190835,-0.5190835,0,66.89581,307.53917)"
+ style="stroke:#000000;stroke-width:3.85294461;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none">
+ <rect
+ y="354.48859"
+ x="188.89853"
+ height="192.86641"
+ width="119.198"
+ id="rect3849"
+ style="opacity:0;fill:#4a4a4a;fill-opacity:1;stroke:#000000;stroke-width:3.85294461;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none" />
+ <g
+ id="0rank1"
+ inkscape:label="#g6067"
+ transform="matrix(-5.3663884,0,0,-5.3663884,7637.5456,5491.7226)"
+ style="opacity:0.8;fill:#e6e6e6;fill-opacity:1;stroke:none;filter:url(#filter3884)">
+ <path
+ transform="translate(1216.3469,585.24088)"
+ id="rect6039"
+ d="m 160.6875,366.40625 -1.03125,1.03125 -2.28125,2.28125 1.03125,1.03125 2.28125,-2.28125 2.28125,2.28125 1.03125,-1.03125 -2.28125,-2.28125 -1.03125,-1.03125 z"
+ style="fill:#e6e6e6;fill-opacity:1;stroke:none"
+ inkscape:connector-curvature="0" />
+ </g>
+ </g>
+ <g
+ style="stroke:#000000;stroke-width:3.85294461;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ transform="matrix(0,0.5190835,-0.5190835,0,494.10916,272.51921)"
+ inkscape:label="#g3769"
+ id="0turret_firing">
+ <path
+ transform="matrix(1.6736524,0,0,7.1213515,-254.17437,-2670.495)"
+ d="m 456.42857,438.79074 c 0,16.17405 -13.11166,29.28572 -29.28572,29.28572 -16.17405,0 -29.28571,-13.11167 -29.28571,-29.28572 0,-16.17405 13.11166,-29.28571 29.28571,-29.28571 16.17406,0 29.28572,13.11166 29.28572,29.28571 z"
+ sodipodi:ry="29.285715"
+ sodipodi:rx="29.285715"
+ sodipodi:cy="438.79074"
+ sodipodi:cx="427.14285"
+ id="path3091"
+ style="opacity:0;fill:#383838;fill-opacity:1;stroke:#000000;stroke-width:1.44432509;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ sodipodi:type="arc" />
+ <path
+ style="fill:#fafbc0;fill-opacity:1;stroke:none"
+ d="m 438.26325,288.72302 c 0.41837,4.37732 5.50796,11.30306 10.90648,16.88461 -0.25983,0.65035 -0.49903,1.31016 -0.75455,1.96861 l 25.44845,0 c -0.25422,-0.57656 -0.49719,-1.17403 -0.75454,-1.74147 3.4551,-3.76097 6.10502,-7.88649 5.89911,-10.82734 -0.19557,-2.79317 -2.9234,-3.9582 -6.37926,-4.01294 4.00364,-10.83931 7.18191,-22.34834 5.89909,-26.12192 -1.45131,-4.26927 -8.1456,2.60608 -13.99321,11.20593 -1.71977,-15.34214 -4.63923,-31.49388 -6.85941,-30.58915 -2.00097,0.81541 -2.82451,15.3025 -2.81237,29.83199 -2.5852,-5.3196 -4.86211,-8.77539 -5.83051,-7.2687 -1.08387,1.68633 -0.24761,9.25263 1.37189,17.71748 -6.0332,-2.08817 -11.9033,-2.2095 -12.14117,2.12003 -0.0148,0.26809 -0.028,0.54106 0,0.83287 z"
+ id="path3851-7"
+ inkscape:connector-curvature="0" />
+ <path
+ style="fill:#fa6b08;fill-opacity:1;stroke:none"
+ d="m 449.23831,294.62885 c 0.34521,2.22647 2.84224,5.58903 5.48755,8.32873 -0.61198,1.5313 -1.18627,3.07651 -1.71486,4.61866 l 15.84525,0 c -0.58292,-1.49879 -1.26103,-3.01116 -1.92063,-4.46724 1.7567,-1.91079 3.05418,-4.03276 2.94955,-5.52724 -0.0978,-1.39845 -1.43525,-2.00161 -3.15533,-2.04432 2.01726,-5.47754 3.5974,-11.26878 2.94954,-13.17454 -0.73919,-2.17446 -4.1583,1.29255 -7.13378,5.67868 -0.87263,-7.79496 -2.30157,-16.05716 -3.42972,-15.59743 -1.01927,0.41535 -1.44983,7.8932 -1.44047,15.29456 -1.33387,-2.76476 -2.51973,-4.56123 -3.01815,-3.78578 -0.552,0.85885 -0.073,4.69595 0.75453,9.01017 -3.07874,-1.07555 -6.05212,-1.14882 -6.17348,1.06002 -0.0113,0.20061 -0.0351,0.37914 0,0.60573 z"
+ id="path3893-0"
+ inkscape:connector-curvature="0" />
+ </g>
+ <g
+ id="0red_dot"
+ inkscape:label="#g3090">
+ <path
+ transform="translate(201.94695,306.71335)"
+ d="m 169.45309,9.1456165 c 0,1.3947295 -1.13066,2.5253815 -2.52539,2.5253815 -1.39473,0 -2.52538,-1.130652 -2.52538,-2.5253815 0,-1.3947296 1.13065,-2.5253813 2.52538,-2.5253813 1.39473,0 2.52539,1.1306517 2.52539,2.5253813 z"
+ sodipodi:ry="2.5253813"
+ sodipodi:rx="2.5253813"
+ sodipodi:cy="9.1456165"
+ sodipodi:cx="166.9277"
+ id="path3088"
+ style="fill:#ff2a2a;fill-opacity:1;stroke:none"
+ sodipodi:type="arc" />
+ </g>
+ <g
+ id="0stencils2"
+ inkscape:label="#g3757"
+ transform="matrix(0,0.5190835,-0.5190835,0,192.6598,389.68202)"
+ style="stroke:#000000;stroke-width:3.85294461;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none">
+ <rect
+ y="354.48859"
+ x="188.89853"
+ height="192.86641"
+ width="119.198"
+ id="rect3100"
+ style="opacity:0;fill:#4a4a4a;fill-opacity:1;stroke:#000000;stroke-width:3.85294461;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none" />
+ <text
+ xml:space="preserve"
+ style="font-size:32.52328873px;font-style:normal;font-weight:normal;line-height:125%;letter-spacing:2.06132531px;word-spacing:0px;opacity:0.8;fill:#e6e6e6;fill-opacity:1;stroke:none;font-family:Sans"
+ x="-277.52396"
+ y="-362.40561"
+ id="text3112"
+ sodipodi:linespacing="125%"
+ transform="scale(-1,-1)"><tspan
+ sodipodi:role="line"
+ id="tspan3114"
+ x="-277.52396"
+ y="-362.40561"
+ style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;letter-spacing:2.06132531px;fill:#e6e6e6;fill-opacity:1;font-family:Armalite Rifle;-inkscape-font-specification:Armalite Rifle">Nit</tspan></text>
+ </g>
+ <g
+ style="stroke:#000000;stroke-width:3.85294461;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ transform="matrix(0,0.5190835,-0.5190835,0,192.6598,308.11221)"
+ inkscape:label="#g3757"
+ id="0stencils3">
+ <rect
+ style="opacity:0;fill:#4a4a4a;fill-opacity:1;stroke:#000000;stroke-width:3.85294461;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ id="rect3118"
+ width="119.198"
+ height="192.86641"
+ x="188.89853"
+ y="354.48859" />
+ <text
+ transform="scale(-1,-1)"
+ sodipodi:linespacing="125%"
+ id="text3120"
+ y="-361.26242"
+ x="-270.396"
+ style="font-size:34.82661438px;font-style:normal;font-weight:normal;line-height:125%;letter-spacing:3.98779774px;word-spacing:0px;opacity:0.8;fill:#e6e6e6;fill-opacity:1;stroke:none;font-family:Sans"
+ xml:space="preserve"><tspan
+ style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;letter-spacing:3.98779774px;fill:#e6e6e6;fill-opacity:1;font-family:Armalite Rifle;-inkscape-font-specification:Armalite Rifle"
+ y="-361.26242"
+ x="-270.396"
+ id="tspan3122"
+ sodipodi:role="line">Xy</tspan></text>
+ </g>
+ <g
+ id="0arrow"
+ inkscape:label="#g3119"
+ transform="translate(-472.75139,179.80715)">
+ <g
+ id="g3107"
+ inkscape:label="#g4191"
+ transform="matrix(0,-4.7070559,-4.2935135,0,5263.6203,6128.1984)"
+ style="fill:#4a4a4a;fill-opacity:1;stroke-width:0.55521804;stroke-miterlimit:4;stroke-dasharray:none">
+ <path
+ inkscape:connector-curvature="0"
+ id="path3109"
+ d="m 1246.9007,1077.1272 -5.8563,6.3886 1.914,0 0,3.1124 7.9696,0 0,-3.1124 1.7879,0 z"
+ style="fill:#4a4a4a;fill-opacity:1;stroke:#000000;stroke-width:0.44488618;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0"
+ sodipodi:nodetypes="cccccccc" />
+ </g>
+ <g
+ id="g3111"
+ inkscape:label="#g3757"
+ transform="matrix(0,0.5190835,-0.71132942,0,892.00519,130.07282)"
+ style="stroke:#000000;stroke-width:3.85294461;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none">
+ <rect
+ y="354.48859"
+ x="188.89853"
+ height="192.86641"
+ width="119.198"
+ id="rect3113"
+ style="opacity:0;fill:#4a4a4a;fill-opacity:1;stroke:#000000;stroke-width:3.85294461;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none" />
+ </g>
+ </g>
+ <path
+ style="fill:#e31700;fill-opacity:0.99608059000000004;stroke:#000000;stroke-width:2.5;stroke-linecap:round;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none;stroke-dashoffset:0"
+ d="m 450.80857,732.08502 0,11.57351 -11.57389,0 0,11.85554 11.57389,0 0,11.57336 11.85517,0 0,-11.57336 11.57275,0 0,-11.85554 -11.57275,0 0,-11.57351 -11.85517,0 z"
+ id="0health"
+ inkscape:connector-curvature="0"
+ inkscape:label="#rect5353" />
+ <path
+ sodipodi:type="arc"
+ style="opacity:0.7;fill:url(#radialGradient8208);fill-opacity:1;stroke:none"
+ id="path4174"
+ sodipodi:cx="282.5"
+ sodipodi:cy="1026.8622"
+ sodipodi:rx="53"
+ sodipodi:ry="53"
+ d="m 335.5,1026.8622 c 0,29.2711 -23.72891,53 -53,53 -29.27109,0 -53,-23.7289 -53,-53 0,-29.27111 23.72891,-53.00002 53,-53.00002 29.27109,0 53,23.72891 53,53.00002 z"
+ transform="matrix(2.1732321,0,0,1.2297878,-377.99213,-499.20265)"
+ mask="none" />
+ <g
+ transform="matrix(0.57931372,0,0,0.57931372,135.53919,418.80375)"
+ id="g3930"
+ inkscape:label="#g3050"
+ style="stroke:#000000;stroke-opacity:1;stroke-width:4.31545105;stroke-miterlimit:4;stroke-dasharray:none">
+ <rect
+ style="fill:#4a4a4a;fill-opacity:1;stroke:#000000;stroke-width:4.31545105;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ id="rect3932"
+ width="29.531679"
+ height="29.531681"
+ x="426.64539"
+ y="558.90302" />
+ </g>
+ <path
+ mask="none"
+ transform="matrix(0.3957946,0,0,0.3957946,277.32176,344.71148)"
+ d="m 335.5,1026.8622 c 0,29.2711 -23.72891,53 -53,53 -29.27109,0 -53,-23.7289 -53,-53 0,-29.27111 23.72891,-53.00002 53,-53.00002 29.27109,0 53,23.72891 53,53.00002 z"
+ sodipodi:ry="53"
+ sodipodi:rx="53"
+ sodipodi:cy="1026.8622"
+ sodipodi:cx="282.5"
+ id="path3934"
+ style="opacity:0.69999999999999996;fill:url(#radialGradient3936);fill-opacity:1;stroke:none;stroke-opacity:1;stroke-width:6.31640755000000009;stroke-miterlimit:4;stroke-dasharray:none"
+ sodipodi:type="arc" />
+ <g
+ id="0shot"
+ inkscape:label="#g3944"
+ transform="translate(-156.42857,52.142857)">
+ <rect
+ y="491.87805"
+ x="534.28711"
+ height="5.0507631"
+ width="125.25893"
+ id="rect3942"
+ style="fill:#fafbc0;fill-opacity:1;stroke:none" />
+ </g>
+ <g
+ id="g3143">
+ <use
+ height="285.1698"
+ width="301.58823"
+ id="use3141"
+ transform="translate(-111.99124,0)"
+ xlink:href="#0tank"
+ inkscape:tiled-clone-of="#0tank"
+ y="0"
+ x="0" />
+ <path
+ sodipodi:nodetypes="ccccccc"
+ inkscape:connector-curvature="0"
+ inkscape:original-d="m 123.56727,371.43965 -0.21157,-12.82973 15.46133,0.17522 18.63668,5.40197 -25.91115,3.98315 6.47424,3.5821 z"
+ inkscape:path-effect="#path-effect3161"
+ id="path3159"
+ d="m 123.56727,371.43965 -0.21157,-12.82973 15.46133,0.17522 18.63668,5.40197 -25.91115,3.98315 6.47424,3.5821 -14.44953,-0.31271"
+ style="fill:#1a1a1a;stroke:#000000;stroke-width:2;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none" />
+ </g>
+ <g
+ id="0tank_hit1"
+ inkscape:label="#g4046">
+ <g
+ id="g3954">
+ <use
+ x="0"
+ y="0"
+ xlink:href="#g3143"
+ id="use3952"
+ transform="translate(-115.66247,0)"
+ width="301.58823"
+ height="285.1698" />
+ <path
+ sodipodi:nodetypes="cccccccc"
+ inkscape:connector-curvature="0"
+ inkscape:original-d="m 105.65934,333.92467 -0.07,-18.78339 -7.151033,-1.09732 -8.84187,2.28503 -11.74606,-3.14455 12.1729,9.6096 7.4409,-1.08563 z"
+ inkscape:path-effect="#path-effect4008"
+ id="path3155-2"
+ d="m 105.65934,333.92467 -0.07,-18.78339 -7.151033,-1.09732 -8.84187,2.28503 -11.74606,-3.14455 12.1729,9.6096 7.4409,-1.08563 8.195163,12.21626"
+ style="fill:#1a1a1a;stroke:#000000;stroke-width:2;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none" />
+ </g>
+ </g>
+ <g
+ id="0tank_hit2"
+ inkscape:label="#g4040">
+ <g
+ id="g3980">
+ <use
+ x="0"
+ y="0"
+ xlink:href="#g3954"
+ id="use3978"
+ transform="translate(-117.68277,0)"
+ width="301.58823"
+ height="285.1698" />
+ <path
+ sodipodi:nodetypes="cccccccc"
+ inkscape:connector-curvature="0"
+ inkscape:original-d="m -109.5358,309.93655 28.069103,-0.0193 -4.079722,6.01462 2.267012,7.12115 -7.569746,0.0496 -3.9846,-8.06576 -15.164357,1.57696 z"
+ inkscape:path-effect="#path-effect3157-7-3-7"
+ id="path3155-2-6"
+ d="m -109.5358,309.93655 28.069103,-0.0193 -4.079722,6.01462 2.267012,7.12115 -7.569746,0.0496 -3.9846,-8.06576 -15.164357,1.57696 0.46231,-6.67727"
+ style="fill:#1a1a1a;stroke:#000000;stroke-width:2;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none" />
+ <path
+ style="fill:#1a1a1a;stroke:#000000;stroke-width:2;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ d="m -75.544863,333.59201 23.971571,-6.69516 -25.449195,1.37285 -6.25692,-5.21668 -7.569746,0.0496 -9.609597,7.91638 10.371354,-2.61947 7.865647,4.13918 2.859536,8.00423 7.342089,8.82498 -3.624838,-10.19237 0.100099,-5.58354"
+ id="path4010"
+ inkscape:path-effect="#path-effect3157-7-3-7"
+ inkscape:original-d="m -75.544863,333.59201 23.971571,-6.69516 -25.449195,1.37285 -6.25692,-5.21668 -7.569746,0.0496 -9.609597,7.91638 10.371354,-2.61947 7.865647,4.13918 2.859536,8.00423 7.342089,8.82498 -3.624838,-10.19237 z"
+ inkscape:connector-curvature="0"
+ sodipodi:nodetypes="cccccccccccc" />
+ </g>
+ </g>
+ <g
+ id="0tank_hit3"
+ inkscape:label="#g4026">
+ <use
+ height="285.1698"
+ width="301.58823"
+ transform="translate(-114.28571,0)"
+ id="use4012"
+ xlink:href="#g3980"
+ y="0"
+ x="0" />
+ <path
+ style="fill:#1a1a1a;stroke:#000000;stroke-width:2;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ d="m -170.3103,371.43223 33.55687,-0.07 -6.60509,-4.62565 16.90787,-11.87233 -0.26472,-10.86217 -9.23079,-1.96924 2.24745,12.30675 -13.15738,4.98314 -8.57038,-0.2587 -14.88383,12.3682"
+ id="path3155-2-8"
+ inkscape:path-effect="#path-effect4008-3"
+ inkscape:original-d="m -170.3103,371.43223 33.55687,-0.07 -6.60509,-4.62565 16.90787,-11.87233 -0.26472,-10.86217 -9.23079,-1.96924 2.24745,12.30675 -13.15738,4.98314 -8.57038,-0.2587 z"
+ inkscape:connector-curvature="0"
+ sodipodi:nodetypes="cccccccccc" />
+ <path
+ sodipodi:nodetypes="cccccc"
+ inkscape:connector-curvature="0"
+ inkscape:original-d="m -153.44662,342.16809 6.7122,4.22507 -0.12167,12.39386 -37.11815,-0.22172 25.99668,-5.35755 z"
+ inkscape:path-effect="#path-effect4008-3"
+ id="path4038"
+ d="m -153.44662,342.16809 6.7122,4.22507 -0.12167,12.39386 -37.11815,-0.22172 25.99668,-5.35755 4.53094,-11.03966"
+ style="fill:#1a1a1a;stroke:#000000;stroke-width:2;stroke-linecap:butt;stroke-linejoin:miter;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none" />
+ </g>
+ <g
+ id="0joystick_cross"
+ transform="matrix(2.1914457,0,0,2.1914457,162.91109,-493.77327)"
+ inkscape:label="#g3947">
+ <rect
+ transform="matrix(0.70710678,-0.70710678,0.70710678,0.70710678,0,0)"
+ y="342.57352"
+ x="-578.71277"
+ height="139.28572"
+ width="5.3571429"
+ id="rect3139"
+ style="fill:url(#radialGradient3951);fill-opacity:1;stroke:none" />
+ <rect
+ transform="matrix(0.70710678,0.70710678,-0.70710678,0.70710678,0,0)"
+ style="fill:url(#radialGradient3953);fill-opacity:1;stroke:none"
+ id="rect3935"
+ width="5.3571429"
+ height="139.28572"
+ x="409.53781"
+ y="506.39136" />
+ </g>
+ <g
+ id="0wheel"
+ inkscape:label="#g4093"
+ transform="matrix(0.96203626,0,0,0.96203626,127.93699,-33.409999)">
+ <path
+ style="fill:#383838;fill-opacity:1;stroke:#000000;stroke-width:2.5;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ d="m 177.03125,263.5625 0,59.75 c -6.93196,1.09069 -12.25,7.07412 -12.25,14.3125 0,1.74211 0.34324,3.39002 0.90625,4.9375 l -51.40625,29.65625 2.28125,3.9375 51.3125,-29.625 c 2.6552,3.3928 6.764,5.59375 11.40625,5.59375 4.64412,0 8.78242,-2.19861 11.4375,-5.59375 l 51.3125,29.625 2.25,-3.9375 -51.375,-29.65625 c 0.56301,-1.54748 0.90625,-3.19539 0.90625,-4.9375 0,-7.23838 -5.31804,-13.22181 -12.25,-14.3125 l 0,-59.75 -4.53125,0 z"
+ transform="translate(-287.44385,387.37671)"
+ id="path4082"
+ inkscape:connector-curvature="0" />
+ <path
+ style="fill:#4a4a4a;fill-opacity:1;stroke:#000000;stroke-width:2.5;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ d="m 179.28125,257.0625 c -1.75842,0 -3.32399,0.7151 -4.46875,1.875 -11.08931,0.62405 -21.56972,3.53578 -30.96875,8.28125 -1.56843,-0.42829 -3.29322,-0.2209 -4.8125,0.65625 -1.52842,0.88243 -2.52901,2.29118 -2.9375,3.875 -9.02227,5.93169 -16.78944,13.63227 -22.71875,22.65625 -1.5607,0.41819 -2.97204,1.42766 -3.84375,2.9375 -0.87692,1.51887 -1.05285,3.2444 -0.625,4.8125 -4.74547,9.39903 -7.6572,19.87944 -8.28125,30.96875 -1.16045,1.14483 -1.875,2.7411 -1.875,4.5 0,1.7589 0.71455,3.32392 1.875,4.46875 0.62324,11.09127 3.53482,21.57116 8.28125,30.96875 -0.42785,1.5681 -0.25192,3.29363 0.625,4.8125 0.87171,1.50984 2.28305,2.51931 3.84375,2.9375 5.92931,9.02011 13.69648,16.72843 22.71875,22.65625 0.40849,1.58382 1.40908,3.02382 2.9375,3.90625 1.53186,0.88442 3.26509,1.03563 4.84375,0.59375 9.38379,4.73025 19.83831,7.65457 30.90625,8.28125 1.14683,1.17737 2.72656,1.90625 4.5,1.90625 1.77439,0 3.38429,-0.72777 4.53125,-1.90625 11.07007,-0.62582 21.52376,-3.54997 30.90625,-8.28125 1.57777,0.44069 3.31299,0.29003 4.84375,-0.59375 1.52886,-0.88269 2.52925,-2.32188 2.9375,-3.90625 9.01245,-5.9239 16.73235,-13.6438 22.65625,-22.65625 1.58437,-0.40825 2.99231,-1.40864 3.875,-2.9375 0.88378,-1.53076 1.06569,-3.26598 0.625,-4.84375 4.73128,-9.38249 7.65543,-19.83618 8.28125,-30.90625 1.17848,-1.14696 1.90625,-2.72561 1.90625,-4.5 0,-1.77439 -0.72777,-3.38429 -1.90625,-4.53125 -0.62668,-11.06794 -3.551,-21.52246 -8.28125,-30.90625 0.44069,-1.57777 0.25878,-3.31299 -0.625,-4.84375 -0.88269,-1.52886 -2.29063,-2.52925 -3.875,-2.9375 -5.9239,-9.01632 -13.6438,-16.72848 -22.65625,-22.65625 -0.40825,-1.58437 -1.40864,-2.99231 -2.9375,-3.875 -1.51887,-0.87692 -3.2444,-1.0841 -4.8125,-0.65625 -9.39759,-4.74643 -19.87748,-7.65801 -30.96875,-8.28125 -1.14483,-1.16045 -2.7411,-1.875 -4.5,-1.875 z m -4,11.1875 c 1.09134,0.90065 2.47451,1.4375 4,1.4375 1.52549,0 2.93991,-0.53685 4.03125,-1.4375 9.73228,0.55443 18.93335,3.09694 27.1875,7.25 0.49191,1.33738 1.41945,2.51306 2.75,3.28125 1.32111,0.76274 2.79205,1.01557 4.1875,0.78125 7.90748,5.20385 14.69472,11.94178 19.90625,19.84375 -0.25127,1.41296 -0.0237,2.90987 0.75,4.25 0.76274,1.32111 1.95559,2.2552 3.28125,2.75 4.1551,8.25099 6.75393,17.42688 7.3125,27.15625 -0.91783,1.09628 -1.46875,2.52089 -1.46875,4.0625 0,1.54161 0.55092,2.93497 1.46875,4.03125 -0.55836,9.72583 -3.16007,18.90757 -7.3125,27.15625 -1.32566,0.4948 -2.51851,1.42889 -3.28125,2.75 -0.76851,1.3311 -0.99318,2.84533 -0.75,4.25 -5.19878,7.88263 -11.96112,14.64497 -19.84375,19.84375 -1.41296,-0.25127 -2.90987,0.008 -4.25,0.78125 -1.33055,0.76819 -2.25809,1.94387 -2.75,3.28125 -8.24541,4.14867 -17.4354,6.72317 -27.15625,7.28125 -1.09628,-0.91783 -2.52089,-1.46875 -4.0625,-1.46875 -1.54161,0 -2.93497,0.55092 -4.03125,1.46875 -9.72583,-0.55836 -18.90757,-3.16007 -27.15625,-7.3125 -0.4948,-1.32566 -1.42889,-2.48726 -2.75,-3.25 -1.33062,-0.76823 -2.84577,-1.024 -4.25,-0.78125 -7.88374,-5.19951 -14.64468,-11.9597 -19.84375,-19.84375 0.24295,-1.40443 -0.0129,-2.91916 -0.78125,-4.25 -0.76819,-1.33055 -1.94387,-2.25809 -3.28125,-2.75 -4.14867,-8.24541 -6.72317,-17.4354 -7.28125,-27.15625 0.91783,-1.09628 1.46875,-2.48964 1.46875,-4.03125 0,-1.54161 -0.55092,-2.96622 -1.46875,-4.0625 0.55857,-9.72937 3.1574,-18.90526 7.3125,-27.15625 1.32566,-0.4948 2.48726,-1.42889 3.25,-2.75 0.77347,-1.33969 1.03212,-2.83745 0.78125,-4.25 5.207,-7.89608 11.97581,-14.64108 19.875,-19.84375 1.39545,0.23432 2.89764,-0.0185 4.21875,-0.78125 1.32111,-0.76274 2.2552,-1.92434 2.75,-3.25 0.004,-0.009 -0.003,-0.0218 0,-0.0312 8.25415,-4.15306 17.45522,-6.69557 27.1875,-7.25 z"
+ transform="translate(-287.44385,387.37671)"
+ id="path3957"
+ inkscape:connector-curvature="0" />
+ </g>
+ <g
+ transform="translate(137.9043,111.33725)"
+ inkscape:label="#g4093"
+ id="g4112">
+ <path
+ inkscape:connector-curvature="0"
+ style="fill:#e6e6e6;fill-opacity:1;stroke:none"
+ d="m 117.15625,337.375 c -43.515565,0 -78.8125,35.29694 -78.8125,78.8125 0,43.51556 35.296935,78.78125 78.8125,78.78125 43.51556,0 78.78125,-35.26569 78.78125,-78.78125 0,-43.51556 -35.26569,-78.8125 -78.78125,-78.8125 z m 0,9.3125 c 38.38721,0 69.5,31.11279 69.5,69.5 0,38.38721 -31.11279,69.5 -69.5,69.5 -38.387206,0 -69.5,-31.11279 -69.5,-69.5 0,-38.38721 31.112794,-69.5 69.5,-69.5 z"
+ transform="translate(-225.30099,308.80528)"
+ id="path4114" />
+ <path
+ sodipodi:type="arc"
+ style="fill:#e6e6e6;fill-opacity:1;stroke:none"
+ id="path4116"
+ sodipodi:cx="117.93531"
+ sodipodi:cy="342.20657"
+ sodipodi:rx="6.3134532"
+ sodipodi:ry="6.3134532"
+ d="m 124.24876,342.20657 c 0,3.48683 -2.82663,6.31346 -6.31345,6.31346 -3.48682,0 -6.31345,-2.82663 -6.31345,-6.31346 0,-3.48682 2.82663,-6.31345 6.31345,-6.31345 3.48682,0 6.31345,2.82663 6.31345,6.31345 z"
+ transform="translate(-226.08577,308.55274)" />
+ <path
+ transform="matrix(0.8660254,0.5,-0.5,0.8660254,-2.0680094,305.37678)"
+ d="m 124.24876,342.20657 c 0,3.48683 -2.82663,6.31346 -6.31345,6.31346 -3.48682,0 -6.31345,-2.82663 -6.31345,-6.31346 0,-3.48682 2.82663,-6.31345 6.31345,-6.31345 3.48682,0 6.31345,2.82663 6.31345,6.31345 z"
+ sodipodi:ry="6.3134532"
+ sodipodi:rx="6.3134532"
+ sodipodi:cy="342.20657"
+ sodipodi:cx="117.93531"
+ id="path4118"
+ style="fill:#e6e6e6;fill-opacity:1;stroke:none"
+ sodipodi:type="arc" />
+ <path
+ sodipodi:type="arc"
+ style="fill:#e6e6e6;fill-opacity:1;stroke:none"
+ id="path4120"
+ sodipodi:cx="117.93531"
+ sodipodi:cy="342.20657"
+ sodipodi:rx="6.3134532"
+ sodipodi:ry="6.3134532"
+ d="m 124.24876,342.20657 c 0,3.48683 -2.82663,6.31346 -6.31345,6.31346 -3.48682,0 -6.31345,-2.82663 -6.31345,-6.31346 0,-3.48682 2.82663,-6.31345 6.31345,-6.31345 3.48682,0 6.31345,2.82663 6.31345,6.31345 z"
+ transform="matrix(0.5,0.8660254,-0.8660254,0.5,193.52504,414.63519)" />
+ <path
+ transform="matrix(0,1,-1,0,308.28439,607.05228)"
+ d="m 124.24876,342.20657 c 0,3.48683 -2.82663,6.31346 -6.31345,6.31346 -3.48682,0 -6.31345,-2.82663 -6.31345,-6.31346 0,-3.48682 2.82663,-6.31345 6.31345,-6.31345 3.48682,0 6.31345,2.82663 6.31345,6.31345 z"
+ sodipodi:ry="6.3134532"
+ sodipodi:rx="6.3134532"
+ sodipodi:cy="342.20657"
+ sodipodi:cx="117.93531"
+ id="path4122"
+ style="fill:#e6e6e6;fill-opacity:1;stroke:none"
+ sodipodi:type="arc" />
+ <path
+ sodipodi:type="arc"
+ style="fill:#e6e6e6;fill-opacity:1;stroke:none"
+ id="path4124"
+ sodipodi:cx="117.93531"
+ sodipodi:cy="342.20657"
+ sodipodi:rx="6.3134532"
+ sodipodi:ry="6.3134532"
+ d="m 124.24876,342.20657 c 0,3.48683 -2.82663,6.31346 -6.31345,6.31346 -3.48682,0 -6.31345,-2.82663 -6.31345,-6.31346 0,-3.48682 2.82663,-6.31345 6.31345,-6.31345 3.48682,0 6.31345,2.82663 6.31345,6.31345 z"
+ transform="matrix(-0.5,0.8660254,-0.8660254,-0.5,311.46035,831.07001)" />
+ <path
+ transform="matrix(-0.8660254,0.5,-0.5,-0.8660254,202.20194,1026.6631)"
+ d="m 124.24876,342.20657 c 0,3.48683 -2.82663,6.31346 -6.31345,6.31346 -3.48682,0 -6.31345,-2.82663 -6.31345,-6.31346 0,-3.48682 2.82663,-6.31345 6.31345,-6.31345 3.48682,0 6.31345,2.82663 6.31345,6.31345 z"
+ sodipodi:ry="6.3134532"
+ sodipodi:rx="6.3134532"
+ sodipodi:cy="342.20657"
+ sodipodi:cx="117.93531"
+ id="path4126"
+ style="fill:#e6e6e6;fill-opacity:1;stroke:none"
+ sodipodi:type="arc" />
+ <path
+ sodipodi:type="arc"
+ style="fill:#e6e6e6;fill-opacity:1;stroke:none"
+ id="path4128"
+ sodipodi:cx="117.93531"
+ sodipodi:cy="342.20657"
+ sodipodi:rx="6.3134532"
+ sodipodi:ry="6.3134532"
+ d="m 124.24876,342.20657 c 0,3.48683 -2.82663,6.31346 -6.31345,6.31346 -3.48682,0 -6.31345,-2.82663 -6.31345,-6.31346 0,-3.48682 2.82663,-6.31345 6.31345,-6.31345 3.48682,0 6.31345,2.82663 6.31345,6.31345 z"
+ transform="matrix(-1,0,0,-1,9.78485,1141.4225)" />
+ <path
+ transform="matrix(-0.8660254,-0.5,0.5,-0.8660254,-214.23291,1144.5985)"
+ d="m 124.24876,342.20657 c 0,3.48683 -2.82663,6.31346 -6.31345,6.31346 -3.48682,0 -6.31345,-2.82663 -6.31345,-6.31346 0,-3.48682 2.82663,-6.31345 6.31345,-6.31345 3.48682,0 6.31345,2.82663 6.31345,6.31345 z"
+ sodipodi:ry="6.3134532"
+ sodipodi:rx="6.3134532"
+ sodipodi:cy="342.20657"
+ sodipodi:cx="117.93531"
+ id="path4130"
+ style="fill:#e6e6e6;fill-opacity:1;stroke:none"
+ sodipodi:type="arc" />
+ <path
+ sodipodi:type="arc"
+ style="fill:#e6e6e6;fill-opacity:1;stroke:none"
+ id="path4132"
+ sodipodi:cx="117.93531"
+ sodipodi:cy="342.20657"
+ sodipodi:rx="6.3134532"
+ sodipodi:ry="6.3134532"
+ d="m 124.24876,342.20657 c 0,3.48683 -2.82663,6.31346 -6.31345,6.31346 -3.48682,0 -6.31345,-2.82663 -6.31345,-6.31346 0,-3.48682 2.82663,-6.31345 6.31345,-6.31345 3.48682,0 6.31345,2.82663 6.31345,6.31345 z"
+ transform="matrix(-0.5,-0.8660254,0.8660254,-0.5,-409.82596,1035.3401)" />
+ <path
+ transform="matrix(0,-1,1,0,-524.58531,842.92297)"
+ d="m 124.24876,342.20657 c 0,3.48683 -2.82663,6.31346 -6.31345,6.31346 -3.48682,0 -6.31345,-2.82663 -6.31345,-6.31346 0,-3.48682 2.82663,-6.31345 6.31345,-6.31345 3.48682,0 6.31345,2.82663 6.31345,6.31345 z"
+ sodipodi:ry="6.3134532"
+ sodipodi:rx="6.3134532"
+ sodipodi:cy="342.20657"
+ sodipodi:cx="117.93531"
+ id="path4134"
+ style="fill:#e6e6e6;fill-opacity:1;stroke:none"
+ sodipodi:type="arc" />
+ <path
+ sodipodi:type="arc"
+ style="fill:#e6e6e6;fill-opacity:1;stroke:none"
+ id="path4136"
+ sodipodi:cx="117.93531"
+ sodipodi:cy="342.20657"
+ sodipodi:rx="6.3134532"
+ sodipodi:ry="6.3134532"
+ d="m 124.24876,342.20657 c 0,3.48683 -2.82663,6.31346 -6.31345,6.31346 -3.48682,0 -6.31345,-2.82663 -6.31345,-6.31346 0,-3.48682 2.82663,-6.31345 6.31345,-6.31345 3.48682,0 6.31345,2.82663 6.31345,6.31345 z"
+ transform="matrix(0.5,-0.8660254,0.8660254,0.5,-527.76127,618.90521)" />
+ <path
+ transform="matrix(0.8660254,-0.5,0.5,0.8660254,-418.50286,423.31215)"
+ d="m 124.24876,342.20657 c 0,3.48683 -2.82663,6.31346 -6.31345,6.31346 -3.48682,0 -6.31345,-2.82663 -6.31345,-6.31346 0,-3.48682 2.82663,-6.31345 6.31345,-6.31345 3.48682,0 6.31345,2.82663 6.31345,6.31345 z"
+ sodipodi:ry="6.3134532"
+ sodipodi:rx="6.3134532"
+ sodipodi:cy="342.20657"
+ sodipodi:cx="117.93531"
+ id="path4138"
+ style="fill:#e6e6e6;fill-opacity:1;stroke:none"
+ sodipodi:type="arc" />
+ <path
+ sodipodi:type="arc"
+ style="fill:#e6e6e6;fill-opacity:1;stroke:none"
+ id="path4140"
+ sodipodi:cx="135.86552"
+ sodipodi:cy="480.09238"
+ sodipodi:rx="42.426407"
+ sodipodi:ry="42.426407"
+ d="m 178.29193,480.09238 c 0,23.43145 -18.99495,42.4264 -42.42641,42.4264 -23.43145,0 -42.426403,-18.99495 -42.426403,-42.4264 0,-23.43146 18.994953,-42.42641 42.426403,-42.42641 23.43146,0 42.42641,18.99495 42.42641,42.42641 z"
+ transform="matrix(0.34191407,0,0,0.34191407,-154.60478,560.83724)" />
+ <rect
+ style="fill:#e6e6e6;fill-opacity:1;stroke:none"
+ id="rect4142"
+ width="4.5456862"
+ height="68.185295"
+ x="-110.42329"
+ y="650.93787"
+ inkscape:transform-center-y="-39.469916" />
+ <rect
+ inkscape:transform-center-y="19.824264"
+ y="-342.41962"
+ x="679.39282"
+ height="68.185295"
+ width="4.5456862"
+ id="rect4144"
+ style="fill:#e6e6e6;fill-opacity:1;stroke:none"
+ transform="matrix(-0.5,0.8660254,-0.8660254,-0.5,0,0)"
+ inkscape:transform-center-x="-34.336597" />
+ <rect
+ inkscape:transform-center-x="34.336634"
+ transform="matrix(-0.5,-0.8660254,0.8660254,-0.5,0,0)"
+ style="fill:#e6e6e6;fill-opacity:1;stroke:none"
+ id="rect4146"
+ width="4.5456862"
+ height="68.185295"
+ x="-575.78802"
+ y="-529.7417"
+ inkscape:transform-center-y="19.824239" />
+ </g>
+ <g
+ id="0handle_track"
+ inkscape:label="#g4199"
+ transform="matrix(1.3940936,0,0,1.3940936,273.10435,-252.93676)">
+ <rect
+ y="276.88766"
+ x="641.2583"
+ height="23.507523"
+ width="163.98499"
+ id="rect2985-0"
+ style="fill:#4d4d4d;fill-opacity:1;stroke:#000000;stroke-width:1.57774007;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ transform="matrix(0,1,-1,0,0,0)"
+ rx="5" />
+ <rect
+ style="fill:#4d4d4d;fill-opacity:1;stroke:#000000;stroke-width:1.12868094;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ id="rect3755-7"
+ width="21.019911"
+ height="38.577435"
+ x="-733.76074"
+ y="269.35272"
+ transform="matrix(0,-1,-1,0,0,0)"
+ rx="5"
+ ry="5" />
+ <path
+ id="path4175"
+ d="m -288.93817,647.43824 c -1.29447,0.0918 -2.52115,0.79171 -3.21875,2 -0.8745,1.51468 -0.62733,3.36006 0.4375,4.625 l 0,65.78125 c -1.56334,1.41366 -1.97149,3.78833 -0.875,5.6875 0.24053,0.41662 0.5379,0.75427 0.875,1.0625 l 0,66.3125 c -0.15283,0.18103 -0.31489,0.38137 -0.4375,0.59375 -1.11619,1.93328 -0.43328,4.41507 1.5,5.53125 0,0 4.38383,0.43328 5.5,-1.5 0.87855,-1.52168 0.67137,-3.35962 -0.40625,-4.625 l 0,-66.28125 c 1.56259,-1.41375 1.97127,-3.75745 0.875,-5.65625 -0.23857,-0.41322 -0.54133,-0.75587 -0.875,-1.0625 l 0,-65.84375 c 0.15283,-0.18103 0.28364,-0.38136 0.40625,-0.59375 0.41857,-0.72498 0.61738,-1.50465 0.5625,-2.28125 -0.0915,-1.29435 -0.82295,-2.52113 -2.03125,-3.21875 -0.72499,-0.41857 -1.53583,-0.58632 -2.3125,-0.53125 z"
+ style="fill:#383838;fill-opacity:1;stroke:#000000;stroke-width:2;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ inkscape:connector-curvature="0" />
+ </g>
+ <g
+ id="0handle"
+ inkscape:label="#g4196"
+ transform="matrix(1.3940936,0,0,1.3940936,122.74666,-196.11401)">
+ <path
+ inkscape:connector-curvature="0"
+ id="path4118-1"
+ d="m -211.33952,565.98832 c -2.02168,0.14287 -3.94161,1.26895 -5.03125,3.15625 -1.74341,3.01968 -0.70717,6.88159 2.3125,8.625 2.36583,1.36591 5.24299,1.00694 7.21875,-0.65625 l 54.78125,0 c 0.28276,0.23871 0.57453,0.46473 0.90625,0.65625 3.01968,1.74341 6.88159,0.70718 8.625,-2.3125 1.74341,-3.01968 0.70718,-6.88159 -2.3125,-8.625 -2.37677,-1.37223 -5.27356,-1.02693 -7.25,0.65625 l -54.75,0 c -0.28275,-0.23871 -0.57452,-0.46473 -0.90625,-0.65625 -1.13237,-0.65378 -2.38074,-0.92947 -3.59375,-0.84375 z"
+ style="fill:#4a4a4a;fill-opacity:1;stroke:#000000;stroke-width:2.5;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none" />
+ </g>
+ <g
+ id="0track"
+ inkscape:label="#g3965"
+ transform="translate(-478.30723,124.24876)">
+ <rect
+ style="opacity:0.2;fill:#000000;fill-opacity:1;stroke:none"
+ id="rect3945"
+ width="20.714298"
+ height="5.3571515"
+ x="406.29874"
+ y="-533.98468"
+ rx="1"
+ ry="1"
+ transform="matrix(0,1,-1,0,0,0)" />
+ <rect
+ transform="matrix(0,1,-1,0,0,0)"
+ ry="1"
+ rx="1"
+ y="-541.60376"
+ x="406.29874"
+ height="5.3571515"
+ width="20.714298"
+ id="rect3947"
+ style="opacity:0.4;fill:#000000;fill-opacity:1;stroke:none" />
+ <rect
+ style="opacity:0.5;fill:#000000;fill-opacity:1;stroke:none"
+ id="rect3949"
+ width="20.714298"
+ height="5.3571515"
+ x="406.29874"
+ y="-549.22278"
+ rx="1"
+ ry="1"
+ transform="matrix(0,1,-1,0,0,0)" />
+ <rect
+ transform="matrix(0,1,-1,0,0,0)"
+ ry="1"
+ rx="1"
+ y="-556.84186"
+ x="406.29874"
+ height="5.3571515"
+ width="20.714298"
+ id="rect3951"
+ style="opacity:0.4;fill:#000000;fill-opacity:1;stroke:none" />
+ <rect
+ transform="matrix(0,1,-1,0,0,0)"
+ ry="1"
+ rx="1"
+ y="-533.98468"
+ x="367.01303"
+ height="5.3571515"
+ width="20.714298"
+ id="rect3953"
+ style="opacity:0.2;fill:#000000;fill-opacity:1;stroke:none" />
+ <rect
+ style="opacity:0.4;fill:#000000;fill-opacity:1;stroke:none"
+ id="rect3955"
+ width="20.714298"
+ height="5.3571515"
+ x="367.01303"
+ y="-541.60376"
+ rx="1"
+ ry="1"
+ transform="matrix(0,1,-1,0,0,0)" />
+ <rect
+ transform="matrix(0,1,-1,0,0,0)"
+ ry="1"
+ rx="1"
+ y="-549.22278"
+ x="367.01303"
+ height="5.3571515"
+ width="20.714298"
+ id="rect3957"
+ style="opacity:0.5;fill:#000000;fill-opacity:1;stroke:none" />
+ <rect
+ style="opacity:0.4;fill:#000000;fill-opacity:1;stroke:none"
+ id="rect3959"
+ width="20.714298"
+ height="5.3571515"
+ x="367.01303"
+ y="-556.84186"
+ rx="1"
+ ry="1"
+ transform="matrix(0,1,-1,0,0,0)" />
+ <rect
+ style="opacity:0.2;fill:#000000;fill-opacity:1;stroke:none"
+ id="rect3961"
+ width="20.714298"
+ height="5.3571515"
+ x="406.29874"
+ y="-564.67053"
+ rx="1"
+ ry="1"
+ transform="matrix(0,1,-1,0,0,0)" />
+ <rect
+ transform="matrix(0,1,-1,0,0,0)"
+ ry="1"
+ rx="1"
+ y="-564.67053"
+ x="367.01303"
+ height="5.3571515"
+ width="20.714298"
+ id="rect3963"
+ style="opacity:0.2;fill:#000000;fill-opacity:1;stroke:none" />
+ </g>
+ <g
+ id="0joystick_zone"
+ transform="matrix(1,0,0,0.1183206,-494.15234,979.71617)"
+ inkscape:label="#g4032"
+ style="fill:url(#linearGradient3207);fill-opacity:1">
+ <rect
+ y="323.72241"
+ x="546.45557"
+ height="529.31995"
+ width="191.92899"
+ id="rect3222"
+ style="opacity:0.4;fill:url(#linearGradient3210);fill-opacity:1;stroke:none" />
+ </g>
+ <g
+ id="0joystick_back"
+ inkscape:label="#g4057"
+ transform="matrix(0.56929864,0,0,0.56929864,-190.74607,665.0211)">
+ <path
+ inkscape:label="#path4037"
+ transform="translate(1811.8419,83.090999)"
+ d="m -548.57141,422.85056 c 0,121.50264 -98.49736,220 -220,220 -121.50265,0 -220,-98.49736 -220,-220 0,-121.50265 98.49735,-220 220,-220 121.50264,0 220,98.49735 220,220 z"
+ sodipodi:ry="220"
+ sodipodi:rx="220"
+ sodipodi:cy="422.85056"
+ sodipodi:cx="-768.57141"
+ id="asdf"
+ style="opacity:0.4;fill:url(#radialGradient4047);fill-opacity:1;stroke:none"
+ sodipodi:type="arc" />
+ </g>
+ <g
+ id="0joystick_handle"
+ inkscape:label="#g4060"
+ transform="matrix(0.56929864,0,0,0.56929864,-406.08249,313.94848)">
+ <path
+ inkscape:label="#path4053"
+ sodipodi:type="arc"
+ style="opacity:0.4;fill:url(#radialGradient4055);fill-opacity:1;stroke:none"
+ id="asdf123"
+ sodipodi:cx="-768.57141"
+ sodipodi:cy="422.85056"
+ sodipodi:rx="220"
+ sodipodi:ry="220"
+ d="m -548.57141,422.85056 c 0,121.50264 -98.49736,220 -220,220 -121.50265,0 -220,-98.49736 -220,-220 0,-121.50265 98.49735,-220 220,-220 121.50264,0 220,98.49735 220,220 z"
+ transform="matrix(0.46737411,0,0,0.46737411,1404.5012,827.53056)" />
+ </g>
+ </g>
+</svg>
--- /dev/null
+<?xml version="1.0" encoding="UTF-8" standalone="no"?>
+<!-- Created with Inkscape (http://www.inkscape.org/) -->
+
+<svg
+ xmlns:dc="http://purl.org/dc/elements/1.1/"
+ xmlns:cc="http://creativecommons.org/ns#"
+ xmlns:rdf="http://www.w3.org/1999/02/22-rdf-syntax-ns#"
+ xmlns:svg="http://www.w3.org/2000/svg"
+ xmlns="http://www.w3.org/2000/svg"
+ xmlns:xlink="http://www.w3.org/1999/xlink"
+ xmlns:sodipodi="http://sodipodi.sourceforge.net/DTD/sodipodi-0.dtd"
+ xmlns:inkscape="http://www.inkscape.org/namespaces/inkscape"
+ width="256"
+ height="260"
+ id="svg2"
+ version="1.1"
+ inkscape:version="0.48.5 r10040"
+ sodipodi:docname="icon.svg">
+ <defs
+ id="defs4">
+ <inkscape:path-effect
+ is_visible="true"
+ id="path-effect4008"
+ effect="spiro" />
+ <inkscape:path-effect
+ effect="spiro"
+ id="path-effect4006"
+ is_visible="true" />
+ <inkscape:path-effect
+ is_visible="true"
+ id="path-effect4004"
+ effect="spiro" />
+ <inkscape:path-effect
+ is_visible="true"
+ id="path-effect3161"
+ effect="spiro" />
+ <inkscape:path-effect
+ effect="spiro"
+ id="path-effect3157"
+ is_visible="true" />
+ <linearGradient
+ id="linearGradient3771">
+ <stop
+ style="stop-color:#000000;stop-opacity:1;"
+ offset="0"
+ id="stop3773" />
+ <stop
+ id="stop3795"
+ offset="0.46052632"
+ style="stop-color:#000000;stop-opacity:1;" />
+ <stop
+ style="stop-color:#000000;stop-opacity:0"
+ offset="1"
+ id="stop3775" />
+ </linearGradient>
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient3771"
+ id="radialGradient3829"
+ gradientUnits="userSpaceOnUse"
+ gradientTransform="matrix(0,0.33243869,-1.4983791,0,690.78032,359.10278)"
+ cx="232.84016"
+ cy="159.23706"
+ fx="232.84016"
+ fy="159.23706"
+ r="33.324886" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient3771"
+ id="radialGradient3831"
+ gradientUnits="userSpaceOnUse"
+ gradientTransform="matrix(-0.35546222,0.09524581,-0.38780905,-1.4473231,590.56362,644.53452)"
+ cx="232.84016"
+ cy="159.23706"
+ fx="232.84016"
+ fy="159.23706"
+ r="33.324886" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient3771"
+ id="radialGradient3833"
+ gradientUnits="userSpaceOnUse"
+ gradientTransform="matrix(-0.23937237,-0.24458338,0.97464411,-0.99586156,344.03542,654.43573)"
+ cx="232.84016"
+ cy="159.23706"
+ fx="232.84016"
+ fy="159.23706"
+ r="33.324886" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient3771"
+ id="radialGradient3835"
+ gradientUnits="userSpaceOnUse"
+ gradientTransform="matrix(0.14945417,-0.27574285,1.3692459,0.49897051,192.06465,416.1818)"
+ cx="232.84016"
+ cy="159.23706"
+ fx="232.84016"
+ fy="159.23706"
+ r="33.324886" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient3771"
+ id="radialGradient3837"
+ gradientUnits="userSpaceOnUse"
+ gradientTransform="matrix(0.30945331,-0.10648859,0.38089919,1.4342744,310.38892,228.91286)"
+ cx="232.84016"
+ cy="159.23706"
+ fx="232.84016"
+ fy="159.23706"
+ r="33.324886" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient3771"
+ id="radialGradient3839"
+ gradientUnits="userSpaceOnUse"
+ gradientTransform="matrix(0.25321654,0.18876246,-0.76597563,1.034515,512.69634,219.42448)"
+ cx="232.84016"
+ cy="159.23706"
+ fx="232.84016"
+ fy="159.23706"
+ r="33.324886" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient3771"
+ id="radialGradient3841"
+ gradientUnits="userSpaceOnUse"
+ gradientTransform="matrix(-0.09974529,-0.26010206,1.1547951,-0.37245631,285.61183,551.09526)"
+ cx="232.84016"
+ cy="159.23706"
+ fx="232.84016"
+ fy="159.23706"
+ r="33.324886" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient3771"
+ id="radialGradient3843"
+ gradientUnits="userSpaceOnUse"
+ gradientTransform="matrix(-0.19843343,0.19551567,-0.80354002,-0.90917483,623.69734,531.37012)"
+ cx="232.84016"
+ cy="159.23706"
+ fx="232.84016"
+ fy="159.23706"
+ r="33.324886" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient3771"
+ id="radialGradient3845"
+ gradientUnits="userSpaceOnUse"
+ gradientTransform="matrix(0.09219417,0.25996074,-1.0629657,0.374089,596.78104,309.88047)"
+ cx="232.84016"
+ cy="159.23706"
+ fx="232.84016"
+ fy="159.23706"
+ r="33.324886" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient3771"
+ id="radialGradient3847"
+ gradientUnits="userSpaceOnUse"
+ gradientTransform="matrix(0.25446796,0.0279428,-0.13072229,0.92539534,408.33237,277.18662)"
+ cx="232.84016"
+ cy="159.23706"
+ fx="232.84016"
+ fy="159.23706"
+ r="33.324886" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient4946"
+ id="radialGradient4952"
+ cx="286.16666"
+ cy="1026.8622"
+ fx="286.16666"
+ fy="1026.8622"
+ r="53"
+ gradientUnits="userSpaceOnUse" />
+ <linearGradient
+ id="linearGradient4946">
+ <stop
+ style="stop-color:#e4e4ff;stop-opacity:0;"
+ offset="0"
+ id="stop4948" />
+ <stop
+ id="stop4956"
+ offset="0.47959185"
+ style="stop-color:#eeefff;stop-opacity:0.36078432;" />
+ <stop
+ id="stop4954"
+ offset="0.883753"
+ style="stop-color:#ebecff;stop-opacity:0.68421054;" />
+ <stop
+ style="stop-color:#f2f3ff;stop-opacity:0.36078432;"
+ offset="0.95870173"
+ id="stop4958" />
+ <stop
+ style="stop-color:#ebeeff;stop-opacity:0;"
+ offset="1"
+ id="stop4950" />
+ </linearGradient>
+ <radialGradient
+ r="53"
+ fy="1026.8622"
+ fx="286.16666"
+ cy="1026.8622"
+ cx="286.16666"
+ gradientUnits="userSpaceOnUse"
+ id="radialGradient8208"
+ xlink:href="#linearGradient4946"
+ inkscape:collect="always" />
+ <radialGradient
+ inkscape:collect="always"
+ xlink:href="#linearGradient4946"
+ id="radialGradient3936"
+ gradientUnits="userSpaceOnUse"
+ cx="286.16666"
+ cy="1026.8622"
+ fx="286.16666"
+ fy="1026.8622"
+ r="53" />
+ <inkscape:path-effect
+ effect="spiro"
+ id="path-effect3157-7"
+ is_visible="true" />
+ <inkscape:path-effect
+ effect="spiro"
+ id="path-effect3157-7-3"
+ is_visible="true" />
+ <inkscape:path-effect
+ effect="spiro"
+ id="path-effect3157-7-3-7"
+ is_visible="true" />
+ <inkscape:path-effect
+ is_visible="true"
+ id="path-effect4008-3"
+ effect="spiro" />
+ </defs>
+ <sodipodi:namedview
+ id="base"
+ pagecolor="#ffffff"
+ bordercolor="#666666"
+ borderopacity="1.0"
+ inkscape:pageopacity="0.0"
+ inkscape:pageshadow="2"
+ inkscape:zoom="1.979899"
+ inkscape:cx="107.98668"
+ inkscape:cy="65.759563"
+ inkscape:document-units="px"
+ inkscape:current-layer="0splash"
+ showgrid="false"
+ inkscape:window-width="2558"
+ inkscape:window-height="1379"
+ inkscape:window-x="2560"
+ inkscape:window-y="27"
+ inkscape:window-maximized="1"
+ fit-margin-top="0"
+ fit-margin-left="0"
+ fit-margin-right="0"
+ fit-margin-bottom="0"
+ showguides="true"
+ inkscape:guide-bbox="true" />
+ <metadata
+ id="metadata7">
+ <rdf:RDF>
+ <cc:Work
+ rdf:about="">
+ <dc:format>image/svg+xml</dc:format>
+ <dc:type
+ rdf:resource="http://purl.org/dc/dcmitype/StillImage" />
+ <dc:title />
+ </cc:Work>
+ </rdf:RDF>
+ </metadata>
+ <g
+ inkscape:label="Layer 1"
+ inkscape:groupmode="layer"
+ id="layer1"
+ transform="translate(-199.28051,-418.7416)">
+ <g
+ id="0splash"
+ inkscape:label="#g3762"
+ transform="matrix(1.4858489,0,0,1.4858489,-166.61365,-424.47172)">
+ <g
+ id="use2990"
+ inkscape:label="#g3757"
+ transform="matrix(0.53315693,0.53315693,-0.52077923,0.52077923,434.16308,287.36041)"
+ style="stroke:#000000;stroke-width:3.85294461;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ inkscape:tile-x0="33.364892"
+ inkscape:tile-y0="3.1002866">
+ <rect
+ y="354.48859"
+ x="188.89853"
+ height="192.86641"
+ width="119.198"
+ id="rect3141"
+ style="fill:#4a4a4a;fill-opacity:1;stroke:#000000;stroke-width:3.85294461;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none" />
+ <rect
+ style="fill:#383838;fill-opacity:1;stroke:#000000;stroke-width:3.85294461;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ id="rect3143"
+ width="68.859299"
+ height="152.28334"
+ x="214.06789"
+ y="395.07166" />
+ </g>
+ <g
+ id="g3253"
+ transform="matrix(0.9571749,0,0,0.9571749,14.241487,126.08446)">
+ <path
+ style="font-size:52.50814056px;font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;line-height:125%;letter-spacing:-1px;word-spacing:0px;fill:#000000;fill-opacity:1;stroke:none;font-family:Armalite Rifle;-inkscape-font-specification:Armalite Rifle"
+ d="m 258.625,595.8125 c -4.89966,1.4313 -12.56953,-1.70866 -15.1875,4.5625 -0.4775,5.90634 -3.5509,14.50575 2.71875,18.6875 2.28891,1.18746 5.12,1.54986 7.5625,0.59375 0.52227,3.72431 1.0541,7.99473 -2.03125,10.59375 -3.51238,6.69348 3.86364,14.87896 10.90625,12.96875 6.54546,1.2404 16.20527,-0.87285 16.34375,-9 1.15076,-4.65522 -4.58661,-6.69297 -3.46875,-11.1875 -0.95739,-2.94159 3.31489,-1.69978 4.46875,-3.78125 5.83868,-2.11249 5.55685,-9.07334 5.53125,-14.34375 1.81324,-6.47371 -5.8435,-9.85183 -11.15625,-8.5625 -4.34595,0.15294 -9.06169,-1.83389 -13.21875,-0.125 0.0516,-2.21144 -1.36209,-0.68823 -2.46875,-0.40625 z"
+ id="path3211"
+ inkscape:connector-curvature="0" />
+ <path
+ style="font-size:52.50814056px;font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;line-height:125%;letter-spacing:-1px;word-spacing:0px;fill:#000000;fill-opacity:1;stroke:none;font-family:Armalite Rifle;-inkscape-font-specification:Armalite Rifle"
+ d="m 286.25,592.6875 c -2.39783,0.63195 -3.74457,2.90332 -6.59375,2.8125 -5.4632,2.29227 -6.35616,10.35289 -2.0625,14.25 -0.60542,4.15669 0.70607,8.39731 0.4375,12.3125 -0.0599,3.57375 -1.98208,6.31549 -3.3125,9.34375 -1.62554,5.38708 2.55698,12.80186 8.96875,10.96875 6.47834,0.22337 16.30714,2.49861 19.125,-5.53125 1.23942,-3.73894 -0.38135,-7.90712 -3.59375,-10.09375 0.3082,-5.37065 -0.71586,-11.3191 0.59375,-16.375 6.74005,-4.69817 1.76294,-18.17585 -6.625,-15.0625 -2.79844,0.69065 -4.06188,-3.31293 -6.9375,-2.625 z"
+ id="path3213"
+ inkscape:connector-curvature="0" />
+ <path
+ style="font-size:52.50814056px;font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;line-height:125%;letter-spacing:-1px;word-spacing:0px;fill:#000000;fill-opacity:1;stroke:none;font-family:Armalite Rifle;-inkscape-font-specification:Armalite Rifle"
+ d="m 335.09375,595.625 c -6.11741,1.41046 -13.70548,-2.83773 -18.875,1.96875 -4.92676,-3.38655 -11.24855,-1.39485 -16.78125,-1.5 -6.41074,0.63929 -9.2314,9.80913 -3.875,13.375 -2.66087,6.08774 0.25237,13.48804 -1.21875,19.59375 -5.38108,5.18981 -0.0423,15.96693 7.46875,13.96875 4.45643,-0.22766 9.52169,0.6793 13.5,-0.25 1.52536,-2.4215 4.389,1.28979 6.875,0.4375 8.78077,1.24633 15.93879,-9.45985 11.28125,-17.03125 -1.13454,-1.93742 2.34919,-3.81652 1.59375,-6.40625 -0.24351,-4.08247 -1.98061,-8.55312 1.5625,-11.59375 2.06416,-4.14959 0.75484,-8.94395 1.0625,-13.375 -0.86458,0.27083 -1.72917,0.54167 -2.59375,0.8125 z"
+ id="path3215"
+ inkscape:connector-curvature="0" />
+ <path
+ style="font-size:52.50814056px;font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;line-height:125%;letter-spacing:-1px;word-spacing:0px;fill:#000000;fill-opacity:1;stroke:none;font-family:Armalite Rifle;-inkscape-font-specification:Armalite Rifle"
+ d="m 362.71875,595.53125 c -4.88629,0.1191 -10.06204,0.70685 -14.78125,0.75 -5.47787,-0.76679 -11.36437,-0.40783 -16.78125,-0.15625 -5.17104,2.08849 -5.75771,9.90066 -1.65625,13.3125 -0.73815,5.29915 0.55713,11.35287 -0.28125,16.21875 -1.57391,2.43976 0.0174,5.43494 -1.9375,7.65625 -1.21338,8.01052 8.60308,12.27891 15.15625,10.1875 4.10866,1.15111 8.03361,-0.96492 11.90625,0.75 4.70244,-0.0919 9.41322,-0.76127 13.9375,-1.21875 6.34357,-2.47232 7.27867,-12.62071 1.1875,-15.90625 -2.84504,-3.85906 -6.71699,-8.25024 -7.5,-12.8125 2.57537,-4.33547 10.38664,-3.74912 10.125,-10.0625 0.19504,-4.87459 -4.47645,-9.43549 -9.375,-8.71875 z"
+ id="path3217"
+ inkscape:connector-curvature="0" />
+ <path
+ style="font-size:52.50814056px;font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;line-height:125%;letter-spacing:-1px;word-spacing:0px;fill:#000000;fill-opacity:1;stroke:none;font-family:Armalite Rifle;-inkscape-font-specification:Armalite Rifle"
+ d="m 387.9375,595.15625 c -4.67722,2.02978 -9.78906,-1.62403 -14.46875,1.25 -9.65979,4.02935 -13.06716,17.5954 -7.09375,25.71875 -5.60204,3.65765 -3.86108,11.71823 -2.5625,17.15625 1.89135,4.23664 7.4795,4.74734 11.125,3.125 3.94271,1.07416 7.9082,-0.0824 11.78125,1.1875 12.90654,0.16282 22.05847,-17.35307 13.34375,-27.46875 4.21701,-4.46396 3.58479,-12.34862 1.53125,-17.90625 -3.12179,-4.23683 -8.89538,-1.69513 -13.1875,-3.09375 l -0.46875,0.0312 z"
+ id="path3219"
+ inkscape:connector-curvature="0" />
+ <path
+ style="font-size:52.50814056px;font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;line-height:125%;letter-spacing:-1px;word-spacing:0px;fill:#000000;fill-opacity:1;stroke:none;font-family:Armalite Rifle;-inkscape-font-specification:Armalite Rifle"
+ d="m 413.09375,593.625 c -5.989,0.79809 -12.31873,3.77439 -13.59375,10.28125 -2.37552,6.92367 2.58427,13.98287 3.0625,20.28125 -6.66505,6.69348 -1.32209,20.82556 8.75,19.25 7.10297,0.39661 12.84047,-7.75209 9.8125,-14.21875 0.3156,-2.89071 -3.70654,-4.76237 -1.46875,-7.53125 2.44848,-7.39695 6.24638,-18.36454 -1.53125,-23.75 -0.23875,-2.6484 -2.19852,-4.85675 -5.03125,-4.3125 z"
+ id="path3221"
+ inkscape:connector-curvature="0" />
+ </g>
+ <g
+ style="stroke:#000000;stroke-width:3.85294461;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ transform="matrix(0.53191035,-0.53191037,0.53191037,0.53191035,-153.38921,657.46125)"
+ inkscape:label="#g3769"
+ id="use2992">
+ <rect
+ style="fill:#383838;fill-opacity:1;stroke:#000000;stroke-width:3.85294461;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ id="rect3153"
+ width="8.5714283"
+ height="102.14286"
+ x="456.42859"
+ y="320.93359" />
+ <path
+ sodipodi:type="arc"
+ style="fill:#383838;fill-opacity:1;stroke:#000000;stroke-width:2.740417;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ id="path3155"
+ sodipodi:cx="427.14285"
+ sodipodi:cy="438.79074"
+ sodipodi:rx="29.285715"
+ sodipodi:ry="29.285715"
+ d="m 456.42857,438.79074 c 0,16.17405 -13.11166,29.28572 -29.28572,29.28572 -16.17405,0 -29.28571,-13.11167 -29.28571,-29.28572 0,-16.17405 13.11166,-29.28571 29.28571,-29.28571 16.17406,0 29.28572,13.11166 29.28572,29.28571 z"
+ transform="matrix(1.4059702,0,0,1.4059702,-139.83581,-163.85023)" />
+ <rect
+ style="fill:#383838;fill-opacity:1;stroke:#000000;stroke-width:3.85294461;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ id="rect3157"
+ width="15"
+ height="23.571428"
+ x="453.21432"
+ y="309.50504" />
+ <path
+ transform="matrix(1.5854423,0,0,5.0615034,-216.49604,-1767.8643)"
+ d="m 456.42857,438.79074 c 0,16.17405 -13.11166,29.28572 -29.28572,29.28572 -16.17405,0 -29.28571,-13.11167 -29.28571,-29.28572 0,-16.17405 13.11166,-29.28571 29.28571,-29.28571 16.17406,0 29.28572,13.11166 29.28572,29.28571 z"
+ sodipodi:ry="29.285715"
+ sodipodi:rx="29.285715"
+ sodipodi:cy="438.79074"
+ sodipodi:cx="427.14285"
+ id="path3160"
+ style="opacity:0;fill:#383838;fill-opacity:1;stroke:#000000;stroke-width:1.44432509;stroke-linecap:round;stroke-linejoin:round;stroke-miterlimit:4;stroke-opacity:1;stroke-dasharray:none"
+ sodipodi:type="arc" />
+ </g>
+ <text
+ sodipodi:linespacing="125%"
+ id="text2994"
+ y="735.54163"
+ x="251.05626"
+ style="font-size:50.25947571px;font-style:normal;font-weight:normal;line-height:125%;letter-spacing:0px;word-spacing:0px;fill:#e6e6e6;fill-opacity:1;stroke:none;font-family:Sans"
+ xml:space="preserve"><tspan
+ style="font-style:normal;font-variant:normal;font-weight:normal;font-stretch:normal;letter-spacing:-0.9571749px;fill:#e6e6e6;fill-opacity:1;font-family:Armalite Rifle;-inkscape-font-specification:Armalite Rifle"
+ y="735.54163"
+ x="251.05626"
+ id="tspan2996"
+ sodipodi:role="line">TINKS!</tspan></text>
+ </g>
+ </g>
+</svg>
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Android client with a joystick
+module android_client is
+ app_name "Tinks!"
+ app_namespace "net.xymus.tinks"
+ android_manifest """<uses-permission android:name="android.permission.INTERNET" />"""
+ android_api_target 10
+end
+
+import mnit_android
+import android::audio
+import android::vibration
+import android::landscape
+
+intrude import client
+import controls
+
+redef class App
+
+ # Tank direction control
+ var joystick = new Joystick is lazy
+
+ redef var controls = new Array[Control].with_items(joystick) is lazy
+
+ redef fun input(event)
+ do
+ var local_player = context.local_player
+ var local_tank = local_tank
+ if local_player != null and local_tank != null and event isa ControlEvent then
+ local_player.orders.add new TankDirectionOrder(local_tank, joystick.value_x, joystick.value_y)
+ return true
+ end
+
+ if event isa AndroidKeyEvent then
+ if event.is_back_key then
+ quit = true
+ native_activity.finish
+ return false
+ end
+ end
+
+ return super
+ end
+end
+
+redef class ExplosionEvent
+ redef fun client_react(display, turn)
+ do
+ super
+
+ var local_tank = app.local_tank
+ var d = 20
+ if local_tank != null then
+ d = local_tank.pos.dist(pos).to_i
+ d = 100 - d*5
+ d = d.max(10)
+ end
+
+ app.vibrator.vibrate d
+ end
+end
+
+# On-demand joystick that popups up when tapping the left border of the screen
+class Joystick
+ super Control
+
+ # Current position of the joystick from its center on the X axis, in `[-1.0..1.0]`
+ var value_x = 0.0
+
+ # Current position of the joystick from its center on the Y axis, in `[-1.0..1.0]`
+ var value_y = 0.0
+
+ # Deadzone at the center of the joystick where the values are set at 0.0
+ var deadzone = 0.3
+
+ # Position of the center of the joystick, set at where the screen is first tapped
+ var center: nullable ScreenPos
+
+ # Position of the top of the joystick, the one that follows the finger
+ var handle: nullable ScreenPos
+
+ # Id of the pointer/finger that triggered the joystick
+ var captured_pointer: Int = -1
+
+ # Image of the left border
+ var img_zone: Image = app.assets.drawing.joystick_zone
+
+ # Image of the joystick base
+ var img_back: Image = app.assets.drawing.joystick_back
+
+ # Image of the top of the joystick
+ var img_handle: Image = app.assets.drawing.joystick_handle
+
+ # Radius where the top of the joystick can move around the center
+ var radius: Float = img_back.width.to_f / 2.0 - 4.0
+
+ # Width of the left border used to trigger the joystick
+ var capture_width = 400.0
+
+ redef fun draw(display)
+ do
+ display.blit_stretched(img_zone,
+ 0, -128,
+ 0, display.height+128,
+ capture_width, display.height+128,
+ capture_width, -128)
+
+ var center = center
+ var handle = handle
+ if center != null and handle != null then
+ img_back.scale = 1.0
+ img_handle.scale = 1.0
+ display.blit_centered(img_back, center.x, center.y)
+ display.blit_centered(img_handle, handle.x, handle.y)
+ end
+ end
+
+ redef fun input(event)
+ do
+ if event isa AndroidPointerEvent then
+ var center = center
+ if center == null then
+ # New joystick?
+ print "New joystick? {event.just_went_down} {event.x} < {capture_width}"
+ if event.just_went_down and
+ event.x < capture_width then
+ # Capture it!
+ self.center = new ScreenPos(event.x, event.y)
+ self.captured_pointer = event.pointer_id
+ self.handle = center
+ return true
+ end
+ else
+ # Already down
+
+ # Is it the finger already on the joystick?
+ if captured_pointer != event.pointer_id then return false
+
+ if event.depressed then
+ self.center = null
+ self.handle = null
+ self.value_x = 0.0
+ self.value_y = 0.0
+ else
+ # Update values
+ var dx = center.x - event.x
+ var dy = center.y - event.y # This is inverted, as is the input
+ var d = dx.hypot_with(dy)
+ if d < deadzone then
+ self.value_x = 0.0
+ self.value_y = 0.0
+ self.handle = center
+ else
+ var a = atan2(dx, dy)+pi/2.0
+ self.value_x = a.cos
+ self.value_y = a.sin
+
+ if d > radius then d = radius
+ self.handle = new ScreenPos(center.x+a.cos*d, center.y-a.sin*d)
+ end
+ end
+
+ app.input new ControlEvent(self)
+ return true
+ end
+ end
+
+ return false
+ end
+end
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Client `Assets` and client-only services on game elements
+module assets is no_warning("attr-in-refinement")
+
+import app::audio
+
+import game
+
+import drawing
+
+redef class App
+ redef fun load_image(path)
+ do
+ var img = super
+ img.scale = 0.5
+ return img
+ end
+end
+
+redef class FeatureRule
+ # Images of different alternatives
+ var images: Array[Image]
+end
+
+redef class TankRule
+ # Image of the base tank structure, at different health level
+ var base_images: Array[Image]
+
+ # Image of the turret
+ var turret_image: Image
+end
+
+redef class Feature
+ # Rotation angle of this feature
+ var angle: Float = pi.rand
+
+ # Index within `rule.images` of the image of this instance
+ var image_index: Int = rule.images.length.rand is lazy
+end
+
+# Collection of assets
+class Assets
+
+ # Images from the `art/drawing.svg` file
+ var drawing = new DrawingImages
+ init do drawing.load_all(app)
+
+ # Firing sound
+ var turret_fire = new Sound("sounds/turret_fire.wav")
+
+ # Turret is ready to fire sound
+ var turret_ready = new Sound("sounds/turret_ready.mp3")
+
+ # Associate images to the `story` rules
+ fun assign_images_to_story(story: Story)
+ do
+ story.tree.images = drawing.trees
+ story.rock.images = drawing.rock
+ story.debris.images = drawing.debris
+
+ for tank in story.tanks do
+ tank.base_images = drawing.tank_hit
+ tank.turret_image = drawing.turret
+ end
+
+ story.health.images = [drawing.health]
+ end
+end
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Portable client
+module client
+
+import mnit
+import mnit::opengles1
+import performance_analysis
+
+import game
+import common
+
+import assets
+import context
+
+# A position within the screen
+class ScreenPos
+ super Point[Float]
+
+ # Convert to a game logic `Pos` by applying camera transformation
+ fun to_logic(camera: Camera): Pos do
+ return new Pos(x/camera.basic_zoom + camera.dx, y/camera.basic_zoom + camera.dy)
+ end
+end
+
+redef class Pos
+ # Convert to a `ScreenPos` by applying camera transformation
+ fun to_screen(camera: Camera): ScreenPos do
+ return new ScreenPos((x - camera.dx) * camera.basic_zoom, (y - camera.dy) * camera.basic_zoom)
+ end
+end
+
+# Camera managing the screen view on the world
+class Camera
+ # Offset of the top left corner of the screen, X part
+ var dx = 0.0
+
+ # Offset of the top left corner of the screen, Y part
+ var dy = 0.0
+
+ # Basic zoom, the distance between 2 features
+ #
+ # In the world logic, the distance is of 1.
+ # This value depends on the size of the graphical assets.
+ #
+ # TODO make it a full zoom by scaling images too, if needed.
+ var basic_zoom = 32.0
+
+ # Center of the `display` as world `Pos`
+ fun center(display: Display): Pos
+ do
+ return (new ScreenPos(display.width.to_f * 0.5, display.height.to_f * 0.5)).to_logic(self)
+ end
+
+ # Center the `display` on the world `pos`
+ fun center_on(display: Display, pos: Pos)
+ do
+ self.dx = pos.x - display.width.to_f * 0.5 / basic_zoom
+ self.dy = pos.y - display.height.to_f * 0.5 / basic_zoom
+ end
+end
+
+redef class App
+
+ # Collection of assets
+ var assets = new Assets is lazy
+
+ redef fun on_create
+ do
+ super
+ maximum_fps = 60
+ assets.assign_images_to_story context.game.story
+ end
+
+ # Camera managing transformation between world and screen positions
+ var camera = new Camera
+
+ # Context of the game, either local or remote
+ var context: GameContext is lazy do
+
+ # Server info
+ var address = null
+ var port = default_listening_port
+
+ if args.not_empty then
+ # Use first argument as the server address
+ address = args[0]
+ if args.length > 1 then port = args[1].to_i
+ else
+ print "Looking for a server..."
+
+ var s = new UDPSocket
+ s.enable_broadcast = true
+ s.blocking = false
+ s.broadcast(discovery_port, "Server? {handshake_app_name}")
+ nanosleep(0, 100_000_000)
+
+ var ptr = new Ref[nullable SocketAddress](null)
+ var resp = s.recv_from(1024, ptr)
+ var src = ptr.item
+
+ if not resp.is_empty then
+ var words = resp.split(" ")
+ if words.length == 3 and words[0] == "Server!" and words[1] == handshake_app_name and words[2].is_numeric then
+ address = src.address
+ port = words[2].to_i
+ end
+ end
+ end
+
+ if address == null then
+ print "Launching a local server"
+
+ # No command line
+ return new LocalServerContext
+ else
+ print "Connecting to:{address}:{port}"
+ maximum_fps = 0
+
+ # Args are: tinks server_address {port}
+ #var address = "riph" # args[0]
+ #var port = sys.default_listening_port
+ if args.length > 1 then port = args[1].to_i
+
+ # Setup connection config
+ var server_config = new RemoteServerConfig(address, port)
+ var server = new RemoteServer(server_config)
+
+ # Connect then complete handshake
+ assert server.connect else print_error "Connection to server failed with {server.socket.last_error or else "none"}"
+ assert server.handshake else print_error "Handshake with server failed"
+
+ # Download and setup remote game
+ var context = new RemoteGameContext(server)
+ context.setup
+
+ return context
+ end
+ end
+
+ # `Tank` of the local player, if any
+ fun local_tank: nullable Tank
+ do
+ # FIXME use a ? to one line this
+ var local_player = context.local_player
+ if local_player == null then return null
+ return local_player.tank
+ end
+
+ # Square of the minimum distance from the tank for an object to be "far"
+ #
+ # This value influences which sounds are heard,
+ # the strength of vibrations and
+ # whether an arrow points to a far unit
+ private var far_dist2 = 2000.0
+
+ # Tank tracks tracks on the ground
+ #
+ # TODO use particles or at least optimize drawing
+ var tracks = new List[Couple[Pos, Float]]
+
+ redef fun frame_core(display)
+ do
+ var clock = new Clock
+
+ var turn = context.do_turn
+ sys.perfs["do_turn"].add clock.lapse
+
+ # Draw
+
+ # Update camera
+ if down_keys.has("left") then camera.dx -= 1.0
+ if down_keys.has("right") then camera.dx += 1.0
+ if down_keys.has("up") then camera.dy -= 1.0
+ if down_keys.has("down") then camera.dy += 1.0
+
+ var local_tank = local_tank
+ if local_tank != null then
+ var tank_speed = local_tank.direction_forwards*local_tank.rule.max_speed
+ tank_speed = tank_speed.min(0.5).max(-0.5)
+
+ var prop_pos = local_tank.pos + local_tank.heading.to_vector(tank_speed * 16.0)
+ var old_pos = camera.center(display)
+ var half = old_pos.lerp(prop_pos, 0.02)
+
+ camera.center_on(display, new Pos(half.x, half.y))
+ end
+
+ # Grass
+ display.clear(0.0, 0.45, 0.0)
+
+ # Past tank tracks
+ for track in tracks do
+ var pos = track.first.to_screen(camera)
+ display.blit_rotated(assets.drawing.track, pos.x, pos.y, track.second)
+ end
+
+ # Past blast sites
+ for blast in context.game.world.blast_sites do
+ var pos = blast.to_screen(camera)
+ display.blit_centered(assets.drawing.blast, pos.x, pos.y)
+ end
+
+ # Terrain features
+ var tl = (new ScreenPos(0.0, 0.0)).to_logic(camera)
+ var br = (new ScreenPos(display.width.to_f, display.height.to_f)).to_logic(camera)
+ for x in [tl.x.floor.to_i .. br.x.ceil.to_i] do
+ for y in [tl.y.floor.to_i .. br.y.ceil.to_i] do
+ var feature = context.game.world[x, y]
+ if feature != null then
+ var pos = feature.pos.to_screen(camera)
+ var image = feature.rule.images[feature.image_index]
+ display.blit_rotated(image, pos.x, pos.y, feature.angle)
+ end
+ end
+ end
+
+ # Tanks
+ for tank in context.game.tanks do
+ # Add random tracks
+ if (tank.direction_heading != 0.0 and 40.rand == 0) or
+ (tank.direction_forwards != 0.0 and 100.rand == 0) then
+
+ tracks.add new Couple[Pos, Float](tank.pos, tank.heading)
+ if tracks.length > 1000 then tracks.shift
+ end
+
+ # Get the player stencil
+ var player = tank.player
+ var stencil = null
+ if player != null then stencil = assets.drawing.stencils[player.stencil_index]
+
+ if camera.center(display).dist2(tank.pos) > far_dist2 then
+ var hw = (display.width/2).to_f
+ var hh = (display.height/2).to_f
+
+ var angle = camera.center(display).atan2(tank.pos)
+ var x = hw + angle.cos * (hw-128.0)
+ var y = hh + angle.sin * (hh-128.0)
+
+ var screen_pos = new ScreenPos(x, y)
+ display.blit_rotated(assets.drawing.arrow, screen_pos.x, screen_pos.y, angle)
+ if stencil != null then display.blit_rotated(stencil, screen_pos.x, screen_pos.y, angle)
+ continue
+ end
+
+ var screen_pos = tank.pos.to_screen(camera)
+
+ var damage = tank.rule.max_health - tank.health
+ damage = damage.max(0).min(tank.rule.base_images.length)
+
+ var base_image = tank.rule.base_images[damage]
+ display.blit_rotated(base_image, screen_pos.x, screen_pos.y, tank.heading)
+ if stencil != null then display.blit_rotated(stencil, screen_pos.x, screen_pos.y, tank.heading)
+ display.blit_rotated(tank.rule.turret_image, screen_pos.x, screen_pos.y, tank.turret.heading)
+
+ if debug then
+ var corners = tank.corners_at(new Couple[Pos, Float](tank.pos, tank.heading))
+ for c in corners do
+ var p = c.to_screen(camera)
+ display.blit_centered(assets.drawing.red_dot, p.x, p.y)
+ end
+ end
+ end
+
+ # Events
+ for event in turn.events do
+ event.client_react(display, turn)
+
+ if event isa ExplosionEvent then
+ var pos = event.pos.to_screen(camera)
+ display.blit_centered(assets.drawing.explosion, pos.x, pos.y)
+ else if event isa OpenFireEvent then
+ var tank = event.tank
+ var screen_pos = tank.pos.to_screen(camera)
+ display.blit_rotated(assets.drawing.turret_firing, screen_pos.x, screen_pos.y, tank.turret.heading)
+
+ if tank.pos.dist2(camera.center(display)) < far_dist2 then
+ assets.turret_fire.play
+ end
+ else if event isa TurretReadyEvent then
+ if event.tank.pos.dist2(camera.center(display)) < far_dist2 then
+ assets.turret_ready.play
+ end
+ end
+ end
+
+ # Gather and show some performance stats!
+ sys.perfs["draw"].add clock.lapse
+ if context.game.tick % 300 == 5 then print sys.perfs
+ end
+
+ # Keys currently down
+ #
+ # TODO find a nice API and move up to mnit/gamnit
+ var down_keys = new HashSet[String]
+
+ redef fun input(ie)
+ do
+ var local_tank = local_tank
+ var local_player = context.local_player
+
+ # Quit?
+ if ie isa QuitEvent or
+ (ie isa KeyEvent and ie.name == "escape") then
+
+ quit = true
+ return true
+ end
+
+ # Spawn a new tank?
+ if local_tank == null and local_player != null then
+ if (ie isa KeyEvent and ie.name == "space") or
+ (ie isa PointerEvent and ie.depressed) then
+
+ local_player.orders.add new SpawnTankOrder(local_player)
+ return true
+ end
+ end
+
+ if ie isa KeyEvent then
+
+ # Update `down_keys`
+ var name = ie.name
+ if ie.is_down then
+ down_keys.add name
+ else if down_keys.has(name) then
+ down_keys.remove name
+ end
+
+ # wasd to move tank
+ var direction_change = ["w", "a", "s", "d"].has(ie.name)
+ if direction_change and local_tank != null and local_player != null then
+ var forward = down_keys.has("w")
+ var backward = down_keys.has("s")
+ var left = down_keys.has("a")
+ var right = down_keys.has("d")
+
+ # Cancel contradictory commands
+ if forward and backward then
+ forward = false
+ backward = false
+ end
+
+ if left and right then
+ left = false
+ right = false
+ end
+
+ # Set movement and direction
+ var move = 0.0
+ if forward then
+ move = 0.5
+ else if backward then move = -0.5
+
+ var ori = 0.0
+ if left then
+ ori = -local_tank.rule.max_direction/2.0
+ else if right then ori = local_tank.rule.max_direction/2.0
+
+ # Activate to invert the orientation on reverse, (for at @R4p4Ss)
+ #if backward then ori = -ori
+
+ # Bonus when only moving or only turning
+ if not forward and not backward then ori *= 2.0
+ if not left and not right then move *= 2.0
+
+ # Give order
+ local_player.orders.add new TankDirectionOrder(local_tank, ori, move)
+ return true
+ end
+ end
+
+ # On click (or tap), aim and fire
+ if ie isa PointerEvent then
+
+ if ie.pressed and local_tank != null and local_player != null then
+ var target = (new ScreenPos(ie.x, ie.y)).to_logic(camera)
+ local_player.orders.add new AimAndFireOrder(local_tank, target)
+ return true
+ end
+ end
+
+ return false
+ end
+end
+
+redef class TEvent
+ fun client_react(display: Display, turn: TTurn) do end
+end
+
+redef class ExplosionEvent
+ redef fun client_react(display, turn)
+ do
+ var pos = pos.to_screen(app.camera)
+ display.blit_centered(app.assets.drawing.explosion, pos.x, pos.y)
+ end
+end
+
+redef class OpenFireEvent
+ redef fun client_react(display, turn)
+ do
+ var screen_pos = tank.pos.to_screen(app.camera)
+ display.blit_rotated(app.assets.drawing.turret_firing, screen_pos.x, screen_pos.y, tank.turret.heading)
+
+ if tank.pos.dist2(app.camera.center(display)) < app.far_dist2 then
+ # Within earshot
+ app.assets.turret_fire.play
+ end
+ end
+end
+
+redef class TurretReadyEvent
+ redef fun client_react(display, turn)
+ do
+ if tank.pos.dist2(app.camera.center(display)) < app.far_dist2 then
+ # Within earshot
+ app.assets.turret_ready.play
+ end
+ end
+end
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Provides context to abstract the exchanges with a local game or a remote game
+module context
+
+import gamnit::network
+
+import game
+intrude import game::players
+import server
+
+# Interface to a game
+abstract class GameContext
+
+ # The current game
+ var game: TGame
+
+ # The local player on this client, if any
+ var local_player: nullable Player = null
+
+ # Do a turn
+ fun do_turn: TTurn is abstract
+end
+
+# Simple local single-player game
+class LocalGameContext
+ super GameContext
+
+ noautoinit
+
+ init
+ do
+ # Create basic game
+ game = new TGame
+ var setup_turn = game.do_turn
+
+ var local_player = new Player
+ game.players.add local_player
+ self.local_player = local_player
+ setup_turn.spawn_tank local_player
+ end
+
+ redef fun do_turn do return game.do_turn
+end
+
+# Multiplayer game running on a remote server
+class RemoteGameContext
+ super GameContext
+
+ autoinit remote_server
+
+ # Remote server that controls the `game`
+ var remote_server: RemoteServer
+
+ # Setup `game` from `remote_server`
+ fun setup
+ do
+ var game = remote_server.reader.deserialize
+ var errors = remote_server.reader.errors
+ assert errors.is_empty else print_error errors.join("\n")
+ assert game isa TGame else print_error "Server sent a {game.class_name}"
+ self.game = game
+
+ var local_player = remote_server.reader.deserialize
+ errors = remote_server.reader.errors
+ assert errors.is_empty else print_error errors.join("\n")
+ assert local_player isa Player else print_error "Server sent a {local_player.class_name}"
+ self.local_player = local_player
+ end
+
+ redef fun do_turn
+ do
+ # Get turn from server
+ var turn = remote_server.reader.deserialize
+ var errors = remote_server.reader.errors
+ assert errors.is_empty else print_error errors.join("\n")
+ assert turn isa TTurn else print_error "Server sent a {turn.class_name}"
+
+ # Apply the turn locally
+ game.apply_turn turn
+
+ # Send orders to server
+ var local_player = local_player
+ if local_player != null and local_player.orders.not_empty then
+ remote_server.writer.serialize local_player.orders
+ remote_server.socket.flush
+ local_player.orders = new Array[TOrder]
+ end
+
+ return turn
+ end
+end
+
+# Local game ran by a server accepting other clients
+class LocalServerContext
+ super LocalGameContext
+
+ # The server managing the game and other clients
+ var server = new Server(default_listening_port)
+
+ init do server.game = game
+
+ redef fun do_turn do return server.do_turn
+end
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# On-screen alternative controls
+module controls
+
+import client
+
+redef class App
+
+ # All active UI controls
+ fun controls: Array[Control] is abstract
+
+ redef fun frame_core(display)
+ do
+ super
+
+ for control in controls do control.draw(display)
+ end
+
+ redef fun input(event)
+ do
+ for control in controls do
+ var hit = control.input(event)
+ if hit then return true
+ end
+
+ return super
+ end
+end
+
+# An event raised by a `Control`
+class ControlEvent
+ super InputEvent
+
+ # Sender control
+ var sender: Control
+end
+
+# UI control
+abstract class Control
+
+ # Draw `self` to `display`
+ fun draw(display: Display) do end
+
+ # Intercept and act upon events concerving `self`
+ fun input(event: InputEvent): Bool do return false
+end
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# GNU/Linux client with config saved to `config.json`
+module linux_client
+
+import mnit_linux
+import linux::audio
+import json::serialization
+
+import client
+
+# Configuration of the client
+class ClientConfig
+ serialize
+
+ # Resolution width
+ var res_x = 1920 is lazy
+
+ # Resolution height
+ var res_y = 1080 is lazy
+
+ # Should the client play sounds?
+ var play_sounds = true is lazy
+end
+
+redef class App
+ private var config_path: String = sys.program_name.dirname / "../config.json"
+
+ private var config: ClientConfig do
+ if config_path.file_exists then
+ var content = config_path.to_path.read_all
+ var deser = new JsonDeserializer(content)
+ var cc = deser.deserialize
+
+ if cc == null then
+ print_error "Client Error: Deserializing config file failed with {deser.errors.join(", ")}"
+ else if not cc isa ClientConfig then
+ print_error "Client Error: Deserializing config file failed, got '{cc}'"
+ # TODO simplify the previous lines with ? or similar
+ else return cc
+ end
+
+ # Save the default config to pretty Json
+ var cc = new ClientConfig
+ var json = cc.to_plain_json
+ json = json.replace(",", ",\n")
+ json.write_to_file config_path
+
+ return cc
+ end
+end
+
+redef class Display
+ redef fun wanted_width do return app.config.res_x
+ redef fun wanted_height do return app.config.res_y
+end
+
+redef class Sound
+ redef fun play do if app.config.play_sounds then super
+end
+
+redef class JsonDeserializer
+ # The only class we deserialize from pretty Json is ClientConfig
+ redef fun class_name_heuristic(object) do return "ClientConfig"
+end
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Services common to the client and server
+module common
+
+import gamnit::network
+
+redef class Sys
+ # Name of this app
+ redef fun handshake_app_name do return "tinks"
+
+ redef fun handshake_app_version do return "0.1"
+
+ # Default listening port of the server
+ fun default_listening_port: Int do return 18721
+
+ # Port to which clients send discovery requests
+ fun discovery_port: Int do return 18722
+end
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Structure of a client/server game, based on turns, events, orders and rules
+module framework is serialize
+
+import geometry
+import realtime
+
+# Main game object containing the world, players and tanks
+#
+# The game object is shared by both the client and the server.
+# So a method using the game object as visitor is to be executed client-side.
+class TGame
+
+ # `Story`, or rule book, with all the stats for this game
+ var story = new Story
+
+ # `Clock` timing the elapsed time between turns
+ private var clock = new Clock is noserialize
+
+ # Tick count of the last turn (The first turn as a tick of 0)
+ var tick: Int = -1
+
+ # Execute the next turn and return it as a `TTurn`
+ #
+ # This is to be executed server-side only.
+ fun do_turn: TTurn
+ do
+ var dt = clock.lapse
+ tick += 1
+
+ var turn = new TTurn(self, tick, dt.to_f, dt.millisec)
+ return turn
+ end
+
+ # Apply `turn` locally by updating `tick` and applying all events
+ #
+ # This is to be executed client-side only.
+ fun apply_turn(turn: TTurn)
+ do
+ tick = turn.tick
+ for event in turn.events do event.apply self
+ end
+end
+
+# A single turn of a `TGame`
+#
+# The turn object is created and populated by the server (using `TGame::do_turn`).
+# It is transmitted to the client but it cannot modify it.
+# So methods using the turn object as visitor are to be executed server-side.
+class TTurn
+
+ # `TGame` of which `self` is part of
+ var game: TGame
+
+ # Tick of this turn
+ var tick: Int
+
+ # Elapsed seconds since previous turn (as a `Float`)
+ var dts: Float
+
+ # Elapsed milliseconds since previous turn (as a `Int`)
+ var dt: Int
+
+ # `TEvent` that happened during this turn
+ #
+ # Events are added using `add`.
+ # This information is used to apply the turn client-side to update its game object.
+ # It is also used by effects on the UI and could be used by an AI.
+ var events: SequenceRead[TEvent] = new Array[TEvent]
+
+ # Add an `event` to `events` and apply it right away server-side
+ fun add(event: TEvent)
+ do
+ event.apply game
+ events.as(Array[TEvent]).add event
+ end
+end
+
+# Game event sent from the server to the client
+class TEvent
+
+ # Executed client-side to apply this event on the `game`
+ fun apply(game: TGame) do end
+end
+
+# An order sent from the client to the server
+class TOrder
+
+ # Apply order server-side on `turn`, usually spawns `GameEvent`
+ fun apply(turn: TTurn) do end
+end
+
+# An entity acting on each turn
+class TTurnable
+
+ # Act on `turn`
+ fun do_turn(turn: TTurn) do end
+end
+
+# A collection of `Rule` guiding the game
+#
+# Changing the story could (in theory) be enough to completely change the context of the game.
+# In _Tinks!_ however, we use this class lightly and fill it with static content.
+class Story
+end
+
+# Metadata of in game `Ruled` entities, keep their stats and assets in a single place
+class Rule
+
+ # `Story` to which `self` belongs
+ var story: Story
+end
+
+# A game entity with metadata in its `rule`
+class Ruled
+
+ # Kind of `Rule` for `rule`
+ type R: Rule
+
+ # Metadata of this entity
+ var rule: R
+end
+
+# Should the game show more information for debugging?
+fun debug: Bool do return false
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+import tanks
+import players
+import world
+import powerups
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Player related and tank spawning logic
+module players is serialize
+
+import tanks
+
+redef class TGame
+
+ # All the known players in the game
+ var players = new Array[Player]
+
+ redef fun do_turn
+ do
+ var turn = super
+ for player in players do
+ player.do_turn turn
+ end
+ return turn
+ end
+end
+
+redef class TTurn
+
+ # Range around the center of the world (0, 0) where a tank can spawn
+ var spawn_range = 256.0
+
+ # Spawn a new tank for `player`
+ fun spawn_tank(player: Player)
+ do
+ var pos = new Pos(spawn_range.rand, spawn_range.rand)
+ var tank = new Tank(game.story.tanks.rand, pos, 2.0*pi.rand)
+
+ if tank.next_move_collisions(self).not_empty then
+ # Clear the way
+ game.world.explode(self, pos, 3)
+ end
+
+ add new TankSpawnEvent(tank, player)
+ end
+end
+
+# A player in the game
+class Player
+ super TTurnable
+
+ # Queue of orders to apply at the end of the turn
+ var orders = new Array[TOrder]
+
+ # The tank controlled by this player, if any
+ var tank: nullable Tank = null
+
+ # Index of the "unique" player stencil applied on all its tanks
+ var stencil_index: Int do
+ var counter = once new Ref[Int](0)
+ var val = counter.item
+ counter.item = (counter.item+1) % 4
+ return val
+ end
+
+ redef fun do_turn(turn)
+ do
+ # Apply orders if they are legal
+ for order in orders do
+ if order.is_legal(turn.game, self) then
+ order.apply turn
+ else print "Server Warning: Order {order} is now illegal"
+ end
+
+ orders.clear
+ end
+end
+
+redef class Tank
+ # The player controlling this tank, if any
+ var player: nullable Player = null
+end
+
+redef class TOrder
+
+ # Is this order (still) legal?
+ #
+ # This is executed client-side.
+ fun is_legal(game: TGame, issed_by: Player): Bool do return true
+end
+
+redef abstract class TankOrder
+ redef fun is_legal(game, issed_by) do return issed_by == tank.player
+end
+
+# A request to spawn a new tank
+class SpawnTankOrder
+ super TOrder
+
+ # Requester
+ var player: Player
+
+ redef fun is_legal(turn, issed_by) do return issed_by == player and player.tank == null
+
+ redef fun apply(turn)
+ do
+ turn.spawn_tank player
+ end
+end
+
+# A new tank appeared
+class TankSpawnEvent
+ super TEvent
+
+ # The new tank
+ var tank: Tank
+
+ # The `tank` owner
+ var player: nullable Player
+
+ redef fun apply(game)
+ do
+ var player = player
+ if player != null then player.tank = tank
+ tank.player = player
+ game.tanks.add tank
+ end
+end
+
+redef class TankDeathEvent
+
+ redef fun apply(game)
+ do
+ super
+
+ # `player` has no tank anymore
+ var player = tank.player
+ if player != null then
+ player.tank = null
+ end
+ end
+end
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Support for pickable powerups (only health for now)
+module powerups is serialize
+
+import tanks
+
+# A powerup item
+class Powerup
+ super Feature
+ redef type R: PowerupRule
+end
+
+# Metadata of a powerup item
+class PowerupRule
+ super FeatureRule
+
+ # Restore all health when picked up
+ var restore_health: Bool
+end
+
+redef class Story
+ # A powerup that restores all health
+ var health = new PowerupRule(self, 2, true)
+
+ # All `PowerupRule` in this story
+ var powerups: Array[PowerupRule] = [health]
+end
+
+redef class Tank
+
+ redef fun destroy(turn)
+ do
+ super
+
+ # Put a random powerup at the center of the old tank
+ var pos = new Pos(pos.x.floor+0.5, pos.y.floor+0.5)
+ var powerup = new Powerup(turn.game.story.powerups.rand, pos)
+ turn.add new FeatureChangeEvent(powerup, pos)
+
+ # Add some debris around it
+ var forward = new Pos((pos.x+heading.cos*1.1).floor+0.5, (pos.y+heading.sin*1.1).floor+0.5)
+ var backward = new Pos((pos.x-heading.cos*1.1).floor+0.5, (pos.y-heading.sin*1.1).floor+0.5)
+ turn.add new FeatureChangeEvent(new Feature(turn.game.story.debris, forward), forward)
+ turn.add new FeatureChangeEvent(new Feature(turn.game.story.debris, backward), backward)
+ end
+
+ # Intercept collision detection of "absorb" powerups
+ #
+ # This is a wee bit hackish.
+ # The collision detection on tank move can return a max of 4 items (1 per side).
+ # If there is powerups, they may have hidden other features.
+ # This could cause the tank to move over a feature and get stuck.
+ # This is not a big problem as the tank can open fire to liberate itself,
+ # or even simply go back as the speed is static.
+ redef fun next_move_collisions(turn)
+ do
+ var collisions = super
+ if collisions.is_empty then return collisions
+
+ for coll in collisions do if not coll isa Powerup then
+ # An unavoidable collision
+ return collisions
+ end
+
+ # Only powerups! absorb them
+ for powerup in collisions do
+ if powerup isa Powerup then
+ turn.add new FeatureChangeEvent(null, powerup.pos)
+
+ if powerup.rule.restore_health then
+ turn.add new TankHealthChange(self, rule.max_health)
+ end
+ end
+ end
+
+ return new HashSet[Feature]
+ end
+end
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Tank and tank turret related logic
+module tanks is serialize
+
+import world
+
+redef class TGame
+ # All of the tanks in game
+ var tanks = new TankSet
+
+ redef fun do_turn
+ do
+ var turn = super
+ for tank in tanks do tank.do_turn turn
+ return turn
+ end
+end
+
+# Stats of a tank kind, its config should be move to the `Story` if we want more than 1
+class TankRule
+ super Rule
+
+ # Width of this tank
+ var width: Float = 64.0/32.0
+
+ # Height of this tank
+ var length: Float = 100.0/32.0
+
+ # Maximum `health` this tank can normally have
+ var max_health = 4
+
+ # Maximum speed of this tank (in world coordinate units per seconds)
+ var max_speed = 2.0
+
+ # Turret turning speed (in radians per second)
+ var turret_turn_speed = 1.6
+
+ # Waiting time between shots can be fired
+ var turret_cooldown_time = 2.0
+
+ # Maximum `direction_heading` heading, may be double
+ var max_direction = 1.0
+end
+
+redef class Story
+ # The main (and only) tank configuration in this game
+ var tanks: Array[TankRule] = [new TankRule(self)]
+end
+
+# A tank!
+class Tank
+ super TTurnable
+ super Ruled
+ redef type R: TankRule
+
+ # In world `Pos` of this entity
+ var pos: Pos
+
+ # Orientation of this entity
+ var heading: Float
+
+ # The turret mounted on this tank
+ var turret = new Turret(self)
+
+ # Commanded direction
+ var direction_heading = 0.0
+
+ # Commanded speed
+ var direction_forwards = 0.0
+
+ # Health of this tank, out of `rule.max_health`
+ var health: Int = rule.max_health is lazy
+
+ redef fun do_turn(turn)
+ do
+ var collisions = next_move_collisions(turn)
+
+ if collisions.is_empty then
+ var next = normal_next_pos(turn)
+ self.pos = next.first
+ self.heading = next.second
+ end
+
+ turret.do_turn turn
+
+ turn.add new TankMoveEvent(self, pos, direction_heading, direction_forwards, heading, turret.relative_heading)
+ end
+
+ # What would be the next position if not blocked by terrain features?
+ #
+ # Returns a couple of the new position and heading.
+ fun normal_next_pos(turn: TTurn): Couple[Pos, Float]
+ do
+ var heading = (heading + direction_heading * turn.dts).angle_normalize
+
+ var speed = direction_forwards * rule.max_speed * turn.dts
+ var pos = pos
+ if speed != 0.0 then
+ pos += heading.to_vector(speed)
+ end
+
+ return new Couple[Pos, Float](pos, heading)
+ end
+
+ # Damage this tank, server-side
+ fun hit(turn: TTurn)
+ do
+ var damage = 1
+ var health = health - damage
+
+ if health <= 0 then
+ destroy turn
+ else
+ turn.add new TankHealthChange(self, health)
+ end
+ end
+
+ # Destroy this tank, server-side
+ fun destroy(turn: TTurn)
+ do
+ turn.add new TankDeathEvent(self)
+ turn.game.world.explode(turn, pos, 3)
+ end
+
+ # Collisions on the next move
+ fun next_move_collisions(turn: TTurn): HashSet[Feature]
+ do
+ var next = normal_next_pos(turn)
+ var features = new HashSet[Feature]
+
+ # Use the lines between the corners to detect collisions
+ var corners = corners_at(next)
+ var prev_corner = corners.last
+ for corner in corners do
+ var feature = turn.game.world.first_collision(prev_corner, corner)
+ if feature != null then features.add feature
+ prev_corner = corner
+ end
+
+ return features
+ end
+
+ # Get the 4 corners at a `next` position
+ fun corners_at(next: Couple[Pos, Float]): Array[Pos]
+ do
+ var next_pos = next.first
+ var heading = next.second
+
+ var corners = new Array[Pos]
+
+ var hwy = rule.width/2.0 * (heading+pi/2.0).sin
+ var hwx = rule.width/2.0 * (heading+pi/2.0).cos
+ var hly = rule.length/2.0 * heading.sin
+ var hlx = rule.length/2.0 * heading.cos
+ corners.add new Pos(next_pos.x + hlx + hwx, next_pos.y + hly + hwy)
+ corners.add new Pos(next_pos.x + hlx - hwx, next_pos.y + hly - hwy)
+ corners.add new Pos(next_pos.x - hlx - hwx, next_pos.y - hly - hwy)
+ corners.add new Pos(next_pos.x - hlx + hwx, next_pos.y - hly + hwy)
+
+ return corners
+ end
+end
+
+# A tank turret
+class Turret
+ super TTurnable
+
+ # The `Tank` on which is mounted this turret
+ var tank: Tank
+
+ # Orientation of this turret relative to the tank
+ var relative_heading = 0.0
+
+ # Absolute orientation of this turret
+ fun heading: Float do return (tank.heading+relative_heading).angle_normalize
+
+ # Current target to aim for and fire upon
+ var target: nullable Pos = null
+
+ # Seconds left before the turret can open fire again
+ var cooldown = 0.0
+
+ redef fun do_turn(turn)
+ do
+ if cooldown > 0.0 then
+ cooldown = cooldown - turn.dts
+
+ if cooldown <= 0.0 then
+ cooldown = 0.0
+
+ # Notify clients
+ turn.add new TurretReadyEvent(tank)
+ end
+ end
+
+ var target = target
+ if target != null then
+
+ var angle_to_target = tank.pos.atan2(target)
+ var d = (heading - angle_to_target).angle_normalize
+
+ var max_angle = tank.rule.turret_turn_speed * turn.dts
+ if d.abs < max_angle then
+ self.relative_heading = angle_to_target - tank.heading
+
+ if cooldown == 0.0 then
+ # On target, fire
+ fire turn
+ self.target = null
+ end
+ else
+ # Turn towards target
+ if d < 0.0 then
+ self.relative_heading += max_angle
+ else self.relative_heading -= max_angle
+ end
+ end
+ end
+
+ # Open fire!
+ fun fire(turn: TTurn)
+ do
+ var dst = target
+ assert dst != null
+
+ # Is there something between the tank and the target?
+ var hit = turn.game.world.first_collision(tank.pos, dst)
+ if hit != null then dst = hit.pos
+
+ # Events!
+ turn.add new OpenFireEvent(tank)
+ turn.game.world.explode(turn, dst, 2)
+
+ # The turret need time to reload, cooldown!
+ cooldown = tank.rule.turret_cooldown_time
+ end
+end
+
+redef class World
+ redef fun explode(turn, center, force)
+ do
+ super
+
+ for tank in game.tanks do
+ if tank.health == 0 then continue
+ if center.dist(tank.pos) <= force.to_f + 1.0 then
+ tank.hit turn
+ end
+ end
+ end
+end
+
+# A collection of `Tank` that could be optimized
+class TankSet
+ super HashSet[Tank]
+end
+
+# A `tank` centric order
+abstract class TankOrder
+ super TOrder
+
+ # The `Tank` at the center of this order
+ var tank: Tank
+end
+
+# A command to change the behavior of `tank`
+class TankDirectionOrder
+ super TankOrder
+
+ # Desired direction, in [-1.0..1.0]
+ var direction_heading: Float
+
+ # Desired speed, in [-1.0..1.0]
+ var direction_forwards: Float
+
+ redef fun apply(game)
+ do
+ # TODO use events
+ var direction_heading = direction_heading
+ direction_heading = direction_heading.min(1.0).max(-1.0)
+ tank.direction_heading = direction_heading*tank.rule.max_direction
+
+ var direction_forwards = direction_forwards
+ direction_forwards = direction_forwards.min(1.0).max(-1.0)
+ tank.direction_forwards = direction_forwards*tank.rule.max_speed
+ end
+end
+
+# Order to aim and fire at `target`
+class AimAndFireOrder
+ super TankOrder
+
+ # Target for the turret
+ var target: Pos
+
+ redef fun apply(game)
+ do
+ tank.turret.target = target
+ end
+end
+
+# A `tank` centric event
+abstract class TankEvent
+ super TEvent
+
+ # The `Tank` at the center of this event
+ var tank: Tank
+end
+
+# `tank` opens fire
+class OpenFireEvent
+ super TankEvent
+end
+
+# The turret of `tank` is ready to open fire
+class TurretReadyEvent
+ super TankEvent
+end
+
+# `tank` has been destroyed
+class TankDeathEvent
+ super TankEvent
+
+ redef fun apply(game)
+ do
+ tank.health = 0
+ game.tanks.remove tank
+ end
+end
+
+# The health of `tank` changes to `new_health`
+class TankHealthChange
+ super TankEvent
+
+ # The new health for `tank`
+ var new_health: Int
+
+ redef fun apply(game)
+ do
+ tank.health = new_health
+ end
+end
+
+# A `tank` moved
+#
+# TODO this event is too big, divide in 2 or more and move more logic client-side
+class TankMoveEvent
+ super TankEvent
+
+ # The position
+ var pos: Pos
+
+ # The direction of the "wheels"
+ var direction_heading: Float
+
+ # The speed
+ var direction_forwards: Float
+
+ # Orientation of the tank
+ var tank_heading: Float
+
+ # Orientation of the turret
+ var turret_heading: Float
+
+ redef fun apply(game)
+ do
+ tank.pos = pos
+ tank.direction_heading = direction_heading
+ tank.direction_forwards = direction_forwards
+ tank.heading = tank_heading
+ tank.turret.relative_heading = turret_heading
+ end
+end
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Physical world logic
+module world is serialize
+
+import noise
+import more_collections
+
+import framework
+
+redef class TGame
+ # The physical world in which this game happens
+ var world = new World(self)
+end
+
+# A terrain features (a rock, a tree, etc.)
+class Feature
+ super Ruled
+ redef type R: FeatureRule
+
+ # Top-left corner of this feature
+ var pos: Pos
+end
+
+# Metadata for a `Feature`
+class FeatureRule
+ super Rule
+
+ # Strength to resist on `World::explode`
+ var strength: Int
+end
+
+# The physical world of the `game`
+class World
+ # Associated `TGame`
+ var game: TGame
+
+ # Past blast sites
+ var blast_sites = new Array[Pos]
+
+ private var mountain_map: Noise do
+ var map = new PerlinNoise
+ map.period = 10.0
+ return map
+ end
+
+ private var forest_map: Noise do
+ var map = new PerlinNoise
+ map.period = 24.0
+ return map
+ end
+
+ # Cache of discovered features, also keeps tracks of changes
+ private var features_cache = new FeatureMap
+
+ # Get the `Feature` at `x, y`, if any
+ fun [](x, y: Int): nullable Feature
+ do
+ if features_cache.has(x, y) then return features_cache[x, y]
+
+ # Generate a feature from the noise map
+ var pos = new Pos(x.to_f+0.5, y.to_f+0.5)
+
+ var feature = null
+ if mountain_map[x.to_f, y.to_f] > 0.55 then
+ feature = new Feature(game.story.rock, pos)
+ else if forest_map[x.to_f, y.to_f] > 0.5 then
+ feature = new Feature(game.story.tree, pos)
+ end
+
+ # Update cache
+ features_cache[x, y] = feature
+
+ return feature
+ end
+
+ # Detect the first collision with a `Feature` from `src` to `dst`
+ #
+ # This is the main collision detection method used by tanks shots, and at tank movement.
+ # The idea is to check all cases between `src` and `dst` and return the first feature found.
+ # Returns `null` if there is no obstacle features.
+ #
+ # Example of the cases that would be checked between `s` and `d`:
+ #
+ # ~~~raw
+ # ................
+ # .s###...........
+ # ....######......
+ # .........####d..
+ # ................
+ # ~~~
+ fun first_collision(src, dst: Pos): nullable Feature
+ do
+ var going_left = dst.x < src.x
+ var angle = src.atan2(dst)
+ var slope = angle.tan
+
+ # Soften slopes approaching infinity
+ if slope > 100.0 then slope = 100.0
+ if slope < -100.0 then slope = -100.0
+
+ # For each column (over x) from src.x to dst.x
+ var x0 = src.x.floor.to_i
+ var x1 = dst.x.floor.to_i
+ for x in [x0 .. x1].smart_step do
+ var dx = x.to_f - src.x
+ var y0 = src.y + dx*slope
+ var y1 = src.y + (dx+1.0)*slope
+
+ var first = y0.floor.to_i
+ var last = y1.floor.to_i
+ if going_left then
+ # Invert the first and last element of the range
+ var swap = first
+ first = last
+ last = swap
+ end
+
+ # For each row (over y)
+ # from where the line enters the column to where it leaves it
+ for y in [first .. last].smart_step do
+ if not y.in_between_floats(src.y, dst.y) then continue
+
+ var feature = self[x.to_i, y]
+ if feature != null then return feature
+ end
+ end
+
+ return null
+ end
+
+ # Apply an explosion at `center` of the given `power`
+ fun explode(turn: TTurn, center: Pos, power: Int)
+ do
+ var x = center.x.floor.to_i
+ var y = center.y.floor.to_i
+ var range = [-power .. power]
+ var features = new Array[Feature]
+
+ for dx in range do
+ for dy in range do
+ var f = self[x+dx, y+dy]
+ var force = (power-dx.abs) + (power-dy.abs)
+ if f != null and f.rule.strength <= force then features.add f
+ end
+ end
+
+ turn.add new ExplosionEvent(center, power, features)
+ end
+end
+
+# Map of features organized by their coordinates
+#
+# The naive implementation is using a `HashMap2`.
+# This class can be redefed with optimizations as needed.
+class FeatureMap
+ super HashMap2[Int, Int, nullable Feature]
+end
+
+redef class Story
+ # Forest tree
+ var tree = new FeatureRule(self, 2)
+
+ # Big rock
+ var rock = new FeatureRule(self, 3)
+
+ # Metallic debris
+ var debris = new FeatureRule(self, 4)
+end
+
+# An explosion
+class ExplosionEvent
+ super TEvent
+
+ # Center of the explosion
+ var pos: Pos
+
+ # Power of the blast
+ var power: Int
+
+ # All the features this explosion destroys
+ var destroyed_features: Array[Feature]
+
+ redef fun apply(game)
+ do
+ for feature in destroyed_features do
+ game.world.features_cache[feature.pos.x.floor.to_i, feature.pos.y.floor.to_i] = null
+ end
+
+ game.world.blast_sites.add pos
+ if game.world.blast_sites.length > 100 then game.world.blast_sites.shift
+ end
+end
+
+# The feature at `pos` changes to `feature`
+class FeatureChangeEvent
+ super TEvent
+
+ # New `Feature`, if any
+ var feature: nullable Feature
+
+ # `Pos` of this change
+ var pos: Pos
+
+ redef fun apply(game)
+ do
+ game.world.features_cache[pos.x.floor.to_i, pos.y.floor.to_i] = feature
+ end
+end
+
+# ---
+# Services
+
+# Position in the world
+class Pos
+ super Point[Float]
+
+ # Add `self` to `other` and return the new position
+ fun +(other: Point[Float]): Pos
+ do
+ var nx = other.x.add(x)
+ var ny = other.y.add(y)
+ return new Pos(x.value_of(nx), y.value_of(ny))
+ end
+end
+
+redef universal Int
+ # Is `self` in between `a` and `b`?
+ #
+ # ~~~
+ # assert 1.in_between_floats(0.0, 2.0)
+ # assert 1.in_between_floats(2.0, 0.0)
+ # assert not 1.in_between_floats(2.0, 4.0)
+ # ~~~
+ fun in_between_floats(a, b: Float): Bool
+ do
+ var f = to_f
+ if a < b then return a.floor - 1.0 < f and f < b.ceil
+ return a.ceil > f and f > b.floor - 1.0
+ end
+end
+
+redef universal Float
+ # Get the vector with `self` as direction and the given `magnitude`
+ fun to_vector(magnitude: Float): Pos
+ do
+ return new Pos(cos*magnitude, sin*magnitude)
+ end
+end
+
+redef class Range[E]
+ # Step appropriately to go from `first` to `last`
+ #
+ # ~~~
+ # assert [1..3].smart_step.to_a == [1, 2, 3]
+ # assert [3..1].smart_step.to_a == [3, 2, 1]
+ # ~~~
+ fun smart_step: Iterator[E]
+ do
+ var step = 1
+ if first > last then step = -1
+ return self.step(step)
+ end
+end
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Dedicated server program
+module dedicated
+
+import server
+
+var port = sys.default_listening_port
+if args.length > 0 then port = args[0].to_i
+
+var server = new Server(port)
+server.run_dedicated
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Server to host multiplayer games
+module server
+
+import gamnit::network
+
+import game
+import common
+
+redef class RemoteClient
+ # `Player` associated to this client
+ var player = new Player
+end
+
+redef class Server
+ # `UDPSocket` to which clients send discovery requests
+ var discovery_socket: UDPSocket do
+ var s = new UDPSocket
+ s.blocking = false
+ s.bind(null, discovery_port)
+ return s
+ end
+
+ # The current game
+ var game = new TGame is lazy, writable
+
+ # Is this a dedicated server
+ var dedicated = false
+
+ # Create and run a new `Game`
+ fun run_dedicated
+ do
+ dedicated = true
+
+ # Setup game
+ print "Server: Setup game"
+ game
+
+ # Play
+ print "Server: Starting play"
+ loop do_turn
+ end
+
+ # Run the server logic over a single turn
+ fun do_turn: TTurn
+ do
+ var game = game
+
+ # Do game logic
+ var turn = game.do_turn
+
+ # Respond to discovery requests
+ loop
+ var ptr = new Ref[nullable SocketAddress](null)
+ var read = discovery_socket.recv_from(1024, ptr)
+
+ # No sender means there is no request (an error would also do it)
+ var sender = ptr.item
+ if sender == null then break
+
+ var words = read.split(" ")
+ if words.length != 2 or words[0] != "Server?" or words[1] != handshake_app_name then
+ print "Server Warning: Rejected discovery request '{read}'"
+ continue
+ end
+
+ discovery_socket.send_to(sender.address, sender.port,
+ "Server! {handshake_app_name} {self.port}")
+ end
+
+ # Setup clients
+ var new_clients = accept_clients
+ for client in new_clients do
+ # Register player and spawn first tank
+ game.players.add client.player
+ turn.spawn_tank client.player
+
+ client.writer.serialize game
+ client.writer.serialize client.player
+ client.socket.flush
+
+ clients.add client
+ end
+
+ if dedicated and clients.is_empty then
+ # No clients, sleep for a while
+ nanosleep(0, 10000000)
+ return turn
+ end
+
+ # Update clients
+ broadcast turn
+
+ # Get orders from players
+ var clients_to_remove = new Array[RemoteClient]
+ for client in clients do
+ if not client.socket.poll_in then continue
+
+ var orders = client.reader.deserialize
+ var errors = client.reader.errors
+ if errors.not_empty then
+ print_error "Comm Error: (Dropping client) {errors.join(", ")}"
+ clients_to_remove.add client
+ else if not orders isa Array[TOrder] then
+ if orders == null then
+ print_error "Comm Error: (Dropping client) Unexpected null"
+ else print_error "Comm Error: (Dropping client) Unexpected {orders.class_name}"
+ # TODO remove code duplication when we have ? or an equivalent
+
+ clients_to_remove.add client
+ else
+ client.player.orders.add_all orders
+ end
+ end
+
+ for client in clients_to_remove do clients.remove client
+
+ return turn
+ end
+end
all: bin/calculator bin/calculator.apk bin/test
-bin/calculator: $(shell ${NITLS} -M src/calculator.nit ../../lib/linux/ui.nit) ${NITC}
+bin/calculator: $(shell ${NITLS} -M src/calculator.nit -m linux) ${NITC}
mkdir -p bin
- ${NITC} -o $@ src/calculator.nit -m ../../lib/linux/ui.nit
+ ${NITC} -o $@ src/calculator.nit -m linux
-bin/calculator.apk: $(shell ${NITLS} -M src/calculator.nit ../../lib/android/ui/) ${NITC} ../../contrib/inkscape_tools/bin/svg_to_icons
+bin/calculator.apk: $(shell ${NITLS} -M src/calculator.nit -m android) ${NITC} ../../contrib/inkscape_tools/bin/svg_to_icons
mkdir -p bin res
../../contrib/inkscape_tools/bin/svg_to_icons art/icon.svg --android --out res/
- ${NITC} -o $@ src/calculator.nit -m ../../lib/android/ui/
+ ${NITC} -o $@ src/calculator.nit -m android
../../contrib/inkscape_tools/bin/svg_to_icons:
make -C ../../contrib/inkscape_tools/
var cavemen_incr = 4
var game : nullable Game = null
- var score = new Container[Int](0)
+ var score = new Ref[Int](0)
var imgs : nullable ImageSet = null
var splash : nullable SplashScreen = null
if game.won then
next_nbr_caveman += cavemen_incr
else
- score = new Container[Int](0)
+ score = new Ref[Int](0)
next_nbr_caveman = cavemen_at_first_level
end
game = new Game( next_nbr_caveman, score )
var over_since = 0
- var score: Container[Int]
+ var score: Ref[Int]
var random_radius_min = 200
var random_radius_max = 400
var entities_sorter = new EntitiesSorter
- init( cavemen_nbr : Int, score: Container[Int] )
+ init( cavemen_nbr : Int, score: Ref[Int] )
do
srand_from(cavemen_nbr)
end
end
-fun display_scale_container: Container[Float] do return once new Container[Float](0.1)
+fun display_scale_container: Ref[Float] do return once new Ref[Float](0.1)
redef fun display_scale do return display_scale_container.item
redef fun display_offset_x: Int do return (300.0*display_scale).to_i
redef fun display_offset_y: Int do return (800.0*display_scale).to_i
for i in [0..10[ do
var a = (['[', ']'] * n)
a.shuffle
- var b = a.join("")
+ var b = a.join
if is_balanced(b) then print "{b} is well-balanced" else print "{b} is not well-balanced"
end
--- /dev/null
+#!/usr/bin/env nit
+#
+# This file is part of NIT ( http://www.nitlanguage.org ).
+# This program is public domain
+
+# Task: Entropy
+# SEE: <http://rosettacode.org/wiki/Entropy>
+module entropy
+
+import counter
+
+# Basic implementation with a hashmap of chars to count them
+fun entropy(string: String): Float
+do
+ var cpt = new HashMap[Char, Int]
+ for char in string.chars do
+ var occ = cpt.get_or_default(char, 0)
+ cpt[char] = occ + 1
+ end
+
+ var len = string.length.to_f
+ var e = 0.0
+ for char, occ in cpt do
+ var freq = occ.to_f / len
+ e = e - freq * freq.log_base(2.0)
+ end
+ return e
+end
+print entropy("1223334444")
+
+# Alternative one-liner implementation using the `Counter::entropy` method of the library `counter`
+print "1223334444".chars.to_counter.entropy
--- /dev/null
+#!/usr/bin/env nit
+#
+# This file is part of NIT ( http://www.nitlanguage.org ).
+# This program is public domain
+
+# Task: Entropy/Narcissist
+# SEE: <http://rosettacode.org/wiki/Entropy/Narcissist>
+module entropy_narcissist
+
+import counter
+
+# Should be run in the right directory
+print "entropy_narcissist.nit".to_path.read_all.chars.to_counter.entropy
--- /dev/null
+#!/usr/bin/env nit
+#
+# This file is part of NIT ( http://www.nitlanguage.org ).
+# This program is public domain
+
+# Task: Fibonacci_word
+# SEE: <http://rosettacode.org/wiki/Fibonacci_word>
+module fibonacci_word
+
+import counter
+
+var words = new Array[String]
+words[0] = ""
+words[1] = "1"
+words[2] = "0"
+
+for i in [1..37] do
+ var w
+ if i >= words.length then
+ w = words[i-1] + words[i-2]
+ words[i] = w
+ else
+ w = words[i]
+ end
+ var out = w
+ if w.length > 40 then out = "..."
+ print "{i}\t{w.length}\t{w.chars.to_counter.entropy.to_precision(16)}\t{out}"
+end
var ary = "_###_##_#_#_#_#__#__".chars
loop
- print ary.join("")
+ print ary.join
var nxt = evolve(ary)
if ary == nxt then break
ary = nxt
--- /dev/null
+#!/usr/bin/env nit
+#
+# This file is part of NIT ( http://www.nitlanguage.org ).
+# This program is public domain
+
+# Simple Rosetta-code task : Parsing a S-Expression
+module s_exp
+
+import sexp
+
+var src = """((data "quoted data" 123 4.5)
+(data (!@# (4.5) "(more" "data)")))"""
+
+var sexp = src.to_sexp
+
+if sexp isa SExpError then
+ print sexp
+ exit(1)
+end
+
+print sexp
+
+if sexp isa SExp then print sexp.pretty_to_s
JNIEnv *env = Sys_jni_env(sys);
return (*env)->NewGlobalRef(env, self);
`}
+
+ # Notify the OS that this activity is done and should be closed
+ fun finish in "Java" `{ self.finish(); `}
end
import native_app_glue
import dalvik
private import log
-private import data_store
redef class App
redef fun init_window
# limitations under the License.
# Android audio services, wraps a part of android audio API
+# This module modifies the default behaviour of the audio loading:
+# It is first loaded from the `res/raw` folder.
+# The file extension is not needed for the `res/raw` loading part.
+# If it didn't work, it is loaded from the `assets` folder.
+# The file extension is needed for the `assets` loading part.
+#
+# `assets` contains the portable version of sounds, since the `res` folder exsists only in android projects.
#
# For this example, the sounds "test_sound" and "test_music" are located in the "assets/sounds" folder,
# they both have ".ogg" extension. "test_sound" is a short sound and "test_music" a music track
redef fun load do
if is_loaded then return
- var nam = app.asset_manager.open_fd(self.name)
- if nam.is_java_null then
- self.error = new Error("Failed to get file descriptor for " + self.name)
- var retval_resources = app.default_soundpool.load_name_rid(app.resource_manager, app.native_activity, self.name)
- if retval_resources == -1 then
- self.error = new Error("Failed to load" + self.name)
+ var retval_resources = app.default_soundpool.load_name_rid(app.resource_manager, app.native_activity, self.name.strip_extension)
+ if retval_resources == -1 then
+ self.error = new Error("failed to load" + self.name)
+ var nam = app.asset_manager.open_fd(self.name)
+ if nam.is_java_null then
+ self.error = new Error("Failed to get file descriptor for " + self.name)
else
- self.soundpool_id = retval_resources
- self.soundpool = app.default_soundpool
- self.error = null
- self.soundpool.error = null
+ var retval_assets = app.default_soundpool.load_asset_fd_rid(nam)
+ if retval_assets == -1 then
+ self.error = new Error("Failed to load" + self.name)
+ else
+ self.soundpool_id = retval_assets
+ self.soundpool = app.default_soundpool
+ self.error = null
+ self.soundpool.error = null
+ end
end
else
- var retval_assets = app.default_soundpool.load_asset_fd_rid(nam)
- if retval_assets == -1 then
- self.error = new Error("Failed to load" + self.name)
- else
- self.soundpool_id = retval_assets
- self.soundpool = app.default_soundpool
- self.error = null
- self.soundpool.error = null
- end
+ self.soundpool_id = retval_resources
+ self.soundpool = app.default_soundpool
+ self.error = null
+ self.soundpool.error = null
end
is_loaded = true
end
redef fun load do
if is_loaded then return
- var nam = app.asset_manager.open_fd(self.name)
- if nam.is_java_null then
- self.error = new Error("Failed to get file descriptor for " + self.name)
- var mp_sound_resources = app.default_mediaplayer.load_sound(app.resource_manager.raw_id(self.name), app.native_activity)
- if mp_sound_resources.error != null then
- self.error = mp_sound_resources.error
+ var mp_sound_resources = app.default_mediaplayer.load_sound(app.resource_manager.raw_id(self.name.strip_extension), app.native_activity)
+ if mp_sound_resources.error != null then
+ self.error = mp_sound_resources.error
+ var nam = app.asset_manager.open_fd(self.name)
+ if nam.is_java_null then
+ self.error = new Error("Failed to get file descriptor for " + self.name)
else
- self.media_player = app.default_mediaplayer
- self.error = null
- self.media_player.error = null
+ var mp_sound_assets = app.default_mediaplayer.data_source_fd(nam)
+ if mp_sound_assets.error != null then
+ self.error = mp_sound_assets.error
+ else
+ self.media_player = app.default_mediaplayer
+ self.error = null
+ self.media_player.error = null
+ end
end
else
- var mp_sound_assets = app.default_mediaplayer.data_source_fd(nam)
- if mp_sound_assets.error != null then
- self.error = mp_sound_assets.error
- else
- self.media_player = app.default_mediaplayer
- self.error = null
- self.media_player.error = null
- end
+ self.media_player = app.default_mediaplayer
+ self.error = null
+ self.media_player.error = null
end
is_loaded = true
end
# Retrieves a music with a media player in the `assets` folder using its name.
# Used to play long sounds or musics, can't play multiple sounds simultaneously
- redef fun load_music(path: String): Music do
+ redef fun load_music(path) do
var fd = asset_manager.open_fd(path)
if not fd.is_java_null then
return add_to_sounds(default_mediaplayer.data_source_fd(fd)).as(Music)
return AMotionEvent_getPointerCount(self);
`}
- # Did this motion event just started?
- fun just_went_down: Bool `{
- return (AMotionEvent_getAction(self) & AMOTION_EVENT_ACTION_MASK) == AMOTION_EVENT_ACTION_DOWN;
- `}
-
fun edge: Int `{
return AMotionEvent_getEdgeFlags(self);
`}
private extern class AMotionEventAction `{ int32_t `}
fun action: Int `{ return self & AMOTION_EVENT_ACTION_MASK; `}
+ # Pointer index concerned by this action
+ #
+ # Require: `is_pointer_down or is_pointer_up`
+ fun pointer_index: Int `{
+ return (self & AMOTION_EVENT_ACTION_POINTER_INDEX_MASK) >> AMOTION_EVENT_ACTION_POINTER_INDEX_SHIFT;
+ `}
+
fun is_down: Bool do return action == 0
fun is_up: Bool do return action == 1
fun is_move: Bool do return action == 2
private var native: NativeAndroidMotionEvent
- private var pointers_cache: nullable Array[AndroidPointerEvent] = null
-
# Pointers (or fingers) composing this motion event
- fun pointers: Array[AndroidPointerEvent]
- do
- if pointers_cache != null then
- return pointers_cache.as(not null)
- else
- var pointers = new Array[AndroidPointerEvent]
- var pointers_count = native.pointers_count
- for i in [0 .. pointers_count [do
- var pointer_event = new AndroidPointerEvent(self, i)
- pointers.add(pointer_event)
- end
- pointers_cache = pointers
- return pointers
+ var pointers: Array[AndroidPointerEvent] is lazy do
+ return [for i in native.pointers_count.times do new AndroidPointerEvent(self, i)]
+ end
+
+ # The pointer (or finger) causing this event
+ var acting_pointer: AndroidPointerEvent is lazy do
+ var action = native.action
+ var index = 0
+
+ if action.is_pointer_down or action.is_pointer_up then
+ index = native.action.pointer_index
end
+
+ return new AndroidPointerEvent(self, index)
end
- redef fun just_went_down: Bool do return native.just_went_down
+ redef fun just_went_down do return native.action.is_down or native.action.is_pointer_down
# Was the top edge of the screen intersected by this event?
fun touch_to_edge: Bool do return native.edge == 1
private var motion_event: AndroidMotionEvent
- private var pointer_id: Int
+ private var pointer_index: Int
- redef fun x: Float do return native_x(motion_event.native, pointer_id)
+ redef fun x do return native_x(motion_event.native, pointer_index)
- private fun native_x(motion_event: NativeAndroidMotionEvent, pointer_id: Int): Float `{
- return AMotionEvent_getX(motion_event, pointer_id);
+ private fun native_x(motion_event: NativeAndroidMotionEvent, pointer_index: Int): Float `{
+ return AMotionEvent_getX(motion_event, pointer_index);
`}
- redef fun y: Float do return native_y(motion_event.native, pointer_id)
+ redef fun y do return native_y(motion_event.native, pointer_index)
- private fun native_y(motion_event: NativeAndroidMotionEvent, pointer_id: Int): Float `{
- return AMotionEvent_getY(motion_event, pointer_id);
+ private fun native_y(motion_event: NativeAndroidMotionEvent, pointer_index: Int): Float `{
+ return AMotionEvent_getY(motion_event, pointer_index);
`}
# Pressure applied by this pointer
- fun pressure: Float do return native_pressure(motion_event.native, pointer_id)
+ fun pressure: Float do return native_pressure(motion_event.native, pointer_index)
- private fun native_pressure(motion_event: NativeAndroidMotionEvent, pointer_id: Int): Float `{
- return AMotionEvent_getPressure(motion_event, pointer_id);
+ private fun native_pressure(motion_event: NativeAndroidMotionEvent, pointer_index: Int): Float `{
+ return AMotionEvent_getPressure(motion_event, pointer_index);
`}
redef fun pressed
do
var action = motion_event.native.action
- return action.is_down or action.is_move
+ return action.is_down or action.is_move or action.is_pointer_down
end
+ # Is this a move event?
+ fun is_move: Bool do return motion_event.acting_pointer == self and
+ motion_event.native.action.is_move
+
redef fun depressed do return not pressed
# Does this pointer just began touching the screen?
- fun just_went_down: Bool
- do
- return motion_event.down_pointer == self
- end
+ fun just_went_down: Bool do return motion_event.acting_pointer == self and
+ motion_event.just_went_down
+
+ # Unique id of this pointer since the beginning of the gesture
+ fun pointer_id: Int do return native_pointer_id(motion_event.native, pointer_index)
+
+ private fun native_pointer_id(motion_event: NativeAndroidMotionEvent, pointer_index: Int): Int `{
+ return AMotionEvent_getPointerId(motion_event, pointer_index);
+ `}
end
# An hardware key event
private fun action: Int `{ return AKeyEvent_getAction(self); `}
- redef fun is_down: Bool do return action == 0
- redef fun is_up: Bool do return action == 1
+ redef fun is_down do return action == 0
+ redef fun is_up do return action == 1
# Hardware code of the key raising this event
fun key_code: Int `{ return AKeyEvent_getKeyCode(self); `}
# See the License for the specific language governing permissions and
# limitations under the License.
-# Config to set the landscape orientation
-module landscape is android_manifest_activity """
- android:screenOrientation="landscape"
-"""
+# Lock the application in the landscape orientation
+#
+# Adds `android:screenOrientation=="sensorLandscape"` to the manifest.
+module landscape is
+ android_api_min 9
+ android_manifest_activity """android:screenOrientation="sensorLandscape" """
+end
import platform
# limitations under the License.
# App audio abstraction
+# Default behaviour is loading the audio from the `assets` folder of the project with its name and extension
+# Platforms implementations can modify this comportement
#
# Once the application has started (after `App.setup`)
# use `App.load_sound` to get a sound
import app_base
import standard::error
+# Platform variations
+# TODO: move on the platform once qualified names are understand in the condition
+import linux::audio is conditional(linux)
+import android::audio is conditional(android)
+
# Abstraction of a playable Audio
abstract class PlayableAudio
# Is this already loaded ?
protected var is_loaded = false is writable
- # load this playable audio
+ # Load this playable audio
fun load is abstract
# Plays the sound
import app_base
import serialization
+# Platform variations
+# TODO: move on the platform once qualified names are understand in the condition
+import linux::data_store is conditional(linux)
+import android::data_store is conditional(android)
+
redef class App
# Services to store and load data
fun data_store: DataStore is abstract
import app_base
+# Platform variations
+# TODO: move on the platform once qualified names are understand in the condition
+import linux::ui is conditional(linux)
+import android::ui is conditional(android)
+
redef class App
super AppComponent
do
return "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"
end
- private fun inverted_base64_chars : HashMap[Char,Int]
+ private fun inverted_base64_chars : HashMap[Byte, Byte]
do
- var inv_base64_chars = new HashMap[Char,Int]
- for k in [0..base64_chars.length[ do
- inv_base64_chars[ base64_chars.chars[k] ] = k
+ var inv_base64_chars = new HashMap[Byte, Byte]
+ for k in [0..base64_chars.bytelen[ do
+ inv_base64_chars[base64_chars.bytes[k]] = k.to_b
end
return inv_base64_chars
end
# Encodes the receiver string to base64.
# By default, uses "=" for padding.
- fun encode_base64 : String do return encode_base64_custom_padding( '=' )
+ fun encode_base64 : String do return encode_base64_custom_padding('='.ascii.to_b)
# Encodes the receiver string to base64 using a custom padding character.
#
# If using the default padding character `=`, see `encode_base64`.
- fun encode_base64_custom_padding( padding : Char ) : String
+ fun encode_base64_custom_padding(padding : Byte) : String
do
- var base64_chars = once base64_chars
- var length = length
+ var base64_bytes = once base64_chars.bytes
+ var length = bytelen
var steps = length / 3
- var chars_in_last_step = length % 3
- var result_length = steps*4
- if chars_in_last_step > 0 then result_length += 4
- var result = (padding.to_s*result_length).to_cstring
+ var bytes_in_last_step = length % 3
+ var result_length = steps * 4
+ if bytes_in_last_step > 0 then result_length += 4
+ var result = new NativeString(result_length + 1)
+ var bytes = self.bytes
+ result[result_length] = 0u8
- var mask_6bit = 63
+ var mask_6bit = 0b0011_1111
- for s in [0..steps[ do
+ for s in [0 .. steps[ do
var e = 0
- for ss in [0..3[ do
- e += self.chars[s*3+ss].ascii.lshift((2-ss)*8)
+ for ss in [0 .. 3[ do
+ e += bytes[s * 3 + ss].to_i << ((2 - ss) * 8)
end
for ss in [0..4[ do
- result[s*4+3-ss] = base64_chars.chars[ e.rshift(ss*6).bin_and( mask_6bit ) ]
+ result[s * 4 + 3 - ss] = base64_bytes[(e >> (ss * 6)) & mask_6bit]
end
end
- if chars_in_last_step == 1 then
- var e = self.chars[length-1].ascii.lshift(16)
- for ss in [0..2[ do
- result[steps*4+1-ss] = base64_chars.chars[ e.rshift((ss+2)*6).bin_and( mask_6bit ) ]
- end
- else if chars_in_last_step == 2 then
- var e = self.chars[length-2].ascii.lshift(16) +
- self.chars[length-1].ascii.lshift(8)
- for ss in [0..3[ do
- result[steps*4+2-ss] = base64_chars.chars[ e.rshift((ss+1)*6).bin_and( mask_6bit ) ]
- end
+ var out_off = result_length - 4
+ var in_off = length - bytes_in_last_step
+ if bytes_in_last_step == 1 then
+ result[out_off] = base64_bytes[((bytes[in_off] & 0b1111_1100u8) >> 2).to_i]
+ result[out_off + 1] = base64_bytes[((bytes[in_off] & 0b0000_0011u8) << 4).to_i]
+ out_off += 2
+ else if bytes_in_last_step == 2 then
+ result[out_off] = base64_bytes[((bytes[in_off] & 0b1111_1100u8) >> 2).to_i]
+ result[out_off + 1] = base64_bytes[(((bytes[in_off] & 0b0000_0011u8) << 4) | ((bytes[in_off + 1] & 0b1111_0000u8) >> 4)).to_i]
+ result[out_off + 2] = base64_bytes[((bytes[in_off + 1] & 0b0000_1111u8) << 2).to_i]
+ out_off += 3
+ end
+ if bytes_in_last_step > 0 then
+ for i in [out_off .. result_length[ do result[i] = padding
end
- return result.to_s
+ return result.to_s_with_length(result_length)
end
# Decodes the receiver string from base64.
# By default, uses "=" for padding.
- fun decode_base64 : String do return decode_base64_custom_padding( '=' )
+ fun decode_base64 : String do return decode_base64_custom_padding('='.ascii.to_b)
# Decodes the receiver string to base64 using a custom padding character.
#
# If using the default padding character `=`, see `decode_base64`.
- fun decode_base64_custom_padding( padding : Char ) : String
+ fun decode_base64_custom_padding(padding : Byte) : String
do
- var inverted_base64_chars = once inverted_base64_chars
- var length = length
+ var inv = once inverted_base64_chars
+ var length = bytelen
+ if length == 0 then return ""
assert length % 4 == 0 else print "base64::decode_base64 only supports strings of length multiple of 4"
+ var bytes = self.bytes
var steps = length / 4
- var result_length = steps*3
-
- var padding_begin = self.search(padding)
- var padding_count : Int
- if padding_begin == null then
- padding_count = 0
- else
- padding_count = length - padding_begin.from
- steps -= 1
- result_length -= padding_count
- end
-
- var result = ("#"*result_length).to_cstring
-
- var mask_8bit = 255
-
- for s in [0..steps[ do
- var e = 0
- for ss in [0..4[ do
- e += inverted_base64_chars[self.chars[s*4+ss]].lshift((3-ss)*6)
- end
+ var result_length = steps * 3
- for ss in [0..3[ do
- result[s*3+ss] = e.rshift((2-ss)*8).bin_and( mask_8bit ).ascii
- end
+ var epos = length - 1
+ var padding_len = 0
+ while epos >= 0 and bytes[epos] == padding do
+ epos -= 1
+ padding_len += 1
end
- var s = steps
- if padding_count == 1 then
- var e = 0
- for ss in [0..3[ do
- e += inverted_base64_chars[self.chars[s*4+ss]].lshift((3-ss)*6)
- end
-
- for ss in [0..2[ do
- result[s*3+ss] = e.rshift((2-ss)*8).bin_and( mask_8bit ).ascii
- end
- else if padding_count == 2 then
- var e = 0
- for ss in [0..2[ do
- e += inverted_base64_chars[self.chars[s*4+ss]].lshift((3-ss)*6)
- end
+ if padding_len != 0 then steps -= 1
+ if padding_len == 1 then result_length -= 1
+ if padding_len == 2 then result_length -= 2
+
+ var result = new NativeString(result_length + 1)
+ result[result_length] = 0u8
+
+ for s in [0 .. steps[ do
+ var c0 = inv[bytes[s * 4]]
+ var c1 = inv[bytes[s * 4 + 1]]
+ var c2 = inv[bytes[s * 4 + 2]]
+ var c3 = inv[bytes[s * 4 + 3]]
+ result[s * 3] = ((c0 & 0b0011_1111u8) << 2) | ((c1 & 0b0011_0000u8) >> 4)
+ result[s * 3 + 1] = ((c1 & 0b0000_1111u8) << 4) | ((c2 & 0b0011_1100u8) >> 2)
+ result[s * 3 + 2] = ((c2 & 0b0000_0011u8) << 6) | (c3 & 0b0011_1111u8)
+ end
- result[s*3] = e.rshift(2*8).bin_and( mask_8bit ).ascii
+ var last_start = steps * 4
+ if padding_len == 1 then
+ var c0 = inv[bytes[last_start]]
+ var c1 = inv[bytes[last_start + 1]]
+ var c2 = inv[bytes[last_start + 2]]
+ result[result_length - 2] = ((c0 & 0b0011_1111u8) << 2) | ((c1 & 0b0011_0000u8) >> 4)
+ result[result_length - 1] = ((c1 & 0b0000_1111u8) << 4) | ((c2 & 0b0011_1100u8) >> 2)
+ else if padding_len == 2 then
+ var c0 = inv[bytes[last_start]]
+ var c1 = inv[bytes[last_start + 1]]
+ result[result_length - 1] = ((c0 & 0b0011_1111u8) << 2) | ((c1 & 0b0011_0000u8) >> 4)
end
- return result.to_s
+ return result.to_s_with_length(result_length)
end
end
# var w = new FileWriter.open("/tmp/data.bin")
# w.write "hello"
# w.write_int64 123456789
-# w.write_byte 3
+# w.write_byte 3u8
# w.write_float 1.25
# w.write_double 1.234567
# w.write_bits(true, false, true)
# var r = new FileReader.open("/tmp/data.bin")
# assert r.read(5) == "hello"
# assert r.read_int64 == 123456789
-# assert r.read_byte == 3
+# assert r.read_byte == 3u8
# assert r.read_float == 1.25
# assert r.read_double == 1.234567
#
super BinaryStream
# Write a boolean `value` on a byte, using 0 for `false` and 1 for `true`
- fun write_bool(value: Bool) do write_byte if value then 1 else 0
+ fun write_bool(value: Bool) do write_byte if value then 1u8 else 0u8
# Write up to 8 `Bool` in a byte
#
do
assert bits.length <= 8
- var int = 0
+ var int = 0u8
for b in bits.length.times do
- if bits[b] then int += 2**b
+ if bits[b] then int |= 1u8 << (7 - b)
end
write_byte int
fun write_string(text: Text)
do
write text
- write_byte 0x00
+ write_byte 0x00u8
end
# Write the length as a 64 bits integer, then the content of `text`
# Read a single byte and return `true` if its value is different than 0
#
# Returns `false` when an error is pending (`last_error != null`).
- fun read_bool: Bool do return read_byte != 0
+ fun read_bool: Bool do return read_byte != 0u8
# Get an `Array` of 8 `Bool` by reading a single byte
#
do
var int = read_byte
if int == null then return new Array[Bool]
- return [for b in 8.times do int.bin_and(2**b) > 0]
+ var arr = new Array[Bool]
+ for i in [7 .. 0].step(-1) do
+ arr.push(((int >> i) & 1u8) != 0u8)
+ end
+ return arr
end
# Read a null terminated string
var buf = new FlatBuffer
loop
var byte = read_byte
- if byte == null or byte == 0x00 then return buf.to_s
- buf.chars.add byte.ascii
+ if byte == null or byte == 0x00u8 then return buf.to_s
+ buf.bytes.add byte
end
end
end
# Utility for `read_float`
- private fun native_read_float(b0, b1, b2, b3: Int, big_endian: Bool): Float `{
+ private fun native_read_float(b0, b1, b2, b3: Byte, big_endian: Bool): Float `{
union {
unsigned char b[4];
float val;
end
# Utility for `read_double`
- private fun native_read_double(b0, b1, b2, b3, b4, b5, b6, b7: Int, big_endian: Bool): Float `{
+ private fun native_read_double(b0, b1, b2, b3, b4, b5, b6, b7: Byte, big_endian: Bool): Float `{
union {
unsigned char b[8];
double val;
end
# Utility for `read_int64`
- private fun native_read_int64(b0, b1, b2, b3, b4, b5, b6, b7: Int, big_endian: Bool): Int `{
+ private fun native_read_int64(b0, b1, b2, b3, b4, b5, b6, b7: Byte, big_endian: Bool): Int `{
union {
unsigned char b[8];
int64_t val;
redef class Int
# Utility for `BinaryWriter`
- private fun int64_byte_at(index: Int, big_endian: Bool): Int `{
+ private fun int64_byte_at(index: Int, big_endian: Bool): Byte `{
union {
unsigned char bytes[8];
int64_t val;
redef class Float
# Utility for `BinaryWriter`
- private fun float_byte_at(index: Int, big_endian: Bool): Int `{
+ private fun float_byte_at(index: Int, big_endian: Bool): Byte `{
union {
unsigned char bytes[4];
float val;
`}
# Utility for `BinaryWriter`
- private fun double_byte_at(index: Int, big_endian: Bool): Int `{
+ private fun double_byte_at(index: Int, big_endian: Bool): Byte `{
union {
unsigned char bytes[8];
double val;
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Serialize and deserialize Nit objects to binary streams
+#
+# The serialized data format uses a dictionary structure similar to BSON:
+#
+# ~~~raw
+# object = 0x01 # null
+# | 0x02 id attributes # New object
+# | 0x03 id # Ref to object
+# | 0x04 int64 # Int
+# | 0x05 int8 # Bool (int8 != 0)
+# | 0x06 int8 # Char
+# | 0x07 double(64 bits) # Float
+# | 0x08 block # String
+# | 0x09 block # NativeString
+# | 0x0A flat_array; # Array[nullable Object]
+#
+# block = int64 int8*;
+# cstring = int8* 0x00;
+# id = int64;
+#
+# attributes = attribute* 0x00;
+# attribute = cstring object;
+# ~~~
+module serialization
+
+import ::serialization::caching
+private import ::serialization::engine_tools
+import binary
+import more_collections
+
+# ---
+# Special bytes, marking the kind of objects in the stream and the end on an object
+
+private fun kind_null: Byte do return 0x01u8
+private fun kind_object_new: Byte do return 0x02u8
+private fun kind_object_ref: Byte do return 0x03u8
+private fun kind_int: Byte do return 0x04u8
+private fun kind_bool: Byte do return 0x05u8
+private fun kind_char: Byte do return 0x06u8
+private fun kind_float: Byte do return 0x07u8
+private fun kind_string: Byte do return 0x08u8
+private fun kind_native_string: Byte do return 0x09u8
+private fun kind_flat_array: Byte do return 0x0Au8
+
+private fun new_object_end: Byte do return 0x00u8
+
+#---
+# Engines
+
+# Writes Nit objects to the binary `stream`
+#
+# The output can be deserialized with `BinaryDeserializer`.
+class BinarySerializer
+ super CachingSerializer
+
+ # Target writing stream
+ var stream: Writer is writable
+
+ redef fun serialize(object)
+ do
+ if object == null then
+ stream.write_byte kind_null
+ else serialize_reference(object)
+ end
+
+ redef fun serialize_attribute(name, value)
+ do
+ stream.write_string name
+ super
+ end
+
+ redef fun serialize_reference(object)
+ do
+ if cache.has_object(object) then
+ # if already serialized, add local reference
+ var id = cache.id_for(object)
+ stream.write_byte kind_object_ref
+ stream.write_int64 id
+ else
+ # serialize here
+ object.serialize_to_binary self
+ end
+ end
+
+ # Write `collection` as a simple list of objects
+ private fun serialize_flat_array(collection: Collection[nullable Object])
+ do
+ stream.write_byte kind_flat_array
+ stream.write_int64 collection.length
+ for e in collection do
+ if not try_to_serialize(e) then
+ assert e != null
+ warn "Element of {collection} is not serializable, it is a {e}"
+ serialize null
+ end
+ end
+ end
+end
+
+# Deserialize Nit objects from a binary `stream`
+#
+# Used with `BinarySerializer`.
+class BinaryDeserializer
+ super CachingDeserializer
+
+ # Source `Reader` stream
+ var stream: Reader
+
+ # Last encountered object reference id.
+ #
+ # See `cache.received`.
+ private var just_opened_id: nullable Int = null
+
+ # Tree of attributes, deserialized but not yet claimed
+ private var unclaimed_attributes = new UnrolledList[HashMap[String, nullable Object]]
+
+ # Read and deserialize the next attribute name and value
+ #
+ # A `peeked_char` can suffix the next attribute name.
+ #
+ # Returns `null` on error.
+ private fun deserialize_next_attribute(peeked_char: nullable Byte):
+ nullable Couple[String, nullable Object]
+ do
+ # Try the next attribute
+ var next_attribute_name = stream.read_string
+ var next_object = deserialize_next_object
+
+ if stream.last_error != null then return null
+
+ if peeked_char != null then
+ # Replace a char peeked to find an object end
+ next_attribute_name = "{peeked_char}{next_attribute_name}"
+ end
+
+ return new Couple[String, nullable Object](next_attribute_name, next_object)
+ end
+
+ redef fun deserialize_attribute(name)
+ do
+ if unclaimed_attributes.last.keys.has(name) then
+ # Pick in already deserialized attributes
+ var value = unclaimed_attributes.last[name]
+ unclaimed_attributes.last.keys.remove(name)
+ return value
+ end
+
+ # Read attributes until we find the wanted one named `name`
+ loop
+ var next = deserialize_next_attribute
+ if next == null then
+ # Error was already logged
+ return null
+ end
+
+ var next_attribute_name = next.first
+ var next_object = next.second
+
+ # Got the wanted object
+ if next_attribute_name == name then return next_object
+
+ # An invalid attribute name is an heuristic for invalid data.
+ # Hitting an object end marker will result in an empty string.
+ assert next_attribute_name.is_valid_id else
+
+ var error
+ if next_attribute_name.is_empty then
+ # Reached the end of the object
+ error = new Error("Deserialization Error: Attributes '{name}' not in stream.")
+ else
+ error = new Error("Deserialization Error: Got an invalid attribute name '{next_attribute_name}', expected '{name}'")
+ # TODO this is invalid data, break even on keep_going
+ end
+ errors.add error
+ return null
+ end
+
+ # It's not the next attribute, put it aside
+ unclaimed_attributes.last[next_attribute_name] = next_object
+ end
+ end
+
+ redef fun notify_of_creation(new_object)
+ do
+ var id = just_opened_id
+ if id == null then return
+ cache[id] = new_object
+ end
+
+ # Convert from simple Json object to Nit object
+ private fun deserialize_next_object: nullable Object
+ do
+ var kind = stream.read_byte
+ assert kind isa Byte else
+ # TODO break even on keep_going
+ return null
+ end
+
+ # After this point, all stream reading errors are caught later
+
+ if kind == kind_null then return null
+ if kind == kind_int then return stream.read_int64
+ if kind == kind_bool then return stream.read_bool
+ if kind == kind_float then return stream.read_double
+ if kind == kind_char then
+ var b = stream.read_byte
+ if b == null then return 0
+ return b.to_i.ascii
+ end
+ if kind == kind_string then return stream.read_block
+ if kind == kind_native_string then return stream.read_block.to_cstring
+
+ if kind == kind_flat_array then
+ # An array
+ var length = stream.read_int64
+ var array = new Array[nullable Object]
+ for i in length.times do
+ array.add deserialize_next_object
+ end
+ return array
+ end
+
+ if kind == kind_object_ref then
+ # A reference
+ var id = stream.read_int64
+ if stream.last_error != null then return null
+
+ if not cache.has_id(id) then
+ errors.add new Error("Deserialization Error: Unknown reference to id #{id}")
+ return null
+ end
+ return cache.object_for(id)
+ end
+
+ if kind == kind_object_new then
+ # A new object
+ var id = stream.read_int64
+ if stream.last_error != null then return null
+
+ if cache.has_id(id) then
+ errors.add new Error("Deserialization Error: Duplicated use of reference #{id}")
+ return null
+ end
+
+ var class_name = stream.read_string
+
+ if stream.last_error != null then return null
+
+ # Use the validity of the `class_name` as heuristic to detect invalid data
+ if not class_name.is_valid_id then
+ errors.add new Error("Deserialization Error: got an invalid class name '{class_name}'")
+ return null
+ end
+
+ # Prepare opening a new object
+ just_opened_id = id
+ unclaimed_attributes.push new HashMap[String, nullable Object]
+
+ var value = deserialize_class(class_name)
+
+ # Check for the attributes end marker
+ loop
+ var next_byte = stream.read_byte
+ if next_byte == new_object_end then break
+
+ # Fetch an additional attribute, even if it isn't expected
+ deserialize_next_attribute(next_byte)
+ end
+
+ # Close object
+ unclaimed_attributes.pop
+ just_opened_id = null
+
+ return value
+ end
+
+ errors.add new Error("Deserialization Error: Unknown binary object kind `{kind}`")
+ # TODO fatal error and break even on keep_going
+ return null
+ end
+
+ redef fun deserialize
+ do
+ errors.clear
+
+ var value = deserialize_next_object
+
+ var error = stream.last_error
+ if error != null then
+ errors.add error
+ return true
+ end
+
+ return value
+ end
+end
+
+# ---
+# Services
+
+redef class Text
+ # Is `self` a valid identifier for a Nit class or property?
+ private fun is_valid_id: Bool
+ do
+ if trim.is_empty then return false
+
+ for c in chars do
+ if not (c.is_letter or c.is_numeric or c == '[' or c == ']' or
+ c == ' ' or c == ',' or c == '_') then return false
+ end
+
+ return true
+ end
+end
+
+# ---
+# Per class serialization behavior
+
+redef class Serializable
+ # Write the binary serialization header
+ #
+ # The header for a normal object is:
+ # 1. The kind of object on 8 bits, `0x01` for a new object.
+ # 2. The id of this object so it is not serialized more than once.
+ # 3. The name of the object type as a null terminated string.
+ private fun serialize_header_to_binary(v: BinarySerializer)
+ do
+ var id = v.cache.new_id_for(self)
+ v.stream.write_byte kind_object_new # is object intro
+ v.stream.write_int64 id
+ v.stream.write_string class_name
+ end
+
+ # Write a normal object to binary
+ private fun serialize_to_binary(v: BinarySerializer)
+ do
+ serialize_header_to_binary v
+ core_serialize_to v
+ v.stream.write_byte new_object_end
+ end
+end
+
+redef class Int
+ redef fun serialize_to_binary(v)
+ do
+ v.stream.write_byte kind_int
+ v.stream.write_int64 self
+ end
+end
+
+redef class Float
+ redef fun serialize_to_binary(v)
+ do
+ v.stream.write_byte kind_float
+ v.stream.write_double self
+ end
+end
+
+redef class Bool
+ redef fun serialize_to_binary(v)
+ do
+ v.stream.write_byte kind_bool
+ v.stream.write_bool self
+ end
+end
+
+redef class Char
+ redef fun serialize_to_binary(v)
+ do
+ v.stream.write_byte kind_char
+ # Fix when UTF-8
+ v.stream.write_byte self.ascii.to_b
+ end
+end
+
+redef class String
+ redef fun serialize_to_binary(v)
+ do
+ v.stream.write_byte kind_string
+ v.stream.write_block self
+ end
+end
+
+redef class NativeString
+ redef fun serialize_to_binary(v)
+ do
+ v.stream.write_byte kind_native_string
+ v.stream.write_block to_s
+ end
+end
+
+redef class SimpleCollection[E]
+
+ redef fun serialize_to_binary(v)
+ do
+ serialize_header_to_binary v
+
+ v.stream.write_string "items"
+ v.serialize_flat_array self
+
+ v.stream.write_byte new_object_end
+ end
+
+ redef init from_deserializer(v)
+ do
+ # Give a chance to other engines, and defs
+ super
+
+ if v isa BinaryDeserializer then
+ v.notify_of_creation self
+ init
+
+ var items = v.deserialize_attribute("items")
+ assert items isa Array[nullable Object]
+ for item in items do
+ assert item isa E else
+ var item_type = "null"
+ if item != null then item_type = item.class_name
+
+ v.errors.add new Error("Deserialization Error: invalid type '{item_type}' for the collection '{class_name}'")
+ continue
+ end
+
+ add item
+ end
+ end
+ end
+end
+
+redef class Map[K, V]
+ redef fun serialize_to_binary(v)
+ do
+ serialize_header_to_binary v
+
+ core_serialize_to v
+
+ v.stream.write_string "keys"
+ v.serialize_flat_array keys
+
+ v.stream.write_string "values"
+ v.serialize_flat_array values
+
+ v.stream.write_byte new_object_end
+ end
+
+ # Instantiate a new `Array` from its serialized representation.
+ redef init from_deserializer(v)
+ do
+ # Give a chance to other engines, and defs
+ super
+
+ if v isa BinaryDeserializer then
+ v.notify_of_creation self
+
+ init
+
+ var keys = v.deserialize_attribute("keys")
+ var values = v.deserialize_attribute("values")
+ assert keys isa Array[nullable Object]
+ assert values isa Array[nullable Object]
+
+ for i in keys.length.times do
+ var key = keys[i]
+ var value = values[i]
+
+ if not key isa K then
+ var item_type = "null"
+ if key != null then item_type = key.class_name
+
+ v.errors.add new Error("Deserialization Error: Invalid key type '{item_type}' for '{class_name}'")
+ continue
+ end
+
+ if not value isa V then
+ var item_type = "null"
+ if value != null then item_type = value.class_name
+
+ v.errors.add new Error("Deserialization Error: Invalid value type '{item_type}' for '{class_name}'")
+ continue
+ end
+
+ self[key] = value
+ end
+ end
+ end
+end
if b == null then
return
end
- bitmap_header[x] = b
+ bitmap_header[x] = b.to_i
end
self.file_size = get_value(bitmap_header.subarray(2, 4))
self.data_offset = get_value(bitmap_header.subarray(10, 4))
for x in [0..39] do
var b = fileReader.read_byte
if b == null then return
- dib_header[x] = b
+ dib_header[x] = b.to_i
end
var dib_size = get_value(dib_header.subarray(0, 4))
# only support BITMAPINFOHEADER
var red = bts[0] << 16
var green = bts[1] << 8
var blue = bts[2]
- row.add(red + green + blue)
+ row.add(red.to_i + green.to_i + blue.to_i)
end
self.data.add(row)
end
init do ns = new NativeString(maxlen)
- fun [](i: Int): Char do return ns[i]
+ fun [](i: Int): Byte do return ns[i]
end
# Simple implementation of the iterator on Substrings for `Leaf`
var buf: ManualBuffer
var bns: NativeString is noinit
- redef var length: Int is noinit
+ redef var length is noinit
+
+ # Unsafe, but since it is an experiment, don't mind
+ redef fun bytelen do return length
redef fun empty do return new Leaf(new ManualBuffer)
redef fun to_cstring do
var len = length
var ns = new NativeString(len + 1)
- ns[len] = '\0'
+ ns[len] = 0u8
buf.ns.copy_to(ns, len, 0, 0)
return ns
end
redef fun substrings do return new LeafSubstrings(self)
- redef fun [](i) do return buf[i]
+ redef fun [](i) do return buf[i].to_i.ascii
init do
bns = buf.ns
redef fun output do new FlatString.with_infos(buf.ns, length, 0, length - 1).output
redef fun to_upper do
- var x = new ManualBuffer
- var nns = x.ns
- var ns = bns
- var mlen = length
- for i in [0..mlen[ do
- nns[i] = ns[i].to_upper
- end
- x.pos = mlen - 1
- return new Leaf(x)
+ var x = new FlatBuffer
+ for i in chars do x.add(i.to_upper)
+ return x.to_s
end
redef fun to_lower do
- var x = new ManualBuffer
- var nns = x.ns
- var ns = bns
- var mlen = length
- for i in [0..mlen[ do
- nns[i] = ns[i].to_lower
- end
- x.pos = mlen - 1
- return new Leaf(x)
+ var x = new FlatBuffer
+ for i in chars do x.add(i.to_lower)
+ return x.to_s
end
redef fun reversed do
redef fun +(o) do
var s = o.to_s
- var slen = s.length
- var mlen = length
+ var slen = s.bytelen
+ var mlen = bytelen
if slen == 0 then return self
if mlen == 0 then return s
var nlen = mlen + slen
var bpos = buf.pos
var sits = s.items
if bpos == mlen then
- sits.copy_to(buf.ns, slen, s.index_from, bpos)
+ sits.copy_to(buf.ns, slen, s.first_byte, bpos)
buf.pos = bpos + slen
return new Leaf(buf)
else
var b = new ManualBuffer
var nbns = b.ns
bns.copy_to(nbns, mlen, 0, 0)
- sits.copy_to(nbns, slen, s.index_from, mlen)
+ sits.copy_to(nbns, slen, s.first_byte, mlen)
b.pos = nlen
return new Leaf(b)
end
b = new ManualBuffer
bns.copy_to(b.ns, mlen, 0, 0)
end
- for i in s.chars do
+ for i in s.bytes do
bns[bpos] = i
bpos += 1
end
redef fun to_cstring do
var len = length
var ns = new NativeString(len + 1)
- ns[len] = '\0'
+ ns[len] = 0u8
var off = 0
for i in substrings do
var ilen = i.length
if i isa FlatString then
- i.items.copy_to(ns, ilen, i.index_from, off)
+ i.items.copy_to(ns, ilen, i.first_byte, off)
else if i isa Leaf then
i.buf.ns.copy_to(ns, ilen, 0, off)
else
if s isa FlatString then
if slen + mlen > maxlen then return new Concat(self, s)
var mits = items
- var sifrom = s.index_from
- var mifrom = index_from
+ var sifrom = s.first_byte
+ var mifrom = first_byte
var sits = s.items
var b = new ManualBuffer
var bns = b.ns
return new Concat(sl + self, s.right)
else if s isa Leaf then
if slen + mlen > maxlen then return new Concat(self, s)
- var mifrom = index_from
+ var mifrom = first_byte
var sb = s.buf
var b = new ManualBuffer
var bns = b.ns
mypos += 1
end
var ns = new NativeString(sl + 1)
- ns[sl] = '\0'
+ ns[sl] = 0u8
i = 0
var off = 0
while i < mypos do
var tmp = na[i]
var tpl = tmp.length
if tmp isa FlatString then
- tmp.items.copy_to(ns, tpl, tmp.index_from, off)
+ tmp.items.copy_to(ns, tpl, tmp.first_byte, off)
off += tpl
else
for j in tmp.substrings do
var slen = j.length
if j isa FlatString then
- j.items.copy_to(ns, slen, j.index_from, off)
+ j.items.copy_to(ns, slen, j.first_byte, off)
else if j isa Leaf then
j.buf.ns.copy_to(ns, slen, 0, off)
end
# Wrapper around an array of `unsigned char` in C (`unsigned char*`) with length and destroy state
class CByteArray
- super CArray[Int]
+ super CArray[Byte]
redef type NATIVE: NativeCByteArray
# Allocate a new array of `size`
super size
end
- # Build from an `Array[Int]`
- new from(array: Array[Int])
+ # Build from a `SequenceRead[Byte]`
+ new from(array: SequenceRead[Byte])
do
var carray = new CByteArray(array.length)
for i in array.length.times do
# An array of `unsigned char` in C (`unsigned char*`)
extern class NativeCByteArray `{ unsigned char* `}
super NativeCArray
- redef type E: Int
+ redef type E: Byte
# Allocate a new array of `size`
new(size: Int) `{ return calloc(size, sizeof(unsigned char)); `}
end
return (sum / map.length.to_f).sqrt
end
+
+ # The information entropy (Shannon entropy) of the elements in the counter (in bits).
+ fun entropy: Float
+ do
+ var res = 0.0
+ var sum = self.sum.to_f
+ for k, v in self do
+ var f = v.to_f / sum
+ res = res - f * f.log_base(2.0)
+ end
+ return res
+ end
+end
+
+redef class Collection[E]
+ # Create and fill up a counter with the elements of `self.
+ #
+ # ~~~
+ # var cpt = "abaa".chars.to_counter
+ # assert cpt['a'] == 3
+ # assert cpt['b'] == 1
+ # assert cpt.length == 2
+ # assert cpt.sum == 4
+ # ~~~
+ fun to_counter: Counter[E]
+ do
+ var res = new Counter[E]
+ res.inc_all(self)
+ return res
+ end
end
private class CounterComparator[E]
if not output_file_name == null then
opt_name = output_file_name
else if not self.url.substring(self.url.length-1, self.url.length) == "/" then
- opt_name = self.url.basename("")
+ opt_name = self.url.basename
else
return answer_failure(0, "Unable to extract file name, please specify one")
end
# Request Chars internal information from the CURL session
fun easy_getinfo_chars(opt: CURLInfoChars): nullable String
do
- var answ = new Container[NativeString]("".to_cstring)
+ var answ = new Ref[NativeString]("".to_cstring)
if not native_getinfo_chars(opt, answ).is_ok then return null
if answ.item.address_is_null then return null
return answ.item.to_s
end
# Internal method used to get String object information initially knowns as C Chars type
- private fun native_getinfo_chars(opt: CURLInfoChars, res: Container[NativeString]): CURLCode
- import Container[NativeString].item= `{
+ private fun native_getinfo_chars(opt: CURLInfoChars, res: Ref[NativeString]): CURLCode
+ import Ref[NativeString].item= `{
char *r;
CURLcode c = curl_easy_getinfo( self, opt, &r);
- if (c == CURLE_OK) Container_of_NativeString_item__assign(res, r);
+ if (c == CURLE_OK) Ref_of_NativeString_item__assign(res, r);
return c;
`}
# Request Long internal information from the CURL session
fun easy_getinfo_long(opt: CURLInfoLong): nullable Int
do
- var answ = new Container[Int](0)
+ var answ = new Ref[Int](0)
if not native_getinfo_long(opt, answ).is_ok then return null
return answ.item
end
# Internal method used to get Int object information initially knowns as C Long type
- private fun native_getinfo_long(opt: CURLInfoLong, res: Container[Int]): CURLCode
- import Container[Int].item= `{
+ private fun native_getinfo_long(opt: CURLInfoLong, res: Ref[Int]): CURLCode
+ import Ref[Int].item= `{
long r;
CURLcode c = curl_easy_getinfo( self, opt, &r);
- if (c == CURLE_OK) Container_of_Int_item__assign(res, r);
+ if (c == CURLE_OK) Ref_of_Int_item__assign(res, r);
return c;
`}
# Request Double internal information from the CURL session
fun easy_getinfo_double(opt: CURLInfoDouble): nullable Float
do
- var answ = new Container[Float](0.0)
+ var answ = new Ref[Float](0.0)
if not native_getinfo_double(opt, answ).is_ok then return null
return answ.item
end
# Internal method used to get Int object information initially knowns as C Double type
- private fun native_getinfo_double(opt: CURLInfoDouble, res: Container[Float]): CURLCode
- import Container[Float].item= `{
+ private fun native_getinfo_double(opt: CURLInfoDouble, res: Ref[Float]): CURLCode
+ import Ref[Float].item= `{
double r;
CURLcode c = curl_easy_getinfo(self, opt, &r);
- if (c == CURLE_OK) Container_of_Float_item__assign(res, r);
+ if (c == CURLE_OK) Ref_of_Float_item__assign(res, r);
return c;
`}
# Request SList internal information from the CURL session
fun easy_getinfo_slist(opt: CURLInfoSList): nullable Array[String]
do
- var answ = new Container[CURLSList](new CURLSList)
+ var answ = new Ref[CURLSList](new CURLSList)
if not native_getinfo_slist(opt, answ).is_ok then return null
var native = answ.item
end
# Internal method used to get Array[String] object information initially knowns as C SList type
- private fun native_getinfo_slist(opt: CURLInfoSList, res: Container[CURLSList]): CURLCode
- import Container[CURLSList].item= `{
+ private fun native_getinfo_slist(opt: CURLInfoSList, res: Ref[CURLSList]): CURLCode
+ import Ref[CURLSList].item= `{
struct curl_slist* csl;
CURLcode c = curl_easy_getinfo(self, opt, &csl);
- if (c == CURLE_OK) Container_of_CURLSList_item__assign(res, csl);
+ if (c == CURLE_OK) Ref_of_CURLSList_item__assign(res, csl);
return c;
`}
assert collectionItemType: self isa Collection[String] else
print "Collection item must be strings."
end
+ if is_empty then return new CURLSList
var primList = new CURLSList.with_str(self.first)
var is_first = true
for s in self do
# Connection Options
-# new `{ return CURLOPT_TIMEOUT; `}
-# new `{ return CURLOPT_TIMEOUT_MS; `}
+ # Set maximum time the request is allowed to take.
+ new timeout `{ return CURLOPT_TIMEOUT; `}
+
+ # Set maximum time the request is allowed to take (in ms).
+ new timeout_ms `{ return CURLOPT_TIMEOUT_MS; `}
+
# new `{ return CURLOPT_LOW_SPEED_LIMIT; `}
# new `{ return CURLOPT_LOW_SPEED_TIME; `}
# new `{ return CURLOPT_MAX_SEND_SPEED_LARGE; `}
# Get the current time of the day
init now do
var tm = new Tm.localtime
- hour = tm.hour
- minute = tm.min
- second = tm.sec
+ init(tm.hour, tm.min, tm.sec)
end
# Get the difference between two times in second
# The date of this day
init today do
var tm = new Tm.localtime
- year = 1900 + tm.year
- month = tm.mon + 1
- day = tm.mday
+ init(1900 + tm.year, tm.mon + 1, tm.mday)
end
# `self` formatted according to ISO 8601
module dom
import parser
+
+redef class XMLEntity
+
+ # The `XMLTag` children with the `tag_name`
+ #
+ # ~~~
+ # var code = """
+ # <?xml version="1.0" encoding="us-ascii"?>
+ # <animal>
+ # <cat/>
+ # <tiger>This is a white tiger!</tiger>
+ # <cat/>
+ # </animal>"""
+ #
+ # var xml = code.to_xml
+ # assert xml["animal"].length == 1
+ # assert xml["animal"].first["cat"].length == 2
+ # ~~~
+ fun [](tag_name: String): Array[XMLEntity]
+ do
+ var res = new Array[XMLEntity]
+ for child in children do
+ if child isa XMLTag and child.tag_name == tag_name then
+ res.add child
+ end
+ end
+ return res
+ end
+end
+
+redef class XMLStartTag
+
+ # Content of this XML tag held within a `PCDATA` or `CDATA`
+ #
+ # ~~~
+ # var code = """
+ # <?xml version="1.0" encoding="us-ascii"?>
+ # <animal>
+ # <cat/>
+ # <tiger>This is a white tiger!</tiger>
+ # <cat/>
+ # </animal>"""
+ #
+ # var xml = code.to_xml
+ # assert xml["animal"].first["tiger"].first.as(XMLStartTag).data == "This is a white tiger!"
+ # ~~~
+ fun data: String
+ do
+ for child in children do
+ if child isa PCDATA then return child.content
+ if child isa CDATA then return child.content
+ end
+ abort
+ end
+end
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# This file is free software, which comes along with NIT. This software is
+# distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY;
+# without even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE. You can modify it is you want, provided this header
+# is kept unaltered, and a notification of the changes is added.
+# You are allowed to redistribute it and sell it, alone or is a part of
+# another product.
+
+# Simple XML validity checker using the `dom` module
+module checker
+
+import dom
+
+# Check arguments
+if args.length != 1 then
+ print_error "Usage: checker xml_file"
+ exit 2
+end
+
+var path = args.first
+if not path.file_exists then
+ print_error "Path '{path}' does not exist"
+ exit 3
+end
+
+# Read file
+var content = path.to_path.read_all
+
+# Parse XML
+var xml = content.to_xml
+
+# Check for errors
+if xml isa XMLError then
+ print_error "XML file at '{path}' is invalid:"
+ print_error xml.message
+ var loc = xml.location
+ if loc != null then print_error loc
+ exit 1
+else
+ print "XML file at '{path}' is valid"
+end
stack.push tag
else if tag isa XMLEndTag then
if stack.is_empty then
- return new XMLError(location = tag.location, "Missing matching tag for `{tag.tag_name}`")
+ return new XMLError(tag.location, "Missing matching tag for `{tag.tag_name}`")
end
var st_last = stack.last
if tag.tag_name == st_last.tag_name then
stack.pop
else
var miss = stack.pop
- return new XMLError("Missing matching tag for `{miss.tag_name}`", location=miss.location)
+ return new XMLError(miss.location, "Missing matching tag for `{miss.tag_name}`")
end
else if tag isa XMLError then
return tag
else
var st = pos
var end_pc = ignore_until("<") - 1
- var pc = new PCDATA(src.substring(st, end_pc - st + 1).trim)
+ var loc = new Location(line, line_offset)
+ var pc = new PCDATA(loc, src.substring(st, end_pc - st + 1).trim)
if stack.is_empty then
pc.parent = doc
else
end
if not stack.is_empty then
var miss = stack.pop
- return new XMLError("Missing matching tag for `{miss.tag_name}`", location=miss.location)
+ return new XMLError(miss.location, "Missing matching tag for `{miss.tag_name}`")
end
return doc
end
private fun read_tag: XMLEntity do
var st_loc = new Location(line, line_offset)
var c = src[pos]
- if not c == '<' then return new XMLError(location=st_loc, "Expected start of tag, got `{c}`")
- var st = pos
+ if not c == '<' then return new XMLError(st_loc, "Expected start of tag, got `{c}`")
pos += 1
c = src[pos]
if c == '!' then
private fun read_special_tag(st_loc: Location): XMLEntity do
var srclen = src.length
pos += 1
- if (pos + 2) >= srclen then return new XMLError(location=st_loc, "Unexpected EOF on start of Special tag")
+ if (pos + 2) >= srclen then return new XMLError(st_loc, "Unexpected EOF on start of Special tag")
if src[pos] == '-' and src[pos + 1] == '-' then
pos += 2
var comst = pos
var endcom = ignore_until("-->")
- if endcom == -1 then return new XMLError(location=st_loc, "Malformatted comment")
+ if endcom == -1 then return new XMLError(st_loc, "Malformed comment")
pos += 3
- return new XMLCommentTag(location=st_loc ,src.substring(comst, endcom - comst + 1))
+ return new XMLCommentTag(st_loc ,src.substring(comst, endcom - comst + 1))
end
var st = pos
if srclen - pos >= 7 then
var cdst = pos
var cdend = ignore_until("]]>")
pos += 3
- if pos >= srclen then return new XMLError(location = st_loc, "Unfinished CDATA block")
- return new CDATA(src.substring(cdst, cdend - cdst))
+ if pos >= srclen then return new XMLError(st_loc, "Unfinished CDATA block")
+ return new CDATA(st_loc, src.substring(cdst, cdend - cdst))
else if spe_type == "DOCTYPE" then
pos += 7
return parse_doctype(st_loc)
end
var end_spec = ignore_until(">")
pos += 1
- return new XMLSpecialTag(location=st_loc, src.substring(st, end_spec - st))
+ return new XMLSpecialTag(st_loc, src.substring(st, end_spec - st))
end
# Parse a Doctype declaration tag
var srclen = src.length
loop
ignore_whitespaces
- if pos >= srclen then return new XMLError(location = st_loc, "Malformatted doctype")
+ if pos >= srclen then return new XMLError(st_loc, "Malformed doctype")
var c = src[pos]
# TODO: Properly support intern DOCTYPE definitions
if c == '[' then
var intern_st = pos
var intern_end = ignore_until("]")
- if intern_end == -1 then return new XMLError(location = st_loc, "Unfinished internal doctype declaration")
+ if intern_end == -1 then return new XMLError(st_loc, "Unfinished internal doctype declaration")
pos += 1
elemts.push src.substring(intern_st, intern_end - intern_st + 1)
continue
end
var elm_st = pos
while pos < srclen and not src[pos].is_whitespace and src[pos] != '>' do pos += 1
- if pos >= srclen then return new XMLError(location = st_loc, "Malformatted doctype")
+ if pos >= srclen then return new XMLError(st_loc, "Malformed doctype")
if pos - elm_st > 1 then
var str = src.substring(elm_st, pos - elm_st)
elemts.push str
end
if src[pos] == '>' then
pos += 1
- return new XMLDoctypeTag(location = st_loc, "DOCTYPE", elemts.join(" "))
+ return new XMLDoctypeTag(st_loc, "DOCTYPE", elemts.join(" "))
end
end
end
private fun read_prolog_tag(st_loc: Location): XMLEntity do
var srclen = src.length
pos += 1
- if pos >= srclen then return new XMLError(location=st_loc, "Invalid start of prolog")
- var idst = pos
+ if pos >= srclen then return new XMLError(st_loc, "Invalid start of prolog")
var tag_name = parse_tag_name(['<', '>'])
var c = src[pos]
- if c == '<' or c == '>' then return new XMLError(location=st_loc ,"Unexpected character `{c}` in prolog declaration")
+ if c == '<' or c == '>' then return new XMLError(st_loc ,"Unexpected character `{c}` in prolog declaration")
if tag_name == "xml" then
var args = parse_args(['?'])
for i in args do
- if i isa BadXMLAttribute then return new XMLError(location = i.location, i.name)
+ if i isa BadXMLAttribute then return new XMLError(i.location, i.name)
end
if src[pos] == '?' then
if src[pos + 1] == '>' then
pos += 2
- return new XMLPrologTag(location=st_loc, tag_name, args)
+ return new XMLPrologTag(st_loc, tag_name, args)
end
end
else
- if tag_name.has("xml") then return new XMLError(location = st_loc, "Forbidden keyword xml in Processing Instruction")
+ if tag_name.has("xml") then return new XMLError(st_loc, "Forbidden keyword xml in Processing Instruction")
var cont_st = pos
var cont_end = ignore_until("?>")
if cont_end == -1 then
pos += 2
- return new XMLError(location = st_loc, "Malformatted Processing Instruction tag")
+ return new XMLError(st_loc, "Malformed Processing Instruction tag")
end
pos += 2
- return new XMLProcessingInstructionTag(location=st_loc, tag_name, src.substring(cont_st, cont_end - cont_st))
+ return new XMLProcessingInstructionTag(st_loc, tag_name, src.substring(cont_st, cont_end - cont_st))
end
pos += 1
- return new XMLError(location=st_loc, "Malformatted prolog tag")
+ return new XMLError(st_loc, "Malformed prolog tag")
end
# Reads an End tag (starting with </)
#
# In case of error, returns a `XMLError`
private fun read_end_tag(st_loc: Location): XMLEntity do
- var srclen = src.length
pos += 1
var tag_name = parse_tag_name(['<', '>'])
ignore_whitespaces
if src[pos] == '>' then
pos += 1
- return new XMLEndTag(location=st_loc, tag_name)
+ return new XMLEndTag(st_loc, tag_name)
end
- return new XMLError(location = st_loc, "Bad end tag `{tag_name}`")
+ return new XMLError(st_loc, "Bad end tag `{tag_name}`")
end
# Reads a Start tag (starting with <)
#
# In case of error, returns a `XMLError`
private fun read_start_tag(st_loc: Location): XMLEntity do
- var srclen = src.length
var tag_name = parse_tag_name(['/', '>'])
var args = parse_args(['/', '>'])
for i in args do
- if i isa BadXMLAttribute then return new XMLError(location=i.location, i.name)
+ if i isa BadXMLAttribute then return new XMLError(i.location, i.name)
end
if src[pos] == '/' then
if src[pos + 1] == '>' then
pos += 2
- return new XMLOnelinerTag(location=st_loc, tag_name, args)
+ return new XMLOnelinerTag(st_loc, tag_name, args)
end
end
pos += 1
- return new XMLStartTag(location=st_loc, tag_name, args)
+ return new XMLStartTag(st_loc, tag_name, args)
end
# Parses an xml tag name
# Parses the next argument in `src`
private fun parse_arg(endtags: Array[Char]): XMLAttribute do
var srclen = src.length
- var attr: XMLAttribute
ignore_whitespaces
var st_loc = new Location(line, line_offset)
- if pos >= srclen then return new BadXMLAttribute(location = st_loc, "Unfinished attribute name")
+ if pos >= srclen then return new BadXMLAttribute(st_loc, "Unfinished attribute name")
# FIXME: Ugly, but as long as it remains private, it is OK I guess
- if endtags.has(src[pos]) then return new XMLAttributeEnd("")
+ if endtags.has(src[pos]) then return new XMLAttributeEnd(st_loc, "")
var attrname_st = pos
while pos < srclen and src[pos] != '=' and not endtags.has(src[pos]) do pos += 1
- if pos >= srclen then return new BadXMLAttribute(location = st_loc, "Unfinished attribute name")
- if src[pos] != '=' then return new BadXMLAttribute(location = st_loc, "Malformatted attribute")
+ if pos >= srclen then return new BadXMLAttribute(st_loc, "Unfinished attribute name")
+ if src[pos] != '=' then return new BadXMLAttribute(st_loc, "Malformed attribute")
var attrname_end = pos - 1
var name = src.substring(attrname_st, attrname_end - attrname_st + 1).trim
pos += 1
ignore_whitespaces
var attrval_st = pos
- if pos >= srclen then return new BadXMLAttribute(location=st_loc, "Unfinished attribute `{name}`")
+ if pos >= srclen then return new BadXMLAttribute(st_loc, "Unfinished attribute `{name}`")
var match = src[pos]
- if match != '\'' and match != '"' then return new BadXMLAttribute(location=st_loc, "Invalid string delimiter `{match}` for attribute `{name}`")
+ if match != '\'' and match != '"' then return new BadXMLAttribute(st_loc, "Invalid string delimiter `{match}` for attribute `{name}`")
pos += 1
while pos < srclen and src[pos] != match do pos += 1
- if pos >= srclen then return new BadXMLAttribute(location=st_loc, "Unfinished attribute `{name}`")
+ if pos >= srclen then return new BadXMLAttribute(st_loc, "Unfinished attribute `{name}`")
var attrval_end = pos
var val = src.substring(attrval_st, attrval_end - attrval_st + 1).trim
pos += 1
- return new XMLStringAttr(location=st_loc, name, val.substring(1, val.length - 2), match)
+ return new XMLStringAttr(st_loc, name, val.substring(1, val.length - 2), match)
end
end
# Any kind of XML Entity
abstract class XMLEntity
# Optional parent of `self`
- var parent: nullable XMLEntity is private writable(set_parent)
+ var parent: nullable XMLEntity = null is private writable(set_parent)
# Optional location of the entity in source
var location: nullable Location
# Sets the parent of `self` to `e`
fun parent=(e: XMLEntity) do
+ var parent = self.parent
if parent != null then
parent.children.remove(self)
end
# The owner, aka, the parent
var owner: XMLEntity
- private var entities = new List[XMLEntity]
+ var entities = new List[XMLEntity]
redef fun length do return entities.length
redef fun []=(index, el) do
var olde = self[index]
- if olde.parent != null then
- olde.parent.children.remove(el)
+ var olde_parent = olde.parent
+ if olde_parent != null then
+ olde_parent.children.remove(el)
end
entities[index] = el
el.set_parent owner
class XMLDocument
super XMLEntity
- redef fun to_s do return children.join("")
+ redef fun to_s do return children.join
end
# PCDATA is any kind of non-xml formatted text
end
s += ">"
for i in children do s += i.to_s
+ var matching = self.matching
if matching != null then s += matching.to_s
return s
end
class XMLProcessingInstructionTag
super XMLTag
+ # Raw content usable by the third-party application
var content: String
redef fun to_s do return "<?{tag_name} {content}?>"
class XMLDoctypeTag
super XMLTag
+ # Raw content
var content: String
redef fun to_s do return "<!DOCTYPE {content}>"
# Error message reported by the parser
var message: String
- redef fun to_s do return "XML Error: {message} at {location.to_s}"
+ redef fun to_s do
+ var l = self.location
+ if l == null then
+ return "XML Error: {message}"
+ else
+ return "XML Error: {message} at {l}"
+ end
+ end
end
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Game and multimedia framework for Nit
+module gamnit
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Client-side network services for games and such
+#
+# The following code implements a client to connect to a local server and
+# briefly exchange with it.
+#
+# ~~~
+# redef fun handshake_app_name do return "nitwork_test"
+# redef fun handshake_app_version do return "1.0"
+#
+# # Prepare connection with remote server
+# var config = new RemoteServerConfig("localhost", 4444)
+# var server = new RemoteServer(config)
+#
+# # Try to connect
+# if not server.connect then return
+#
+# # Make sure the server is compatible
+# if not server.handshake then return
+#
+# # Connection up! communicate
+# server.writer.serialize "hello server"
+# print server.reader.deserialize.as(Object)
+#
+# # Done, close socket
+# server.socket.close
+# ~~~
+module client
+
+import common
+
+# Information of the remove server
+class RemoteServerConfig
+
+ # Address of the remote server, either a domain name or an Internet address
+ var address: Text
+
+ # Listening port of the server
+ var port: Int
+end
+
+# Connection to a remote server
+class RemoteServer
+
+ # `RemoteServerConfig` used to initiate connection to the server
+ var config: RemoteServerConfig
+
+ # Communication socket with the server
+ var socket: nullable TCPStream = null
+
+ # Is this connection connected?
+ fun connected: Bool do return socket != null and socket.connected == true
+
+ # `BinarySerializer` used to send data to this client through `socket`
+ var writer: BinarySerializer is noinit
+
+ # `BinaryDeserializer` used to receive data from this client through `socket`
+ var reader: BinaryDeserializer is noinit
+
+ # Attempt connection with the remote server
+ fun connect: Bool
+ do
+ print "Connecting to {config.address}:{config.port}..."
+ var socket = new TCPStream.connect(config.address.to_s, config.port)
+ self.socket = socket
+
+ if not socket.connected then
+ print "Connection failed: {socket.last_error or else "Internal error"}"
+ return false
+ end
+
+ # Setup serialization
+ writer = new BinarySerializer(socket)
+ writer.cache = new AsyncCache(false)
+ reader = new BinaryDeserializer(socket)
+ writer.link reader
+
+ return true
+ end
+
+ # Attempt handshake with server
+ #
+ # Validates compatibility between `handshake_app_name` and `handshake_app_version`.
+ #
+ # On error, close `socket`.
+ fun handshake: Bool
+ do
+ # The client goes first so that the server doesn't show its hand
+ var socket = socket
+ assert socket != null
+
+ # App name
+ var app_name = sys.handshake_app_name
+ socket.write_string app_name
+
+ var server_app = socket.read_string
+ if server_app != app_name then
+ print_error "Handshake Error: server app name is '{server_app}'"
+ socket.close
+ return false
+ end
+
+ # App version
+ socket.write_string sys.handshake_app_version
+
+ var server_version = socket.read_string
+ if server_version != sys.handshake_app_version then
+ print_error "Handshake Error: server version is different '{server_version}'"
+ socket.close
+ return false
+ end
+
+ return true
+ end
+end
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Services common to the `client` and `server` modules
+module common
+
+import socket
+import binary::serialization
+
+# Unique name of the application to use in the handshake
+#
+# This name must be the same between client/server and
+# it should not be used by other programs that may interfere.
+#
+# Both client and server refuse connections with a different name.
+fun handshake_app_name: String do return program_name
+
+# Version of the communication protocol to use in the handshake
+#
+# Its value should change with the communication protocol in such a way
+# that different versions indicates incompatible protocols.
+#
+# Both client and server refuse connections with a different version.
+fun handshake_app_version: String do return "0.0"
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Easy client/server logic for games and simple distributed applications
+module network
+
+import server
+import client
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Server-side network services for games and such
+#
+# The following code creates a server that continuously listen for new clients,
+# and exchange with them briefly before disconnecting.
+#
+# ~~~nitish
+# redef fun handshake_app_name do return "nitwork_test"
+# redef fun handshake_app_version do return "1.0"
+#
+# Open a server on port 4444
+# var server = new Server(4444)
+#
+# loop
+# # Accept new clients
+# var new_clients = server.accept_clients
+# for client in new_clients do
+# # A client is connected, communicate!
+# print ""
+# print client.reader.deserialize.as(Object)
+# client.writer.serialize "Goodbye client"
+#
+# # Done, close socket
+# client.socket.close
+# end
+#
+# # `accept_clients` in non-blocking,
+# # sleep before tying again, or do something else.
+# nanosleep(0, 50000000)
+# printn "."
+# end
+# ~~~
+module server
+
+import common
+
+# Game server controller
+class Server
+
+ # Port for the `listening_socket`
+ var port: Int
+
+ # All connected `RemoteClient`
+ var clients = new Array[RemoteClient]
+
+ # Socket accepting new connections
+ var listening_socket: TCPServer is lazy do
+ print port
+ var socket = new TCPServer(port)
+ socket.listen 8
+ socket.blocking = false
+ return socket
+ end
+ init do listening_socket
+
+ # Accept currently waiting clients and return them as an array
+ fun accept_clients: Array[RemoteClient]
+ do
+ assert not listening_socket.closed
+
+ var new_clients = new Array[RemoteClient]
+ loop
+ var client_socket = listening_socket.accept
+ if client_socket == null then break
+
+ var rc = new RemoteClient(client_socket)
+
+ var handshake_success = rc.handshake
+ if handshake_success then
+ new_clients.add rc
+ print "Server: Client at {client_socket.address} passed the handshake"
+ else
+ print_error "Server Error: Client at {client_socket.address} failed the handshake"
+ client_socket.close
+ end
+ end
+ return new_clients
+ end
+
+ # Broadcast a `message` to all `clients`, then flush the connection
+ fun broadcast(message: Serializable)
+ do
+ for client in clients do
+ client.writer.serialize(message)
+ client.socket.flush
+ end
+ end
+end
+
+# Reference to a remote client connected to this server
+class RemoteClient
+
+ # Communication socket with the client
+ var socket: TCPStream
+
+ # Is this client connected?
+ fun connected: Bool do return socket.connected
+
+ # `BinarySerializer` used to send data to this client through `socket`
+ var writer: BinarySerializer is noinit
+
+ # `BinaryDeserializer` used to receive data from this client through `socket`
+ var reader: BinaryDeserializer is noinit
+
+ init
+ do
+ # Setup serialization
+ writer = new BinarySerializer(socket)
+ writer.cache = new AsyncCache(true)
+ reader = new BinaryDeserializer(socket)
+ writer.link reader
+ end
+
+ # Check for compatibility with the client
+ fun handshake: Bool
+ do
+ print "Server: Handshake requested by {socket.address}"
+
+ # Make sure it is the same app
+ var server_app = sys.handshake_app_name
+ var client_app = socket.read_string
+ if server_app != client_app then
+ print_error "Server Error: Client app name is '{client_app}'"
+
+ # Send an empty string so the client read it and give up
+ socket.write_string ""
+ socket.close
+ return false
+ end
+
+ socket.write_string server_app
+
+ # App version
+ var app_version = sys.handshake_app_version
+ var client_version = socket.read_string
+ if client_version != app_version then
+ print_error "Handshake Error: client version is different '{client_version}'"
+ socket.write_string ""
+ socket.close
+ return false
+ end
+
+ socket.write_string app_version
+
+ return true
+ end
+end
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Angle related service using `Float` to represent an angle in radians
+module angles
+
+import points_and_lines
+
+redef class Point[N]
+ # Arctangent function using the difference between `self` and `other` as trigonometric ratio
+ #
+ # Behave similarly to the toplevel `atan2` as it returns the angle in the appropriate quadrant.
+ #
+ # ~~~
+ # var p0 = new Point[Float](0.0, 0.0)
+ # var p1 = new Point[Float](1.0, 1.0)
+ # assert p0.atan2(p1).is_approx(0.25*pi, 0.0001)
+ # ~~~
+ fun atan2(other: Point[N]): Float
+ do
+ var dx = other.x.to_f - x.to_f
+ var dy = other.y.to_f - y.to_f
+ var a = sys.atan2(dy.to_f, dx.to_f)
+ return a
+ end
+end
+
+redef universal Float
+ # Normalize the `self` angle in radians to be within `[-pi .. pi[`
+ #
+ # ~~~
+ # assert (1.5*pi).angle_normalize.is_approx(-0.5*pi, 0.0001)
+ # assert 8.0.angle_normalize.is_approx(1.7168, 0.0001)
+ # assert (-1.0).angle_normalize == -1.0
+ # ~~~
+ fun angle_normalize: Float
+ do
+ var s = self
+ while s < -pi do s += 2.0*pi
+ while s >= pi do s -= 2.0*pi
+ return s
+ end
+
+ # Linear interpolation on the arc delimited by `self` and `other` at `p` out of 1.0
+ #
+ # The result is normalized with `angle_normalize`.
+ #
+ # ~~~
+ # assert 0.0.angle_lerp(pi, 0.5).is_approx(0.5*pi, 0.0001)
+ # assert 0.0.angle_lerp(pi, 8.5).is_approx(0.5*pi, 0.0001)
+ # assert 0.0.angle_lerp(pi, 7.5).is_approx(-0.5*pi, 0.0001)
+ # ~~~
+ fun angle_lerp(other, p: Float): Float
+ do
+ var d = other - self
+ var a = self + d*p
+ return a.angle_normalize
+ end
+end
assert left != null and right != null and top != null and bottom != null
- self.left = left
- self.right = right
- self.top = top
- self.bottom = bottom
+ init(left, right, top, bottom)
end
# Create a `Box` using left, right, bottom and top
init lrbt(left, right, bottom, top: N)
do
- self.left = left
- self.right = right
- self.top = top
- self.bottom = bottom
+ init(left, right, top, bottom)
end
# Create a `Box` using left, right, top and bottom
init lrtb(left, right, top, bottom: N)
do
- self.left = left
- self.right = right
- self.top = top
- self.bottom = bottom
+ init(left, right, top, bottom)
end
# Create a `Box` using left, bottom, width and height
init lbwh(left, bottom, width, height: N)
do
- self.left = left
- self.bottom = bottom
-
- self.right = left + width
- self.top = bottom + height
+ init(left, left + width, bottom + height, bottom)
end
# Create a `Box` using left, top, width and height
init ltwh(left, top, width, height: N)
do
- self.left = left
- self.top = top
-
- self.right = left + width
- self.bottom = top - height
+ init(left, left+width, top, top - height)
end
redef fun to_s do return "<left: {left}, right: {right}, top: {top}, bottom: {bottom}>"
import points_and_lines
import boxes
+import angles
# limitations under the License.
# Provides interfaces and classes to represent basic geometry needs.
-module points_and_lines
+module points_and_lines is serialize
+
+import serialization
# An abstract 2d point, strongly linked to its implementation `Point`
interface IPoint[N: Numeric]
- # horizontal coordinate
+
+ # Horizontal coordinate
fun x: N is abstract
- # vertical coordinate
+
+ # Vertical coordinate
fun y: N is abstract
redef fun to_s do return "({x}, {y})"
+
+ # Distance with `other`
+ #
+ # ~~~
+ # var p0 = new Point[Float](0.0, 0.0)
+ # var p1 = new Point[Float](2.0, 3.0)
+ # assert p0.dist(p1).is_approx(3.6, 0.01)
+ # ~~~
+ #
+ # TODO 3D implementation.
+ fun dist(other: Point[Numeric]): N
+ do
+ return x.value_of(dist2(other).to_f.sqrt)
+ end
+
+ # Square of the distance with `other`
+ #
+ # May be used as an approximation to compare distance between two points.
+ #
+ # ~~~
+ # var p0 = new Point[Float](0.0, 0.0)
+ # var p1 = new Point[Float](2.0, 3.0)
+ # assert p0.dist2(p1) == 13.0
+ # ~~~
+ #
+ # TODO 3D implementation.
+ fun dist2(other: Point[Numeric]): N
+ do
+ var dx = other.x.sub(x)
+ var dy = other.y.sub(y)
+ var s = (dx.mul(dx)).add(dy.mul(dy))
+ return x.value_of(s)
+ end
+
+ # Linear interpolation between `self` and `other` at `p` out of `1.0`
+ #
+ # ~~~
+ # var p0 = new Point[Float](0.0, 0.0)
+ # var p1 = new Point[Float](2.0, 3.0)
+ # assert p0.lerp(p1, 0.0) == p0
+ # assert p0.lerp(p1, 1.0) == p1
+ # assert p0.lerp(p1, 0.5) == new Point[Float](1.0, 1.5)
+ # ~~~
+ #
+ # TODO 3D implementation.
+ fun lerp(other: Point[Numeric], p: Float): Point[N]
+ do
+ var xx = x.to_f + (other.x.to_f - x.to_f).to_f * p
+ var yy = y.to_f + (other.y.to_f - y.to_f).to_f * p
+ return new Point[N](x.value_of(xx), y.value_of(yy))
+ end
+
+ redef fun ==(o) do return o isa IPoint[Numeric] and o.x == x and o.y == y
end
# A 2d point and an implementation of `IPoint`
point_right = a
end
end
-
end
# An abstract 3d line segment
# init calculating the center
init with_center(pts : Array[Array[Float]]) do
- center = calc_center(pts)
+ init(calc_center(pts))
end
# Calculate the center
--- /dev/null
+# Nit wrapper for Github API
+
+This module provides a Nit object oriented interface to access the Github api.
+
+## Accessing the API
+
+[[doc: GithubAPI]]
+
+### Authentification
+
+[[doc: GithubAPI::auth]]
+
+Token can also be recovered from user config with `get_github_oauth`.
+
+[[doc: get_github_oauth]]
+
+### Retrieving user data
+
+[[doc: load_user]]
+[[doc: User]]
+[[list: User]]
+
+### Retrieving repo data
+
+[[doc: load_repo]]
+[[doc: Repo]]
+[[list: Repo]]
+
+### Other data
+
+[[list: api]]
+
+### Advanced uses
+
+#### Caching
+
+[[doc: cache]]
+
+#### Custom requests
+
+[[doc: GithubAPI::get]]
+
+#### Change the user agent
+
+[[doc: GithubAPI::user_agent]]
+
+#### Debugging
+
+[[doc: verbose_lvl]]
+
+#### Using with GitLab
+
+If URL scheme of GitLab API follows the one of Github API, it may be possible to
+configure this wrapper to use a custom URL.
+
+[[doc: api_url]]
+
+## Creating hooks
+
+Using this API you can create Github hooks able to respond to actions performed
+on a repository.
+
+[[doc: hooks]]
+
+## Dealing with events
+
+GithubAPI can trigger different events depending on the hook configuration.
+
+[[doc: GithubEvent]]
+
+[[list: github::events]]
# See the License for the specific language governing permissions and
# limitations under the License.
-# Nit object oriented interface to Github api.
+# Nit object oriented interface to [Github api](https://developer.github.com/v3/).
#
# This modules reifies Github API elements as Nit classes.
#
import github_curl
-# Interface to Github REST API.
+# Client to Github API
#
-# Used by all `GithubEntity` to perform requests.
-#
-# Usage:
+# To access the API you need an instance of a `GithubAPI` client.
#
# ~~~
# # Get Github authentification token.
# var api = new GithubAPI(token)
# ~~~
#
-# The API client allows to get Github API entities:
+# The API client allows you to get Github API entities.
#
# ~~~
# var repo = api.load_repo("privat/nit")
# ~~~
class GithubAPI
- # Github API OAuth token.
+ # Github API OAuth token
+ #
+ # To access your private ressources, you must
+ # [authenticate](https://developer.github.com/guides/basics-of-authentication/).
+ #
+ # For client applications, Github recommands to use the
+ # [OAuth tokens](https://developer.github.com/v3/oauth/) authentification method.
+ #
+ #
#
- # This token is used to authenticate the application on Github API.
# Be aware that there is [rate limits](https://developer.github.com/v3/rate_limit/)
# associated to the key.
var auth: String
return res.as(JsonObject)
end
- # Get the Github user with `login`.
+ # Get the Github user with `login`
#
- # Returns `null` if the user cannot be found.
+ # Loads the `User` from the API or returns `null` if the user cannot be found.
#
# var api = new GithubAPI(get_github_oauth)
# var user = api.load_user("Morriar")
# Get the Github repo with `full_name`.
#
- # Returns `null` if the repo cannot be found.
+ # Loads the `Repo` from the API or returns `null` if the repo cannot be found.
#
# var api = new GithubAPI(get_github_oauth)
# var repo = api.load_repo("privat/nit")
fun html_url: String do return json["html_url"].to_s
end
-# A Github user.
+# A Github user
#
+# Provides access to [Github user data](https://developer.github.com/v3/users/).
# Should be accessed from `GithubAPI::load_user`.
-#
-# See <https://developer.github.com/v3/users/>.
class User
super GithubEntity
# A Github repository.
#
+# Provides access to [Github repo data](https://developer.github.com/v3/repos/).
# Should be accessed from `GithubAPI::load_repo`.
-#
-# See <https://developer.github.com/v3/repos/>.
class Repo
super GithubEntity
# See the License for the specific language governing permissions and
# limitations under the License.
-# Github API related features.
+# Nit wrapper for Github API
+#
+# This module provides a Nit object oriented interface to access the
+# [Github api](https://developer.github.com/v3/).
module github
import cache
var header: HeaderMap is noinit
# OAuth token
+ #
+ # Use an empty string to disable authentication and connect
+ # anonymously (thus less capabilities and more rate limits)
var auth: String
# User agent (is used by github to contact devs in case of problems)
init do
header = new HeaderMap
- header["Authorization"] = "token {auth}"
+ if auth != "" then header["Authorization"] = "token {auth}"
end
# Get the requested URI, and check the HTTP response. Then convert to JSON
redef fun to_s do return "[{name}] {super}"
end
+# Gets the Github token from `git` configuration
+#
# Return the value of `git config --get github.oauthtoken`
-# return "" if no such a key
+# or `""` if no key exists.
fun get_github_oauth: String
do
var p = new ProcessReader("git", "config", "--get", "github.oauthtoken")
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Supporting services for the FFI with Java
+#
+# This modules relies on `Sys::jvm`, `Sys::jni_env` and
+# `Sys::create_default_jvm` to get a handle on a JVM. You can adapt the
+# behavior of the FFI and services in this module by redefing
+# `Sys::create_default_jvm` and supply your own JVM object. You can manage
+# multiple java thread by switching the current environment in a redef
+# of `Sys::jni_env`, and multiple JVM using `Sys::jvm`.
+module base is
+ cflags "-I $(JAVA_HOME)/include/ -I $(JAVA_HOME)/include/linux/"
+ ldflags "-L $(JNI_LIB_PATH) -ljvm"
+ new_annotation extra_java_files
+end
+
+import jvm
+
+redef class Sys
+ private var jvm_cache: nullable JavaVM = null
+ private var jni_env_cache: nullable JniEnv = null
+
+ # Default Java Virtual Machine to use (will be instantiated using
+ # `create_default_jvm` if not already set)
+ fun jvm: JavaVM
+ do
+ if jvm_cache == null then create_default_jvm
+ return jvm_cache.as(not null)
+ end
+
+ # Sets the current default Java Virtual Machine (use with `jni_env=`)
+ fun jvm=(jvm: JavaVM) do jvm_cache = jvm
+
+ # Current main `JniEnv`
+ fun jni_env: JniEnv
+ do
+ if jni_env_cache == null then create_default_jvm
+ return jni_env_cache.as(not null)
+ end
+
+ # Sets the current default JNI env (use with `jvm=`)
+ fun jni_env=(jni_env: JniEnv) do jni_env_cache = jni_env
+
+ # Called by `jvm` and `jni_env` to instantiate a Java Virtual Machine.
+ # Used mostly for the FFI with Java.
+ protected fun create_default_jvm
+ do
+ var builder = new JavaVMBuilder
+
+ # By default, look for Java classes in a jar file the same directory as the executable
+ builder.options.add "-Djava.class.path={sys.program_name}.jar"
+
+ var jvm = builder.create_jvm
+ assert jvm != null else print "JVM creation failed"
+
+ self.jvm = jvm
+ self.jni_env = builder.jni_env.as(not null)
+ end
+
+ # Get a Java class by its name from the current `jni_env`
+ fun load_jclass(name: NativeString): JClass import jni_env `{
+ JNIEnv *nit_ffi_jni_env = Sys_jni_env(self);
+
+ // retrieve the implementation Java class
+ jclass java_class = (*nit_ffi_jni_env)->FindClass(nit_ffi_jni_env, name);
+ if (java_class == NULL) {
+ fprintf(stderr, "Nit FFI with Java error: failed to load class.\\n");
+ (*nit_ffi_jni_env)->ExceptionDescribe(nit_ffi_jni_env);
+ exit(1);
+ }
+
+ return java_class;
+ `}
+end
+
+# A standard Java string `java.lang.String`
+#
+# Converted to a Nit string using `to_s`, or to a C string with `to_cstring`.
+# Created using `String::to_java_string` or `NativeString::to_java_string`.
+extern class JavaString in "Java" `{ java.lang.String `}
+ super JavaObject
+
+ # Get the string from Java and copy it to Nit memory
+ fun to_cstring: NativeString import sys, Sys.jni_env `{
+ Sys sys = JavaString_sys(self);
+ JNIEnv *env = Sys_jni_env(sys);
+
+ // Get the data from Java
+ const char *java_cstr = (*env)->GetStringUTFChars(env, self, NULL);
+ jsize len = (*env)->GetStringUTFLength(env, self);
+
+ // Copy it in control of Nit
+ char *nit_cstr = (char*)malloc(len+1);
+ memcpy(nit_cstr, java_cstr, len);
+ nit_cstr[len] = '\0';
+
+ // Free JNI ref and return
+ (*env)->ReleaseStringUTFChars(env, self, java_cstr);
+ return nit_cstr;
+ `}
+
+ redef fun to_s do return to_cstring.to_s
+end
+
+redef class NativeString
+ # Get a Java string from this C string
+ #
+ # This instance is only valid until the next execution of Java code.
+ # You can use `new_local_ref` to keep it longer.
+ fun to_java_string: JavaString import sys, Sys.jni_env `{
+ Sys sys = JavaString_sys(self);
+ JNIEnv *env = Sys_jni_env(sys);
+ return (*env)->NewStringUTF(env, self);
+ `}
+end
+
+redef class Text
+ # Get `self` as a `JavaString`
+ fun to_java_string: JavaString do return to_cstring.to_java_string
+end
+
+redef extern class JavaObject
+
+ # Returns a global reference to the Java object behind this reference
+ #
+ # You must use a global reference when keeping a Java object
+ # across execution of Java code, per JNI specification.
+ fun new_global_ref: SELF import sys, Sys.jni_env `{
+ Sys sys = JavaObject_sys(self);
+ JNIEnv *env = Sys_jni_env(sys);
+ return (*env)->NewGlobalRef(env, self);
+ `}
+
+ # Delete this global reference
+ fun delete_global_ref import sys, Sys.jni_env `{
+ Sys sys = JavaObject_sys(self);
+ JNIEnv *env = Sys_jni_env(sys);
+ (*env)->DeleteGlobalRef(env, self);
+ `}
+
+ # Delete this local reference
+ fun delete_local_ref import sys, Sys.jni_env `{
+ Sys sys = JavaObject_sys(self);
+ JNIEnv *env = Sys_jni_env(sys);
+ (*env)->DeleteLocalRef(env, self);
+ `}
+
+ # Pops the current local reference frame and return a valid reference to self
+ #
+ # Similar to `JavaVM::pop_local_frame` but returns a value.
+ fun pop_from_local_frame: SELF
+ do
+ var jni_env = sys.jni_env
+ return pop_from_local_frame_with_env(jni_env)
+ end
+
+ # Java implementation of `pop_from_local_frame`
+ protected fun pop_from_local_frame_with_env(jni_env: JniEnv): SELF `{
+ return (*jni_env)->PopLocalFrame(jni_env, self);
+ `}
+
+ # Is `self` null in Java?
+ #
+ # Since Java type system doesn't have the same `nullable` concept as Nit's,
+ # the two systems are not directly compatible. Any Nit instances of
+ # `JavaObject` may hold a Java null.
+ #
+ # To benefit from the safer type system of Nit, it is recommended to check
+ # the return of all extern methods implemented in Java to ensure the value
+ # is not a Java null. In case it is, you should replace it by a normal Nit
+ # `null`.
+ fun is_java_null: Bool in "Java" `{ return self == null; `}
+
+ # `JavaString` representation of `self` using Java's `toString`
+ fun to_java_string: JavaString in "Java" `{ return self.toString(); `}
+
+ # Use Java's `toString` for any `JavaObject`
+ redef fun to_s
+ do
+ if is_java_null then return super
+ return to_java_string.to_s
+ end
+end
# ~~~
module collections
-import java
+import base
# Java primitive array
#
# This module is used by `android::assets_and_resources` and `android::audio`.
module io
-import java
+import base
in "Java" `{
import java.io.File;
# This file is part of NIT ( http://www.nitlanguage.org ).
#
-# Copyright 2014 Alexis Laferrière <alexis.laf@xymus.net>
-#
# Licensed under the Apache License, Version 2.0 (the "License");
# you may not use this file except in compliance with the License.
# You may obtain a copy of the License at
# The module `jvm` gives more control over the JVM instances and wraps
# most of JNI functions. You can use it to further customize the behavior
# of your code.
-module java is
- cflags "-I $(JAVA_HOME)/include/ -I $(JAVA_HOME)/include/linux/"
- ldflags "-L $(JNI_LIB_PATH) -ljvm"
- new_annotation extra_java_files
-end
-
-import jvm
-
-redef class Sys
- private var jvm_cache: nullable JavaVM = null
- private var jni_env_cache: nullable JniEnv = null
-
- # Default Java Virtual Machine to use (will be instantiated using
- # `create_default_jvm` if not already set)
- fun jvm: JavaVM
- do
- if jvm_cache == null then create_default_jvm
- return jvm_cache.as(not null)
- end
-
- # Sets the current default Java Virtual Machine (use with `jni_env=`)
- fun jvm=(jvm: JavaVM) do jvm_cache = jvm
-
- # Current main `JniEnv`
- fun jni_env: JniEnv
- do
- if jni_env_cache == null then create_default_jvm
- return jni_env_cache.as(not null)
- end
-
- # Sets the current default JNI env (use with `jvm=`)
- fun jni_env=(jni_env: JniEnv) do jni_env_cache = jni_env
-
- # Called by `jvm` and `jni_env` to instantiate a Java Virtual Machine.
- # Used mostly for the FFI with Java.
- protected fun create_default_jvm
- do
- var builder = new JavaVMBuilder
-
- # By default, look for Java classes in a jar file the same directory as the executable
- builder.options.add "-Djava.class.path={sys.program_name}.jar"
-
- var jvm = builder.create_jvm
- assert jvm != null else print "JVM creation failed"
-
- self.jvm = jvm
- self.jni_env = builder.jni_env.as(not null)
- end
-
- # Get a Java class by its name from the current `jni_env`
- fun load_jclass(name: NativeString): JClass import jni_env `{
- JNIEnv *nit_ffi_jni_env = Sys_jni_env(self);
-
- // retrieve the implementation Java class
- jclass java_class = (*nit_ffi_jni_env)->FindClass(nit_ffi_jni_env, name);
- if (java_class == NULL) {
- fprintf(stderr, "Nit FFI with Java error: failed to load class.\\n");
- (*nit_ffi_jni_env)->ExceptionDescribe(nit_ffi_jni_env);
- exit(1);
- }
-
- return java_class;
- `}
-end
-
-# A standard Java string `java.lang.String`
-#
-# Converted to a Nit string using `to_s`, or to a C string with `to_cstring`.
-# Created using `String::to_java_string` or `NativeString::to_java_string`.
-extern class JavaString in "Java" `{ java.lang.String `}
- super JavaObject
-
- # Get the string from Java and copy it to Nit memory
- fun to_cstring: NativeString import sys, Sys.jni_env `{
- Sys sys = JavaString_sys(self);
- JNIEnv *env = Sys_jni_env(sys);
-
- // Get the data from Java
- const jbyte *java_cstr = (char*)(*env)->GetStringUTFChars(env, self, NULL);
- jsize len = (*env)->GetStringUTFLength(env, self);
-
- // Copy it in control of Nit
- char *nit_cstr = (char*)malloc(len+1);
- memcpy(nit_cstr, java_cstr, len);
- nit_cstr[len] = '\0';
-
- // Free JNI ref and return
- (*env)->ReleaseStringUTFChars(env, self, java_cstr);
- return nit_cstr;
- `}
-
- redef fun to_s do return to_cstring.to_s
-end
-
-redef class NativeString
- # Get a Java string from this C string
- #
- # This instance is only valid until the next execution of Java code.
- # You can use `new_local_ref` to keep it longer.
- fun to_java_string: JavaString import sys, Sys.jni_env `{
- Sys sys = JavaString_sys(self);
- JNIEnv *env = Sys_jni_env(sys);
- return (*env)->NewStringUTF(env, self);
- `}
-end
-
-redef class Text
- # Get `self` as a `JavaString`
- fun to_java_string: JavaString do return to_cstring.to_java_string
-end
-
-redef extern class JavaObject
-
- # Returns a global reference to the Java object behind this reference
- #
- # You must use a global reference when keeping a Java object
- # across execution of Java code, per JNI specification.
- fun new_global_ref: SELF import sys, Sys.jni_env `{
- Sys sys = JavaObject_sys(self);
- JNIEnv *env = Sys_jni_env(sys);
- return (*env)->NewGlobalRef(env, self);
- `}
-
- # Delete this global reference
- fun delete_global_ref import sys, Sys.jni_env `{
- Sys sys = JavaObject_sys(self);
- JNIEnv *env = Sys_jni_env(sys);
- (*env)->DeleteGlobalRef(env, self);
- `}
-
- # Delete this local reference
- fun delete_local_ref import sys, Sys.jni_env `{
- Sys sys = JavaObject_sys(self);
- JNIEnv *env = Sys_jni_env(sys);
- (*env)->DeleteLocalRef(env, self);
- `}
-
- # Pops the current local reference frame and return a valid reference to self
- #
- # Similar to `JavaVM::pop_local_frame` but returns a value.
- fun pop_from_local_frame: SELF
- do
- var jni_env = sys.jni_env
- return pop_from_local_frame_with_env(jni_env)
- end
-
- private fun pop_from_local_frame_with_env(jni_env: JniEnv): SELF `{
- return (*jni_env)->PopLocalFrame(jni_env, self);
- `}
-
- # Is `self` null in Java?
- #
- # Since Java type system doesn't have the same `nullable` concept as Nit's,
- # the two systems are not directly compatible. Any Nit instances of
- # `JavaObject` may hold a Java null.
- #
- # To benefit from the safer type system of Nit, it is recommended to check
- # the return of all extern methods implemented in Java to ensure the value
- # is not a Java null. In case it is, you should replace it by a normal Nit
- # `null`.
- fun is_java_null: Bool in "Java" `{ return self == null; `}
-
- # `JavaString` representation of `self` using Java's `toString`
- fun to_java_string: JavaString in "Java" `{ return self.toString(); `}
+module java
- # Use Java's `toString` for any `JavaObject`
- redef fun to_s
- do
- if is_java_null then return super
- return to_java_string.to_s
- end
-end
+import base
+import collections
# Write a string to the connection
redef fun write(str)
do
- native_buffer_event.write(str.to_cstring, str.length)
+ native_buffer_event.write(str.to_cstring, str.bytelen)
end
redef fun write_byte(byte) do native_buffer_event.write_byte(byte)
`}
# Write the byte `value`
- fun write_byte(value: Int): Int `{
+ fun write_byte(value: Byte): Int `{
unsigned char byt = (unsigned char)value;
return bufferevent_write(self, &byt, 1);
`}
# Find DB path
var config_home = xdg_basedir.config_home.to_s
- var config_dir = config_home.join_path(sys.program_name.basename(""))
+ var config_dir = config_home.join_path(sys.program_name.basename)
if not config_dir.file_exists then config_dir.mkdir
var db_path = config_dir.join_path(db_file)
module linux
import app
-private import data_store
c2 = ' '
end
- var loc = text.pos_to_loc(pos)
+ var loc = new MDLocation(
+ current_loc.line_start,
+ current_loc.column_start + pos,
+ current_loc.line_start,
+ current_loc.column_start + pos)
if c == '*' then
if c1 == '*' then
end
return -1
end
+
+ # Location used for next parsed token.
+ #
+ # This location can be changed by the emitter to adjust with `\n` found
+ # in the input.
+ private fun current_loc: MDLocation do return emitter.current_loc
end
# Emit output corresponding to blocks content.
# Transform and emit mardown text
fun emit_text(text: Text) do emit_text_until(text, 0, null)
- # Transform and emit mardown text starting at `from` and
+ # Transform and emit mardown text starting at `start` and
# until a token with the same type as `token` is found.
- # Go until the end of text if `token` is null.
+ # Go until the end of `text` if `token` is null.
fun emit_text_until(text: Text, start: Int, token: nullable Token): Int do
var old_text = current_text
var old_pos = current_pos
current_text = text
current_pos = start
while current_pos < text.length do
+ if text[current_pos] == '\n' then
+ current_loc.line_start += 1
+ current_loc.column_start = -current_pos
+ end
var mt = processor.token_at(text, current_pos)
if (token != null and not token isa TokenNone) and
(mt.is_same_type(token) or
return buffer_stack.last
end
+ # Stacked locations.
+ private var loc_stack = new List[MDLocation]
+
+ # Push a new MDLocation on the stack.
+ private fun push_loc(location: MDLocation) do loc_stack.add location
+
+ # Pop the last buffer.
+ private fun pop_loc: MDLocation do return loc_stack.pop
+
+ # Current output buffer.
+ private fun current_loc: MDLocation do
+ assert not loc_stack.is_empty
+ return loc_stack.last
+ end
+
# Append `e` to current buffer.
fun add(e: Writable) do
if e isa Text then
var column_end: Int
redef fun to_s do return "{line_start},{column_start}--{line_end},{column_end}"
+
+ # Return a copy of `self`.
+ fun copy: MDLocation do
+ return new MDLocation(line_start, column_start, line_end, column_end)
+ end
end
# A block of markdown lines.
fun emit_blocks(v: MarkdownEmitter) do
var block = self.block.first_block
while block != null do
+ v.push_loc(block.location)
block.kind.emit(v)
+ v.pop_loc
block = block.next
end
end
class BlockHeadline
super Block
- redef fun emit(v) do v.decorator.add_headline(v, self)
+ redef fun emit(v) do
+ var loc = block.location.copy
+ loc.column_start += start
+ v.push_loc(loc)
+ v.decorator.add_headline(v, self)
+ v.pop_loc
+ end
+
+ private var start = 0
# Depth of the headline used to determine the headline level.
var depth = 0
line.leading = 0
line.trailing = 0
end
+ self.start = start
depth = level.min(6)
end
end
return null
end
- # Init a `MDLocation` instance at `pos` in `self`.
- private fun pos_to_loc(pos: Int): MDLocation do
- assert pos <= length
- var line = 1
- var col = 0
- var i = 0
- while i <= pos do
- col += 1
- var c = self[i]
- if c == '\n' then
- line +=1
- col = 0
- end
- i +=1
- end
- return new MDLocation(line, col, line, col)
- end
-
# Is `self` an unsafe HTML element?
private fun is_html_unsafe: Bool do return html_unsafe_tags.has(self.write_to_string)
"TokenLink at 4,1--4,1"]
(new TestTokenProcessor(stack)).process(string)
end
+
+ fun test_token_location4 do
+ var string = "**Hello**\n\n`World`"
+ var stack = [
+ "TokenStrongStar at 1,1--1,1",
+ "TokenStrongStar at 1,8--1,8",
+ "TokenCodeSingle at 3,1--3,1",
+ "TokenCodeSingle at 3,7--3,7"]
+ (new TestTokenProcessor(stack)).process(string)
+ end
+
+ fun test_token_location5 do
+ var string = "# *Title1*\n\n# *Title2*"
+ var stack = [
+ "TokenEmStar at 1,3--1,3",
+ "TokenEmStar at 1,10--1,10",
+ "TokenEmStar at 3,3--3,3",
+ "TokenEmStar at 3,10--3,10"]
+ (new TestTokenProcessor(stack)).process(string)
+ end
end
class TestTokenProcessor
var token = super
if token isa TokenNone then return token
var res = "{token.class_name} at {token.location}"
- print res
var exp = test_stack.shift
+ print ""
+ print "EXP {exp}"
+ print "RES {res}"
assert exp == res
return token
end
proc.emitter.decorator = new TestBlockDecorator(stack)
proc.process(string)
end
+
+ fun test_block_location3 do
+ var stack = [
+ "BlockHeadline: 1,1--1,8",
+ "BlockHeadline: 3,1--3,10"]
+ var string ="""# Title\n\n## Title 2"""
+ proc.emitter.decorator = new TestBlockDecorator(stack)
+ proc.process(string)
+ end
end
class TestBlockDecorator
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Test suites for module `markdown`
+module test_wikilinks is test_suite
+
+import test_markdown
+import wikilinks
+
+class TestTokenWikilink
+ super TestSuite
+
+ fun test_token_location1 do
+ var string = "[[wikilink]]"
+ var stack = ["TokenWikiLink at 1,1--1,1"]
+ (new TestTokenProcessor(stack)).process(string)
+ end
+
+ fun test_token_location2 do
+ var string = "Hello [[World]]"
+ var stack = ["TokenWikiLink at 1,7--1,7"]
+ (new TestTokenProcessor(stack)).process(string)
+ end
+
+ fun test_token_location3 do
+ var string = "\nHello\nworld [[wikilink]] !"
+ var stack = ["TokenWikiLink at 3,7--3,7"]
+ (new TestTokenProcessor(stack)).process(string)
+ end
+
+ fun test_token_location4 do
+ var string = "[[link1]]\n\n[[link2]]"
+ var stack = [
+ "TokenWikiLink at 1,1--1,1",
+ "TokenWikiLink at 3,1--3,1"]
+ (new TestTokenProcessor(stack)).process(string)
+ end
+
+ fun test_token_location5 do
+ var string = "[[link1]]\n[[link2]]"
+ var stack = [
+ "TokenWikiLink at 1,1--1,1",
+ "TokenWikiLink at 2,1--2,1"]
+ (new TestTokenProcessor(stack)).process(string)
+ end
+
+ fun test_token_location6 do
+ var string = """
+[[doc: github]]
+
+[[loollll]]
+
+## Accessing the API
+
+[[doc: GithubAPI]]"""
+ var stack = [
+ "TokenWikiLink at 1,1--1,1",
+ "TokenWikiLink at 3,1--3,1",
+ "TokenWikiLink at 7,1--7,1"]
+ (new TestTokenProcessor(stack)).process(string)
+ end
+end
redef class Decorator
# Renders a `[[wikilink]]` item.
- fun add_wikilink(v: EMITTER, link: Text, name, comment: nullable Text) do
- if name != null then
- v.add "[[{name}|{link}]]"
+ fun add_wikilink(v: EMITTER, token: TokenWikiLink) do
+ if token.name != null then
+ v.add "[[{token.name.to_s}|{token.link.to_s}]]"
else
- v.add "[[{link}]]"
+ v.add "[[{token.link.to_s}]]"
end
end
end
super TokenLink
redef fun emit_hyper(v) do
- v.decorator.add_wikilink(v, link.as(not null), name, comment)
+ v.decorator.add_wikilink(v, self)
end
redef fun check_link(v, out, start, token) do
EGL_RED_SIZE, 8,
EGL_NONE
};
- EGLint w, h, dummy, format;
+ EGLint w, h, format;
EGLint numConfigs;
EGLConfig config;
EGLSurface surface;
var handled = input(ie)
if not handled then
- for pe in ie.pointers do
- input(pe)
- end
+ input ie.acting_pointer
end
return handled
fun is_down: Bool is abstract
# Key is currently up?
- fun is_up: Bool is abstract
+ fun is_up: Bool do return not is_down
# Key is the up arrow key?
fun is_arrow_up: Bool is abstract
level2.keys.remove(k2)
end
+ # Is there a value at `k1, k2`?
+ fun has(k1: K1, k2: K2): Bool
+ do
+ if not level1.keys.has(k1) then return false
+ return level1[k1].keys.has(k2)
+ end
+
# Remove all items
fun clear do level1.clear
end
level2.remove_at(k2, k3)
end
+ # Is there a value at `k1, k2, k3`?
+ fun has(k1: K1, k2: K2, k3: K3): Bool
+ do
+ if not level1.keys.has(k1) then return false
+ return level1[k1].has(k2, k3)
+ end
+
# Remove all items
fun clear do level1.clear
end
private var batch_id: nullable Int = null
# Load the entity from base
- private init from_neo(neo: Neo4jClient, url: String) do
+ private init from_neo(neo: Neo4jClient, url: String) is nosuper do
self.neo = neo
self.url = url
end
# Init entity from JSON representation
- private init from_json(neo: Neo4jClient, obj: JsonObject) do
+ private init from_json(neo: Neo4jClient, obj: JsonObject) is nosuper do
self.neo = neo
self.url = obj["self"].to_s
self.internal_properties = obj["data"].as(JsonObject)
do
# Set the content length if not already set
if not header.keys.has("Content-Length") then
- header["Content-Length"] = body.length.to_s
+ header["Content-Length"] = body.bytelen.to_s
end
# Set server ID
types["asf"] = "video/x-ms-asf"
types["mng"] = "video/x-mng"
types["apk"] = "application/vnd.android.package-archive"
+ types["svg"] = "image/svg+xml"
+ types["ttf"] = "application/x-font-ttf"
+ types["otf"] = "application/x-font-opentype"
+ types["eof"] = "application/vnd.ms-fontobject"
+ types["woff"] = "application/font-woff"
+ types["woff2"] = "application/font-woff2"
end
end
# limitations under the License.
# Provides the noise generators `PerlinNoise` and `InterpolatedNoise`
-module noise
+module noise is serialize
+
+import serialization
# 2D noise generator
abstract class Noise
# Seed to the random number generator `gradient_vector`
#
# By default, `seed` has a random value created with `Int::rand`.
- var seed: Int = 19559.rand is lazy, writable
+ var seed: Int = 19511359.rand is lazy, writable
end
# 2D Perlin noise generator using layered `InterpolatedNoise`
# Used to get seeds for layers from the previous layers or `seed`.
protected fun pseudo_random(value: Int): Int
do
- return value + 2935391 % 954847
+ return (value * 3537391).mask % 1291377
end
end
var ix1 = sx.lerp(n0, n1)
var val = sy.lerp(ix0, ix1)
- # Return value in [min...max] from val in [-0.5...0.5]
+ # Return value in [min...max] from val in [-1.0...1.0]
+ val /= 2.0
val += 0.5
return val.lerp(min, max)
end
#
# These magic prime numbers were determined good enough by
# non-emperical experimentation. They may need to be changed/improved.
- var i = 17957*seed + 45127*x + 22613*y
- var mod = 19031
+ var seed = 817721 + self.seed
+ var i = seed * (x+seed) * 25111217 * (y+seed) * 72233613
+ var mod = 137121
+ var angle = (i.mask.abs%mod).to_f*2.0*pi/mod.to_f
+
+ # Debug code to evaluate the efficiency of the random angle generator
+ # The average of the produced angles should be at pi
+ #
+ #var sum = once new Container[Float](0.0)
+ #var count = once new Container[Float](0.0)
+ #sum.item += angle
+ #count.item += 1.0
+ #if count.item.to_i % 1000 == 0 then print "avg:{sum.item/count.item}/{count.item} i:{i} a:{angle} ({x}, {y}: {seed})"
- var angle = (i%mod).to_f*2.0*pi/mod.to_f
if w == 0 then return angle.cos
return angle.sin
end
return dx*gradient_vector(ix, iy, 0) + dy*gradient_vector(ix, iy, 1)
end
end
+
+redef universal Int
+ # The value of the least-significant 30 bits of `self`
+ #
+ # This mask is used as compatibility with 32 bits architecture.
+ # The missing 2 bits are used to tag integers by the Nit system.
+ private fun mask: Int
+ do
+ return bin_and(0x3FFF_FFFF)
+ end
+end
end
end
-# An option with a String as parameter
+# An option with a `String` as parameter
class OptionString
super OptionParameter
redef type VALUE: nullable String
redef fun convert(str) do return str
end
-# An option with an enum as parameter
-# In the code, declaring an option enum (-e) with an enum like `["zero", "one", "two"]
-# In the command line, typing `myprog -e one` is giving 1 as value
+# An option to choose from an enumeration
+#
+# Declare an enumeration option with all its possible values as an array.
+# Once the arguments are processed, `value` is set as the index of the selected value, if any.
class OptionEnum
super OptionParameter
redef type VALUE: Int
--- /dev/null
+# This file is part of NIT (http://www.nitlanguage.org).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Services to gather information on the performance of events by categories
+#
+# Provides `PerfMap` to manage all the categories and
+# `PerfEntry` for per-category statistics.
+#
+# ~~~
+# for i in 100.times do
+# var clock = new Clock
+#
+# # Do some "work" here
+# nanosleep(0, 1000000)
+#
+# # Register the perf
+# sys.perfs["sleep 1ms"].add clock.lapse
+#
+# # Do some other "work" here
+# nanosleep(0, 5000000)
+#
+# # Register the perf
+# sys.perfs["sleep 5ms"].add clock.lapse
+# end
+#
+# assert sys.perfs["sleep 1ms"].count == 100
+# assert sys.perfs["sleep 1ms"].avg.is_approx(0.001, 0.001)
+# assert sys.perfs["sleep 5ms"].avg.is_approx(0.005, 0.005)
+# ~~~
+module performance_analysis
+
+import realtime
+
+redef class Sys
+ # Main `PerfMap` available by default
+ var perfs = new PerfMap
+end
+
+# Collection of statistics on many events
+class PerfMap
+ super HashMap[String, PerfEntry]
+
+ redef fun provide_default_value(key)
+ do
+ if not key isa String then return super
+
+ var ts = new PerfEntry(key)
+ self[key] = ts
+ return ts
+ end
+
+ redef fun to_s do return "* " + join("\n* ", ": ")
+end
+
+# Statistics on wall clock execution time of a category of events by `name`
+class PerfEntry
+
+ # Name of the category
+ var name: String
+
+ # Shortest execution time of registered events
+ var min = 0.0
+
+ # Longest execution time of registered events
+ var max = 0.0
+
+ # Average execution time of registered events
+ var avg = 0.0
+
+ # Number of registered events
+ var count = 0
+
+ # Total execution time of this event
+ var sum = 0.0
+
+ # Register a new event execution time with a `Timespec`
+ fun add(lapse: Timespec) do add_float lapse.to_f
+
+ # Register a new event execution time in seconds using a `Float`
+ fun add_float(time: Float)
+ do
+ if time.to_f < min.to_f or count == 0 then min = time
+ if time.to_f > max.to_f then max = time
+
+ sum += time
+ count += 1
+ avg = sum / count.to_f
+ end
+
+ redef fun to_s do return "min {min}, max {max}, avg {avg}, sum {sum}, count {count}"
+end
# - [x] `ConcurrentList`
# - [ ] `ConcurrentHashMap`
# - [ ] `ConcurrentHashSet`
-# - [ ] `ConcurrentContainer`
+# - [ ] `ConcurrentRef`
# - [ ] `ConcurrentQueue`
#
# Introduced collections specialize their critical methods according to the
private extern class NativePthreadMutex in "C" `{ pthread_mutex_t * `}
new (attr: NativePthreadMutexAttr) `{
pthread_mutex_t *mutex = malloc(sizeof(pthread_mutex_t));
- int res = pthread_mutex_init(mutex, attr);
+ int r = pthread_mutex_init(mutex, attr);
+ if (r != 0) {
+ free(mutex);
+ return NULL;
+ }
return mutex;
`}
private extern class NativePthreadMutexAttr in "C" `{ pthread_mutexattr_t * `}
new `{
pthread_mutexattr_t *attr = malloc(sizeof(pthread_mutexattr_t));
- int res = pthread_mutexattr_init(attr);
+ int r = pthread_mutexattr_init(attr);
+ if (r != 0) {
+ free(attr);
+ return NULL;
+ }
return attr;
`}
private extern class NativePthreadKey in "C" `{ pthread_key_t * `}
new `{
pthread_key_t *key = malloc(sizeof(pthread_key_t));
- int res = pthread_key_create(key, NULL);
+ int r = pthread_key_create(key, NULL);
+ if (r != 0) {
+ free(key);
+ return NULL;
+ }
return key;
`}
# - [ ] `List`
# - [ ] `HashMap`
# - [ ] `HashSet`
-# - [ ] `Container`
+# - [ ] `Ref`
# - [ ] `Queue`
module redef_collections
#include <time.h>
`}
+in "C" `{
+
+#ifdef __MACH__
+/* OS X does not have clock_gettime, mascarade it and use clock_get_time
+ * cf http://stackoverflow.com/questions/11680461/monotonic-clock-on-osx
+*/
+#include <mach/clock.h>
+#include <mach/mach.h>
+#define CLOCK_REALTIME CALENDAR_CLOCK
+#define CLOCK_MONOTONIC SYSTEM_CLOCK
+void clock_gettime(clock_t clock_name, struct timespec *ts) {
+ clock_serv_t cclock;
+ mach_timespec_t mts;
+ host_get_clock_service(mach_host_self(), clock_name, &cclock);
+ clock_get_time(cclock, &mts);
+ mach_port_deallocate(mach_task_self(), cclock);
+ ts->tv_sec = mts.tv_sec;
+ ts->tv_nsec = mts.tv_nsec;
+}
+#endif
+`}
+
# Elapsed time representation.
extern class Timespec `{struct timespec*`}
return self->tv_nsec;
`}
- # Seconds in Float
- # Loss of precision but great to print
+ # Elapsed time in microseconds, with both whole seconds and the rest
+ #
+ # May cause an `Int` overflow, use only with a low number of seconds.
+ fun microsec: Int `{
+ return self->tv_sec*1000000 + self->tv_nsec/1000;
+ `}
+
+ # Elapsed time in milliseconds, with both whole seconds and the rest
+ #
+ # May cause an `Int` overflow, use only with a low number of seconds.
+ fun millisec: Int `{
+ return self->tv_sec*1000 + self->tv_nsec/1000000;
+ `}
+
+ # Number of seconds as a `Float`
+ #
+ # Incurs a loss of precision, but the result is pretty to print.
fun to_f: Float do return sec.to_f + nanosec.to_f / 1000000000.0
redef fun to_s do return "{to_f}s"
# Smallest time frame reported by clock
fun resolution : Timespec `{
struct timespec* tv = malloc( sizeof(struct timespec) );
+#ifdef __MACH__
+ clock_serv_t cclock;
+ int nsecs;
+ mach_msg_type_number_t count;
+ host_get_clock_service(mach_host_self(), SYSTEM_CLOCK, &cclock);
+ clock_get_attributes(cclock, CLOCK_GET_TIME_RES, (clock_attr_t)&nsecs, &count);
+ mach_port_deallocate(mach_task_self(), cclock);
+ tv->tv_sec = 0;
+ tv->tv_nsec = nsecs;
+#else
clock_getres( CLOCK_MONOTONIC, tv );
+#endif
return tv;
`}
s += "n{object_id} -> n{str.object_id} [label = \"str\"];\n"
s += str.internal_to_dot
s += "n{object_id} -> n{ns.object_id} [label = \"ns\"];\n"
- s += "n{ns.object_id}[label = \"NativeString\", content=\"{ns.to_s_with_length(rpos)}\"];\n"
+ s += "n{ns.object_id}[label = \"Items\", content=\"{ns}\"];\n"
return s
end
end
redef class FlatString
redef fun internal_to_dot: String
do
- return "n{object_id} [label=\"FlatString\\nindex_from = {index_from}\\nindex_to = {index_to}\\nNativeString = {items.to_s_with_length(items.cstring_length)}\"];\n"
+ return "n{object_id} [label=\"FlatString\\nlength = {length}\\nbytelen = {bytelen}\\nfirst_byte = {first_byte}\\nlast_byte = {last_byte}\\nText = {self.escape_to_dot}\"];\n"
end
end
redef class FlatBuffer
redef fun internal_to_dot: String
do
- return "n{object_id} [label=\"FlatBuffer\\length = {length}\\ncapacity = {capacity}\\nitems = {items.to_s_with_length(items.cstring_length)}\"];\n"
+ return "n{object_id} [label=\"FlatBuffer\\nbytelen = {bytelen}\\nlength = {length}\\ncapacity = {capacity}\\nText = {escape_to_dot}\"];\n"
end
end
last_char = -1
return
end
- last_char = s
+ last_char = s.to_i
# XML 1.0 end-of-line handling
# Note: Regardless the XML version, any EOL defined by the
if was_cr and last_char == '\n'.ascii then
# EOL already reported. => Skip this byte.
s = input.read_byte
- if s == null then s = -1
- last_char = s
+ if s == null then
+ last_char = -1
+ else
+ last_char = s.to_i
+ end
end
was_cr = last_char == '\r'.ascii
if was_cr then
# Require: `not has_object(object)`
fun new_id_for(object: Serializable): Int
do
- var id = sent.length
+ var id = next_available_id
sent[object] = id
return id
end
+
+ # Get a free id to associate to an object in the cache
+ protected fun next_available_id: Int do return sent.length
end
# Cache of received objects sorted by there reference id
sent[object] = id
end
end
+
+# A shared cache where 2 clients serialize objects at the same types, prevents references collision
+class AsyncCache
+ super DuplexCache
+
+ # Should this end use even numbers?
+ var use_even: Bool
+
+ private var last_id: Int is lazy do return if use_even then 0 else 1
+
+ redef fun next_available_id
+ do
+ last_id += 2
+ return last_id
+ end
+end
# This method should be redefined for each custom subclass of `Serializable`.
# All refinement should look for a precise `class_name` and call super
# on unsupported classes.
- protected fun deserialize_class(class_name: String): Object do
+ protected fun deserialize_class(class_name: String): nullable Object do
return deserialize_class_intern(class_name)
end
# Refinements to this method will be generated by the serialization phase.
# To avoid conflicts, there should not be any other refinements to this method.
# You can instead use `deserialize_class`.
- protected fun deserialize_class_intern(class_name: String): Object do
- print "Error: doesn't know how to deserialize class \"{class_name}\""
- abort
+ protected fun deserialize_class_intern(class_name: String): nullable Object do
+ errors.add new Error("Deserialization Error: Doesn't know how to deserialize class \"{class_name}\"")
+ return null
end
# Should `self` keep trying to deserialize an object after an error?
end
end
-redef class Container[E]
+redef class Ref[E]
super Serializable
redef init from_deserializer(v)
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# This file is free software, which comes along with NIT. This software is
+# distributed in the hope that it will be useful, but WITHOUT ANY WARRANTY;
+# without even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE. You can modify it is you want, provided this header
+# is kept unaltered, and a notification of the changes is added.
+# You are allowed to redistribute it and sell it, alone or is a part of
+# another product.
+
+# S-Expression parsing facilities
+module sexp
+
+intrude import parser_base
+
+# Any S-Expression entity
+abstract class SExpEntity
+
+ # Location in the source document
+ var location: nullable Location
+end
+
+# A full S-Expression, delimited by `(` and `)`
+class SExp
+ super SExpEntity
+
+ # Children of a SExp
+ var content = new Array[SExpEntity]
+
+ redef fun to_s do return "({content.join(" ")})"
+
+ # Returns a pretty-printable version of self
+ #
+ # assert "( ( sp 12.3 ) \"DQString\")".to_sexp.as(SExp).pretty_to_s == "(\n\t(\n\t\tsp\n\t\t12.30\n\t)\n\t\"DQString\"\n)"
+ fun pretty_to_s: String do return recurse_to_s(0)
+
+ private fun recurse_to_s(depth: Int): String do
+ var s = "{"\t" * depth}(\n"
+ for i in content do
+ if i isa SExp then
+ s += i.recurse_to_s(depth + 1)
+ s += "\n"
+ continue
+ end
+ s += "\t" * (depth + 1)
+ s += i.to_s
+ s += "\n"
+ end
+ return s + "{"\t" * depth})"
+ end
+end
+
+# A Double-quoted String
+class SExpDQString
+ super SExpEntity
+
+ # Double-quoted string
+ var content: String
+
+ redef fun to_s do return content
+end
+
+# A float-value
+class SExpFloat
+ super SExpEntity
+
+ # Floating-point value
+ var content: Float
+
+ redef fun to_s do return content.to_precision(2)
+end
+
+# Any Identifier, non string and non-float
+class SExpId
+ super SExpEntity
+
+ # S-Exp compatible identifier
+ var content: String
+
+ redef fun to_s do return content
+end
+
+# An error parsing S-Expressions
+class SExpError
+ super SExpEntity
+
+ # Cause of the error
+ var message: String
+
+ redef fun to_s do return "S-Expression error: {message} at {location or else "unknown location"}"
+end
+
+# S-Expression processor
+class SExpProcessor
+ super StringProcessor
+
+ # Parses an S-Expression entity
+ fun parse_entity: SExpEntity do
+ var srclen = src.length
+ var delims = once ['(', ')', '"']
+ ignore_whitespaces
+ if pos >= srclen then return new SExpError("Empty S-Expression", location = new Location(line, line_offset))
+ var c = src[pos]
+ if pos >= srclen then return new SExpError("Empty S-Expression")
+ if c == '(' then
+ var cnt = new SExp
+ var loc = new Location(line, line_offset)
+ pos += 1
+ while pos < srclen and src[pos] != ')' do
+ var p = parse_entity
+ if p isa SExpError then break
+ cnt.content.add p
+ ignore_whitespaces
+ end
+ if pos < srclen and src[pos] == ')' then
+ pos += 1
+ return cnt
+ else
+ return new SExpError("Incomplete S-Expression", location = loc)
+ end
+ else if c == '"' then
+ var stdq = pos
+ pos += 1
+ ignore_until("\"")
+ pos += 1
+ var endq = pos
+ return new SExpDQString(src.substring(stdq, endq - stdq))
+ else
+ var stid = pos
+ while pos < srclen and not c.is_whitespace and not delims.has(c) do
+ c = src[pos]
+ pos += 1
+ end
+ if delims.has(c) or c.is_whitespace then pos -= 1
+ if pos >= srclen then return new SExpError("Invalid S-Expression")
+ var endid = pos
+ var cntstr = src.substring(stid, endid - stid)
+ var cnt: SExpEntity
+ if cntstr.is_numeric then
+ cnt = new SExpFloat(cntstr.to_f)
+ else
+ cnt = new SExpId(cntstr)
+ end
+ return cnt
+ end
+ end
+end
+
+redef class Text
+
+ # Tries to parse `self` as an S-Expression
+ fun to_sexp: SExpEntity do return (new SExpProcessor(self.to_s)).parse_entity
+end
private import socket_c
intrude import standard::stream
-# A general TCP socket, either a `TCPStream` or a `TCPServer`
+# A general Socket, either TCP or UDP
abstract class Socket
# Underlying C socket
- private var socket: NativeSocket is noinit
+ private var native: NativeSocket is noinit
+
+ # Is this socket closed?
+ var closed = false
+
+ # Set whether calls to `accept` are blocking
+ fun blocking=(value: Bool)
+ do
+ # We use the opposite from the native version as the native API
+ # is closer to the C API. In the Nity API, we use a positive version
+ # of the name.
+ native.non_blocking = not value
+ end
+end
+
+# A general TCP socket, either a `TCPStream` or a `TCPServer`
+abstract class TCPSocket
+ super Socket
# Port used by the socket
var port: Int
#
# Formatted as xxx.xxx.xxx.xxx.
var address: String is noinit
-
- # Is this socket closed?
- var closed = false
end
# Simple communication stream with a remote socket
class TCPStream
- super Socket
+ super TCPSocket
super BufferedReader
super Writer
super PollableReader
do
_buffer = new NativeString(1024)
_buffer_pos = 0
- socket = new NativeSocket.socket(new NativeSocketAddressFamilies.af_inet,
+ native = new NativeSocket.socket(new NativeSocketAddressFamilies.af_inet,
new NativeSocketTypes.sock_stream, new NativeSocketProtocolFamilies.pf_null)
- if socket.address_is_null then
+ if native.address_is_null then
end_reached = true
closed = true
return
end
- if not socket.setsockopt(new NativeSocketOptLevels.socket, new NativeSocketOptNames.reuseaddr, 1) then
+ if not native.setsockopt(new NativeSocketOptLevels.socket, new NativeSocketOptNames.reuseaddr, 1) then
end_reached = true
closed = true
return
end
- var hostname = sys.gethostbyname(host.to_cstring)
- if hostname.address_is_null then
+ var hostent = sys.gethostbyname(host.to_cstring)
+ if hostent.address_is_null then
# Error in name lookup
- var err = sys.h_errno
- last_error = new IOError(err.to_s)
+ last_error = new IOError.from_h_errno
closed = true
end_reached = true
return
end
- addrin = new NativeSocketAddrIn.with_hostent(hostname, port)
- address = addrin.address
- init(addrin.port, hostname.h_name)
+ addrin = new NativeSocketAddrIn
+ addrin.fill_from_hostent hostent
+ addrin.port = port
+
+ address = addrin.address.to_s
+ init(addrin.port, hostent.h_name.to_s)
closed = not internal_connect
end_reached = closed
if closed then
# Connection failed
- last_error = new IOError(errno.strerror)
+ last_error = new IOError.from_errno
end
+
+ prepare_buffer(1024)
end
# Creates a client socket, this is meant to be used by accept only
private init server_side(h: SocketAcceptResult)
do
- _buffer = new NativeString(1024)
- _buffer_pos = 0
- socket = h.socket
+ native = h.socket
addrin = h.addr_in
- address = addrin.address
+ address = addrin.address.to_s
init(addrin.port, address)
+
+ prepare_buffer(1024)
end
redef fun poll_in do return ready_to_read(0)
# timeout : Time in milliseconds before stopping listening for events on this socket
private fun pollin(event_types: Array[NativeSocketPollValues], timeout: Int): Array[NativeSocketPollValues] do
if end_reached then return new Array[NativeSocketPollValues]
- return socket.socket_poll(new PollFD(socket.descriptor, event_types), timeout)
+ return native.socket_poll(new PollFD(native.descriptor, event_types), timeout)
end
# Easier use of pollin to check for something to read on all channels of any priority
return pollin(events, timeout).length != 0
end
- # Checks if the socket still is connected
+ # Is this socket still connected?
fun connected: Bool
do
if closed then return false
- var events = [new NativeSocketPollValues.pollhup, new NativeSocketPollValues.pollerr]
- if pollin(events, 0).length == 0 then
+ if native.poll_hup_err == 0 then
return true
else
closed = true
private fun internal_connect: Bool
do
assert not closed
- return socket.connect(addrin) >= 0
+ return native.connect(addrin) >= 0
end
# If socket.end_reached, nothing will happen
redef fun write(msg)
do
if closed then return
- socket.write(msg.to_s)
+ native.write(msg.to_cstring, msg.length)
end
redef fun write_byte(value)
do
if closed then return
- socket.write_byte value
+ native.write_byte value
end
- redef fun write_bytes(s) do
+ redef fun write_bytes(bytes) do
if closed then return
- socket.write(s.to_s)
+ var s = bytes.to_s
+ native.write(s.to_cstring, s.length)
end
fun write_ln(msg: Text)
do
- if end_reached then return
- write(msg.to_s)
- write("\n")
+ if closed then return
+ write msg.to_s
+ write "\n"
end
redef fun fill_buffer
do
- _buffer_length = 0
- _buffer_pos = 0
if not connected then return
- var read = socket.read
- if read.length == 0 then
+
+ var read = native.read(_buffer, _buffer_capacity)
+ if read == -1 then
close
end_reached = true
end
- enlarge(_buffer_length + read.length)
- read.copy_to_native(_buffer, read.length, 0, 0)
- _buffer_length = read.length
+
+ _buffer_length = read
+ _buffer_pos = 0
end
fun enlarge(len: Int) do
if _buffer_capacity >= len then return
- while _buffer_capacity < len do _buffer_capacity = _buffer_capacity * 2 + 2
+ _buffer_capacity = len
+
var ns = new NativeString(_buffer_capacity)
_buffer.copy_to(ns, _buffer_length - _buffer_pos, _buffer_pos, 0)
_buffer = ns
redef fun close
do
if closed then return
- if socket.close >= 0 then
+ if native.close >= 0 then
closed = true
end_reached = true
end
# Send the data present in the socket buffer
fun flush
do
- if not socket.setsockopt(new NativeSocketOptLevels.tcp, new NativeSocketOptNames.tcp_nodelay, 1) or
- not socket.setsockopt(new NativeSocketOptLevels.tcp, new NativeSocketOptNames.tcp_nodelay, 0) then
+ if not native.setsockopt(new NativeSocketOptLevels.tcp, new NativeSocketOptNames.tcp_nodelay, 1) or
+ not native.setsockopt(new NativeSocketOptLevels.tcp, new NativeSocketOptNames.tcp_nodelay, 0) then
closed = true
end
end
#
# Create streams to communicate with clients using `accept`.
class TCPServer
- super Socket
+ super TCPSocket
private var addrin: NativeSocketAddrIn is noinit
# Create and bind a listening server socket on port `port`
init
do
- socket = new NativeSocket.socket(new NativeSocketAddressFamilies.af_inet,
+ native = new NativeSocket.socket(new NativeSocketAddressFamilies.af_inet,
new NativeSocketTypes.sock_stream, new NativeSocketProtocolFamilies.pf_null)
- assert not socket.address_is_null
- if not socket.setsockopt(new NativeSocketOptLevels.socket, new NativeSocketOptNames.reuseaddr, 1) then
+ assert not native.address_is_null
+ if not native.setsockopt(new NativeSocketOptLevels.socket, new NativeSocketOptNames.reuseaddr, 1) then
closed = true
return
end
- addrin = new NativeSocketAddrIn.with_port(port, new NativeSocketAddressFamilies.af_inet)
- address = addrin.address
+
+ addrin = new NativeSocketAddrIn
+ addrin.family = new NativeSocketAddressFamilies.af_inet
+ addrin.port = port
+ addrin.address_any
+
+ address = addrin.address.to_s
# Bind it
closed = not bind
#
# Returns whether the socket has been be bound.
private fun bind: Bool do
- return socket.bind(addrin) >= 0
+ return native.bind(addrin) >= 0
end
# Sets the socket as ready to accept incoming connections, `size` is the maximum number of queued clients
#
# Returns `true` if the socket could be set, `false` otherwise
fun listen(size: Int): Bool do
- return socket.listen(size) >= 0
+ return native.listen(size) >= 0
end
# Accepts an incoming connection from a client
fun accept: nullable TCPStream
do
assert not closed
- var native = socket.accept
+ var native = native.accept
if native == null then return null
return new TCPStream.server_side(native)
end
- # Set whether calls to `accept` are blocking
- fun blocking=(value: Bool)
- do
- # We use the opposite from the native version as the native API
- # is closer to the C API. In the Nity API, we use a positive version
- # of the name.
- socket.non_blocking = not value
- end
-
# Close this socket
fun close
do
# FIXME unify with `SocketStream::close` when we can use qualified names
if closed then return
- if socket.close >= 0 then
+ if native.close >= 0 then
closed = true
end
end
init do clear
# Add `socket` to this set
- fun add(socket: Socket) do native.set(socket.socket)
+ fun add(socket: Socket) do native.set(socket.native)
# Remove `socket` from this set
- fun remove(socket: Socket) do native.clear(socket.socket)
+ fun remove(socket: Socket) do native.clear(socket.native)
# Does this set has `socket`?
- fun has(socket: Socket): Bool do return native.is_set(socket.socket)
+ fun has(socket: Socket): Bool do return native.is_set(socket.native)
# Clear all sockets from this set
fun clear do native.zero
# `NativeSockectObserver::select` is not stable.
var timeval = new NativeTimeval(seconds, microseconds)
- return native.select(max.socket, read_set.native, write_set.native, except_set.native, timeval) > 0
+ return native.select(max.native, read_set.native, write_set.native, except_set.native, timeval) > 0
end
end
+
+# Socket over UDP, sends and receive data without the need for a connection
+class UDPSocket
+ super Socket
+
+ # Last error raised by this socket
+ var error: nullable Error = null
+
+ init do native = new NativeSocket.socket(
+ new NativeSocketAddressFamilies.af_inet,
+ new NativeSocketTypes.sock_dgram,
+ new NativeSocketProtocolFamilies.pf_null)
+
+ # Bind this socket to an `address`, on `port` (to all addresses if `null`)
+ #
+ # On error, sets `error` appropriately.
+ fun bind(address: nullable Text, port: Int)
+ do
+ var addr_in = new NativeSocketAddrIn
+ addr_in.port = port
+ if address != null then
+ # FIXME replace all use of gethostbyname with something not obsolete
+ var hostent = sys.gethostbyname(address.to_cstring)
+ if hostent.address_is_null then
+ error = new IOError.from_h_errno
+ addr_in.free
+ return
+ end
+
+ addr_in.fill_from_hostent hostent
+ else
+ addr_in.family = new NativeSocketAddressFamilies.af_inet
+ addr_in.address_any
+ end
+
+ if native.bind(addr_in) != 0 then error = new IOError.from_errno
+
+ addr_in.free
+ end
+
+ # Receive `length` bytes of data from any sender
+ #
+ # On error, returns an empty string and sets `error` appropriately.
+ fun recv(length: Int): String
+ do
+ var buf = new NativeString(length)
+ var len = native.recvfrom(buf, length, 0, new NativeSocketAddrIn.nul)
+ if len == -1 then
+ error = new IOError.from_errno
+ return ""
+ end
+ return buf.to_s_with_length(len)
+ end
+
+ # Receive `length` bytes of data from any sender and store the sender info in `sender.item`
+ #
+ # On error, returns an empty string and sets `error` appropriately.
+ fun recv_from(length: Int, sender: Ref[nullable SocketAddress]): String
+ do
+ var src = new NativeSocketAddrIn
+ var buf = new NativeString(length)
+
+ var len = native.recvfrom(buf, length, 0, src)
+ if len == -1 then
+ error = new IOError.from_errno
+ src.free
+ return ""
+ end
+
+ sender.item = new SocketAddress(src)
+ return buf.to_s_with_length(len)
+ end
+
+ # Send `data` to `dest_address` on `port`
+ #
+ # On error, sets `error` appropriately.
+ fun send_to(dest_address: Text, port: Int, data: Text)
+ do
+ var hostent = sys.gethostbyname(dest_address.to_cstring)
+ if hostent.address_is_null then
+ error = new IOError.from_h_errno
+ return
+ end
+
+ var dest = new NativeSocketAddrIn
+ dest.fill_from_hostent hostent
+ dest.port = port
+ native.setsockopt(new NativeSocketOptLevels.socket, new NativeSocketOptNames.broadcast, 1)
+
+ var buf = data.to_cstring
+ if native.sendto(buf, data.length, 0, dest) == -1 then
+ error = new IOError.from_errno
+ end
+ dest.free
+ end
+
+ # Enable broadcasting for this socket
+ #
+ # On error, sets `error` appropriately.
+ fun enable_broadcast=(value: Bool) do
+ var res = native.setsockopt(new NativeSocketOptLevels.socket, new NativeSocketOptNames.broadcast, value.to_i)
+ if res == -1 then error = new IOError.from_errno
+ end
+
+ # Broadcast `data` on the network on `port`
+ #
+ # On error, sets `error` appropriately.
+ #
+ # Require: setting `enable_broadcast = true`
+ fun broadcast(port: Int, data: Text)
+ do
+ var addr_in = new NativeSocketAddrIn
+ addr_in.port = port
+ addr_in.family = new NativeSocketAddressFamilies.af_inet
+ addr_in.address_broadcast
+
+ var buf = data.to_cstring
+ if native.sendto(buf, data.length, 0, addr_in) == -1 then
+ error = new IOError.from_errno
+ end
+
+ addr_in.free
+ end
+end
+
+# Address of a socket in the Internet namespace
+#
+# Used in one of the out parameters of `UDPSocket::recv_from`.
+class SocketAddress
+ super FinalizableOnce
+
+ # FIXME make init private
+
+ private var native: NativeSocketAddrIn
+
+ init
+ do
+ address = native.address.to_s
+ port = native.port
+ end
+
+ # Internet address
+ var address: String is noinit
+
+ # Port of the socket
+ var port: Int is noinit
+
+ redef fun ==(o) do return o isa SocketAddress and o.address == address and o.port == port
+
+ redef fun finalize_once do native.free
+end
+
+redef class IOError
+ # Fill a new `IOError` from the message of `errno`
+ init from_errno do init errno.strerror
+
+ # Fill a new `IOError` from the message of `h_errno`
+ #
+ # Used with `gethostbyname`.
+ init from_h_errno do init h_errno.to_s
+end
return connect(*self, (struct sockaddr*)addrIn, sizeof(*addrIn));
`}
- fun write(buffer: String): Int
- import String.to_cstring, String.length `{
- return write(*self, (char*)String_to_cstring(buffer), String_length(buffer));
+ # Write `length` bytes from `buffer`
+ fun write(buffer: NativeString, length: Int): Int `{
+ return write(*self, buffer, length);
`}
# Write `value` as a single byte
- fun write_byte(value: Int): Int `{
+ fun write_byte(value: Byte): Int `{
unsigned char byt = (unsigned char)value;
return write(*self, &byt, 1);
`}
- fun read: String import NativeString.to_s_with_length, NativeString `{
- char *c = new_NativeString(1024);
- int n = read(*self, c, 1023);
- if(n < 0) {
- return NativeString_to_s_with_length("",0);
- }
- c[n] = 0;
- return NativeString_to_s_with_length(c, n);
+ # Read `length` bytes into `buffer`, returns the number of bytes read
+ fun read(buffer: NativeString, length: Int): Int `{
+ return read(*self, buffer, length);
`}
# Sets an option for the socket
return filedesc.check_response(result)
end
+ # Poll this socket with `POLLHUP|POLLERR`
+ #
+ # A return value of 0 means there is no errors.
+ fun poll_hup_err: Int `{
+ struct pollfd fd = {*self, POLLHUP|POLLERR, 0};
+ int res = poll(&fd, 1, 0);
+ return res;
+ `}
+
# Call to the poll function of the C socket
#
# Signature:
return new SocketAcceptResult(s, addrIn)
end
- # Set wether this socket is non blocking
+ # Set whether this socket is non blocking
fun non_blocking=(value: Bool) `{
int flags = fcntl(*self, F_GETFL, 0);
if (flags == -1) flags = 0;
}
fcntl(*self, F_SETFL, flags);
`}
+
+ # Send `len` bytes from `buf` to `dest_addr`
+ fun sendto(buf: NativeString, len: Int, flags: Int, dest_addr: NativeSocketAddrIn): Int `{
+ return sendto(*self, buf, len, flags, (struct sockaddr*)dest_addr, sizeof(struct sockaddr_in));
+ `}
+
+ # Receive a message into `buf` of maximum `len` bytes
+ fun recv(buf: NativeString, len: Int, flags: Int): Int `{
+ return recv(*self, buf, len, flags);
+ `}
+
+ # Receive a message into `buf` of maximum `len` bytes and store sender info into `src_addr`
+ fun recvfrom(buf: NativeString, len: Int, flags: Int, src_addr: NativeSocketAddrIn): Int `{
+ socklen_t srclen = sizeof(struct sockaddr_in);
+ return recvfrom(*self, buf, len, flags, (struct sockaddr*)src_addr, &srclen);
+ `}
end
# Result of a call to `NativeSocket::accept`
var addr_in: NativeSocketAddrIn
end
+# Socket address in the Internet namespace, pointer to a `struct sockaddr_in`
extern class NativeSocketAddrIn `{ struct sockaddr_in* `}
+
+ # `NULL` pointer
+ new nul `{ return NULL; `}
+
+ # `malloc` a new instance
new `{
struct sockaddr_in *sai = NULL;
sai = malloc(sizeof(struct sockaddr_in));
return sai;
`}
- new with_port(port: Int, family: NativeSocketAddressFamilies) `{
- struct sockaddr_in *sai = NULL;
- sai = malloc(sizeof(struct sockaddr_in));
- sai->sin_family = family;
- sai->sin_port = htons(port);
- sai->sin_addr.s_addr = INADDR_ANY;
- return sai;
+ # Set `address` and `family` from `hostent` (to use with `Sys::gethostbyname`)
+ fun fill_from_hostent(hostent: NativeSocketHostent) `{
+ self->sin_family = hostent->h_addrtype;
+ memcpy((char*)&self->sin_addr.s_addr,
+ (char*)hostent->h_addr,
+ hostent->h_length);
`}
- new with_hostent(hostent: NativeSocketHostent, port: Int) `{
- struct sockaddr_in *sai = NULL;
- sai = malloc(sizeof(struct sockaddr_in));
- sai->sin_family = hostent->h_addrtype;
- sai->sin_port = htons(port);
- memcpy((char*)&sai->sin_addr.s_addr, (char*)hostent->h_addr, hostent->h_length);
- return sai;
- `}
+ # Internet address as then IPV4 numbers-and-dots notation
+ fun address: NativeString `{ return (char*)inet_ntoa(self->sin_addr); `}
- fun address: String import NativeString.to_s `{ return NativeString_to_s((char*)inet_ntoa(self->sin_addr)); `}
+ # Set `address` to `INADDR_ANY`
+ fun address_any `{ self->sin_addr.s_addr = INADDR_ANY; `}
+ # Set `address` to `INADDR_BROADCAST`
+ fun address_broadcast `{ self->sin_addr.s_addr = INADDR_BROADCAST; `}
+
+ # Address family
fun family: NativeSocketAddressFamilies `{ return self->sin_family; `}
+ # Address family
+ fun family=(value: NativeSocketAddressFamilies) `{ self->sin_family = value; `}
+
+ # Port
fun port: Int `{ return ntohs(self->sin_port); `}
- fun destroy `{ free(self); `}
+ # Port
+ fun port=(value: Int) `{ self->sin_port = htons(value); `}
end
+# Host entry information, a pointer to a `struct hostent`
extern class NativeSocketHostent `{ struct hostent* `}
- private fun native_h_aliases(i: Int): String import NativeString.to_s `{ return NativeString_to_s(self->h_aliases[i]); `}
-
- private fun native_h_aliases_reachable(i: Int): Bool `{ return (self->h_aliases[i] != NULL); `}
+ private fun native_h_aliases(i: Int): NativeString `{
+ return self->h_aliases[i];
+ `}
+ # Alternative names for the host
fun h_aliases: Array[String]
do
- var i=0
- var d=new Array[String]
+ var res = new Array[String]
loop
- d.add(native_h_aliases(i))
- if native_h_aliases_reachable(i+1) == false then break
- i += 1
+ var ha = native_h_aliases(res.length)
+ if ha.address_is_null then break
+ res.add ha.to_s
end
- return d
+ return res
end
- fun h_addr: String import NativeString.to_s `{ return NativeString_to_s((char*)inet_ntoa(*(struct in_addr*)self->h_addr)); `}
+ fun h_addr: NativeString `{
+ return (char*)inet_ntoa(*(struct in_addr*)self->h_addr);
+ `}
fun h_addrtype: Int `{ return self->h_addrtype; `}
fun h_length: Int `{ return self->h_length; `}
- fun h_name: String import NativeString.to_s `{ return NativeString_to_s(self->h_name); `}
+ fun h_name: NativeString `{ return self->h_name; `}
end
extern class NativeTimeval `{ struct timeval* `}
new pf_key `{ return PF_KEY; `}
new pf_inet6 `{ return PF_INET6; `}
new pf_max `{ return PF_MAX; `}
+ new ipproto_udp `{ return IPPROTO_UDP; `}
end
# Level on which to set options
# Open a connection to the database file at `path`
init open(path: Text)
do
- native_connection = new NativeSqlite3.open(path.to_s)
+ init(new NativeSqlite3.open(path.to_s))
if native_connection.is_valid then is_open = true
end
--- /dev/null
+# Nit Core Library
+
+Core classes and methods used by default by Nit programs and libraries.
+
+## Core Basic Types and Operations
+
+[[doc:kernel]]
+
+### Object
+
+[[doc:Object]]
+
+#### Equality
+
+[[doc:Object::==]]
+[[doc:Object::!=]]
+[[doc:Object::hash]]
+[[doc:Object::is_same_instance]]
+[[doc:Object::object_id]]
+
+#### Debuging
+
+[[doc:Object::output]]
+[[doc:Object::output_class_name]]
+[[doc:Object::is_same_type]]
+
+### Sys
+
+[[doc:Sys]]
+
+#### Program Execution
+
+[[doc:Sys::main]]
+[[doc:Sys::run]]
+
+### Other
+
+[[list:kernel]]
+
+## Core Collections
+
+[[doc:collection]]
+
+## String and Text manipulation
+
+[[doc:text]]
# A buffer containing Byte-manipulation facilities
#
# Uses Copy-On-Write when persisted
-#
-# TODO: Change the bound to Byte when available in stdlib and bootstrap
class Bytes
- super AbstractArray[Int]
+ super AbstractArray[Byte]
# A NativeString being a char*, it can be used as underlying representation here.
private var items: NativeString
init(ns, 0, 0)
end
+ # Init a `Bytes` with capacity `cap`
init with_capacity(cap: Int) do
var ns = new NativeString(cap)
init(ns, 0, cap)
redef fun is_empty do return length != 0
# var b = new Bytes.empty
- # b.add 101
- # assert b[0] == 101
+ # b.add 101u8
+ # assert b[0] == 101u8
redef fun [](i) do
assert i >= 0
assert i < length
- return items[i].ascii
+ return items[i]
end
# var b = new Bytes.with_capacity(1)
- # b[0] = 101
+ # b[0] = 101u8
# assert b.to_s == "e"
redef fun []=(i, v) do
if persisted then regen
assert i >= 0
assert i <= length
if i == length then add(v)
- items[i] = v.ascii
+ items[i] = v
end
# var b = new Bytes.empty
- # b.add 101
+ # b.add 101u8
# assert b.to_s == "e"
redef fun add(c) do
if persisted then regen
if length >= capacity then
enlarge(length)
end
- items[length] = c.ascii
+ items[length] = c
length += 1
end
# var b = new Bytes.empty
- # b.append([104, 101, 108, 108, 111])
+ # b.append([104u8, 101u8, 108u8, 108u8, 111u8])
# assert b.to_s == "hello"
redef fun append(arr) do
if arr isa Bytes then
end
end
+ # var b = new Bytes.empty
+ # b.append([0x41u8, 0x41u8, 0x18u8])
+ # b.pop
+ # assert b.to_s == "AA"
+ redef fun pop do
+ assert length >= 1
+ length -= 1
+ return items[length]
+ end
+
redef fun clear do length = 0
# Regenerates the buffer, necessary when it was persisted
end
private class BytesIterator
- super IndexedIterator[Int]
+ super IndexedIterator[Byte]
var tgt: NativeString
redef fun next do index += 1
- redef fun item do return tgt[index].ascii
+ redef fun item do return tgt[index]
+end
+
+redef class Text
+ # Returns a mutable copy of `self`'s bytes
+ #
+ # ~~~nit
+ # assert "String".to_bytes isa Bytes
+ # assert "String".to_bytes == [83u8, 116u8, 114u8, 105u8, 110u8, 103u8]
+ # ~~~
+ fun to_bytes: Bytes do
+ var b = new Bytes.with_capacity(bytelen)
+ for s in substrings do
+ var from = if s isa FlatString then s.first_byte else 0
+ b.append_ns_from(s.items, s.bytelen, from)
+ end
+ return b
+ end
+end
+
+redef class FlatText
+ redef fun to_bytes do
+ var len = bytelen
+ var b = new Bytes.with_capacity(len)
+ var from = if self isa FlatString then first_byte else 0
+ b.append_ns_from(items, len, from)
+ return b
+ end
end
redef class NativeString
+ # Creates a new `Bytes` object from `self` with `strlen` as length
fun to_bytes: Bytes do
var len = cstring_length
return new Bytes(self, len, len)
#
# Also used when one want to give a single element when a full
# collection is expected
-class Container[E]
+class Ref[E]
super Collection[E]
redef fun first do return item
end
end
- redef fun iterator do return new ContainerIterator[E](self)
+ redef fun iterator do return new RefIterator[E](self)
# The stored item
var item: E is writable
end
# This iterator is quite stupid since it is used for only one item.
-private class ContainerIterator[E]
+private class RefIterator[E]
super Iterator[E]
redef fun item do return _container.item
redef var is_ok = true
- var container: Container[E]
+ var container: Ref[E]
end
# Items can be removed from this collection
# assert x.is_empty == false
fun is_empty: Bool is abstract
+ # Alias for `not is_empty`.
+ #
+ # Some people prefer to have conditions grammatically easier to read.
+ #
+ # var map = new HashMap[String, Int]
+ # assert map.not_empty == false
+ # map["one"] = 1
+ # assert map.not_empty == true
+ fun not_empty: Bool do return not self.is_empty
+
# Number of items in the collection.
#
# var x = new HashMap[String, Int]
do
_index = _array.length - 1
end
+
+ # Do not cache `self`
+ redef fun finish do end
end
# Others collections ##########################################################
# Linked nodes that constitute a linked list.
private class ListNode[E]
- super Container[E]
+ super Ref[E]
# The next node.
var next: nullable ListNode[E] = null
redef fun pipeflags do return 3
- redef fun execute
+ redef fun execute do super
+
+ # Write `input` to process and return its output
+ #
+ # Writing and reading are processed line by line,
+ # reading only when something is available.
+ #
+ # ~~~
+ # var proc = new ProcessDuplex("tr", "[:lower:]", "[:upper:]")
+ # assert proc.write_and_read("""
+ # Alice
+ # Bob
+ # """) == """
+ # ALICE
+ # BOB
+ # """
+ # ~~~
+ fun write_and_read(input: Text): String
do
- super
+ var read = new Buffer #new Array[String]
+
+ # Main loop, read and write line by line
+ var prev = 0
+ for delimiter in input.search_all('\n') do
+ write input.substring(prev, delimiter.after-prev)
+ prev = delimiter.after
+
+ while stream_in.poll_in do
+ read.append stream_in.read_line
+ end
+ end
+
+ # Write the last line
+ write input.substring_from(prev)
+ stream_out.close
+
+ # Read the rest, may be everything for some programs
+ read.append stream_in.read_all
+ stream_in.close
+
+ # Clean up
+ wait
+ return read.to_s
end
end
last_error = null
_file = new NativeFile.io_open_read(path.to_cstring)
if _file.address_is_null then
- last_error = new IOError("Error: Opening file at '{path.as(not null)}' failed with '{sys.errno.strerror}'")
+ last_error = new IOError("Cannot open `{path.as(not null)}`: {sys.errno.strerror}")
end_reached = true
return
end
redef fun fill_buffer
do
var nb = _file.io_read(_buffer, _buffer_capacity)
+ if last_error == null and _file.ferror then
+ last_error = new IOError("Cannot read `{path.as(not null)}`: {sys.errno.strerror}")
+ end_reached = true
+ end
if nb <= 0 then
end_reached = true
nb = 0
prepare_buffer(10)
_file = new NativeFile.io_open_read(path.to_cstring)
if _file.address_is_null then
- last_error = new IOError("Error: Opening file at '{path}' failed with '{sys.errno.strerror}'")
+ last_error = new IOError("Cannot open `{path}`: {sys.errno.strerror}")
end_reached = true
end
end
end_reached = true
end
end
+
+ redef fun poll_in
+ do
+ var res = native_poll_in(fd)
+ if res == -1 then
+ last_error = new IOError(errno.to_s)
+ return false
+ else return res > 0
+ end
+
+ private fun native_poll_in(fd: Int): Int `{
+ struct pollfd fds = {fd, POLLIN, 0};
+ return poll(&fds, 1, 0);
+ `}
end
# `Stream` that can write to a File
last_error = new IOError("cannot write to non-writable stream")
return
end
- write_native(s.items, s.length)
+ write_native(s.items, 0, s.length)
end
redef fun write(s)
last_error = new IOError("cannot write to non-writable stream")
return
end
- for i in s.substrings do write_native(i.to_cstring, i.length)
+ s.write_native_to(self)
end
redef fun write_byte(value)
redef var is_writable = false
# Write `len` bytes from `native`.
- private fun write_native(native: NativeString, len: Int)
+ private fun write_native(native: NativeString, from, len: Int)
do
if last_error != null then return
if not _is_writable then
_is_writable = false
return
end
- var err = _file.io_write(native, len)
+ var err = _file.io_write(native, from, len)
if err != len then
# Big problem
last_error = new IOError("Problem in writing : {err} {len} \n")
self.path = path
_is_writable = true
if _file.address_is_null then
- last_error = new IOError("Error: Opening file at '{path}' failed with '{sys.errno.strerror}'")
+ last_error = new IOError("Cannot open `{path}`: {sys.errno.strerror}")
is_writable = false
end
end
path = "/dev/stdin"
prepare_buffer(1)
end
-
- redef fun poll_in `{
- struct pollfd fd = {0, POLLIN, 0};
- int res = poll(&fd, 1, 0);
- if (res == -1) {
- perror("Error poll stdin");
- exit(EXIT_FAILURE);
- }
- return res > 0;
- `}
end
# Standard output stream.
end
end
-# Utility class to access file system services
+# Utility class to access file system services.
#
# Usually created with `Text::to_path`.
+#
+# `Path` objects does not necessarily represent existing files in a file system.
+# They are sate-less objects that efficiently represent path information.
+# They also provide an easy to use API on file-system services and are used to store their error status (see `last_error`)
class Path
private var path: String
# Path to this file
redef fun to_s do return path
- # Name of the file name at `to_s`
+ # Short name of the file at `to_s`
#
# ~~~
# var path = "/tmp/somefile".to_path
# assert path.filename == "somefile"
# ~~~
- var filename: String = path.basename("") is lazy
+ #
+ # The result does not depend of the file system, thus is cached for efficiency.
+ var filename: String = path.basename is lazy
+
+ # The path simplified by removing useless `.`, removing `//`, and resolving `..`
+ #
+ # ~~~
+ # var path = "somedir/./tmp/../somefile".to_path
+ # assert path.simplified.to_s == "somedir/somefile"
+ # ~~~
+ #
+ # See `String:simplify_path` for details.
+ #
+ # The result does not depend of the file system, thus is cached for efficiency.
+ var simplified: Path is lazy do
+ var res = path.simplify_path.to_path
+ res.simplified = res
+ return res
+ end
+
+ # Return the directory part of the path.
+ #
+ # ~~~
+ # var path = "/foo/bar/baz".to_path
+ # assert path.dir.to_s == "/foo/bar"
+ # assert path.dir.dir.to_s == "/foo"
+ # assert path.dir.dir.dir.to_s == "/"
+ # ~~~
+ #
+ # See `String:dirname` for details.
+ #
+ # The result does not depend of the file system, thus is cached for efficiency.
+ var dir: Path is lazy do
+ return path.dirname.to_path
+ end
+
+ # Last error produced by I/O operations.
+ #
+ # ~~~
+ # var path = "/does/not/exists".to_path
+ # assert path.last_error == null
+ # path.read_all
+ # assert path.last_error != null
+ # ~~~
+ #
+ # Since `Path` objects are stateless, `last_error` is reset on most operations and reflect its status.
+ var last_error: nullable IOError = null is writable
# Does the file at `path` exists?
+ #
+ # If the file does not exists, `last_error` is set to the information.
fun exists: Bool do return stat != null
# Information on the file at `self` following symbolic links
#
# Returns `null` if there is no file at `self`.
+ # `last_error` is updated to contains the error information on error, and null on success.
#
# assert "/etc/".to_path.stat.is_dir
# assert "/etc/issue".to_path.stat.is_file
# if stat != null then # Does `p` exist?
# print "It's size is {stat.size}"
# if stat.is_dir then print "It's a directory"
+ # else
+ # print p.last_error.to_s
# end
# ~~~
fun stat: nullable FileStat
do
var stat = path.to_cstring.file_stat
- if stat.address_is_null then return null
+ if stat.address_is_null then
+ last_error = new IOError("Cannot open `{path}`: {sys.errno.strerror}")
+ return null
+ end
+ last_error = null
return new FileStat(stat)
end
fun link_stat: nullable FileStat
do
var stat = path.to_cstring.file_lstat
- if stat.address_is_null then return null
+ if stat.address_is_null then
+ last_error = new IOError("Cannot open `{path}`: {sys.errno.strerror}")
+ return null
+ end
+ last_error = null
return new FileStat(stat)
end
- # Delete a file from the file system, return `true` on success
- fun delete: Bool do return path.to_cstring.file_delete
+ # Delete a file from the file system.
+ #
+ # `last_error` is updated to contains the error information on error, and null on success.
+ fun delete
+ do
+ var res = path.to_cstring.file_delete
+ if not res then
+ last_error = new IOError("Cannot delete `{path}`: {sys.errno.strerror}")
+ else
+ last_error = null
+ end
+ end
- # Copy content of file at `path` to `dest`
+ # Copy content of file at `path` to `dest`.
#
- # Require: `exists`
+ # `last_error` is updated to contains the error information on error, and null on success.
fun copy(dest: Path)
do
+ last_error = null
var input = open_ro
var output = dest.open_wo
input.close
output.close
+ last_error = input.last_error or else output.last_error
end
- # Open this file for reading
+ # Open this file for reading.
+ #
+ # ~~~
+ # var file = "/etc/issue".to_path.open_ro
+ # print file.read_line
+ # file.close
+ # ~~~
+ #
+ # Note that it is the user's responsibility to close the stream.
+ # Therefore, for simple use case, look at `read_all` or `each_line`.
#
- # Require: `exists and not link_stat.is_dir`
+ # ENSURE `last_error == result.last_error`
fun open_ro: FileReader
do
- # TODO manage streams error when they are merged
- return new FileReader.open(path)
+ var res = new FileReader.open(path)
+ last_error = res.last_error
+ return res
end
# Open this file for writing
#
- # Require: `not exists or not stat.is_dir`
+ # ~~~
+ # var file = "bla.log".to_path.open_wo
+ # file.write "Blabla\n"
+ # file.close
+ # ~~~
+ #
+ # Note that it is the user's responsibility to close the stream.
+ # Therefore, for simple use case, look at `Writable::write_to_file`.
+ #
+ # ENSURE `last_error == result.last_error`
fun open_wo: FileWriter
do
- # TODO manage streams error when they are merged
- return new FileWriter.open(path)
+ var res = new FileWriter.open(path)
+ last_error = res.last_error
+ return res
end
- # Read all the content of the file
+ # Read all the content of the file as a string.
#
# ~~~
# var content = "/etc/issue".to_path.read_all
# print content
# ~~~
#
+ # `last_error` is updated to contains the error information on error, and null on success.
+ # In case of error, the result might be empty or truncated.
+ #
# See `Reader::read_all` for details.
fun read_all: String do return read_all_bytes.to_s
+ # Read all the content on the file as a raw sequence of bytes.
+ #
+ # ~~~
+ # var content = "/etc/issue".to_path.read_all_bytes
+ # print content.to_s
+ # ~~~
+ #
+ # `last_error` is updated to contains the error information on error, and null on success.
+ # In case of error, the result might be empty or truncated.
fun read_all_bytes: Bytes
do
var s = open_ro
var res = s.read_all_bytes
s.close
+ last_error = s.last_error
return res
end
# end
# ~~~
#
+ # `last_error` is updated to contains the error information on error, and null on success.
+ # In case of error, the result might be empty or truncated.
+ #
# See `Reader::read_lines` for details.
fun read_lines: Array[String]
do
var s = open_ro
var res = s.read_lines
s.close
+ last_error = s.last_error
return res
end
#
# Note: the stream is automatically closed at the end of the file (see `LineIterator::close_on_finish`)
#
+ # `last_error` is updated to contains the error information on error, and null on success.
+ #
# See `Reader::each_line` for details.
fun each_line: LineIterator
do
var s = open_ro
var res = s.each_line
res.close_on_finish = true
+ last_error = s.last_error
return res
end
- # Lists the name of the files contained within the directory at `path`
+ # Lists the files contained within the directory at `path`.
+ #
+ # var files = "/etc".to_path.files
+ # assert files.has("/etc/issue".to_path)
#
- # Require: `exists and is_dir`
+ # `last_error` is updated to contains the error information on error, and null on success.
+ # In case of error, the result might be empty or truncated.
+ #
+ # var path = "/etc/issue".to_path
+ # files = path.files
+ # assert files.is_empty
+ # assert path.last_error != null
fun files: Array[Path]
do
- var files = new Array[Path]
- for filename in path.files do
- files.add new Path(path / filename)
+ last_error = null
+ var res = new Array[Path]
+ var d = new NativeDir.opendir(path.to_cstring)
+ if d.address_is_null then
+ last_error = new IOError("Cannot list directory `{path}`: {sys.errno.strerror}")
+ return res
end
- return files
+
+ loop
+ var de = d.readdir
+ if de.address_is_null then
+ # readdir cannot fail, so null means end of list
+ break
+ end
+ var name = de.to_s_with_copy
+ if name == "." or name == ".." then continue
+ res.add new Path(path / name)
+ end
+ d.closedir
+
+ return res
end
- # Delete a directory and all of its content, return `true` on success
+ # Delete a directory and all of its content
#
# Does not go through symbolic links and may get stuck in a cycle if there
# is a cycle in the file system.
- fun rmdir: Bool
+ #
+ # `last_error` is updated to contains the error information on error, and null on success.
+ # The method does not stop on the first error and try to remove most file and directories.
+ #
+ # ~~~
+ # var path = "/does/not/exists/".to_path
+ # path.rmdir
+ # assert path.last_error != null
+ # ~~~
+ fun rmdir
do
- var ok = true
+ last_error = null
for file in self.files do
var stat = file.link_stat
+ if stat == null then
+ last_error = file.last_error
+ continue
+ end
if stat.is_dir then
- ok = file.rmdir and ok
+ # Recursively rmdir
+ file.rmdir
else
- ok = file.delete and ok
+ file.delete
end
+ if last_error == null then last_error = file.last_error
end
- # Delete the directory itself
- if ok then ok = path.to_cstring.rmdir and ok
-
- return ok
+ # Delete the directory itself if things are fine
+ if last_error == null then
+ if path.to_cstring.rmdir then
+ last_error = new IOError("Cannot remove `{self}`: {sys.errno.strerror}")
+ end
+ end
end
- redef fun ==(other) do return other isa Path and path.simplify_path == other.path.simplify_path
- redef fun hash do return path.simplify_path.hash
+ redef fun ==(other) do return other isa Path and simplified.path == other.simplified.path
+ redef fun hash do return simplified.path.hash
end
# Information on a file
redef class Text
# Access file system related services on the path at `self`
fun to_path: Path do return new Path(to_s)
+
+ private fun write_native_to(s: FileWriter)
+ do
+ for i in substrings do s.write_native(i.to_cstring, 0, i.bytelen)
+ end
end
redef class String
# Copy content of file at `self` to `dest`
fun file_copy_to(dest: String) do to_path.copy(dest.to_path)
- # Remove the trailing extension `ext`.
+ # Remove the trailing `extension`.
#
- # `ext` usually starts with a dot but could be anything.
+ # `extension` usually starts with a dot but could be anything.
#
- # assert "file.txt".strip_extension(".txt") == "file"
- # assert "file.txt".strip_extension("le.txt") == "fi"
- # assert "file.txt".strip_extension("xt") == "file.t"
+ # assert "file.txt".strip_extension(".txt") == "file"
+ # assert "file.txt".strip_extension("le.txt") == "fi"
+ # assert "file.txt".strip_extension("xt") == "file.t"
#
- # if `ext` is not present, `self` is returned unmodified.
+ # If `extension == null`, the rightmost extension is stripped, including the last dot.
+ #
+ # assert "file.txt".strip_extension == "file"
+ #
+ # If `extension` is not present, `self` is returned unmodified.
#
# assert "file.txt".strip_extension(".tar.gz") == "file.txt"
- fun strip_extension(ext: String): String
+ fun strip_extension(extension: nullable String): String
do
- if has_suffix(ext) then
- return substring(0, length - ext.length)
+ if extension == null then
+ extension = file_extension
+ if extension == null then
+ return self
+ else extension = ".{extension}"
+ end
+
+ if has_suffix(extension) then
+ return substring(0, length - extension.length)
end
return self
end
- # Extract the basename of a path and remove the extension
+ # Extract the basename of a path and strip the `extension`
#
- # assert "/path/to/a_file.ext".basename(".ext") == "a_file"
- # assert "path/to/a_file.ext".basename(".ext") == "a_file"
- # assert "path/to".basename(".ext") == "to"
- # assert "path/to/".basename(".ext") == "to"
+ # The extension is stripped only if `extension != null`.
+ #
+ # assert "/path/to/a_file.ext".basename(".ext") == "a_file"
+ # assert "path/to/a_file.ext".basename(".ext") == "a_file"
+ # assert "path/to/a_file.ext".basename == "a_file.ext"
+ # assert "path/to".basename(".ext") == "to"
+ # assert "path/to/".basename(".ext") == "to"
+ # assert "path/to".basename == "to"
# assert "path".basename("") == "path"
# assert "/path".basename("") == "path"
# assert "/".basename("") == "/"
# assert "".basename("") == ""
- fun basename(ext: String): String
+ fun basename(extension: nullable String): String
do
var l = length - 1 # Index of the last char
while l > 0 and self.chars[l] == '/' do l -= 1 # remove all trailing `/`
if pos >= 0 then
n = substring(pos+1, l-pos)
end
- return n.strip_extension(ext)
+
+ if extension != null then
+ return n.strip_extension(extension)
+ else return n
end
# Extract the dirname of a path
# In other cases, parts of the current directory may be exhibited:
#
# var p = "../foo/bar".relpath("baz")
- # var c = getcwd.basename("")
+ # var c = getcwd.basename
# assert p == "../../{c}/baz"
#
# For path resolution independent of the current directory (eg. for paths in URL),
# assert "/fail/does not/exist".rmdir != null
fun rmdir: nullable Error
do
- var res = to_path.rmdir
- if res then return null
- var error = new IOError("Cannot change remove `{self}`: {sys.errno.strerror}")
- return error
+ var p = to_path
+ p.rmdir
+ return p.last_error
end
# Change the current working directory
end
end
+redef class FlatString
+ redef fun write_native_to(s)
+ do
+ s.write_native(items, first_byte, bytelen)
+ end
+end
+
redef class NativeString
private fun file_exists: Bool `{
FILE *hdl = fopen(self,"r");
return fread(buf, 1, len, self);
`}
- fun io_write(buf: NativeString, len: Int): Int `{
- return fwrite(buf, 1, len, self);
+ fun io_write(buf: NativeString, from, len: Int): Int `{
+ return fwrite(buf+from, 1, len, self);
`}
- fun write_byte(value: Int): Int `{
+ fun write_byte(value: Byte): Int `{
unsigned char b = (unsigned char)value;
return fwrite(&b, 1, 1, self);
`}
return 0;
`}
+ fun ferror: Bool `{ return ferror(self); `}
+
fun fileno: Int `{ return fileno(self); `}
# Flushes the buffer, forcing the write operation
# You are allowed to redistribute it and sell it, alone or is a part of
# another product.
-# Most minimal classes and methods.
-# This module is the root of the standard module hierarchy.
+# Most basic classes and methods.
+#
+# This module is the root of the module hierarchy.
+# It provides a very minimal set of classes and services used as a
+# foundation to define other classes and methods.
module kernel
import end # Mark this module is a top level one. (must be only one)
###############################################################################
# The root of the class hierarchy.
-# Each class implicitly specialize Object.
#
-# Currently, Object is also used to collect all top-level methods.
+# Each other class implicitly specializes Object,
+# therefore the services of Object are inherited by every other class and are usable
+# on each value, including primitive types like integers (`Int`), strings (`String`) and arrays (`Array`).
+#
+# Note that `nullable Object`, not `Object`, is the root of the type hierarchy
+# since the special value `null` is not considered as an instance of Object.
interface Object
# Type of this instance, automatically specialized in every class
#
# `SELF`, pretty much the same things as you would do with parameter types.
type SELF: Object
- # The unique object identifier in the class.
- # Unless specific code, you should not use this method.
- # The identifier is used internally to provide a hash value.
+ # An internal hash code for the object based on its identity.
+ #
+ # Unless specific code, you should not use this method but
+ # use `hash` instead.
+ #
+ # As its name hints it, the internal hash code, is used internally
+ # to provide a hash value.
+ # It is also used by the `inspect` method to loosely identify objects
+ # and helps debugging.
+ #
+ # ~~~
+ # var a = "Hello"
+ # var b = a
+ # assert a.object_id == b.object_id
+ # ~~~
+ #
+ # The specific details of the internal hash code it let to the specific
+ # engine. The rules are the following:
+ #
+ # * The `object_id` MUST be invariant for the whole life of the object.
+ # * Two living instances of the same classes SHOULD NOT share the same `object_id`.
+ # * Two instances of different classes MIGHT share the same `object_id`.
+ # * The `object_id` of a garbage-collected instance MIGHT be reused by new instances.
+ # * The `object_id` of an object MIGHT be non constant across different executions.
+ #
+ # For instance, the `nitc` compiler uses the address of the object in memory
+ # as its `object_id`.
+ #
+ # TODO rename in something like `internal_hash_code`
fun object_id: Int is intern
# Return true if `self` and `other` have the same dynamic type.
- # Unless specific code, you should not use this method.
+ #
+ # ~~~
+ # assert 1.is_same_type(2)
+ # assert "Hello".is_same_type("World")
+ # assert not "Hello".is_same_type(2)
+ # ~~~
+ #
+ # The method returns false if the dynamic type of `other` is a subtype of the dynamic type of `self`
+ # (or the other way around).
+ #
+ # Unless specific code, you should not use this method because it is inconsistent
+ # with the fact that a subclass can be used in lieu of a superclass.
fun is_same_type(other: Object): Bool is intern
- # Return true if `self` and `other` are the same instance.
- # Unless specific code, you should use `==` instead.
+ # Return true if `self` and `other` are the same instance (i.e. same identity).
+ #
+ # ~~~
+ # var a = new Buffer
+ # var b = a
+ # var c = new Buffer
+ # assert a.is_same_instance(b)
+ # assert not a.is_same_instance(c)
+ # assert a == c # because both buffers are empty
+ # ~~~
+ #
+ # Obviously, the identity of an object is preserved even if the object is mutated.
+ #
+ # ~~~
+ # var x = [1]
+ # var y = x
+ # x.add 2
+ # assert x.is_same_instance(y)
+ # ~~~
+ #
+ # Unless specific code, you should use `==` instead of `is_same_instance` because
+ # most of the time is it the semantic (and user-defined) comparison that make sense.
+ #
+ # Moreover, relying on `is_same_instance` on objects you do not control
+ # might have unexpected effects when libraries reuse objects or intern them.
fun is_same_instance(other: nullable Object): Bool is intern
# Have `self` and `other` the same value?
#
- # The exact meaning of "same value" is left to the subclasses.
- # Implicitly, the default implementation, is `is_same_instance`
+ # ~~~
+ # assert 1 + 1 == 2
+ # assert not 1 == "1"
+ # assert 1.to_s == "1"
+ # ~~~
+ #
+ # The exact meaning of *same value* is left to the subclasses.
+ # Implicitly, the default implementation, is `is_same_instance`.
+ #
+ # The laws of `==` are the following:
+ #
+ # * reflexivity `a.is_same_instance(b) implies a == b`
+ # * symmetry: `(a == b) == (b == a)`
+ # * transitivity: `(a == b) and (b == c) implies (a == c)`
+ #
+ # `==` might not be constant on some objects overtime because of their evolution.
+ #
+ # ~~~
+ # var a = [1]
+ # var b = [1]
+ # var c = [1,2]
+ # assert a == b and not a == c
+ # a.add 2
+ # assert not a == b and a == c
+ # ~~~
+ #
+ # Lastly, `==` is highly linked with `hash` and a specific redefinition of `==` should
+ # usually be associated with a specific redefinition of `hash`.
+ #
+ # ENSURE `result implies self.hash == other.hash`
fun ==(other: nullable Object): Bool do return self.is_same_instance(other)
# Have `self` and `other` different values?
#
- # != is equivalent with "not ==".
+ # `!=` is equivalent with `not ==`.
fun !=(other: nullable Object): Bool do return not (self == other)
# Display self on stdout (debug only).
+ #
# This method MUST not be used by programs, it is here for debugging
- # only and can be removed without any notice
+ # only and can be removed without any notice.
+ #
+ # TODO: rename to avoid blocking a good identifier like `output`.
fun output
do
'<'.output
end
# Display class name on stdout (debug only).
+ #
# This method MUST not be used by programs, it is here for debugging
- # only and can be removed without any notice
+ # only and can be removed without any notice.
+ #
+ # TODO: rename to avoid blocking a good identifier like `output`.
fun output_class_name is intern
# The hash code of the object.
- # Assuming that a == b -> a.hash == b.hash
#
- # Without redefinition, it is based on the `object_id` of the instance.
+ # The hash code is used in many data-structures and algorithms to identify objects that might be equal.
+ # Therefore, the precise semantic of `hash` is highly linked with the semantic of `==`
+ # and the only law of `hash` is that `a == b implies a.hash == b.hash`.
+ #
+ # ~~~
+ # assert (1+1).hash == 2.hash
+ # assert 1.to_s.hash == "1".hash
+ # ~~~
+ #
+ # `hash` (like `==`) might not be constant on some objects over time because of their evolution.
+ #
+ # ~~~
+ # var a = [1]
+ # var b = [1]
+ # var c = [1,2]
+ # assert a.hash == b.hash
+ # a.add 2
+ # assert a.hash == c.hash
+ # # There is a very high probability that `b.hash != c.hash`
+ # ~~~
+ #
+ # A specific redefinition of `==` should usually be associated with a specific redefinition of `hash`.
+ # Note that, unfortunately, a correct definition of `hash` that is lawful with `==` is sometime tricky
+ # and a cause of bugs.
+ #
+ # Without redefinition, `hash` is based on the `object_id` of the instance.
fun hash: Int do return object_id / 8
end
# The main class of the program.
-# `Sys` is a singleton class, its only instance is `sys` defined in `Object`.
-# `sys` is used to invoke methods on the program on the system.
+#
+# `Sys` is a singleton class, its only instance is accessible from everywhere with `sys`.
+#
+# Because of this, methods that should be accessible from everywhere, like `print` or `exit`,
+# are defined in `Sys`.
+# Moreover, unless there is an ambiguity with `self`, the receiver of a call to these methods is implicitly `sys`.
+# Basically it means that the two following instructions are equivalent.
+#
+# ~~~nit
+# print "Hello World"
+# sys.print "Hello World"
+# ~~~
+#
+# ## Methods Implicitly Defined in Sys
+#
+# `Sys` is the class where are defined top-level methods,
+# i.e. those defined outside of any class like in a procedural language.
+# Basically it means that
+#
+# ~~~nitish
+# redef class Sys
+# fun foo do print "hello"
+# end
+# ~~~
+#
+# is equivalent with
+#
+# ~~~nitish
+# fun foo print "hello"
+# ~~~
+#
+# As a corollary, in a top-level method, `self` (the current receiver) is always `sys`.
class Sys
- # Instructions outside classes implicitly redefine this method.
+ # The main method of a program.
+ #
+ # In a module, the instructions defined outside any classes or methods
+ # (usually called the *main* of the module) is
+ # an implicit definition of this `main` method.
+ # Basically it means that the following program
+ #
+ # ~~~nit
+ # print "Hello World"
+ # ~~~
+ #
+ # is equivalent with
+ #
+ # ~~~nit
+ # redef class Sys
+ # redef fun main do
+ # print "Hello World"
+ # end
+ # end
+ # ~~~
fun main do end
# The entry point for the execution of the whole program.
- # Its job is to call `main` but some modules may want to refine it
+ #
+ # When a program starts, the following implicit sequence of instructions is executed
+ #
+ # ~~~nitish
+ # sys = new Sys
+ # sys.run
+ # ~~~
+ #
+ # Whereas the job of the `run` method is just to execute `main`.
+ #
+ # The only reason of the existence of `run` is to allow modules to refine it
# and inject specific work before or after the main part.
fun run do main
redef type OTHER: Char
redef fun object_id is intern
+ redef fun output `{
+ if(self < 128){
+ printf("%c", self);
+ }else if(self < 2048){
+ printf("%c%c", 0xC0 | ((0x7C0 & self) >> 6), 0x80 | (0x3F & self));
+ }else if(self < 65536){
+ printf("%c%c%c", 0xE0 | ((0xF000 & self) >> 12), 0x80 | ((0xFC0 & self) >> 6) ,0x80 | (0x3F & self));
+ }else if(self < 2097152){
+ printf("%c%c%c%c", 0xF0 | ((0x1C0000 & self) >> 18), 0x80 | ((0x3F000 & self) >> 12), 0x80 | ((0xFC0 & self) >> 6), 0x80 | (0x3F & self));
+ }else{
+ // Bad char
+ printf("%c", self);
+ }
+ `}
redef fun hash do return ascii
redef fun ==(o) is intern
redef fun !=(o) is intern
- redef fun output is intern
redef fun <=(i) is intern
redef fun <(i) is intern
fun hypot_with(b: Float): Float `{ return hypotf(self, b); `}
# Returns true is self is not a number.
+ #
+ # As `nan != nan`, `is_nan` should be used to test if a float is the special *not a number* value.
+ #
+ # ~~~
+ # assert nan != nan # By IEEE 754
+ # assert nan.is_nan
+ # assert not 10.0.is_nan
+ # ~~~
fun is_nan: Bool `{ return isnan(self); `}
# Is the float an infinite value
# * 1 if self is positive infinity
# * -1 if self is negative infinity
# * 0 otherwise
+ #
+ # ~~~
+ # assert 10.0.is_inf == 0
+ # assert inf.is_inf == 1
+ # assert (-inf).is_inf == -1
+ # ~~~
fun is_inf: Int do
if native_is_inf then
if self < 0.0 then return -1
fun lerp(a, b: Float): Float do return (1.0 - self) * a + self * b
end
+# Positive float infinite (IEEE 754)
+#
+# assert inf > 10.0
+# assert inf.is_inf == 1
+#
+# `inf` follows the arithmetic of infinites
+#
+# assert (inf - 1.0) == inf
+# assert (inf - inf).is_nan
+#
+# The negative infinite can be used as `-inf`.
+#
+# assert -inf < -10.0
+# assert (-inf).is_inf == -1
+fun inf: Float do return 1.0 / 0.0
+
+# Not a Number, representation of an undefined or unrepresentable float (IEEE 754).
+#
+# `nan` is not comparable with itself, you should use `Float::is_nan` to test it.
+#
+# ~~~
+# assert nan.is_nan
+# assert nan != nan # By IEEE 754
+# ~~~
+#
+# `nan` is the quiet result of some undefined operations.
+#
+# ~~~
+# assert (1.0 + nan).is_nan
+# assert (0.0 / 0.0).is_nan
+# assert (inf - inf).is_nan
+# assert (inf / inf).is_nan
+# assert (-1.0).sqrt.is_nan
+# ~~~
+fun nan: Float do return 0.0 / 0.0
+
redef class Collection[ E ]
# Return a random element form the collection
# There must be at least one element in the collection
fun read_char: nullable Char is abstract
# Reads a byte. Returns `null` on EOF or timeout
- fun read_byte: nullable Int is abstract
+ fun read_byte: nullable Byte is abstract
# Reads a String of at most `i` length
fun read(i: Int): String do return read_bytes(i).to_s
# var i = new StringReader(txt)
# assert i.read_all == txt
# ~~~
- fun read_all: String do return read_all_bytes.to_s
+ fun read_all: String do
+ var s = read_all_bytes
+ var slen = s.length
+ if slen == 0 then return ""
+ var rets = ""
+ var pos = 0
+ var sits = s.items
+ var remsp = slen
+ while pos < slen do
+ # The 129 size was decided more or less arbitrarily
+ # It will require some more benchmarking to compute
+ # if this is the best size or not
+ var chunksz = 129
+ if chunksz > remsp then
+ rets += new FlatString.with_infos(sits, remsp, pos, pos + remsp - 1)
+ break
+ end
+ var st = sits.find_beginning_of_char_at(pos + chunksz - 1)
+ var bytelen = st - pos
+ rets += new FlatString.with_infos(sits, bytelen, pos, st - 1)
+ pos = st
+ remsp -= bytelen
+ end
+ if rets isa Concat then return rets.balance
+ return rets
+ end
# Read all the stream until the eof.
#
fun write(s: Text) is abstract
# Write a single byte
- fun write_byte(value: Int) is abstract
+ fun write_byte(value: Byte) is abstract
# Can the stream be used to write
fun is_writable: Bool is abstract
last_error = new IOError("Stream has reached eof")
return null
end
- var c = _buffer[_buffer_pos]
+ # TODO: Fix when supporting UTF-8
+ var c = _buffer[_buffer_pos].to_i.ascii
_buffer_pos += 1
return c
end
last_error = new IOError("Stream has reached eof")
return null
end
- var c = _buffer[_buffer_pos].ascii
+ var c = _buffer[_buffer_pos]
_buffer_pos += 1
return c
end
var j = _buffer_pos
var k = _buffer_length
while j < k do
- s.add(_buffer[j].ascii)
+ s.add(_buffer[j])
j += 1
end
_buffer_pos = j
loop
# First phase: look for a '\n'
var i = _buffer_pos
- while i < _buffer_length and _buffer[i] != '\n' do
+ while i < _buffer_length and _buffer[i] != 0xAu8 do
i += 1
end
var eol
if i < _buffer_length then
- assert _buffer[i] == '\n'
+ assert _buffer[i] == 0xAu8
i += 1
eol = true
else
# if there is something to append
if i > _buffer_pos then
# Enlarge the string (if needed)
- s.enlarge(s.length + i - _buffer_pos)
+ s.enlarge(s.bytelen + i - _buffer_pos)
# Copy from the buffer to the string
var j = _buffer_pos
while j < i do
- s.add(_buffer[j])
+ s.bytes.add(_buffer[j])
j += 1
end
_buffer_pos = i
# The string to read from.
var source: String
- # The current position in the string.
+ # The current position in the string (bytewise).
private var cursor: Int = 0
redef fun read_char do
if cursor < source.length then
+ # Fix when supporting UTF-8
var c = source[cursor]
-
cursor += 1
return c
else
redef fun read_byte do
if cursor < source.length then
- var c = source[cursor]
-
+ var c = source.bytes[cursor]
cursor += 1
- return c.ascii
+ return c
else
return null
end
return new Bytes(nns, nslen, nslen)
end
- redef fun eof do return cursor >= source.length
+ redef fun eof do return cursor >= source.bytelen
end
# assert "hello".chars.to_a == ['h', 'e', 'l', 'l', 'o']
fun chars: SequenceRead[Char] is abstract
+ # Gets a view on the bytes of the Text object
+ #
+ # assert "hello".bytes.to_a == [104u8, 101u8, 108u8, 108u8, 111u8]
+ fun bytes: SequenceRead[Byte] is abstract
+
# Number of characters contained in self.
#
# assert "12345".length == 5
# assert "".length == 0
+ # assert "あいうえお".length == 5
fun length: Int is abstract
+ # Number of bytes in `self`
+ #
+ # assert "12345".bytelen == 5
+ # assert "あいうえお".bytelen == 15
+ fun bytelen: Int is abstract
+
# Create a substring.
#
# assert "abcd".substring(1, 2) == "bc"
# assert "abcd".substring(-1, 2) == "a"
# assert "abcd".substring(1, 0) == ""
# assert "abcd".substring(2, 5) == "cd"
+ # assert "あいうえお".substring(1,3) == "いうえ"
#
# A `from` index < 0 will be replaced by 0.
# Unless a `count` value is > 0 at the same time.
# assert "abcd".has_suffix("bcd") == true
fun has_suffix(suffix: String): Bool do return has_substring(suffix, length - suffix.length)
- # If `self` contains only digits, return the corresponding integer
+ # Returns a copy of `self` minus all occurences of `c`
+ #
+ # assert "__init__".remove_all('_') == "init"
+ fun remove_all(c: Char): String do
+ var b = new Buffer
+ for i in chars do if i != c then b.add i
+ return b.to_s
+ end
+
+ # Is `self` a well-formed Integer (i.e. parsable via `to_i`)
+ #
+ # assert "123".is_int
+ # assert "0b1011".is_int
+ # assert not "0x_".is_int
+ # assert not "0xGE".is_int
+ fun is_int: Bool do
+ var s = remove_all('_')
+ var pos = 0
+ while s[pos] == '-' do
+ pos += 1
+ end
+ s = s.substring_from(pos)
+ var rets = s.strip_numhead
+ if rets == "" then return false
+ var hd = get_numhead
+ if hd == "0x" or hd == "0X" then return rets.is_hex
+ if hd == "0b" or hd == "0B" then return rets.is_bin
+ if hd == "0o" or hd == "0O" then return rets.is_oct
+ return hd.is_dec
+ end
+
+ # Removes the numeric head of `self` if present
+ #
+ # intrude import standard::text::abstract_text
+ # assert "0xFFEF".strip_numhead == "FFEF"
+ # assert "0o7364".strip_numhead == "7364"
+ # assert "0b01001".strip_numhead == "01001"
+ # assert "98".strip_numhead == "98"
+ private fun strip_numhead: Text do
+ if get_numhead != "" then return substring_from(2)
+ return self
+ end
+
+ # Gets the numeric head of `self` if present
+ # Returns "" otherwise
+ #
+ # intrude import standard::text::abstract_text
+ # assert "0xFEFF".get_numhead == "0x"
+ # assert "0b01001".get_numhead == "0b"
+ # assert "0o872".get_numhead == "0o"
+ # assert "98".get_numhead == ""
+ private fun get_numhead: Text do
+ if self.length < 2 then return ""
+ var c = self[0]
+ if c != '0' then return ""
+ c = self[1]
+ if c == 'x' or c == 'b' or c == 'o' or
+ c == 'X' or c == 'B' or c == 'O' then return substring(0, 2)
+ return ""
+ end
+
+ # Removes the numeric extension if present
+ #
+ # intrude import standard::text::abstract_text
+ # assert "0xFEFFu8".strip_numext == "0xFEFF"
+ # assert "0b01001u8".strip_numext == "0b01001"
+ # assert "0o872u8".strip_numext == "0o872"
+ # assert "98".strip_numext == "98"
+ private fun strip_numext: Text do
+ var ext = get_numext
+ if ext != "" then return substring(0, length - ext.length)
+ return self
+ end
+
+ # Gets the numeric extension (i/u 8/16/32) in `self` is present
+ # Returns "" otherwise
+ #
+ # intrude import standard::text::abstract_text
+ # assert "0xFEFFu8".get_numext == "u8"
+ # assert "0b01001u8".get_numext == "u8"
+ # assert "0o872u8".get_numext == "u8"
+ # assert "98".get_numext == ""
+ private fun get_numext: Text do
+ var len = self.length
+ var max = if self.length < 3 then self.length else 3
+ for i in [1 .. max] do
+ var c = self[len - i]
+ if c == 'i' or c == 'u' then return substring_from(len - i)
+ end
+ return ""
+ end
+
+ # Returns `self` as the corresponding integer
#
# assert "123".to_i == 123
# assert "-1".to_i == -1
+ # assert "0x64".to_i == 100
+ # assert "0b1100_0011".to_i== 195
+ # assert "--12".to_i == 12
+ #
+ # REQUIRE: `self`.`is_int`
fun to_i: Int
do
- # Shortcut
- return to_s.to_cstring.atoi
+ assert self.is_int
+ var s = remove_all('_')
+ var val = 0
+ var neg = false
+ var pos = 0
+ while s[pos] == '-' do
+ neg = not neg
+ pos += 1
+ end
+ s = s.substring_from(pos)
+ if s.length >= 2 then
+ var s1 = s[1]
+ if s1 == 'x' or s1 == 'X' then
+ val = s.substring_from(2).to_hex
+ else if s1 == 'o' or s1 == 'O' then
+ val = s.substring_from(2).to_oct
+ else if s1 == 'b' or s1 == 'B' then
+ val = s.substring_from(2).to_bin
+ else if s1.is_numeric then
+ val = s.to_dec
+ end
+ else
+ val = s.to_dec
+ end
+ return if neg then -val else val
+ end
+
+ # Is `self` a valid integer ?
+ #
+ # assert "0xFE46u8".is_num
+ # assert "0b0100".is_num
+ # assert "0o645".is_num
+ # assert "897u8".is_num
+ fun is_num: Bool do
+ var prefix = get_numhead
+ var s = strip_numhead.strip_numext.remove_all('_')
+ if prefix != "" then
+ var c = prefix[1]
+ if c == 'x' or c == 'X' then return s.is_hex
+ if c == 'o' or c == 'O' then return s.is_oct
+ if c == 'b' or c == 'B' then return s.is_bin
+ end
+ return s.is_dec
+ end
+
+ # Is `self` is a properly formatted integer, returns the corresponding value
+ #
+ # assert "0xFEu8".to_num == 254u8
+ # assert "0b10_10".to_num != 10u8
+ fun to_num: nullable Numeric do
+ if not is_num then return null
+ var s = remove_all('_')
+ var ext = s.get_numext
+ var trunk = s.strip_numext
+ if trunk.strip_numhead == "" then return null
+ var trval = trunk.to_i
+ if ext == "u8" then
+ return trval.to_b
+ else if ext == "" then
+ return trval
+ else
+ return null
+ end
end
# If `self` contains a float, return the corresponding float
# assert "101101".to_bin == 45
fun to_bin: Int do return a_to(2)
+ # If `self` contains only digits '0' .. '9', return the corresponding integer.
+ #
+ # assert "108".to_dec == 108
+ fun to_dec: Int do return a_to(10)
+
# If `self` contains only digits and letters, return the corresponding integer in a given base
#
# assert "120".a_to(3) == 15
return true
end
+ # Returns `true` if the string contains only Binary digits
+ #
+ # assert "1101100".is_bin == true
+ # assert "1101020".is_bin == false
+ fun is_bin: Bool do
+ for i in chars do if i != '0' and i != '1' then return false
+ return true
+ end
+
+ # Returns `true` if the string contains only Octal digits
+ #
+ # assert "213453".is_oct == true
+ # assert "781".is_oct == false
+ fun is_oct: Bool do
+ for i in chars do if i < '0' or i > '7' then return false
+ return true
+ end
+
+ # Returns `true` if the string contains only Decimal digits
+ #
+ # assert "10839".is_dec == true
+ # assert "164F".is_dec == false
+ fun is_dec: Bool do
+ for i in chars do if i < '0' or i > '9' then return false
+ return true
+ end
+
# Are all letters in `self` upper-case ?
#
# assert "HELLO WORLD".is_upper == true
var mypos = src_offset
var itspos = dest_offset
while n > 0 do
- dest[itspos] = self.chars[mypos]
+ dest[itspos] = self.bytes[mypos]
itspos += 1
mypos += 1
n -= 1
# Real items, used as cache for to_cstring is called
private var real_items: nullable NativeString = null
- # Returns a char* starting at position `index_from`
+ # Returns a char* starting at position `first_byte`
#
# WARNING: If you choose to use this service, be careful of the following.
#
redef var length = 0
+ redef var bytelen = 0
+
redef fun output
do
var i = 0
end
# Abstract class for the SequenceRead compatible
-# views on String and Buffer objects
+# views on the chars of any Text
private abstract class StringCharView
super SequenceRead[Char]
redef fun reverse_iterator do return self.reverse_iterator_from(self.length - 1)
end
+# Abstract class for the SequenceRead compatible
+# views on the bytes of any Text
+private abstract class StringByteView
+ super SequenceRead[Byte]
+
+ type SELFTYPE: Text
+
+ var target: SELFTYPE
+
+ redef fun is_empty do return target.is_empty
+
+ redef fun length do return target.length
+
+ redef fun iterator do return self.iterator_from(0)
+
+ redef fun reverse_iterator do return self.reverse_iterator_from(target.bytelen - 1)
+end
+
# Immutable sequence of characters.
#
# String objects may be created using literals.
# In Buffers, the internal sequence of character is mutable
# Thus, `chars` can be used to modify the buffer.
redef fun chars: Sequence[Char] is abstract
+
+ # In Buffers, the internal sequence of bytes is mutable
+ # Thus, `bytes` can be used to modify the buffer.
+ redef fun bytes: Sequence[Byte] is abstract
end
-# View on Buffer objects, extends Sequence
+# View for chars on Buffer objects, extends Sequence
# for mutation operations
private abstract class BufferCharView
super StringCharView
end
+# View for bytes on Buffer objects, extends Sequence
+# for mutation operations
+private abstract class BufferByteView
+ super StringByteView
+ super Sequence[Byte]
+
+ redef type SELFTYPE: Buffer
+end
+
redef class Object
# User readable representation of `self`.
fun to_s: String do return inspect
redef fun to_s do
var nslen = byte_to_s_len
var ns = new NativeString(nslen + 1)
- ns[nslen] = '\0'
+ ns[nslen] = 0u8
native_byte_to_s(ns, nslen + 1)
return ns.to_s_with_length(nslen)
end
end
redef class Char
+
+ # Length of `self` in a UTF-8 String
+ private fun u8char_len: Int do
+ var c = self.ascii
+ if c < 0x80 then return 1
+ if c <= 0x7FF then return 2
+ if c <= 0xFFFF then return 3
+ if c <= 0x10FFFF then return 4
+ # Bad character format
+ return 1
+ end
+
# assert 'x'.to_s == "x"
- redef fun to_s
- do
- var s = new Buffer.with_cap(1)
- s.chars[0] = self
- return s.to_s
+ redef fun to_s do
+ var ln = u8char_len
+ var ns = new NativeString(ln + 1)
+ u8char_tos(ns, ln)
+ return ns.to_s_with_length(ln)
end
+ private fun u8char_tos(r: NativeString, len: Int) `{
+ r[len] = '\0';
+ switch(len){
+ case 1:
+ r[0] = self;
+ break;
+ case 2:
+ r[0] = 0xC0 | ((self & 0x7C0) >> 6);
+ r[1] = 0x80 | (self & 0x3F);
+ break;
+ case 3:
+ r[0] = 0xE0 | ((self & 0xF000) >> 12);
+ r[1] = 0x80 | ((self & 0xFC0) >> 6);
+ r[2] = 0x80 | (self & 0x3F);
+ break;
+ case 4:
+ r[0] = 0xF0 | ((self & 0x1C0000) >> 18);
+ r[1] = 0x80 | ((self & 0x3F000) >> 12);
+ r[2] = 0x80 | ((self & 0xFC0) >> 6);
+ r[3] = 0x80 | (self & 0x3F);
+ break;
+ }
+ `}
+
# Returns true if the char is a numerical digit
#
# assert '0'.is_numeric
# assert '9'.is_numeric
# assert not 'a'.is_numeric
# assert not '?'.is_numeric
+ #
+ # FIXME: Works on ASCII-range only
fun is_numeric: Bool
do
return self >= '0' and self <= '9'
# assert 'Z'.is_alpha
# assert not '0'.is_alpha
# assert not '?'.is_alpha
+ #
+ # FIXME: Works on ASCII-range only
fun is_alpha: Bool
do
return (self >= 'a' and self <= 'z') or (self >= 'A' and self <= 'Z')
# assert '0'.is_alphanumeric
# assert '9'.is_alphanumeric
# assert not '?'.is_alphanumeric
+ #
+ # FIXME: Works on ASCII-range only
fun is_alphanumeric: Bool
do
return self.is_numeric or self.is_alpha
return s.to_s
end
- # Concatenate and separate each elements with `sep`.
+ # Concatenate and separate each elements with `separator`.
+ #
+ # Only concatenate if `separator == null`.
#
- # assert [1, 2, 3].join(":") == "1:2:3"
- # assert [1..3].join(":") == "1:2:3"
- fun join(sep: Text): String
+ # assert [1, 2, 3].join(":") == "1:2:3"
+ # assert [1..3].join(":") == "1:2:3"
+ # assert [1..3].join == "123"
+ fun join(separator: nullable Text): String
do
if is_empty then return ""
# Concat other items
i.next
while i.is_ok do
- s.append(sep)
+ if separator != null then s.append(separator)
e = i.item
if e != null then s.append(e.to_s)
i.next
end
redef class Map[K,V]
- # Concatenate couple of 'key value'.
- # key and value are separated by `couple_sep`.
- # each couple is separated each couple with `sep`.
+ # Concatenate couples of key value.
+ # Key and value are separated by `couple_sep`.
+ # Couples are separated by `sep`.
#
- # var m = new ArrayMap[Int, String]
+ # var m = new HashMap[Int, String]
# m[1] = "one"
# m[10] = "ten"
# assert m.join("; ", "=") == "1=one; 10=ten"
- fun join(sep: String, couple_sep: String): String is abstract
+ fun join(sep, couple_sep: String): String is abstract
end
redef class Sys
module flat
intrude import abstract_text
+intrude import native
`{
#include <stdio.h>
super FlatText
super String
- # Index in _items of the start of the string
- private var index_from: Int is noinit
+ # Index at which `self` begins in `items`, inclusively
+ private var first_byte: Int is noinit
- # Indes in _items of the last item of the string
- private var index_to: Int is noinit
+ # Index at which `self` ends in `items`, inclusively
+ private var last_byte: Int is noinit
redef var chars = new FlatStringCharView(self) is lazy
- redef fun [](index)
- do
- # Check that the index (+ index_from) is not larger than indexTo
- # In other terms, if the index is valid
- assert index >= 0
- assert (index + index_from) <= index_to
- return items[index + index_from]
+ redef var bytes = new FlatStringByteView(self) is lazy
+
+ # Cache of the latest position (char) explored in the string
+ var position: Int = 0
+ # Cached position (bytes) in the NativeString underlying the String
+ var bytepos: Int = first_byte is lateinit
+
+ redef var length is lazy do
+ if bytelen == 0 then return 0
+ var st = first_byte
+ var its = items
+ var ln = 0
+ var lst = last_byte
+ while st <= lst do
+ st += its.length_of_char_at(st)
+ ln += 1
+ end
+ return ln
end
- ################################################
- # AbstractString specific methods #
- ################################################
+ redef fun [](index) do return items.char_at(char_to_byte_index(index))
+
+ # Index of the character `index` in `items`
+ private fun char_to_byte_index(index: Int): Int do
+ var ln = length
+ assert index >= 0
+ assert index < ln
+
+ # Find best insertion point
+ var delta_begin = index
+ var delta_end = (ln - 1) - index
+ var delta_cache = (position - index).abs
+ var min = delta_begin
+ var its = items
+
+ if delta_cache < min then min = delta_cache
+ if delta_end < min then min = delta_end
+
+ var ns_i: Int
+ var my_i: Int
+
+ if min == delta_begin then
+ ns_i = first_byte
+ my_i = 0
+ else if min == delta_cache then
+ ns_i = bytepos
+ my_i = position
+ else
+ ns_i = its.find_beginning_of_char_at(last_byte)
+ my_i = length - 1
+ end
+
+ ns_i = its.char_to_byte_index_cached(index, my_i, ns_i)
+
+ position = index
+ bytepos = ns_i
+
+ return ns_i
+ end
redef fun reversed
do
- var native = new NativeString(self.length + 1)
- var length = self.length
- var items = self.items
- var pos = 0
- var ipos = length-1
- while pos < length do
- native[pos] = items[ipos]
- pos += 1
- ipos -= 1
+ var b = new FlatBuffer.with_capacity(bytelen + 1)
+ for i in [length - 1 .. 0].step(-1) do
+ b.add self[i]
end
- return native.to_s_with_length(self.length)
+ var s = b.to_s.as(FlatString)
+ s.length = self.length
+ return s
end
- redef fun fast_cstring do return items.fast_cstring(index_from)
+ redef fun fast_cstring do return items.fast_cstring(first_byte)
redef fun substring(from, count)
do
from = 0
end
- var new_from = index_from + from
+ if (count + from) > length then count = length - from
+ if count <= 0 then return ""
+ var end_index = from + count - 1
- if (new_from + count) > index_to then
- var new_len = index_to - new_from + 1
- if new_len <= 0 then return empty
- return new FlatString.with_infos(items, new_len, new_from, index_to)
- end
-
- if count <= 0 then return empty
+ var bytefrom = char_to_byte_index(from)
+ var byteto = char_to_byte_index(end_index)
+ byteto += items.length_of_char_at(byteto) - 1
- var to = new_from + count - 1
-
- return new FlatString.with_infos(items, to - new_from + 1, new_from, to)
+ var s = new FlatString.full(items, byteto - bytefrom + 1, bytefrom, byteto, count)
+ return s
end
redef fun empty do return "".as(FlatString)
redef fun to_upper
do
- var outstr = new NativeString(self.length + 1)
- var out_index = 0
+ var outstr = new FlatBuffer.with_capacity(self.bytelen + 1)
- var myitems = self.items
- var index_from = self.index_from
- var max = self.index_to
+ var mylen = length
+ var pos = 0
- while index_from <= max do
- outstr[out_index] = myitems[index_from].to_upper
- out_index += 1
- index_from += 1
+ while pos < mylen do
+ outstr.add(chars[pos].to_upper)
+ pos += 1
end
- outstr[self.length] = '\0'
-
- return outstr.to_s_with_length(self.length)
+ return outstr.to_s
end
redef fun to_lower
do
- var outstr = new NativeString(self.length + 1)
- var out_index = 0
+ var outstr = new FlatBuffer.with_capacity(self.bytelen + 1)
- var myitems = self.items
- var index_from = self.index_from
- var max = self.index_to
+ var mylen = length
+ var pos = 0
- while index_from <= max do
- outstr[out_index] = myitems[index_from].to_lower
- out_index += 1
- index_from += 1
+ while pos < mylen do
+ outstr.add(chars[pos].to_lower)
+ pos += 1
end
- outstr[self.length] = '\0'
-
- return outstr.to_s_with_length(self.length)
+ return outstr.to_s
end
redef fun output
do
- var i = self.index_from
- var imax = self.index_to
- while i <= imax do
- items[i].output
- i += 1
- end
+ for i in chars do i.output
end
##################################################
# String Specific Methods #
##################################################
- # Low-level creation of a new string with given data.
+ # Low-level creation of a new string with minimal data.
#
# `items` will be used as is, without copy, to retrieve the characters of the string.
# Aliasing issues is the responsibility of the caller.
- private init with_infos(items: NativeString, length: Int, from: Int, to: Int)
+ private init with_infos(items: NativeString, bytelen, from, to: Int)
do
self.items = items
- self.length = length
- index_from = from
- index_to = to
+ self.bytelen = bytelen
+ first_byte = from
+ last_byte = to
end
- redef fun to_cstring
+ # Low-level creation of a new string with all the data.
+ #
+ # `items` will be used as is, without copy, to retrieve the characters of the string.
+ # Aliasing issues is the responsibility of the caller.
+ private init full(items: NativeString, bytelen, from, to, length: Int)
do
- if real_items != null then
- return real_items.as(not null)
- else
- var newItems = new NativeString(length + 1)
- self.items.copy_to(newItems, length, index_from, 0)
- newItems[length] = '\0'
- self.real_items = newItems
- return newItems
- end
+ self.items = items
+ self.length = length
+ self.bytelen = bytelen
+ first_byte = from
+ last_byte = to
+ end
+
+ redef fun to_cstring do
+ if real_items != null then return real_items.as(not null)
+ var new_items = new NativeString(bytelen + 1)
+ self.items.copy_to(new_items, bytelen, first_byte, 0)
+ new_items[bytelen] = 0u8
+ real_items = new_items
+ return new_items
end
redef fun ==(other)
if self.object_id == other.object_id then return true
- var my_length = length
+ var my_length = bytelen
- if other.length != my_length then return false
+ if other.bytelen != my_length then return false
- var my_index = index_from
- var its_index = other.index_from
+ var my_index = first_byte
+ var its_index = other.first_byte
var last_iteration = my_index + my_length
if self.object_id == other.object_id then return false
- var my_curr_char : Char
- var its_curr_char : Char
-
- var curr_id_self = self.index_from
- var curr_id_other = other.index_from
+ var my_length = self.bytelen
+ var its_length = other.bytelen
- var my_items = self.items
- var its_items = other.items
+ var max = if my_length < its_length then my_length else its_length
- var my_length = self.length
- var its_length = other.length
+ var myits = self.bytes
+ var itsits = other.bytes
- var max_iterations = curr_id_self + my_length
-
- while curr_id_self < max_iterations do
- my_curr_char = my_items[curr_id_self]
- its_curr_char = its_items[curr_id_other]
+ for i in [0 .. max[ do
+ var my_curr_char = myits[i]
+ var its_curr_char = itsits[i]
if my_curr_char != its_curr_char then
if my_curr_char < its_curr_char then return true
return false
end
-
- curr_id_self += 1
- curr_id_other += 1
end
return my_length < its_length
end
- redef fun +(s)
- do
- var my_length = self.length
- var its_length = s.length
-
- var total_length = my_length + its_length
-
- var target_string = new NativeString(my_length + its_length + 1)
-
- self.items.copy_to(target_string, my_length, index_from, 0)
- if s isa FlatString then
- s.items.copy_to(target_string, its_length, s.index_from, my_length)
- else if s isa FlatBuffer then
- s.items.copy_to(target_string, its_length, 0, my_length)
+ redef fun +(o) do
+ var s = o.to_s
+ var slen = s.bytelen
+ var mlen = bytelen
+ var nlen = mlen + slen
+ var mits = items
+ var mifrom = first_byte
+ if s isa FlatText then
+ var sits = s.items
+ var sifrom = s.as(FlatString).first_byte
+ var ns = new NativeString(nlen + 1)
+ mits.copy_to(ns, mlen, mifrom, 0)
+ sits.copy_to(ns, slen, sifrom, mlen)
+ return new FlatString.full(ns, nlen, 0, nlen - 1, length + o.length)
else
- var curr_pos = my_length
- for i in [0..s.length[ do
- var c = s.chars[i]
- target_string[curr_pos] = c
- curr_pos += 1
- end
+ abort
end
-
- target_string[total_length] = '\0'
-
- return target_string.to_s_with_length(total_length)
end
- redef fun *(i)
- do
- assert i >= 0
-
- var my_length = self.length
-
- var final_length = my_length * i
-
- var my_items = self.items
-
- var target_string = new NativeString(final_length + 1)
-
- target_string[final_length] = '\0'
-
- var current_last = 0
-
- for iteration in [1 .. i] do
- my_items.copy_to(target_string, my_length, 0, current_last)
- current_last += my_length
+ redef fun *(i) do
+ var mybtlen = bytelen
+ var new_bytelen = mybtlen * i
+ var mylen = length
+ var newlen = mylen * i
+ var ns = new NativeString(new_bytelen + 1)
+ ns[new_bytelen] = 0u8
+ var offset = 0
+ while i > 0 do
+ items.copy_to(ns, bytelen, first_byte, offset)
+ offset += mybtlen
+ i -= 1
end
-
- return target_string.to_s_with_length(final_length)
+ return new FlatString.full(ns, new_bytelen, 0, new_bytelen - 1, newlen)
end
+
redef fun hash
do
if hash_cache == null then
# djb2 hash algorithm
var h = 5381
- var i = index_from
+ var i = first_byte
var myitems = items
- while i <= index_to do
- h = h.lshift(5) + h + myitems[i].ascii
+ while i <= last_byte do
+ h = h.lshift(5) + h + myitems[i].to_i
i += 1
end
redef fun substrings do return new FlatSubstringsIter(self)
end
-private class FlatStringReverseIterator
+private class FlatStringCharReverseIterator
super IndexedIterator[Char]
var target: FlatString
+ var curr_pos: Int
+
+ init with_pos(tgt: FlatString, pos: Int)
+ do
+ init(tgt, pos)
+ end
+
+ redef fun is_ok do return curr_pos >= 0
+
+ redef fun item do return target[curr_pos]
+
+ redef fun next do curr_pos -= 1
+
+ redef fun index do return curr_pos
+
+end
+
+private class FlatStringCharIterator
+ super IndexedIterator[Char]
+
+ var target: FlatString
+
+ var max: Int
+
+ var curr_pos: Int
+
+ init with_pos(tgt: FlatString, pos: Int)
+ do
+ init(tgt, tgt.length - 1, pos)
+ end
+
+ redef fun is_ok do return curr_pos <= max
+
+ redef fun item do return target[curr_pos]
+
+ redef fun next do curr_pos += 1
+
+ redef fun index do return curr_pos
+
+end
+
+private class FlatStringCharView
+ super StringCharView
+
+ redef type SELFTYPE: FlatString
+
+ redef fun [](index) do return target[index]
+
+ redef fun iterator_from(start) do return new FlatStringCharIterator.with_pos(target, start)
+
+ redef fun reverse_iterator_from(start) do return new FlatStringCharReverseIterator.with_pos(target, start)
+
+end
+
+private class FlatStringByteReverseIterator
+ super IndexedIterator[Byte]
+
+ var target: FlatString
+
var target_items: NativeString
var curr_pos: Int
init with_pos(tgt: FlatString, pos: Int)
do
- target = tgt
- target_items = tgt.items
- curr_pos = pos + tgt.index_from
+ init(tgt, tgt.items, pos + tgt.first_byte)
end
- redef fun is_ok do return curr_pos >= target.index_from
+ redef fun is_ok do return curr_pos >= target.first_byte
redef fun item do return target_items[curr_pos]
redef fun next do curr_pos -= 1
- redef fun index do return curr_pos - target.index_from
+ redef fun index do return curr_pos - target.first_byte
end
-private class FlatStringIterator
- super IndexedIterator[Char]
+private class FlatStringByteIterator
+ super IndexedIterator[Byte]
var target: FlatString
init with_pos(tgt: FlatString, pos: Int)
do
- target = tgt
- target_items = tgt.items
- curr_pos = pos + target.index_from
+ init(tgt, tgt.items, pos + tgt.first_byte)
end
- redef fun is_ok do return curr_pos <= target.index_to
+ redef fun is_ok do return curr_pos <= target.last_byte
redef fun item do return target_items[curr_pos]
redef fun next do curr_pos += 1
- redef fun index do return curr_pos - target.index_from
+ redef fun index do return curr_pos - target.first_byte
end
-private class FlatStringCharView
- super StringCharView
+private class FlatStringByteView
+ super StringByteView
redef type SELFTYPE: FlatString
redef fun [](index)
do
- # Check that the index (+ index_from) is not larger than indexTo
+ # Check that the index (+ first_byte) is not larger than last_byte
# In other terms, if the index is valid
assert index >= 0
var target = self.target
- assert (index + target.index_from) <= target.index_to
- return target.items[index + target.index_from]
+ assert (index + target.first_byte) <= target.last_byte
+ return target.items[index + target.first_byte]
end
- redef fun iterator_from(start) do return new FlatStringIterator.with_pos(target, start)
+ redef fun iterator_from(start) do return new FlatStringByteIterator.with_pos(target, start)
- redef fun reverse_iterator_from(start) do return new FlatStringReverseIterator.with_pos(target, start)
+ redef fun reverse_iterator_from(start) do return new FlatStringByteReverseIterator.with_pos(target, start)
end
redef var chars: Sequence[Char] = new FlatBufferCharView(self) is lazy
- private var capacity: Int = 0
+ redef var bytes: Sequence[Byte] = new FlatBufferByteView(self) is lazy
+
+ redef var bytelen = 0
+
+ # O(n)
+ redef fun length do
+ var max = bytelen
+ if max == 0 then return 0
+ var pos = 0
+ var ln = 0
+ var its = items
+ while pos < max do
+ pos += its.length_of_char_at(pos)
+ ln += 1
+ end
+ return ln
+ end
+
+ private var capacity = 0
redef fun fast_cstring do return items.fast_cstring(0)
# the Copy-On-Write flag `written` is set at true.
private fun reset do
var nns = new NativeString(capacity)
- items.copy_to(nns, length, 0, 0)
+ items.copy_to(nns, bytelen, 0, 0)
items = nns
written = false
end
- redef fun [](index)
+ # Shifts the content of the buffer by `len` bytes to the right, starting at byte `from`
+ #
+ # Internal only, does not modify bytelen or length, this is the caller's responsability
+ private fun rshift_bytes(from: Int, len: Int) do
+ var oit = items
+ var nit = items
+ if bytelen + len > capacity then
+ capacity = capacity * 2 + 2
+ nit = new NativeString(capacity)
+ oit.copy_to(nit, 0, 0, from)
+ end
+ oit.copy_to(nit, bytelen - from, from, from + len)
+ end
+
+ # Shifts the content of the buffer by `len` bytes to the left, starting at `from`
+ #
+ # Internal only, does not modify bytelen or length, this is the caller's responsability
+ private fun lshift_bytes(from: Int, len: Int) do
+ items.copy_to(items, bytelen - from, from, from - len)
+ end
+
+ redef fun [](i)
do
- assert index >= 0
- assert index < length
- return items[index]
+ assert i < length and i >= 0
+ return items.char_at(items.char_to_byte_index(i))
end
redef fun []=(index, item)
do
+ assert index >= 0 and index <= length
+ if written then reset
is_dirty = true
if index == length then
- add(item)
+ add item
return
end
- if written then reset
- assert index >= 0 and index < length
- items[index] = item
+ var ip = items.char_to_byte_index(index)
+ var c = items.char_at(ip)
+ var clen = c.u8char_len
+ var itemlen = item.u8char_len
+ var size_diff = itemlen - clen
+ if size_diff > 0 then
+ rshift_bytes(ip + clen, size_diff)
+ else if size_diff < 0 then
+ lshift_bytes(ip + clen, -size_diff)
+ end
+ bytelen += size_diff
+ items.set_char_at(ip, item)
end
redef fun add(c)
do
+ if written then reset
+ is_dirty = true
+ var clen = c.u8char_len
+ enlarge(bytelen + clen)
+ items.set_char_at(bytelen, c)
+ bytelen += clen
+ end
+
+ private fun add_byte(b: Byte) do
+ if written then reset
is_dirty = true
- if capacity <= length then enlarge(length + 5)
- items[length] = c
- length += 1
+ enlarge(bytelen + 1)
+ items[bytelen] = b
+ # FIXME: Might trigger errors
+ bytelen += 1
end
redef fun clear do
is_dirty = true
if written then reset
- length = 0
+ bytelen = 0
end
redef fun empty do return new Buffer
# it does a copy of the current `Buffer`
written = false
var a = new NativeString(c+1)
- if length > 0 then items.copy_to(a, length, 0, 0)
+ if bytelen > 0 then items.copy_to(a, bytelen, 0, 0)
items = a
capacity = c
end
redef fun to_s
do
written = true
- if length == 0 then items = new NativeString(1)
- return new FlatString.with_infos(items, length, 0, length - 1)
+ if bytelen == 0 then items = new NativeString(1)
+ return new FlatString.with_infos(items, bytelen, 0, bytelen - 1)
end
redef fun to_cstring
do
if is_dirty then
- var new_native = new NativeString(length + 1)
- new_native[length] = '\0'
- if length > 0 then items.copy_to(new_native, length, 0, 0)
+ var new_native = new NativeString(bytelen + 1)
+ new_native[bytelen] = 0u8
+ if length > 0 then items.copy_to(new_native, bytelen, 0, 0)
real_items = new_native
is_dirty = false
end
#
# If `items` is shared, `written` should be set to true after the creation
# so that a modification will do a copy-on-write.
- private init with_infos(items: NativeString, capacity, length: Int)
+ private init with_infos(items: NativeString, capacity, bytelen: Int)
do
self.items = items
- self.length = length
self.capacity = capacity
+ self.bytelen = bytelen
end
# Create a new string copied from `s`.
init from(s: Text)
do
- capacity = s.length + 1
- length = s.length
- items = new NativeString(capacity)
- if s isa FlatString then
- s.items.copy_to(items, length, s.index_from, 0)
- else if s isa FlatBuffer then
- s.items.copy_to(items, length, 0, 0)
+ items = new NativeString(s.bytelen)
+ if s isa FlatText then
+ items = s.items
else
- var curr_pos = 0
- for i in [0..s.length[ do
- var c = s.chars[i]
- items[curr_pos] = c
- curr_pos += 1
- end
+ for i in substrings do i.as(FlatString).items.copy_to(items, i.bytelen, 0, 0)
end
+ bytelen = s.bytelen
+ capacity = s.bytelen
+ written = true
end
# Create a new empty string with a given capacity.
init with_capacity(cap: Int)
do
assert cap >= 0
- items = new NativeString(cap+1)
+ items = new NativeString(cap + 1)
capacity = cap
- length = 0
+ bytelen = 0
end
redef fun append(s)
do
if s.is_empty then return
is_dirty = true
- var sl = s.length
- if capacity < length + sl then enlarge(length + sl)
+ var sl = s.bytelen
+ enlarge(bytelen + sl)
if s isa FlatString then
- s.items.copy_to(items, sl, s.index_from, length)
+ s.items.copy_to(items, sl, s.first_byte, bytelen)
else if s isa FlatBuffer then
- s.items.copy_to(items, sl, 0, length)
+ s.items.copy_to(items, sl, 0, bytelen)
else
- var curr_pos = self.length
- for i in [0..s.length[ do
- var c = s.chars[i]
- items[curr_pos] = c
- curr_pos += 1
- end
+ for i in s.substrings do append i
+ return
end
- length += sl
+ bytelen += sl
end
# Copies the content of self in `dest`
redef fun substring(from, count)
do
assert count >= 0
- count += from
if from < 0 then from = 0
- if count > length then count = length
- if from < count then
- var len = count - from
- var r_items = new NativeString(len)
- items.copy_to(r_items, len, from, 0)
- var r = new FlatBuffer.with_infos(r_items, len, len)
- return r
+ if (from + count) > length then count = length - from
+ if count != 0 then
+ var bytefrom = items.char_to_byte_index(from)
+ var byteto = items.char_to_byte_index(count + from - 1)
+ byteto += items.char_at(byteto).u8char_len - 1
+ var byte_length = byteto - bytefrom + 1
+ var r_items = new NativeString(byte_length)
+ items.copy_to(r_items, byte_length, bytefrom, 0)
+ return new FlatBuffer.with_infos(r_items, byte_length, byte_length)
else
return new Buffer
end
redef fun reverse
do
written = false
- var ns = new NativeString(capacity)
- var si = length - 1
- var ni = 0
- var it = items
- while si >= 0 do
- ns[ni] = it[si]
- ni += 1
- si -= 1
- end
- items = ns
+ var ns = new FlatBuffer.with_capacity(capacity)
+ for i in chars.reverse_iterator do ns.add i
+ items = ns.items
end
redef fun times(repeats)
do
- var x = new FlatString.with_infos(items, length, 0, length - 1)
- for i in [1..repeats[ do
+ var x = new FlatString.with_infos(items, bytelen, 0, bytelen - 1)
+ for i in [1 .. repeats[ do
append(x)
end
end
redef fun upper
do
if written then reset
- var it = items
- var id = length - 1
- while id >= 0 do
- it[id] = it[id].to_upper
- id -= 1
- end
+ for i in [0 .. length[ do self[i] = self[i].to_upper
end
redef fun lower
do
if written then reset
- var it = items
- var id = length - 1
- while id >= 0 do
- it[id] = it[id].to_lower
- id -= 1
- end
+ for i in [0 .. length[ do self[i] = self[i].to_lower
end
end
-private class FlatBufferReverseIterator
- super IndexedIterator[Char]
+private class FlatBufferByteReverseIterator
+ super IndexedIterator[Byte]
var target: FlatBuffer
init with_pos(tgt: FlatBuffer, pos: Int)
do
- target = tgt
- if tgt.length > 0 then target_items = tgt.items
- curr_pos = pos
+ init(tgt, tgt.items, pos)
end
redef fun index do return curr_pos
end
+private class FlatBufferByteView
+ super BufferByteView
+
+ redef type SELFTYPE: FlatBuffer
+
+ redef fun [](index) do return target.items[index]
+
+ redef fun []=(index, item)
+ do
+ assert index >= 0 and index <= target.bytelen
+ if index == target.bytelen then
+ add(item)
+ return
+ end
+ target.items[index] = item
+ end
+
+ redef fun push(c)
+ do
+ target.add_byte(c)
+ end
+
+ fun enlarge(cap: Int)
+ do
+ target.enlarge(cap)
+ end
+
+ redef fun append(s)
+ do
+ var s_length = s.length
+ if target.capacity < (target.length + s_length) then enlarge(s_length + target.length)
+ var pos = target.length
+ var its = target.items
+ for i in s do
+ its[pos] = i
+ pos += 1
+ end
+ target.length += s.length
+ end
+
+ redef fun iterator_from(pos) do return new FlatBufferByteIterator.with_pos(target, pos)
+
+ redef fun reverse_iterator_from(pos) do return new FlatBufferByteReverseIterator.with_pos(target, pos)
+
+end
+
+private class FlatBufferByteIterator
+ super IndexedIterator[Byte]
+
+ var target: FlatBuffer
+
+ var target_items: NativeString
+
+ var curr_pos: Int
+
+ init with_pos(tgt: FlatBuffer, pos: Int)
+ do
+ init(tgt, tgt.items, pos)
+ end
+
+ redef fun index do return curr_pos
+
+ redef fun is_ok do return curr_pos < target.bytelen
+
+ redef fun item do return target_items[curr_pos]
+
+ redef fun next do curr_pos += 1
+
+end
+
+private class FlatBufferCharReverseIterator
+ super IndexedIterator[Char]
+
+ var target: FlatBuffer
+
+ var curr_pos: Int
+
+ init with_pos(tgt: FlatBuffer, pos: Int)
+ do
+ init(tgt, pos)
+ end
+
+ redef fun index do return curr_pos
+
+ redef fun is_ok do return curr_pos >= 0
+
+ redef fun item do return target[curr_pos]
+
+ redef fun next do curr_pos -= 1
+
+end
+
private class FlatBufferCharView
super BufferCharView
redef type SELFTYPE: FlatBuffer
- redef fun [](index) do return target.items[index]
+ redef fun [](index) do return target[index]
redef fun []=(index, item)
do
add(item)
return
end
- target.items[index] = item
+ target[index] = item
end
redef fun push(c)
do
var s_length = s.length
if target.capacity < s.length then enlarge(s_length + target.length)
+ for i in s do target.add i
end
- redef fun iterator_from(pos) do return new FlatBufferIterator.with_pos(target, pos)
+ redef fun iterator_from(pos) do return new FlatBufferCharIterator.with_pos(target, pos)
- redef fun reverse_iterator_from(pos) do return new FlatBufferReverseIterator.with_pos(target, pos)
+ redef fun reverse_iterator_from(pos) do return new FlatBufferCharReverseIterator.with_pos(target, pos)
end
-private class FlatBufferIterator
+private class FlatBufferCharIterator
super IndexedIterator[Char]
var target: FlatBuffer
- var target_items: NativeString
+ var max: Int
var curr_pos: Int
init with_pos(tgt: FlatBuffer, pos: Int)
do
- target = tgt
- if tgt.length > 0 then target_items = tgt.items
- curr_pos = pos
+ init(tgt, tgt.length - 1, pos)
end
redef fun index do return curr_pos
- redef fun is_ok do return curr_pos < target.length
+ redef fun is_ok do return curr_pos <= max
- redef fun item do return target_items[curr_pos]
+ redef fun item do return target[curr_pos]
redef fun next do curr_pos += 1
var new_self = new NativeString(length + 1)
copy_to(new_self, length, 0, 0)
var str = new FlatString.with_infos(new_self, length, 0, length - 1)
- new_self[length] = '\0'
+ new_self[length] = 0u8
str.real_items = new_self
return str
end
+
+ # Sets the next bytes at position `pos` to the value of `c`, encoded in UTF-8
+ #
+ # Very unsafe, make sure to have room for this char prior to calling this function.
+ private fun set_char_at(pos: Int, c: Char) do
+ var ln = c.u8char_len
+ native_set_char(pos, c, ln)
+ end
+
+ private fun native_set_char(pos: Int, c: Char, ln: Int) `{
+ char* dst = self + pos;
+ switch(ln){
+ case 1:
+ dst[0] = c;
+ break;
+ case 2:
+ dst[0] = 0xC0 | ((c & 0x7C0) >> 6);
+ dst[1] = 0x80 | (c & 0x3F);
+ break;
+ case 3:
+ dst[0] = 0xE0 | ((c & 0xF000) >> 12);
+ dst[1] = 0x80 | ((c & 0xFC0) >> 6);
+ dst[2] = 0x80 | (c & 0x3F);
+ break;
+ case 4:
+ dst[0] = 0xF0 | ((c & 0x1C0000) >> 18);
+ dst[1] = 0x80 | ((c & 0x3F000) >> 12);
+ dst[2] = 0x80 | ((c & 0xFC0) >> 6);
+ dst[3] = 0x80 | (c & 0x3F);
+ break;
+ }
+ `}
end
redef class Int
var nslen = int_to_s_len
var ns = new NativeString(nslen + 1)
- ns[nslen] = '\0'
+ ns[nslen] = 0u8
native_int_to_s(ns, nslen + 1)
- return ns.to_s_with_length(nslen)
+ return new FlatString.full(ns, nslen, 0, nslen - 1, nslen)
end
end
continue
end
var tmp = itsi.to_s
- sl += tmp.length
+ sl += tmp.bytelen
na[mypos] = tmp
i += 1
mypos += 1
end
var ns = new NativeString(sl + 1)
- ns[sl] = '\0'
+ ns[sl] = 0u8
i = 0
var off = 0
while i < mypos do
var tmp = na[i]
- var tpl = tmp.length
if tmp isa FlatString then
- tmp.items.copy_to(ns, tpl, tmp.index_from, off)
+ var tpl = tmp.bytelen
+ tmp.items.copy_to(ns, tpl, tmp.first_byte, off)
off += tpl
else
for j in tmp.substrings do
var s = j.as(FlatString)
- var slen = s.length
- s.items.copy_to(ns, slen, s.index_from, off)
+ var slen = s.bytelen
+ s.items.copy_to(ns, slen, s.first_byte, off)
off += slen
end
end
var sl = 0
var mypos = 0
while i < l do
- sl += na[i].length
+ sl += na[i].bytelen
i += 1
mypos += 1
end
var ns = new NativeString(sl + 1)
- ns[sl] = '\0'
+ ns[sl] = 0u8
i = 0
var off = 0
while i < mypos do
var tmp = na[i]
- var tpl = tmp.length
if tmp isa FlatString then
- tmp.items.copy_to(ns, tpl, tmp.index_from, off)
+ var tpl = tmp.bytelen
+ tmp.items.copy_to(ns, tpl, tmp.first_byte, off)
off += tpl
else
for j in tmp.substrings do
var s = j.as(FlatString)
- var slen = s.length
- s.items.copy_to(ns, slen, s.index_from, off)
+ var slen = s.bytelen
+ s.items.copy_to(ns, slen, s.first_byte, off)
off += slen
end
end
module native
import kernel
+import math
+
+redef class Byte
+ # Gives the length of the UTF-8 char starting with `self`
+ private fun u8len: Int do
+ if self & 0b1000_0000u8 == 0u8 then
+ return 1
+ else if self & 0b1110_0000u8 == 0b1100_0000u8 then
+ return 2
+ else if self & 0b1111_0000u8 == 0b1110_0000u8 then
+ return 3
+ else if self & 0b1111_1000u8 == 0b1111_0000u8 then
+ return 4
+ else
+ return 1
+ end
+ end
+end
# Native strings are simple C char *
extern class NativeString `{ char* `}
fun fast_cstring(index: Int): NativeString is intern
# Get char at `index`.
- fun [](index: Int): Char is intern
+ fun [](index: Int): Byte is intern
# Set char `item` at index.
- fun []=(index: Int, item: Char) is intern
+ fun []=(index: Int, item: Byte) is intern
# Copy `self` to `dest`.
fun copy_to(dest: NativeString, length: Int, from: Int, to: Int) is intern
fun cstring_length: Int
do
var l = 0
- while self[l] != '\0' do l += 1
+ while self[l] != 0u8 do l += 1
return l
end
# Parse `self` as a Float.
fun atof: Float `{ return atof(self); `}
+
+ # Gets the UTF-8 char at index `pos`
+ #
+ # Index is expressed in Unicode chars
+ #
+ # ~~~raw
+ # assert "かきく".as(FlatString).items.char_at(0) == 'か'
+ # ~~~
+ #
+ # If the char at position pos is an invalid Unicode char,
+ # the Unicode replacement character � (0xFFFD) will be used.
+ #
+ # ~~~raw
+ # assert "かきく".as(FlatString).items.char_at(1) == '�'
+ # ~~~
+ fun char_at(pos: Int): Char `{
+ char c = self[pos];
+ if((c & 0x80) == 0x00) return (uint32_t)c;
+ if(((c & 0xE0) == 0xC0) && ((self[pos + 1] & 0xC0) == 0x80)) return ((((uint32_t)c) & 0x1F) << 6) + ((((uint32_t)self[pos + 1] & 0x3F)));
+ if(((c & 0xF0) == 0xE0) && ((self[pos + 1] & 0xC0) == 0x80) && ((self[pos + 2] & 0xC0) == 0x80)) return ((((uint32_t)c) & 0xF) << 12) + ((((uint32_t)self[pos + 1]) & 0x3F) << 6) + ((((uint32_t)self[pos + 2] & 0x3F)));
+ if(((c & 0xF8) == 0xF0) && ((self[pos + 1] & 0xC0) == 0x80) && ((self[pos + 2] & 0xC0) == 0x80) && ((self[pos + 3] & 0xC0) == 0x80)) return ((((uint32_t)c) & 0x7) << 18) + ((((uint32_t)self[pos + 1]) & 0x3F) << 12) + ((((uint32_t)self[pos + 2]) & 0x3F) << 6) + ((((uint32_t)self[pos + 3] & 0x3F)));
+ return 0xFFFD;
+ `}
+
+ # Gets the byte index of char at position `n` in UTF-8 String
+ fun char_to_byte_index(n: Int): Int do return char_to_byte_index_cached(n, 0, 0)
+
+ # Gets the length of the character at position `pos` (1 if invalid sequence)
+ fun length_of_char_at(pos: Int): Int do
+ var c = self[pos]
+ if c & 0x80u8 == 0x00u8 then
+ return 1
+ else if c & 0xE0u8 == 0xC0u8 and self[pos + 1] & 0xC0u8 == 0x80u8 then
+ return 2
+ else if c & 0xF0u8 == 0xE0u8 and self[pos + 1] & 0xC0u8 == 0x80u8 and self[pos + 2] & 0xC0u8 == 0x80u8 then
+ return 3
+ else if c & 0xF8u8 == 0xF0u8 and self[pos + 1] & 0xC0u8 == 0x80u8 and self[pos + 2] & 0xC0u8 == 0x80u8 and self[pos + 3] & 0xC0u8 == 0x80u8 then
+ return 4
+ else
+ return 1
+ end
+ end
+
+ # Gets the byte index of char at position `n` in UTF-8 String
+ #
+ # `char_from` and `byte_from` are cached values to seek from.
+ #
+ # NOTE: char_from and byte_from are not guaranteed to be valid cache values
+ # It it up to the client to ensure the validity of the information
+ fun char_to_byte_index_cached(n, char_from, byte_from: Int): Int do
+ var ns_i = byte_from
+ var my_i = char_from
+
+ while my_i < n do
+ ns_i += length_of_char_at(ns_i)
+ my_i += 1
+ end
+
+ while my_i > n do
+ ns_i = find_beginning_of_char_at(ns_i - 1)
+ my_i -= 1
+ end
+
+ return ns_i
+ end
+
+ # Returns the beginning position of the char at position `pos`
+ #
+ # If the char is invalid UTF-8, `pos` is returned as-is
+ #
+ # ~~~raw
+ # assert "abc".items.find_beginning_of_char_at(2) == 2
+ # assert "か".items.find_beginning_of_char_at(1) == 0
+ # assert [0x41u8, 233u8].to_s.items.find_beginning_of_char_at(1) == 1
+ # ~~~
+ fun find_beginning_of_char_at(pos: Int): Int do
+ var endpos = pos
+ var c = self[pos]
+ while c & 0xC0u8 == 0x80u8 do
+ pos -= 1
+ c = self[pos]
+ end
+ var stpos = pos
+ if length_of_char_at(stpos) >= (endpos - stpos + 1) then return pos
+ return endpos
+ end
end
redef var chars is lazy do return new RopeChars(self)
+ redef var bytes is lazy do return new RopeBytes(self)
+
redef var length is noinit
+ redef var bytelen is noinit
+
redef fun substrings do return new RopeSubstrings(self)
redef fun empty do return ""
+ # Cache for the latest accessed FlatString in `self`
+ var flat_cache: String = ""
+
+ # Position of the beginning of `flat_cache` in `self`
+ var flat_last_pos_start: Int = -1
+
redef var to_cstring is lazy do
- var len = length
+ var len = bytelen
var ns = new NativeString(len + 1)
- ns[len] = '\0'
+ ns[len] = 0u8
var off = 0
for i in substrings do
- var ilen = i.length
- i.as(FlatString).items.copy_to(ns, ilen, i.as(FlatString).index_from, off)
+ var ilen = i.bytelen
+ i.as(FlatString).items.copy_to(ns, ilen, i.as(FlatString).first_byte, off)
off += ilen
end
return ns
init do
length = left.length + right.length
+ bytelen = left.bytelen + right.bytelen
end
redef fun output do
right.output
end
- redef fun iterator do return new RopeIter(self)
+ redef fun iterator do return new RopeCharIterator(self)
redef fun *(i) do
var x: String = self
end
redef fun [](i) do
- var llen = left.length
- if i >= llen then return right[i - llen]
- return left[i]
+ if flat_last_pos_start != -1 then
+ var fsp = i - flat_last_pos_start
+ if fsp >= 0 and fsp < flat_cache.length then return flat_cache[fsp]
+ end
+ var s: String = self
+ var st = i
+ loop
+ if s isa FlatString then break
+ s = s.as(Concat)
+ var lft = s.left
+ var llen = lft.length
+ if i >= llen then
+ s = s.right
+ i -= llen
+ else
+ s = s.left
+ end
+ end
+ flat_last_pos_start = st - i
+ flat_cache = s
+ return s[i]
end
redef fun substring(from, len) do
redef fun +(o) do
var s = o.to_s
- var slen = s.length
+ var slen = s.bytelen
if s isa Concat then
return new Concat(self, s)
else
var r = right
- var rlen = r.length
+ var rlen = r.bytelen
if rlen + slen > maxlen then return new Concat(self, s)
return new Concat(left, r + s)
end
st = 0
end
end
+
+ # Returns a balanced version of `self`
+ fun balance: String do
+ var children = new Array[String]
+ var rnod: String
+ var iter: nullable RopeCharIteratorPiece = new RopeCharIteratorPiece(self, false, false, null)
+ loop
+ if iter == null then break
+ rnod = iter.node
+ if not rnod isa Concat then
+ children.push rnod
+ iter = iter.prev
+ continue
+ end
+ if not iter.ldone then
+ iter.ldone = true
+ iter = new RopeCharIteratorPiece(rnod.left, false, false, iter)
+ else if not iter.rdone then
+ iter.rdone = true
+ iter = new RopeCharIteratorPiece(rnod.right, false, false, iter)
+ else
+ iter = iter.prev
+ end
+
+ end
+ return recurse_balance(children, children.length)
+ end
+
+ fun recurse_balance(nodes: Array[String], len: Int): String do
+ var finpos = 0
+ var stpos = 0
+ while stpos < len do
+ if len - stpos > 1 then
+ nodes[finpos] = new Concat(nodes[stpos], nodes[stpos + 1])
+ stpos += 2
+ else
+ nodes[finpos] = nodes[stpos]
+ stpos += 1
+ end
+ finpos += 1
+ end
+ if finpos == 1 then return nodes[0]
+ return recurse_balance(nodes, finpos)
+ end
end
# Mutable `Rope`, optimized for concatenation operations
redef var chars: Sequence[Char] is lazy do return new RopeBufferChars(self)
+ redef var bytes: Sequence[Byte] is lazy do return new RopeBufferBytes(self)
+
# The final string being built on the fly
- private var str: String is noinit
+ private var str: String = ""
# Current concatenation buffer
private var ns: NativeString is noinit
# a long string (length > maxlen) is appended.
private var dumped: Int is noinit
- # Length of the complete rope
- redef var length = 0
+ # Length of the complete rope in chars (0)
+ redef fun length do
+ var st = dumped
+ var len = str.length
+ while st < rpos do
+ st += ns[st].u8len
+ len += 1
+ end
+ return len
+ end
- # Length of the mutable part
+ # Length of the complete rope in bytes
+ redef var bytelen = 0
+
+ # Length of the mutable part (in bytes)
#
# Is also used as base to compute the size of the next
# mutable native string (`ns`)
# Builds an empty `RopeBuffer`
init do
- str = ""
ns = new NativeString(maxlen)
buf_size = maxlen
dumped = 0
self.str = str
ns = new NativeString(maxlen)
buf_size = maxlen
- length = str.length
+ bytelen = str.length
dumped = 0
end
written = false
end
+ redef fun [](i) do
+ if i < str.length then
+ return str[i]
+ else
+ var index = ns.char_to_byte_index_cached(i - str.length, 0, dumped)
+ return ns.char_at(index)
+ end
+ end
+
+ redef fun []=(i, c) do
+ assert i >= 0 and i <= length
+ if i == length then add c
+ if i < str.length then
+ bytelen += c.u8char_len - str[i].u8char_len
+ var s = str
+ var l = s.substring(0, i)
+ var r = s.substring_from(i + 1)
+ str = l + c.to_s + r
+ else
+ var reali = i - str.length
+ var index = ns.char_to_byte_index_cached(reali, 0, dumped)
+ var st_nxt = ns.char_to_byte_index_cached(reali + 1, reali, index)
+ var loc_c = ns.char_at(index)
+ if loc_c.u8char_len != c.u8char_len then
+ var delta = c.u8char_len - loc_c.u8char_len
+ var remsp = buf_size - rpos
+ if remsp < delta then
+ buf_size *= 2
+ var nns = new NativeString(buf_size)
+ ns.copy_to(nns, index - dumped, dumped, 0)
+ ns.copy_to(nns, rpos - index - loc_c.u8char_len, index + loc_c.u8char_len, index - dumped + delta)
+ ns = nns
+ index = index - dumped
+ else
+ ns.copy_to(ns, rpos - st_nxt, st_nxt, st_nxt + delta)
+ end
+ bytelen += delta
+ rpos += delta
+ end
+ ns.set_char_at(index, c)
+ end
+ end
+
redef fun empty do return new RopeBuffer
redef fun clear do
str = ""
- length = 0
+ bytelen = 0
rpos = 0
dumped = 0
if written then
end
redef fun append(s) do
- var slen = s.length
- length += slen
- var rp = rpos
- if s isa Rope or slen > maxlen then
- if rp > 0 and dumped != rp then
- str += new FlatString.with_infos(ns, rp - dumped, dumped, rp - 1)
- dumped = rp
- end
- str = str + s
+ var slen = s.bytelen
+ if slen >= maxlen then
+ persist_buffer
+ str += s.to_s
return
end
- var remsp = buf_size - rp
- var sits: NativeString
- var begin: Int
- if s isa FlatString then
- begin = s.index_from
- sits = s.items
- else if s isa FlatBuffer then
- begin = 0
- sits = s.items
- else
+ if s isa FlatText then
+ var oits = s.items
+ var from = if s isa FlatString then s.first_byte else 0
+ var remsp = buf_size - rpos
if slen <= remsp then
- for i in s.chars do
- ns[rpos] = i
- rpos += 1
- end
- else
- var spos = 0
- for i in [0..remsp[ do
- ns[rpos] = s[spos]
- rpos += 1
- spos += 1
- end
- dump_buffer
- while spos < slen do
- ns[rpos] = s[spos]
- spos += 1
- rpos += 1
- end
- end
- return
- end
- if slen <= remsp then
- if remsp <= 0 then
- dump_buffer
- rpos = 0
- else
- sits.copy_to(ns, slen, begin, rp)
+ oits.copy_to(ns, slen, from, rpos)
rpos += slen
+ return
end
- else
- sits.copy_to(ns, remsp, begin, rp)
- rpos = buf_size
+ var brk = oits.find_beginning_of_char_at(from + remsp)
+ oits.copy_to(ns, brk, from, rpos)
+ rpos += brk
dump_buffer
- var nlen = slen - remsp
- sits.copy_to(ns, nlen, begin + remsp, 0)
- rpos = nlen
+ oits.copy_to(ns, slen - remsp, brk, 0)
+ rpos = slen - remsp
+ else
+ for i in s.substrings do append i
end
end
dump_buffer
rp = 0
end
- ns[rp] = c
+ # TODO: Fix when supporting UTF-8
+ ns[rp] = c.ascii.to_b
+ rp += 1
+ bytelen += 1
+ rpos = rp
+ end
+
+ private fun add_byte(b: Byte) do
+ var rp = rpos
+ if rp >= buf_size then
+ dump_buffer
+ rp = 0
+ end
+ ns[rp] = b
rp += 1
- length += 1
+ bytelen += 1
rpos = rp
end
ns = new NativeString(bs)
buf_size = bs
dumped = 0
+ rpos = 0
+ end
+
+ # Similar to dump_buffer, but does not reallocate a new NativeString
+ private fun persist_buffer do
+ if rpos == dumped then return
+ var nstr = new FlatString.with_infos(ns, rpos - dumped, dumped, rpos - 1)
+ str += nstr
+ dumped = rpos
end
redef fun output do
redef fun enlarge(i) do end
redef fun to_s do
+ persist_buffer
written = true
- var nnslen = rpos - dumped
- if nnslen == 0 then return str
- return str + new FlatString.with_infos(ns, rpos - dumped, dumped, rpos - 1)
+ return str
end
redef fun reverse do
redef fun upper do
if written then reset
+ persist_buffer
str = str.to_upper
- var mits = ns
- for i in [0 .. rpos[ do
- mits[i] = mits[i].to_upper
- end
end
redef fun lower do
if written then reset
+ persist_buffer
str = str.to_lower
- var mits = ns
- for i in [0 .. rpos[ do
- mits[i] = mits[i].to_lower
- end
end
end
redef fun +(o) do
var s = o.to_s
- var slen = s.length
- var mlen = length
+ var slen = s.bytelen
+ var mlen = bytelen
if slen == 0 then return self
if mlen == 0 then return s
var nlen = slen + mlen
if s isa FlatString then
if nlen > maxlen then return new Concat(self, s)
var mits = items
- var sifrom = s.index_from
- var mifrom = index_from
+ var sifrom = s.first_byte
+ var mifrom = first_byte
var sits = s.items
var ns = new NativeString(nlen + 1)
mits.copy_to(ns, mlen, mifrom, 0)
return ns.to_s_with_length(nlen)
else if s isa Concat then
var sl = s.left
- var sllen = sl.length
+ var sllen = sl.bytelen
if sllen + mlen > maxlen then return new Concat(self, s)
return new Concat(self + sl, s.right)
else
end
# A simple linked list for use with iterators
-private class RopeIterPiece
+private class RopeCharIteratorPiece
# The encapsulated node of the `Rope`
var node: String
# Was its left child (if any) visited ?
# Was its right child (if any) visited ?
var rdone: Bool
# The previous node in the list.
- var prev: nullable RopeIterPiece
+ var prev: nullable RopeCharIteratorPiece
+end
+
+# A reverse iterator capable of working with `Rope` objects
+private class RopeByteReverseIterator
+ super IndexedIterator[Byte]
+
+ # Current NativeString
+ var ns: NativeString
+ # Current position in NativeString
+ var pns: Int
+ # Position in the Rope (0-indexed)
+ var pos: Int
+ # Iterator on the substrings, does the Postfix part of
+ # the Rope traversal.
+ var subs: IndexedIterator[FlatString]
+
+ init(root: Concat) is old_style_init do
+ pos = root.bytelen - 1
+ subs = new ReverseRopeSubstrings(root)
+ var s = subs.item
+ ns = s.items
+ pns = s.last_byte
+ end
+
+ init from(root: Concat, pos: Int) do
+ self.pos = pos
+ subs = new ReverseRopeSubstrings.from(root, pos)
+ var s = subs.item
+ ns = s.items
+ pns = pos - subs.index
+ end
+
+ redef fun index do return pos
+
+ redef fun is_ok do return pos >= 0
+
+ redef fun item do return ns[pns]
+
+ redef fun next do
+ pns -= 1
+ pos -= 1
+ if pns >= 0 then return
+ if not subs.is_ok then return
+ subs.next
+ if not subs.is_ok then return
+ var s = subs.item
+ ns = s.items
+ pns = s.last_byte
+ end
+end
+
+# Forward iterator on the bytes of a `Rope`
+private class RopeByteIterator
+ super IndexedIterator[Byte]
+
+ # Position in current `String`
+ var pns: Int
+ # Current `String` being iterated on
+ var ns: NativeString
+ # Substrings of the Rope
+ var subs: IndexedIterator[FlatString]
+ # Maximum position to iterate on (e.g. Rope.length)
+ var max: Int
+ # Position (char) in the Rope (0-indexed)
+ var pos: Int
+
+ init(root: Concat) is old_style_init do
+ subs = new RopeSubstrings(root)
+ pns = 0
+ ns = subs.item.items
+ max = root.length - 1
+ pos = 0
+ end
+
+ init from(root: Concat, pos: Int) do
+ subs = new RopeSubstrings.from(root, pos)
+ pns = pos - subs.index
+ self.pos = pos
+ ns = subs.item.items
+ max = root.length - 1
+ end
+
+ redef fun item do return ns[pns]
+
+ redef fun is_ok do return pos <= max
+
+ redef fun index do return pos
+
+ redef fun next do
+ pns += 1
+ pos += 1
+ if pns < subs.item.bytelen then return
+ if not subs.is_ok then return
+ subs.next
+ if not subs.is_ok then return
+ ns = subs.item.items
+ pns = 0
+ end
end
+
# A reverse iterator capable of working with `Rope` objects
-private class RopeReviter
+private class RopeCharReverseIterator
super IndexedIterator[Char]
# Current NativeString
end
# Forward iterator on the chars of a `Rope`
-private class RopeIter
+private class RopeCharIterator
super IndexedIterator[Char]
# Position in current `String`
# Substrings of a Rope (i.e. Reverse postfix iterator on leaves)
private class ReverseRopeSubstrings
- super IndexedIterator[String]
+ super IndexedIterator[FlatString]
# Visit Stack
- var iter: RopeIterPiece is noinit
+ var iter: RopeCharIteratorPiece is noinit
# Position in `Rope`
var pos: Int is noinit
# Current leaf
- var str: String is noinit
+ var str: FlatString is noinit
init(root: Concat) is old_style_init do
- var r = new RopeIterPiece(root, false, true, null)
+ var r = new RopeCharIteratorPiece(root, false, true, null)
pos = root.length - 1
var lnod: String = root
loop
if lnod isa Concat then
lnod = lnod.right
- r = new RopeIterPiece(lnod, false, true, r)
+ r = new RopeCharIteratorPiece(lnod, false, true, r)
else
- str = lnod
+ str = lnod.as(FlatString)
iter = r
break
end
end
init from(root: Concat, pos: Int) do
- var r = new RopeIterPiece(root, false, true, null)
+ var r = new RopeCharIteratorPiece(root, false, true, null)
var rnod: String = root
var off = pos
loop
if off >= rnod.left.length then
off -= rnod.left.length
rnod = rnod.right
- r = new RopeIterPiece(rnod, false, true, r)
+ r = new RopeCharIteratorPiece(rnod, false, true, r)
else
r.ldone = true
rnod = rnod.left
- r = new RopeIterPiece(rnod, false, true, r)
+ r = new RopeCharIteratorPiece(rnod, false, true, r)
end
else
- str = rnod
+ str = rnod.as(FlatString)
r.ldone = true
iter = r
self.pos = pos - off
while curr != null do
currit = curr.node
if not currit isa Concat then
- str = currit
+ str = currit.as(FlatString)
pos -= str.length
iter = curr
return
end
if not curr.rdone then
curr.rdone = true
- curr = new RopeIterPiece(currit.right, false, false, curr)
+ curr = new RopeCharIteratorPiece(currit.right, false, false, curr)
continue
end
if not curr.ldone then
curr.ldone = true
- curr = new RopeIterPiece(currit.left, false, false, curr)
+ curr = new RopeCharIteratorPiece(currit.left, false, false, curr)
continue
end
curr = curr.prev
super IndexedIterator[FlatString]
# Visit Stack
- var iter: RopeIterPiece is noinit
+ var iter: RopeCharIteratorPiece is noinit
# Position in `Rope`
var pos: Int is noinit
# Maximum position in `Rope` (i.e. length - 1)
var str: FlatString is noinit
init(root: Concat) is old_style_init do
- var r = new RopeIterPiece(root, true, false, null)
+ var r = new RopeCharIteratorPiece(root, true, false, null)
pos = 0
max = root.length - 1
var rnod: String = root
loop
if rnod isa Concat then
rnod = rnod.left
- r = new RopeIterPiece(rnod, true, false, r)
+ r = new RopeCharIteratorPiece(rnod, true, false, r)
else
str = rnod.as(FlatString)
r.rdone = true
end
init from(root: Concat, pos: Int) do
- var r = new RopeIterPiece(root, true, false, null)
+ var r = new RopeCharIteratorPiece(root, true, false, null)
max = root.length - 1
var rnod: String = root
var off = pos
r.rdone = true
off -= rnod.left.length
rnod = rnod.right
- r = new RopeIterPiece(rnod, true, false, r)
+ r = new RopeCharIteratorPiece(rnod, true, false, r)
else
rnod = rnod.left
- r = new RopeIterPiece(rnod, true, false, r)
+ r = new RopeCharIteratorPiece(rnod, true, false, r)
end
else
str = rnod.as(FlatString)
if not it.ldone then
rnod = rnod.left
it.ldone = true
- it = new RopeIterPiece(rnod, false, false, it)
+ it = new RopeCharIteratorPiece(rnod, false, false, it)
else if not it.rdone then
it.rdone = true
rnod = rnod.right
- it = new RopeIterPiece(rnod, false, false, it)
+ it = new RopeCharIteratorPiece(rnod, false, false, it)
else
it = it.prev
rnod = it.node
return target[i]
end
- redef fun iterator_from(i) do return new RopeIter.from(target, i)
+ redef fun iterator_from(i) do return new RopeCharIterator.from(target, i)
+
+ redef fun reverse_iterator_from(i) do return new RopeCharReverseIterator.from(target, i)
+
+end
+
+# Implementation of a `StringCharView` for `Concat` objects
+private class RopeBytes
+ super StringByteView
+
+ redef type SELFTYPE: Concat
+
+ redef fun [](i) do
+ var nod: String = target
+ loop
+ if nod isa FlatString then return nod.items[i]
+ if not nod isa Concat then abort
+ if nod.left.bytelen >= i then
+ nod = nod.right
+ else
+ nod = nod.left
+ end
+ end
+ end
+
+ redef fun iterator_from(i) do return new RopeByteIterator.from(target, i)
- redef fun reverse_iterator_from(i) do return new RopeReviter.from(target, i)
+ redef fun reverse_iterator_from(i) do return new RopeByteReverseIterator.from(target, i)
end
# An Iterator over a RopeBuffer.
-class RopeBufferIter
+class RopeBufferCharIterator
+ super IndexedIterator[Char]
+
+ # Subiterator.
+ var sit: IndexedIterator[Char]
+
+ redef fun index do return sit.index
+
+ # Init the iterator from a RopeBuffer.
+ init(t: RopeBuffer) is old_style_init do
+ t.persist_buffer
+ sit = t.str.chars.iterator
+ end
+
+ # Init the iterator from a RopeBuffer starting from `pos`.
+ init from(t: RopeBuffer, pos: Int) do
+ t.persist_buffer
+ sit = t.str.chars.iterator_from(pos)
+ end
+
+ redef fun is_ok do return sit.is_ok
+
+ redef fun item do
+ assert is_ok
+ return sit.item
+ end
+
+ redef fun next do sit.next
+end
+
+# Reverse iterator over a RopeBuffer.
+class RopeBufferCharReverseIterator
super IndexedIterator[Char]
# Subiterator.
var sit: IndexedIterator[Char]
+ redef fun index do return sit.index
+
+ # Init the iterator from a RopeBuffer.
+ init(tgt: RopeBuffer) is old_style_init do
+ tgt.persist_buffer
+ sit = tgt.str.chars.reverse_iterator
+ end
+
+ # Init the iterator from a RopeBuffer starting from `pos`.
+ init from(tgt: RopeBuffer, pos: Int) do
+ tgt.persist_buffer
+ sit = tgt.str.chars.reverse_iterator_from(pos)
+ end
+
+ redef fun is_ok do return sit.is_ok
+
+ redef fun item do
+ assert is_ok
+ return sit.item
+ end
+
+ redef fun next do sit.next
+end
+
+# View on the chars of a `RopeBuffer`
+class RopeBufferChars
+ super BufferCharView
+
+ redef type SELFTYPE: RopeBuffer
+
+ redef fun [](i) do return target[i]
+
+ redef fun []=(i,c) do target[i] = c
+
+ redef fun add(c) do target.add c
+
+ redef fun push(c) do target.add c
+
+ redef fun iterator_from(i) do return new RopeBufferCharIterator.from(target, i)
+
+ redef fun reverse_iterator_from(i) do return new RopeBufferCharReverseIterator.from(target, i)
+end
+
+# An Iterator over a RopeBuffer.
+class RopeBufferByteIterator
+ super IndexedIterator[Byte]
+
+ # Subiterator.
+ var sit: IndexedIterator[Byte]
+
# Native string iterated over.
var ns: NativeString
# Init the iterator from a RopeBuffer.
init(t: RopeBuffer) is old_style_init do
ns = t.ns
- maxpos = t.rpos
- sit = t.str.chars.iterator
+ maxpos = t.bytelen
+ sit = t.str.bytes.iterator
pns = t.dumped
index = 0
end
# Init the iterator from a RopeBuffer starting from `pos`.
init from(t: RopeBuffer, pos: Int) do
ns = t.ns
- maxpos = t.length
- sit = t.str.chars.iterator_from(pos)
+ maxpos = t.bytelen
+ sit = t.str.bytes.iterator_from(pos)
pns = pos - t.str.length
index = pos
end
end
# Reverse iterator over a RopeBuffer.
-class RopeBufferReviter
- super IndexedIterator[Char]
+class RopeBufferByteReverseIterator
+ super IndexedIterator[Byte]
# Subiterator.
- var sit: IndexedIterator[Char]
+ var sit: IndexedIterator[Byte]
# Native string iterated over.
var ns: NativeString
# Init the iterator from a RopeBuffer.
init(tgt: RopeBuffer) is old_style_init do
- sit = tgt.str.chars.reverse_iterator
+ sit = tgt.str.bytes.reverse_iterator
pns = tgt.rpos - 1
- index = tgt.length - 1
+ index = tgt.bytelen - 1
ns = tgt.ns
end
# Init the iterator from a RopeBuffer starting from `pos`.
init from(tgt: RopeBuffer, pos: Int) do
- sit = tgt.str.chars.reverse_iterator_from(pos - tgt.rpos - tgt.dumped)
- pns = pos - tgt.str.length
+ sit = tgt.str.bytes.reverse_iterator_from(pos - (tgt.rpos - tgt.dumped))
+ pns = pos - tgt.str.bytelen + tgt.rpos
index = pos
ns = tgt.ns
end
- redef fun is_ok do return index > 0
+ redef fun is_ok do return index >= 0
redef fun item do
if pns >= 0 then return ns[pns]
redef fun next do
index -= 1
- if pns >= 0 then
+ if pns > 0 then
pns -= 1
else
sit.next
end
# View on the chars of a `RopeBuffer`
-class RopeBufferChars
- super BufferCharView
+class RopeBufferBytes
+ super BufferByteView
redef type SELFTYPE: RopeBuffer
redef fun [](i) do
- if i < target.str.length then
- return target.str[i]
+ if i < target.str.bytelen then
+ return target.str.bytes[i]
else
- return target.ns[i - target.str.length]
+ return target.ns[i - target.str.bytelen]
end
end
redef fun []=(i,c) do
- if i == target.length then target.add c
+ if i == target.length then target.add_byte c
if i < target.str.length then
+ # FIXME: Will need to be optimized and rewritten with Unicode
var s = target.str
var l = s.substring(0, i)
var r = s.substring_from(i + 1)
- target.str = l + c.to_s + r
+ target.str = l + c.to_i.ascii.to_s + r
else
target.ns[i - target.str.length] = c
end
end
- redef fun add(c) do target.add c
+ redef fun add(c) do target.add_byte c
- redef fun push(c) do target.add c
+ redef fun push(c) do target.add_byte c
- redef fun iterator_from(i) do return new RopeBufferIter.from(target, i)
+ redef fun iterator_from(i) do return new RopeBufferByteIterator.from(target, i)
- redef fun reverse_iterator_from(i) do return new RopeBufferReviter.from(target, i)
+ redef fun reverse_iterator_from(i) do return new RopeBufferByteReverseIterator.from(target, i)
end
var ans_buffer = new Bytes.with_capacity(msg.length)
# Flag for final frame set to 1
# opcode set to 1 (for text)
- ans_buffer.add(129)
+ ans_buffer.add(129u8)
if msg.length < 126 then
- ans_buffer.add(msg.length)
+ ans_buffer.add(msg.length.to_b)
end
if msg.length >= 126 and msg.length <= 65535 then
- ans_buffer.add(126)
- ans_buffer.add(msg.length.rshift(8))
- ans_buffer.add(msg.length)
+ ans_buffer.add(126u8)
+ ans_buffer.add((msg.length >> 8).to_b)
+ ans_buffer.add(msg.length.to_b)
end
if msg isa FlatString then
- ans_buffer.append_ns_from(msg.items, msg.length, msg.index_from)
+ ans_buffer.append_ns_from(msg.items, msg.length, msg.first_byte)
else
for i in msg.substrings do
- ans_buffer.append_ns_from(i.as(FlatString).items, i.length, i.as(FlatString).index_from)
+ ans_buffer.append_ns_from(i.as(FlatString).items, i.length, i.as(FlatString).first_byte)
end
end
return ans_buffer
# Reads an HTTP frame
protected fun read_http_frame(buf: Buffer): String
do
- buf.append client.read_line
- buf.append("\r\n")
+ var ln = client.read_line
+ buf.append ln
+ buf.append "\r\n"
if buf.has_suffix("\r\n\r\n") then return buf.to_s
return read_http_frame(buf)
end
# %x9 denotes a ping
# %xA denotes a pong
# %xB-F are reserved for further control frames
- var fin_flag = fst_byte.bin_and(128)
+ var fin_flag = fst_byte & 0b1000_0000u8
if fin_flag != 0 then fin = true
- var opcode = fst_byte.bin_and(15)
+ var opcode = fst_byte & 0b0000_1111u8
if opcode == 9 then
- bf.add(138)
- bf.add(0)
+ bf.add(138u8)
+ bf.add(0u8)
client.write(bf.to_s)
_buffer_pos = _buffer_length
return
# |(mask - 1bit)|(payload length - 7 bits)
# As specified, if the payload length is 126 or 127
# The next 16 or 64 bits contain an extended payload length
- var mask_flag = snd_byte.bin_and(128)
- var len = snd_byte.bin_and(127)
+ var mask_flag = snd_byte & 0b1000_0000u8
+ var len = (snd_byte & 0b0111_1111u8).to_i
var payload_ext_len = 0
if len == 126 then
var tmp = client.read_bytes(2)
client.close
return
end
- payload_ext_len = tmp[1] + tmp[0].lshift(8)
+ payload_ext_len += tmp[0].to_i << 8
+ payload_ext_len += tmp[1].to_i
else if len == 127 then
- # 64 bits for length are not supported,
- # only the last 32 will be interpreted as a Nit Integer
var tmp = client.read_bytes(8)
if tmp.length != 8 then
last_error = new IOError("Error: received interrupted frame")
client.close
return
end
- for pos in [0 .. tmp.length[ do
- var i = tmp[pos]
- payload_ext_len += i.lshift(8 * (7 - pos))
+ for i in [0 .. 8[ do
+ payload_ext_len += tmp[i].to_i << (8 * (7 - i))
end
end
if mask_flag != 0 then
var return_message = new NativeString(len)
for i in [0 .. len[ do
- return_message[i] = message[i].ascii.bin_xor(key[i%4].ascii).ascii
+ return_message[i] = message[i] ^ key[i % 4]
end
return return_message
syn match NITExprSubstLong "\\." contained
syn match NITExprSubstLong "{*\zs{{{\([^}]\|\n\)*}}}\ze}*" contained
-" Numbers and ASCII Codes
-syn match NITNumber "\<\(\d\+\.\d\+\|\d\+\)\>"
+" Numbers
+syn match NITNumber "\<\([0-9_]\+\|0[bB][01_]\+\|0[oO][0-7_]\+\|0[xX][0-9a-fA-F_]\+\)\([iu]\(8\|16\|32\)\)\?\>"
+syn match NITNumber "\<[0-9_]\+\.[0-9_]\+\>"
" Identifiers
syn match NITClass "\<\u\w*"
Currently, this only affect the android platform.
+`-g`, `--debug`
+: Compile in debug mode.
+
+ Currently removes gcc optimizations.
+ Also preserves the source-files directory for C-debuggers.
+
+ For more debugging-related options, see also `--hardening` and `NIT_GC_OPTION`
+
## COMPILATION MODES
`nitc` includes distinct compilation modes.
# limitations under the License.
NITCOPT=--semi-global
-OLDNITCOPT=
+OLDNITCOPT=--semi-global
OBJS=nitc nitpick nit nitdoc nitls nitunit nitpretty nitmetrics nitx nitlight nitdbg_client nitserial
SRCS=$(patsubst %,%.nit,$(OBJS))
BINS=$(patsubst %,../bin/%,$(OBJS))
-all: $(BINS)
+all: bin/nitc
nitc_0: ../c_src/nitc parser/parser.nit
@echo '***************************************************************'
./git-gen-version.sh
../c_src/nitc ${OLDNITCOPT} -o nitc_0 -v nitc.nit
-$(BINS): nitc_0 parser/parser.nit
+bin/nitc: nitc_0 parser/parser.nit
@echo '***************************************************************'
@echo '* Compile binaries from NIT source files *'
@echo '***************************************************************'
./git-gen-version.sh
test -d ../bin || mkdir ../bin
./nitc_0 ${NITCOPT} -v --dir ../bin $(SRCS)
- rm -r .nit_compile || true # to clean old .nit_compile generated file
$(OBJS): nitc_0 parser/parser.nit
./git-gen-version.sh
var anchor: nullable MClassType
# Make a new Int literal
- fun make_int(value: Int): AIntExpr
+ fun make_int(value: Int): AIntegerExpr
do
- return new ADecIntExpr.make(value, mmodule.int_type)
+ return new AIntegerExpr.make(value, mmodule.int_type)
end
# Make a new instatiation
end
end
-redef class ADecIntExpr
+redef class AIntegerExpr
private init make(value: Int, t: MType)
do
self.value = value
- self._n_number = new TNumber # dummy
+ self._n_integer = new TInteger # dummy
self.mtype = t
end
end
end
end
-redef class AIntExpr
- redef fun accept_printer(v)
- do
- v.write(value.to_s)
- end
-end
-
-redef class AByteExpr
+redef class AIntegerExpr
redef fun accept_printer(v)
do
v.write(value.to_s)
end
redef fun makefile_rule_content do
- var ff = filename.basename("")
+ var ff = filename.basename
var o = makefile_rule_name
var pkg = ""
if not pkgconfigs.is_empty then
var opt_no_gcc_directive = new OptionArray("Disable a advanced gcc directives for optimization", "--no-gcc-directive")
# --release
var opt_release = new OptionBool("Compile in release mode and finalize application", "--release")
+ # -g
+ var opt_debug = new OptionBool("Compile in debug mode (no C-side optimization)", "--debug", "-g")
redef init
do
self.option_context.add_option(self.opt_no_gcc_directive)
self.option_context.add_option(self.opt_release)
self.option_context.add_option(self.opt_max_c_lines, self.opt_group_c_files)
+ self.option_context.add_option(self.opt_debug)
opt_no_main.hidden = true
end
redef fun write_and_make
do
+ var debug = toolcontext.opt_debug.value
var compile_dir = compile_dir
# Remove the compilation directory unless explicitly set
var auto_remove = toolcontext.opt_compile_dir.value == null
+ # If debug flag is set, do not remove sources
+ if debug then auto_remove = false
# Generate the .h and .c files
# A single C file regroups many compiled rumtime functions
# Copy original .[ch] files to compile_dir
for src in compiler.files_to_copy do
- var basename = src.basename("")
+ var basename = src.basename
var dst = "{compile_dir}/{basename}"
src.file_copy_to dst
end
var libs = m.collect_linker_libs
if libs != null then linker_options.add_all(libs)
end
+ var debug = toolcontext.opt_debug.value
- makefile.write("CC = ccache cc\nCXX = ccache c++\nCFLAGS = -g -O2 -Wno-unused-value -Wno-switch -Wno-attributes\nCINCL =\nLDFLAGS ?= \nLDLIBS ?= -lm {linker_options.join(" ")}\n\n")
+ makefile.write("CC = ccache cc\nCXX = ccache c++\nCFLAGS = -g{ if not debug then " -O2 " else " "}-Wno-unused-value -Wno-switch -Wno-attributes\nCINCL =\nLDFLAGS ?= \nLDLIBS ?= -lm {linker_options.join(" ")}\n\n")
makefile.write "\n# SPECIAL CONFIGURATION FLAGS\n"
if platform.supports_libunwind then
makefile.write("CFLAGS += -D NO_STACKTRACE\n\n")
end
+ makefile.write """
+# Special configuration for Darwin
+ifeq ($(uname_S),Darwin)
+ # Remove POSIX flag -lrt
+ LDLIBS := $(filter-out -lrt,$(LDLIBS))
+endif
+
+"""
+
makefile.write("all: {outpath}\n")
if outpath != real_outpath then
makefile.write("\tcp -- {outpath.escape_to_sh} {real_outpath.escape_to_sh.replace("$","$$")}")
# Compile each required extern body into a specific .o
for f in compiler.extern_bodies do
var o = f.makefile_rule_name
- var ff = f.filename.basename("")
+ var ff = f.filename.basename
makefile.write("{o}: {ff}\n")
makefile.write("\t{f.makefile_rule_content}\n\n")
dep_rules.add(f.makefile_rule_name)
v.add("signal(SIGINT, sig_handler);")
v.add("signal(SIGTERM, sig_handler);")
v.add("signal(SIGSEGV, sig_handler);")
- v.add("signal(SIGPIPE, sig_handler);")
+ v.add("signal(SIGPIPE, SIG_IGN);")
v.add("glob_argc = argc; glob_argv = argv;")
v.add("initialize_gc_option();")
fun char_instance(value: Char): RuntimeVariable
do
var t = mmodule.char_type
- var res = new RuntimeVariable("'{value.to_s.escape_to_c}'", t, t)
- return res
+
+ if value.ascii < 128 then
+ return new RuntimeVariable("'{value.to_s.escape_to_c}'", t, t)
+ else
+ return new RuntimeVariable("{value.ascii}", t, t)
+ end
end
# Generate a float value
var native_mtype = mmodule.native_string_type
var nat = self.new_var(native_mtype)
self.add("{nat} = \"{string.escape_to_c}\";")
- var length = self.int_instance(string.length)
+ var length = self.int_instance(string.bytelen)
self.add("{res} = {self.send(self.get_property("to_s_with_length", native_mtype), [nat, length]).as(not null)};")
self.add("{name} = {res};")
self.add("\}")
file = file.strip_extension(".nit")
var tryfile = file + ".nit.h"
if tryfile.file_exists then
- self.declare_once("#include \"{tryfile.basename("")}\"")
+ self.declare_once("#include \"{tryfile.basename}\"")
self.compiler.files_to_copy.add(tryfile)
end
tryfile = file + "_nit.h"
if tryfile.file_exists then
- self.declare_once("#include \"{tryfile.basename("")}\"")
+ self.declare_once("#include \"{tryfile.basename}\"")
self.compiler.files_to_copy.add(tryfile)
end
tryfile = file + "_nit.c"
if not tryfile.file_exists then return
end
- var f = new ExternCFile(tryfile.basename(""), "")
+ var f = new ExternCFile(tryfile.basename, "")
self.compiler.extern_bodies.add(f)
self.compiler.files_to_copy.add(tryfile)
end
return true
end
else if cname == "Char" then
- if pname == "output" then
- v.add("printf(\"%c\", ((unsigned char){arguments.first}));")
- return true
- else if pname == "object_id" then
+ if pname == "object_id" then
v.ret(v.new_expr("(long){arguments.first}", ret.as(not null)))
return true
else if pname == "successor" then
end
else if cname == "NativeString" then
if pname == "[]" then
- v.ret(v.new_expr("(uint32_t)(unsigned char){arguments[0]}[{arguments[1]}]", ret.as(not null)))
+ v.ret(v.new_expr("(unsigned char)((int){arguments[0]}[{arguments[1]}])", ret.as(not null)))
return true
else if pname == "[]=" then
v.add("{arguments[0]}[{arguments[1]}]=(unsigned char){arguments[2]};")
end
end
-redef class AIntExpr
- redef fun expr(v) do return v.int_instance(self.value.as(not null))
-end
-
-redef class AByteExpr
- redef fun expr(v) do return v.byte_instance(self.value.as(not null))
+redef class AIntegerExpr
+ redef fun expr(v) do
+ if value isa Int then return v.int_instance(value.as(Int))
+ if value isa Byte then return v.byte_instance(value.as(Byte))
+ # Should never happen
+ abort
+ end
end
redef class AFloatExpr
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Compile Nit code to Java code
+#
+# 3 runtime structures are used to represent Nit instance in Java generated code:
+# * `RTClass` to represent a class, it's super-type table and its VFT
+# * `RTMethod` to reprensent a compiled method definition
+# * `RTVal` to reprensent a Nit instance, the null value or a native value
+#
+# More details are given in the documentation of these 3 classes.
+#
+# TODO Factorize with `abstract_compiler`
+module java_compiler
+
+import rapid_type_analysis
+import transform
+import frontend
+
+redef class ToolContext
+
+ # Where to output the generated binary
+ var opt_output = new OptionString("Output file", "-o", "--output")
+
+ # Where to output tmp files
+ var opt_compile_dir = new OptionString("Directory used to generate temporary files", "--compile-dir")
+
+ # Compile using ant instead of make (faster, but no error display)
+ var opt_ant = new OptionBool("Batch with ant (faster, but no error display)", "--ant")
+
+ redef init do
+ super
+ option_context.add_option(opt_output, opt_compile_dir, opt_ant)
+ end
+end
+
+redef class ModelBuilder
+
+ # Start the Java compiler
+ fun run_java_compiler(mainmodule: MModule, runtime_type_analysis: RapidTypeAnalysis) do
+ var time0 = get_time
+ toolcontext.info("*** GENERATING JAVA ***", 1)
+
+ var compiler = new JavaCompiler(mainmodule, self, runtime_type_analysis)
+ compiler.do_compilation
+
+ var time1 = get_time
+ toolcontext.info("*** END GENERATING JAVA: {time1-time0} ***", 2)
+ write_and_make(compiler)
+ end
+
+ # Write Java code and compile it into an executable jar
+ fun write_and_make(compiler: JavaCompiler) do
+ var time0 = get_time
+ toolcontext.info("*** WRITING JAVA ***", 1)
+
+ compiler.compile_dir.mkdir
+
+ var jfiles = write_java_files(compiler)
+
+ var time1 = get_time
+ toolcontext.info("*** END WRITING JAVA: {time1-time0} ***", 2)
+
+ time0 = time1
+ toolcontext.info("*** COMPILING JAVA ***", 1)
+
+ if toolcontext.opt_ant.value then
+ build_with_ant(compiler, jfiles)
+ else
+ build_with_make(compiler, jfiles)
+ end
+ write_shell_script(compiler)
+
+ time1 = get_time
+ toolcontext.info("*** END COMPILING JAVA: {time1-time0} ***", 2)
+ end
+
+ # Write files managed by `compiler` into concrete files
+ fun write_java_files(compiler: JavaCompiler): Array[String] do
+ var jfiles = new Array[String]
+ for f in compiler.files do
+ var filepath = "{compiler.compile_dir}/{f.filename}"
+ var file = cache_file(filepath)
+ for line in f.lines do file.write(line)
+ close_cache(filepath, file)
+ jfiles.add(f.filename)
+ end
+ return jfiles
+ end
+
+ # Cache a file as `{filepath}.tmp` and replace the original if different
+ private fun cache_file(filepath: String): FileWriter do
+ if toolcontext.opt_ant.value and filepath.file_exists then
+ return new FileWriter.open("{filepath}.tmp")
+ else
+ return new FileWriter.open(filepath)
+ end
+ end
+
+ # Close the writer and move tmp file to original if modified
+ private fun close_cache(filepath: String, file: FileWriter) do
+ file.close
+ if "{filepath}.tmp".file_exists then
+ sys.system("if ! diff {filepath}.tmp {filepath} > /dev/null; then mv {filepath}.tmp {filepath}; else rm {filepath}.tmp; fi")
+ end
+ end
+
+ # Compile Java generated files using `make`
+ fun build_with_make(compiler: JavaCompiler, jfiles: Array[String]) do
+ write_manifest(compiler)
+ write_makefile(compiler, jfiles)
+ var compile_dir = compiler.compile_dir
+ var outname = compiler.outname.to_path.filename
+ toolcontext.info("make -N -C {compile_dir} -f {outname}.mk", 2)
+ var res
+ if toolcontext.verbose_level >= 3 then
+ res = sys.system("make -B -C {compile_dir} -f {outname}.mk 2>&1")
+ else
+ res = sys.system("make -B -C {compile_dir} -f {outname}.mk 2>&1 > /dev/null")
+ end
+ if res != 0 then toolcontext.error(null, "make failed! Error code: {res}.")
+ end
+
+ # Compile Java sources using `ant`
+ fun build_with_ant(compiler: JavaCompiler, jfiles: Array[String]) do
+ compile_antfile(compiler, jfiles)
+ var outname = compiler.outname.to_path.filename
+ var antpath = "{compiler.compile_dir}/{outname}.xml"
+ self.toolcontext.info("ant jar -f {antpath}", 2)
+ var res
+ if self.toolcontext.verbose_level >= 3 then
+ res = sys.system("ant jar -f {antpath} 2>&1")
+ else
+ res = sys.system("ant jar -f {antpath} 2>&1 > /dev/null")
+ end
+ if res != 0 then
+ toolcontext.error(null, "ant compile failed! Error code: {res}.")
+ end
+ end
+
+ # Write the Makefile used to compile Java generated files into an executable jar
+ fun write_makefile(compiler: JavaCompiler, jfiles: Array[String]) do
+ # list class files from jfiles
+ var ofiles = new List[String]
+ for f in jfiles do ofiles.add(f.strip_extension(".java") + ".class")
+
+ var compile_dir = compiler.compile_dir
+ var outname = compiler.outname.to_path.filename
+ var outpath = (sys.getcwd / compiler.outname).simplify_path
+ var makename = "{compile_dir}/{outname}.mk"
+ var makefile = new FileWriter.open(makename)
+
+ makefile.write("JC = javac\n")
+ makefile.write("JAR = jar\n\n")
+
+ makefile.write("all: {outpath}.jar\n\n")
+
+ makefile.write("{outpath}.jar: {compiler.mainmodule.jname}_Main.class\n")
+ makefile.write("\t$(JAR) cfm {outpath}.jar {outname}.mf {ofiles.join(" ")}\n\n")
+
+ makefile.write("{compiler.mainmodule.jname}_Main.class:\n")
+ makefile.write("\t$(JC) {jfiles.join(" ")}\n\n")
+
+ makefile.write("clean:\n")
+ makefile.write("\trm {ofiles.join(" ")} 2>/dev/null\n\n")
+
+ makefile.close
+ toolcontext.info("Generated makefile: {makename}", 2)
+ end
+
+ # The Ant `build.xml` script used to compile build the final jar
+ fun compile_antfile(compiler: JavaCompiler, jfiles: Array[String]) do
+ var compile_dir = compiler.compile_dir
+ var outname = compiler.outname.to_path.filename
+ var outpath = (sys.getcwd / compiler.outname).simplify_path
+ var antname = "{compile_dir}/{outname}.xml"
+ var antfile = new FileWriter.open(antname)
+ var jname = compiler.mainmodule.jname
+ antfile.write("<project>")
+ antfile.write(" <target name=\"compile\">")
+ antfile.write(" <mkdir dir=\"classes\"/>")
+ antfile.write(" <javac includes=\"{compiler.mainmodule.jname}_Main.java {jfiles.join(" ")}\" srcdir=\".\" destdir=\"classes\"/>")
+ antfile.write(" </target>")
+ antfile.write(" <target name=\"jar\" depends=\"compile\">")
+ antfile.write(" <jar destfile=\"{outpath}.jar\" basedir=\"classes\">")
+ antfile.write(" <manifest>")
+ antfile.write(" <attribute name=\"Main-Class\" value=\"{jname}_Main\"/>")
+ antfile.write(" </manifest>")
+ antfile.write(" </jar>")
+ antfile.write(" </target>")
+ antfile.write("</project>")
+ antfile.close
+ toolcontext.info("Generated antfile: {antname}", 2)
+ end
+
+ # Write the Java manifest file
+ private fun write_manifest(compiler: JavaCompiler) do
+ var compile_dir = compiler.compile_dir
+ var outname = compiler.outname.to_path.filename
+ var maniffile = new FileWriter.open("{compile_dir}/{outname}.mf")
+ maniffile.write("Manifest-Version: 1.0\n")
+ maniffile.write("Main-Class: {compiler.mainmodule.jname}_Main\n")
+ maniffile.close
+ end
+
+ # Write a simple bash script that runs the jar like it was a binary generated by nitc
+ private fun write_shell_script(compiler: JavaCompiler) do
+ var outname = compiler.outname
+ var shfile = new FileWriter.open(outname)
+ shfile.write("#!/bin/bash\n")
+ shfile.write("java -jar {outname}.jar \"$@\"\n")
+ shfile.close
+ sys.system("chmod +x {outname}")
+ end
+end
+
+# Compiler that translates Nit code to Java code
+class JavaCompiler
+ # The main module of the program currently compiled
+ var mainmodule: MModule
+
+ # Modelbuilder used to know the model and the AST
+ var modelbuilder: ModelBuilder
+
+ # The result of the RTA (used to know live types and methods)
+ var runtime_type_analysis: RapidTypeAnalysis
+
+ # Where to generate tmp files
+ var compile_dir: String is lazy do
+ var dir = modelbuilder.toolcontext.opt_compile_dir.value
+ if dir == null then dir = "nitj_compile"
+ return dir
+ end
+
+ # Name of the generated executable
+ var outname: String is lazy do
+ var name = modelbuilder.toolcontext.opt_output.value
+ if name == null then name = mainmodule.jname
+ return name
+ end
+
+ # The list of all associated files
+ # Used to generate .java files
+ var files: Array[JavaCodeFile] = new Array[JavaCodeFile]
+
+ # Force the creation of a new file
+ # The point is to avoid contamination between must-be-compiled-separately files
+ fun new_file(name: String): JavaCodeFile do
+ var file = new JavaCodeFile(name)
+ files.add(file)
+ return file
+ end
+
+ # Kind of visitor to use
+ type VISITOR: JavaCompilerVisitor
+
+ # Initialize a visitor specific for the compiler engine
+ fun new_visitor(filename: String): VISITOR do
+ return new JavaCompilerVisitor(self, new_file(filename))
+ end
+
+ # RuntimeModel representation
+ private var rt_model: JavaRuntimeModel is lazy do return new JavaRuntimeModel
+
+ # Compile Nit code to Java
+ fun do_compilation do
+ # compile java classes used to represents the runtime model of the program
+ rt_model.compile_rtmodel(self)
+ compile_box_kinds
+
+ # compile class structures
+ compile_mclasses_to_java
+
+ # compile method structures
+ compile_mmethods_to_java
+
+ # compile main
+ compile_main_function
+ end
+
+ # Prepare the boxes used to represent Java primitive types
+ fun compile_box_kinds do
+ # Collect all bas box class
+ # FIXME: this is not completely fine with a separate compilation scheme
+ for classname in ["Int", "Bool", "Byte", "Char", "Float"] do
+ var classes = mainmodule.model.get_mclasses_by_name(classname)
+ if classes == null then continue
+ assert classes.length == 1 else print classes.join(", ")
+ box_kinds.add(classes.first.mclass_type)
+ end
+ end
+
+ # Types of boxes used to represent Java primitive types
+ var box_kinds = new Array[MClassType]
+
+ # Generate a `RTClass` for each `MClass` found in model
+ #
+ # This is a global phase because we need to know all the program to build
+ # attributes, fill vft and type table.
+ fun compile_mclasses_to_java do
+ for mclass in mainmodule.model.mclasses do
+ mclass.compile_to_java(new_visitor("{mclass.rt_name}.java"))
+ end
+ end
+
+ # Generate a `RTMethod` for each `MMethodDef` found in model
+ #
+ # This is a separate phase.
+ fun compile_mmethods_to_java do
+ for mmodule in mainmodule.in_importation.greaters do
+ for mclassdef in mmodule.mclassdefs do
+ for mdef in mclassdef.mpropdefs do
+ if mdef isa MMethodDef then
+ mdef.compile_to_java(new_visitor("{mdef.rt_name}.java"))
+ end
+ end
+ end
+ end
+ end
+
+ # Generate Java main that call Sys.main
+ fun compile_main_function do
+ var v = new_visitor("{mainmodule.jname}_Main.java")
+ v.add("public class {mainmodule.jname}_Main \{")
+ v.add(" public static void main(String[] args) \{")
+
+ var main_type = mainmodule.sys_type
+ if main_type != null then
+ var mainmodule = v.compiler.mainmodule
+ var glob_sys = v.init_instance(main_type)
+ var main_init = mainmodule.try_get_primitive_method("init", main_type.mclass)
+ if main_init != null then
+ v.send(main_init, [glob_sys])
+ end
+ var main_method = mainmodule.try_get_primitive_method("run", main_type.mclass) or else
+ mainmodule.try_get_primitive_method("main", main_type.mclass)
+ if main_method != null then
+ v.send(main_method, [glob_sys])
+ end
+ end
+ v.add(" \}")
+ v.add("\}")
+ end
+end
+
+# The class visiting the AST
+#
+# A visitor is attached to one JavaCodeFile it writes into.
+class JavaCompilerVisitor
+ super Visitor
+
+ # JavaCompiler used with this visitor
+ type COMPILER: JavaCompiler
+
+ # The associated compiler
+ var compiler: JavaCompiler
+
+ # The file to write generated code into
+ var file: JavaCodeFile
+
+ # Names handling
+
+ private var names = new HashSet[String]
+ private var last: Int = 0
+
+ # Return a new name based on `s` and unique in the visitor
+ fun get_name(s: String): String do
+ if not self.names.has(s) then
+ self.names.add(s)
+ return s
+ end
+ var i = self.last + 1
+ loop
+ var s2 = s + i.to_s
+ if not self.names.has(s2) then
+ self.last = i
+ self.names.add(s2)
+ return s2
+ end
+ i = i + 1
+ end
+ end
+
+ # Return an unique and stable identifier associated with an escapemark
+ fun escapemark_name(e: nullable EscapeMark): String do
+ assert e != null
+ var frame = self.frame
+ assert frame != null
+ if frame.escapemark_names.has_key(e) then return frame.escapemark_names[e]
+ var name = e.name
+ if name == null then name = "label"
+ name = get_name(name)
+ frame.escapemark_names[e] = name
+ return name
+ end
+
+ # Insert a C label for associated with an escapemark
+ fun add_escape_label(e: nullable EscapeMark) do
+ if e == null then return
+ if e.escapes.is_empty then return
+ add("BREAK_{escapemark_name(e)}: ")
+ end
+
+ # Variables handling
+
+ # Registered variables
+ protected var variables = new HashMap[Variable, RuntimeVariable]
+
+ # Return the local RuntimeVariable associated to a Nit local variable
+ fun variable(variable: Variable): RuntimeVariable do
+ if variables.has_key(variable) then
+ return variables[variable]
+ else
+ var name = get_name("var_{variable.name}")
+ var mtype = variable.declared_type.as(not null)
+ mtype = anchor(mtype)
+ var res = decl_var(name, mtype)
+ variables[variable] = res
+ return res
+ end
+ end
+
+ # Return a new uninitialized local RuntimeVariable with `name`
+ fun decl_var(name: String, mtype: MType): RuntimeVariable do
+ var res = new RuntimeVariable(name, mtype, mtype)
+ res.is_boxed = not mtype.is_java_primitive
+ add("{mtype.java_type} {name} /* : {mtype} */;")
+ return res
+ end
+
+ # Return a new uninitialized local RuntimeVariable
+ fun new_var(mtype: MType): RuntimeVariable do
+ mtype = anchor(mtype)
+ var name = self.get_name("var")
+ return decl_var(name, mtype)
+ end
+
+ # Calls handling
+
+ # The current `JavaStaticFrame`
+ var frame: nullable JavaStaticFrame = null is writable
+
+ # Return a new local RuntimeVariable initialized from `args[0]`
+ fun new_recv(mtype: MType): RuntimeVariable do
+ var res = new_var(mtype)
+ add("{res} = args[0];")
+ return res
+ end
+
+ # Calls handling
+
+ # Compile a call within a callsite
+ fun compile_callsite(callsite: CallSite, arguments: Array[RuntimeVariable]): nullable RuntimeVariable do
+ var initializers = callsite.mpropdef.initializers
+ if not initializers.is_empty then
+ var recv = arguments.first
+
+ var i = 1
+ for p in initializers do
+ if p isa MMethod then
+ var args = [recv]
+ var msignature = p.intro.msignature
+ if msignature != null then
+ for x in msignature.mparameters do
+ args.add arguments[i]
+ i += 1
+ end
+ end
+ send(p, args)
+ else if p isa MAttribute then
+ info("NOT YET IMPLEMENTED {class_name}::compile_callsite for MAttribute `{p}`")
+ #self.write_attribute(p, recv, arguments[i])
+ i += 1
+ else abort
+ end
+ assert i == arguments.length
+
+ return send(callsite.mproperty, [recv])
+ end
+
+ return send(callsite.mproperty, arguments)
+ end
+
+ # Evaluate `args` as expressions in the call of `mpropdef` on `recv`.
+ #
+ # This method is used to manage varargs in signatures and returns the real array
+ # of runtime variables to use in the call.
+ fun varargize(mpropdef: MMethodDef, map: nullable SignatureMap, recv: RuntimeVariable, args: SequenceRead[AExpr]): Array[RuntimeVariable] do
+ var msignature = mpropdef.new_msignature or else mpropdef.msignature.as(not null)
+ var res = new Array[RuntimeVariable]
+ res.add(recv)
+
+ if msignature.arity == 0 then return res
+
+ if map == null then
+ assert args.length == msignature.arity
+ for ne in args do
+ res.add expr(ne, null)
+ end
+ return res
+ end
+
+ # Eval in order of arguments, not parameters
+ var exprs = new Array[RuntimeVariable].with_capacity(args.length)
+ for ne in args do
+ exprs.add expr(ne, null)
+ end
+
+ # Fill `res` with the result of the evaluation according to the mapping
+ for i in [0..msignature.arity[ do
+ var param = msignature.mparameters[i]
+ var j = map.map.get_or_null(i)
+ if j == null then
+ # default value
+ res.add(null_instance)
+ continue
+ end
+ if param.is_vararg and map.vararg_decl > 0 then
+ var vararg = exprs.sub(j, map.vararg_decl)
+ var elttype = param.mtype
+ var arg = self.vararg_instance(mpropdef, recv, vararg, elttype)
+ res.add(arg)
+ continue
+ end
+ res.add exprs[j]
+ end
+ return res
+ end
+
+ # Generate a static call on a method definition (no receiver needed).
+ fun static_call(mmethoddef: MMethodDef, arguments: Array[RuntimeVariable]): nullable RuntimeVariable do
+ var res: nullable RuntimeVariable
+ var ret = mmethoddef.msignature.as(not null).return_mtype
+ if ret == null then
+ res = null
+ else
+ ret = ret.resolve_for(mmethoddef.mclassdef.bound_mtype, mmethoddef.mclassdef.bound_mtype, mmethoddef.mclassdef.mmodule, true)
+ res = self.new_var(ret)
+ end
+
+ # Autobox arguments
+ adapt_signature(mmethoddef, arguments)
+
+ var rt_name = mmethoddef.rt_name
+ if res == null then
+ add("{rt_name}.get{rt_name}().exec(new RTVal[]\{{arguments.join(",")}\});")
+ return null
+ end
+ var ress = new_expr("{rt_name}.get{rt_name}().exec(new RTVal[]\{{arguments.join(",")}\});", compiler.mainmodule.object_type)
+ assign(res, ress)
+ return res
+ end
+
+ # Generate a polymorphic send for `method` with `arguments`
+ fun send(mmethod: MMethod, arguments: Array[RuntimeVariable]): nullable RuntimeVariable do
+ # Shortcut calls on primitives
+ if arguments.first.mcasttype.is_java_primitive then
+ return monomorphic_send(mmethod, arguments.first.mcasttype, arguments)
+ end
+ # Polymorphic send
+ return table_send(mmethod, arguments)
+ end
+
+
+ # Handle common special cases before doing the effective method invocation
+ # This methods handle the `==` and `!=` methods and the case of the null receiver.
+ # Note: a { is open in the generated C, that enclose and protect the effective method invocation.
+ # Client must not forget to close the } after them.
+ #
+ # The value returned is the result of the common special cases.
+ # If not null, client must compile it with the result of their own effective method invocation.
+ #
+ # If `before_send` can shortcut the whole message sending, a dummy `if(0){`
+ # is generated to cancel the effective method invocation that will follow
+ # TODO: find a better approach
+ private fun before_send(res: nullable RuntimeVariable, mmethod: MMethodDef, arguments: Array[RuntimeVariable]) do
+ var bool_type = compiler.mainmodule.bool_type
+ var recv = arguments.first
+ var consider_null = mmethod.name == "==" or mmethod.name == "!=" or mmethod.name == "is_same_instance"
+ if recv.mcasttype isa MNullableType or recv.mcasttype isa MNullType then
+ add("if ({recv} == null || {recv}.is_null()) \{")
+ if mmethod.name == "==" or mmethod.name == "is_same_instance" then
+ if res == null then res = new_var(bool_type)
+ var arg = arguments[1]
+ if arg.mcasttype isa MNullableType then
+ add("{res} = ({arg} == null || {arg}.is_null());")
+ else if arg.mcasttype isa MNullType then
+ add("{res} = true; /* is null */")
+ else
+ add("{res} = false; /* {arg.inspect} cannot be null */")
+ end
+ else if mmethod.name == "!=" then
+ if res == null then res = new_var(bool_type)
+ # res = self.new_var(bool_type)
+ var arg = arguments[1]
+ if arg.mcasttype isa MNullableType then
+ add("{res} = ({arg} != null && !{arg}.is_null());")
+ else if arg.mcasttype isa MNullType then
+ add("{res} = false; /* is null */")
+ else
+ add("{res} = true; /* {arg.inspect} cannot be null */")
+ end
+ else
+ add_abort("Receiver is null")
+ ret(null_instance)
+ end
+ add("\} else \{")
+ else
+ add "\{"
+ add "/* recv ({recv}) cannot be null since it's a {recv.mcasttype}"
+ end
+ if consider_null then
+ var arg = arguments[1]
+ if arg.mcasttype isa MNullType then
+ if res == null then res = new_var(bool_type)
+ if mmethod.name == "!=" then
+ add("{res} = true; /* arg is null and recv is not */")
+ else # `==` and `is_same_instance`
+ add("{res} = false; /* arg is null but recv is not */")
+ end
+ add("\}") # closes the null case
+ add("if (false) \{") # what follow is useless, Javac will drop it
+ end
+ end
+ end
+
+ # Perform a method call through vft
+ private fun table_send(mmethod: TableCallable, arguments: Array[RuntimeVariable]): nullable RuntimeVariable do
+ var mdef: MMethodDef
+ var name: String
+ if mmethod isa MMethod then
+ mdef = mmethod.intro
+ name = mmethod.full_name
+ else if mmethod isa MMethodDef then
+ mdef = mmethod
+ name = mmethod.full_name
+ else
+ abort
+ end
+
+ var recv = arguments.first
+ var rect = mdef.mclassdef.bound_mtype
+ var msignature = mdef.msignature.as(not null)
+ msignature = msignature.resolve_for(rect, rect, compiler.mainmodule, true)
+ adapt_signature(mdef, arguments)
+
+ var res: nullable RuntimeVariable
+ var ret = msignature.return_mtype
+ if ret == null then
+ res = null
+ else
+ res = self.new_var(ret)
+ end
+
+ before_send(res, mdef, arguments)
+
+ add "/* concrete call to {mdef} */"
+ if res != null then
+ var ress = new_expr("{recv}.rtclass.vft.get(\"{name}\").exec(new RTVal[]\{{arguments.join(",")}\});", compiler.mainmodule.object_type)
+ assign(res, ress)
+ else
+ add("{recv}.rtclass.vft.get(\"{name}\").exec(new RTVal[]\{{arguments.join(",")}\});")
+ end
+
+ add("\}") # closes the null case
+
+ return res
+ end
+
+ # Generate a super call from a method definition
+ fun supercall(m: MMethodDef, recvtype: MClassType, args: Array[RuntimeVariable]): nullable RuntimeVariable do
+ return table_send(m, args)
+ end
+
+ # Generate a monomorphic send for the method `m`, the type `t` and the arguments `args`
+ fun monomorphic_send(m: MMethod, t: MType, args: Array[RuntimeVariable]): nullable RuntimeVariable do
+ assert t isa MClassType
+ var propdef = m.lookup_first_definition(self.compiler.mainmodule, t)
+ return self.static_call(propdef, args)
+ end
+
+ # Code generation
+
+ # Add a line (will be suffixed by `\n`)
+ fun add(line: String) do file.lines.add("{line}\n")
+
+ # Add a new partial line (no `\n` suffix)
+ fun addn(line: String) do file.lines.add(line)
+
+ # Compile a statement (if any)
+ fun stmt(nexpr: nullable AExpr) do
+ if nexpr == null then return
+ if nexpr.mtype == null and not nexpr.is_typed then
+ # Untyped expression.
+ # Might mean dead code or invalid code
+ # so aborts
+ add_abort("FATAL: bad statement executed.")
+ return
+ end
+
+ var old = self.current_node
+ current_node = nexpr
+ nexpr.stmt(self)
+ current_node = old
+ end
+
+ # Compile an expression an return its result
+ # `mtype` is the expected return type, pass null if no specific type is expected.
+ fun expr(nexpr: AExpr, mtype: nullable MType): RuntimeVariable do
+ var old = current_node
+ current_node = nexpr
+
+ var res = null
+ if nexpr.mtype != null then
+ res = nexpr.expr(self)
+ end
+
+ if res == null then
+ # Untyped expression.
+ # Might mean dead code or invalid code.
+ # so aborts
+ add_abort("FATAL: bad expression executed.")
+ # and return a placebo result to please the C compiler
+ if mtype == null then mtype = compiler.mainmodule.object_type
+ res = null_instance
+
+ self.current_node = old
+ return res
+ end
+
+ if mtype != null then
+ mtype = anchor(mtype)
+ res = autobox(res, mtype)
+ end
+
+ current_node = old
+ return res
+ end
+
+ # Alias for `self.expr(nexpr, self.bool_type)`
+ fun expr_bool(nexpr: AExpr): RuntimeVariable do
+ return expr(nexpr, compiler.mainmodule.bool_type)
+ end
+
+ # Correctly assign a left and a right value
+ # Boxing and unboxing is performed if required
+ fun assign(left, right: RuntimeVariable) do
+ add("{left} = {autobox(right, left.mtype)};")
+ end
+
+ # Generate a return with `value`
+ fun ret(value: RuntimeVariable) do
+ var frame = self.frame
+ assert frame != null
+ var returnvar = frame.returnvar
+ if returnvar != null then
+ assign(returnvar, value)
+ end
+ self.add("break {frame.returnlabel.as(not null)};")
+ end
+
+ # Return a new local RuntimeVariable initialized with the Java expression `jexpr`.
+ #
+ # `mtype` is used for the Java return variable initialization.
+ fun new_expr(jexpr: String, mtype: MType): RuntimeVariable do
+ var res = new_var(mtype)
+ add("{res} = {jexpr};")
+ return res
+ end
+
+ # Generate generic abort
+ #
+ # Used by aborts, asserts, casts, etc.
+ fun add_abort(message: String) do
+ add("System.err.print(\"Runtime error: {message}\");")
+ add_raw_abort
+ end
+
+ # Abort without displaying the cause.
+ #
+ # Used to customizable errors.
+ private fun add_raw_abort do
+ var node = current_node
+ if node != null then
+ add("System.err.print(\" ({node.location.short_location})\");")
+ end
+ add("System.err.println(\"\");")
+ add("System.exit(1);")
+ end
+
+ # Add a dynamic cast
+ fun add_cast(value: RuntimeVariable, mtype: MType) do
+ var res = type_test(value, mtype)
+ add("if (!{res}) \{")
+ add("System.err.print(\"Runtime error: Cast failed. Expected `{mtype.to_s.escape_to_c}`, got `\" + {value}.rtclass.class_name + \"`\");")
+ add_raw_abort
+ add("\}")
+ end
+
+ # Types handling
+
+ # Anchor a type to the main module and the current receiver
+ fun anchor(mtype: MType): MType do
+ if not mtype.need_anchor then return mtype
+ return mtype.anchor_to(compiler.mainmodule, frame.as(not null).receiver)
+ end
+
+ # Adapt the arguments of a method according to targetted `MMethodDef`
+ fun adapt_signature(m: MMethodDef, args: Array[RuntimeVariable]) do
+ var msignature = m.msignature.as(not null).resolve_for(
+ m.mclassdef.bound_mtype,
+ m.mclassdef.bound_mtype,
+ m.mclassdef.mmodule, true)
+ args.first = autobox(args.first, compiler.mainmodule.object_type)
+ for i in [0..msignature.arity[ do
+ args[i+1] = autobox(args[i + 1], compiler.mainmodule.object_type)
+ end
+ end
+
+ # Box primitive `value` to `mtype`.
+ private fun box(value: RuntimeVariable, mtype: MType): RuntimeVariable do
+ if value.is_boxed then return value
+ var obj_type = compiler.mainmodule.object_type
+ if value.mtype isa MNullType then
+ return new_expr("new RTVal(null, null)", compiler.mainmodule.model.null_type)
+ end
+ var mbox = value.mtype.as(MClassType).mclass
+ return new_expr("new RTVal({mbox.rt_name}.get{mbox.rt_name}(), {value})", obj_type)
+ end
+
+ # Unbox primitive `value` to `mtype`.
+ private fun unbox(value: RuntimeVariable, mtype: MType): RuntimeVariable do
+ if not value.is_boxed then return value
+ if not mtype.is_java_primitive then return value
+ if compiler.box_kinds.has(mtype) then
+ return new_expr("({mtype.java_type}){value}.value", mtype)
+ else
+ info "NOT YET IMPLEMENTED unbox for {value} ({mtype})"
+ abort
+ end
+ end
+
+ # Box or unbox primitive `value` to `mtype` if needed.
+ private fun autobox(value: RuntimeVariable, mtype: MType): RuntimeVariable do
+ if mtype.is_java_primitive then return unbox(value, mtype)
+ return box(value, mtype)
+ end
+
+ # Can this `value` be a primitive Java value?
+ private fun can_be_primitive(value: RuntimeVariable): Bool do
+ var t = value.mcasttype.undecorate
+ if not t isa MClassType then return false
+ var k = t.mclass.kind
+ return k == interface_kind or t.is_java_primitive
+ end
+
+ # Generate a polymorphic subtype test
+ fun type_test(value: RuntimeVariable, mtype: MType): RuntimeVariable do
+ add("/* {value.inspect} isa {mtype} */")
+ var res = self.new_var(compiler.mainmodule.bool_type)
+
+ # check color is in table
+ var maybenull = (value.mcasttype isa MNullableType or value.mcasttype isa MNullType)
+ if maybenull then
+ add("if({value} == null || {value}.is_null()) \{")
+ add("{res} = true && {mtype isa MNullableType};")
+ add("\} else \{")
+ end
+ if mtype isa MNullableType then mtype = mtype.mtype
+ var mclass = mtype.as(MClassType).mclass
+ add("{res} = {value}.rtclass.supers.get(\"{mclass.jname}\") == {mclass.rt_name}.get{mclass.rt_name}();")
+ if maybenull then
+ add("\}")
+ end
+ return res
+ end
+
+ # Generate the code required to dynamically check if 2 objects share the same runtime type
+ fun is_same_type_test(value1, value2: RuntimeVariable): RuntimeVariable do
+ var res = self.new_var(compiler.mainmodule.bool_type)
+ add("{res} = {value1}.rtclass == {value2}.rtclass;")
+ return res
+ end
+
+ # Native instances
+
+ # Generate an integer value
+ fun int_instance(value: Int): RuntimeVariable do
+ var t = compiler.mainmodule.int_type
+ return new RuntimeVariable(value.to_s, t, t)
+ end
+
+ # Generate a byte value
+ fun byte_instance(value: Byte): RuntimeVariable do
+ var t = compiler.mainmodule.byte_type
+ return new RuntimeVariable(value.to_s, t, t)
+ end
+
+ # Generate a char value
+ fun char_instance(value: Char): RuntimeVariable do
+ var t = compiler.mainmodule.char_type
+ return new RuntimeVariable("'{value.to_s.escape_to_c}'", t, t)
+ end
+
+ # Generate a float value
+ #
+ # FIXME pass a Float, not a string
+ fun float_instance(value: String): RuntimeVariable do
+ var t = compiler.mainmodule.float_type
+ return new RuntimeVariable(value.to_s, t, t)
+ end
+
+ # Generate an integer value
+ fun bool_instance(value: Bool): RuntimeVariable do
+ var t = compiler.mainmodule.bool_type
+ return new RuntimeVariable(value.to_s, t, t)
+ end
+
+ # Generate the `null` value
+ fun null_instance: RuntimeVariable do
+ var t = compiler.mainmodule.model.null_type
+ return new RuntimeVariable("null", t, t)
+ end
+
+ # Get an instance of a array for a vararg
+ fun vararg_instance(mpropdef: MPropDef, recv: RuntimeVariable, varargs: Array[RuntimeVariable], elttype: MType): RuntimeVariable do
+ # TODO handle dynamic types
+ info("NOT YET IMPLEMENTED vararg_instance")
+ return null_instance
+ # TODO return array_instance(varargs, elttype)
+ end
+
+ # Nit instances
+
+ # Generate a alloc-instance + init-attributes
+ fun init_instance(mtype: MClassType): RuntimeVariable do
+ var rt_name = mtype.mclass.rt_name
+ var res = new_expr("new RTVal({rt_name}.get{rt_name}())", mtype)
+ generate_init_attr(self, res, mtype)
+ return res
+ end
+
+ # Generate code that initialize the attributes on a new instance
+ fun generate_init_attr(v: JavaCompilerVisitor, recv: RuntimeVariable, mtype: MClassType) do
+ var cds = mtype.collect_mclassdefs(v.compiler.mainmodule).to_a
+ v.compiler.mainmodule.linearize_mclassdefs(cds)
+ for cd in cds do
+ for npropdef in v.compiler.modelbuilder.collect_attr_propdef(cd) do
+ npropdef.init_expr(v, recv)
+ end
+ end
+ end
+
+ # Generate a Nit "is" for two runtime_variables
+ fun equal_test(value1, value2: RuntimeVariable): RuntimeVariable do
+ var res = new_var(compiler.mainmodule.bool_type)
+ if value2.mtype.is_java_primitive and not value1.mtype.is_java_primitive then
+ var tmp = value1
+ value1 = value2
+ value2 = tmp
+ end
+ if value1.mtype.is_java_primitive then
+ if value2.mtype == value1.mtype then
+ add("{res} = {value1} == {value2}; /* == with two primitives */")
+ else if value2.mtype.is_java_primitive then
+ add("{res} = true; /* incompatible types {value1.mtype} vs. {value2.mtype}*/")
+ # else if value1.mtype.is_tagged then
+ # add("{res} = ({value2} != NULL) && ({autobox(value2, value1.mtype)} == {value1});")
+ else
+ var rt_name = value1.mtype.as(MClassType).mclass.rt_name
+ add("{res} = ({value2} != null) && ({value2}.rtclass == {rt_name}.get{rt_name}());")
+ add("if ({res}) \{")
+ add("{res} = ({self.autobox(value2, value1.mtype)} == {value1});")
+ add("\}")
+ end
+ return res
+ end
+ var maybe_null = true
+ var test = new Array[String]
+ var t1 = value1.mcasttype
+ if t1 isa MNullableType then
+ test.add("{value1} != null && !{value1}.is_null()")
+ t1 = t1.mtype
+ else
+ maybe_null = false
+ end
+ var t2 = value2.mcasttype
+ if t2 isa MNullableType then
+ test.add("{value2} != null && !{value2}.is_null()")
+ t2 = t2.mtype
+ else
+ maybe_null = false
+ end
+
+ var incompatible = false
+ var primitive
+ if t1.is_java_primitive then
+ primitive = t1
+ if t1 == t2 then
+ # No need to compare class
+ else if t2.is_java_primitive then
+ incompatible = true
+ else if can_be_primitive(value2) then
+ if t1.is_java_primitive then
+ self.add("{res} = {value1} == {value2}; /* t1 is primitive and t2 can be */")
+ return res
+ end
+ # if not compiler.modelbuilder.toolcontext.opt_no_tag_primitives.value then
+ # test.add("(!{extract_tag(value2)})")
+ # end
+ test.add("{value1}.rtclass == {value2}.rtclass")
+ else
+ incompatible = true
+ end
+ else if t2.is_java_primitive then
+ primitive = t2
+ if can_be_primitive(value1) then
+ if t2.is_java_primitive then
+ self.add("{res} = {value1} == {value2}; /* t2 is primitive and t1 can be */")
+ return res
+ end
+ test.add("{value1}.rtclass == {value2}.rtclass")
+ else
+ incompatible = true
+ end
+ else
+ primitive = null
+ end
+
+ if incompatible then
+ if maybe_null then
+ self.add("{res} = {value1} == {value2}; /* incompatible types {t1} vs. {t2}; but may be NULL*/")
+ return res
+ else
+ self.add("{res} = false; /* incompatible types {t1} vs. {t2}; cannot be NULL */")
+ return res
+ end
+ end
+ if primitive != null then
+ if primitive.is_java_primitive then
+ self.add("{res} = {value1} == {value2};")
+ return res
+ end
+ test.add("({value1}.value == {value2}.value")
+ else if can_be_primitive(value1) and can_be_primitive(value2) then
+ test.add("{value1}.rtclass == {value2}.rtclass")
+ var s = new Array[String]
+ for b in compiler.box_kinds do
+ var rt_name = b.mclass.rt_name
+ s.add "({value1}.rtclass == {rt_name}.get{rt_name}()) && ({value1}.value.equals({value2}.value))"
+ if b.mclass.name == "Float" then
+ s.add "({value1}.rtclass == RTClass_kernel_Float.getRTClass_kernel_Float() && {value1}.rtclass == {value2}.rtclass && Math.abs((double)({value1}.value)) == 0.0 && Math.abs((double)({value2}.value)) == 0.0)"
+ end
+ end
+ if s.is_empty then
+ self.add("{res} = {value1} == {value2}; /* both can be primitive */")
+ return res
+ end
+ test.add("({s.join(" || ")})")
+ else
+ self.add("{res} = {value1} == {value2}; /* no primitives */")
+ return res
+ end
+ self.add("{res} = {value1} == {value2} || ({test.join(" && ")});")
+ return res
+ end
+
+ # Attributes
+
+ # Generate a polymorphic attribute is_set test
+ fun isset_attribute(a: MAttribute, recv: RuntimeVariable): RuntimeVariable do
+ # TODO self.check_recv_notnull(recv)
+ var res = new_var(compiler.mainmodule.bool_type)
+
+ # What is the declared type of the attribute?
+ var mtype = a.intro.static_mtype.as(not null)
+ var intromclassdef = a.intro.mclassdef
+ mtype = mtype.resolve_for(intromclassdef.bound_mtype, intromclassdef.bound_mtype, intromclassdef.mmodule, true)
+
+ if mtype isa MNullableType then
+ add("{res} = true; /* easy isset: {a} on {recv.inspect} */")
+ return res
+ end
+ add("{res} = {recv}.attrs.get(\"{a.jname}\") != null; /* {a} on {recv.inspect} */")
+ return res
+ end
+
+ # Generate a polymorphic attribute read
+ fun read_attribute(a: MAttribute, recv: RuntimeVariable): RuntimeVariable do
+ # TODO check_recv_notnull(recv)
+ # TODO compile_check(v)
+ # What is the declared type of the attribute?
+ var ret = a.intro.static_mtype.as(not null)
+ var intromclassdef = a.intro.mclassdef
+ ret = ret.resolve_for(intromclassdef.bound_mtype, intromclassdef.bound_mtype, intromclassdef.mmodule, true)
+
+ # Check for Uninitialized attribute
+ if not ret isa MNullableType then check_attribute(a, recv)
+
+ return new_expr("{recv}.attrs.get(\"{a.jname}\")", ret)
+ end
+
+ # Generate a polymorphic attribute write
+ fun write_attribute(a: MAttribute, recv: RuntimeVariable, value: RuntimeVariable) do
+ # TODO check_recv_notnull(recv)
+ add "{recv}.attrs.put(\"{a.jname}\", {autobox(value, compiler.mainmodule.object_type)});"
+ end
+
+ # Check uninitialized attribute
+ fun check_attribute(a: MAttribute, recv: RuntimeVariable) do
+ add "if({recv}.attrs.get(\"{a.jname}\") == null) \{"
+ add_abort "Uninitialized attribute {a.name}"
+ add "\}"
+ end
+
+ # Utils
+
+ # Display a info message
+ fun info(str: String) do compiler.modelbuilder.toolcontext.info(str, 0)
+end
+
+# A file containing Java code.
+class JavaCodeFile
+
+ # File name
+ var filename: String
+
+ # Lines to write
+ var lines: List[String] = new List[String]
+end
+
+redef class MEntity
+ # A Java compatible name for `self`
+ private fun jname: String do return name.to_cmangle
+end
+
+# Handler for runtime classes generation
+#
+# We need 3 kinds of runtime structures:
+# * `RTClass` to represent a global class
+# * `RTMethod` to represent a method definition
+# * `RTVal` to represent runtime variables
+class JavaRuntimeModel
+
+ # Compile JavaRuntimeModel structures
+ fun compile_rtmodel(compiler: JavaCompiler) do
+ compile_rtclass(compiler)
+ compile_rtmethod(compiler)
+ compile_rtval(compiler)
+ end
+
+ # Compile the abstract runtime class structure
+ #
+ # Runtime classes have 3 attributes:
+ # * `class_name`: the class name as a String
+ # * `vft`: the virtual function table for the class (flattened)
+ # * `supers`: the super type table (used for type tests)
+ fun compile_rtclass(compiler: JavaCompiler) do
+ var v = compiler.new_visitor("RTClass.java")
+ v.add("import java.util.HashMap;")
+ v.add("public abstract class RTClass \{")
+ v.add(" public String class_name;")
+ v.add(" public HashMap<String, RTMethod> vft = new HashMap<>();")
+ v.add(" public HashMap<String, RTClass> supers = new HashMap<>();")
+ v.add(" protected RTClass() \{\}")
+ v.add("\}")
+ end
+
+ # Compile the abstract runtime method structure
+ #
+ # Method body is executed through the `exec` method:
+ # * `exec` always take an array of RTVal as arg, the first one must be the receiver
+ # * `exec` always returns a RTVal (or null if the Nit return type is void)
+ fun compile_rtmethod(compiler: JavaCompiler) do
+ var v = compiler.new_visitor("RTMethod.java")
+ v.add("public abstract class RTMethod \{")
+ v.add(" protected RTMethod() \{\}")
+ v.add(" public abstract RTVal exec(RTVal[] args);")
+ v.add("\}")
+ end
+
+ # Compile the runtime value structure
+ #
+ # RTVal both represents object instances and primitives values:
+ # * object instances:
+ # * `rtclass` the class of the RTVal is instance of
+ # * `attrs` contains the attributes of the instance
+ # * primitive values:
+ # * `rtclass` represents the class of the primitive value Nit type
+ # * `value` contains the primitive value of the instance
+ # * null values:
+ # * they must have both `rtclass` and `value` as null
+ fun compile_rtval(compiler: JavaCompiler) do
+ var v = compiler.new_visitor("RTVal.java")
+ v.add("import java.util.HashMap;")
+ v.add("public class RTVal \{")
+ v.add(" public RTClass rtclass;")
+ v.add(" public HashMap<String, RTVal> attrs = new HashMap<>();")
+ v.add(" Object value;")
+ v.add(" public RTVal(RTClass rtclass) \{")
+ v.add(" this.rtclass = rtclass;")
+ v.add(" \}")
+ v.add(" public RTVal(RTClass rtclass, Object value) \{")
+ v.add(" this.rtclass = rtclass;")
+ v.add(" this.value = value;")
+ v.add(" \}")
+ v.add(" public boolean is_null() \{ return rtclass == null && value == null; \}")
+ v.add("\}")
+ end
+end
+
+# A runtime variable hold a runtime value in Java.
+# Runtime variables are associated to Nit local variables and intermediate results in Nit expressions.
+class RuntimeVariable
+
+ # The name of the variable in the Java code
+ var name: String
+
+ # The static type of the variable (as declard in Java)
+ var mtype: MType
+
+ # The current casted type of the variable (as known in Nit)
+ var mcasttype: MType is writable
+
+ # If the variable exaclty a mcasttype?
+ # false (usual value) means that the variable is a mcasttype or a subtype.
+ var is_exact: Bool = false is writable
+
+ # Is this variable declared as a RTVal or a Java primitive one?
+ var is_boxed = false
+
+ redef fun to_s do return name
+
+ redef fun inspect
+ do
+ var exact_str
+ if self.is_exact then
+ exact_str = " exact"
+ else
+ exact_str = ""
+ end
+ var type_str
+ if self.mtype == self.mcasttype then
+ type_str = "{mtype}{exact_str}"
+ else
+ type_str = "{mtype}({mcasttype}{exact_str})"
+ end
+ return "<{name}:{type_str}>"
+ end
+end
+
+# The static context of a visited property in a `JavaCompilerVisitor`
+class JavaStaticFrame
+ # The associated visitor
+ var visitor: JavaCompilerVisitor
+
+ # The executed property.
+ # A Method in case of a call, an attribute in case of a default initialization.
+ var mpropdef: MPropDef
+
+ # The static type of the receiver
+ var receiver: MClassType
+
+ # Arguments of the method (the first is the receiver)
+ var arguments: Array[RuntimeVariable]
+
+ # The runtime_variable associated to the return (in a function)
+ var returnvar: nullable RuntimeVariable = null is writable
+
+ # The label at the end of the property
+ var returnlabel: nullable String = null is writable
+
+ # Labels associated to a each escapemarks.
+ # Because of inlinings, escape-marks must be associated to their context (the frame)
+ private var escapemark_names = new HashMap[EscapeMark, String]
+end
+
+redef class Location
+ # Return a shortened version of the location with `"{file}:{line_start}"`
+ fun short_location: String do
+ var file = self.file
+ if file == null then return "<no file>:{line_start}"
+ return "{file.filename.escape_to_c}:{line_start}"
+ end
+end
+
+redef class MType
+ # Return the Java type associated to a given Nit static type
+ fun java_type: String do return "RTVal"
+
+ # Is the associated Java type a primitive one?
+ #
+ # ENSURE `result == (java_type != "Object")`
+ var is_java_primitive: Bool is lazy do return java_type != "RTVal"
+end
+
+redef class MClassType
+
+ redef var java_type is lazy do
+ if mclass.name == "Int" then
+ return "int"
+ else if mclass.name == "Bool" then
+ return "boolean"
+ else if mclass.name == "Char" then
+ return "char"
+ else if mclass.name == "Float" then
+ return "double"
+ else if mclass.name == "Byte" then
+ return "byte"
+ else if mclass.name == "NativeString" then
+ return "String"
+ else if mclass.name == "NativeArray" then
+ return "Array"
+ end
+ return "RTVal"
+ end
+end
+
+redef class MClass
+
+ # Runtime name
+ private fun rt_name: String do return "RTClass_{intro.mmodule.jname}_{jname}"
+
+ # Generate a Java RTClass for a Nit MClass
+ fun compile_to_java(v: JavaCompilerVisitor) do
+ v.add("public class {rt_name} extends RTClass \{")
+ v.add(" protected static RTClass instance;")
+ v.add(" private {rt_name}() \{")
+ v.add(" this.class_name = \"{name}\";")
+ compile_vft(v)
+ compile_type_table(v)
+ v.add(" \}")
+ v.add(" public static RTClass get{rt_name}() \{")
+ v.add(" if(instance == null) \{")
+ v.add(" instance = new {rt_name}();")
+ v.add(" \}")
+ v.add(" return instance;")
+ v.add(" \}")
+ v.add("\}")
+ end
+
+ # Compile the virtual function table for the mclass
+ private fun compile_vft(v: JavaCompilerVisitor) do
+ # TODO handle generics
+ if mclass_type.need_anchor then return
+ var mclassdefs = mclass_type.collect_mclassdefs(v.compiler.mainmodule).to_a
+ v.compiler.mainmodule.linearize_mclassdefs(mclassdefs)
+
+ var mainmodule = v.compiler.mainmodule
+ for mclassdef in mclassdefs.reversed do
+ for mprop in mclassdef.intro_mproperties do
+ var mpropdef = mprop.lookup_first_definition(mainmodule, intro.bound_mtype)
+ if not mpropdef isa MMethodDef then continue
+ var rt_name = mpropdef.rt_name
+ v.add("this.vft.put(\"{mprop.full_name}\", {rt_name}.get{rt_name}());")
+
+ # fill super next definitions
+ while mpropdef.has_supercall do
+ var prefix = mpropdef.full_name
+ mpropdef = mpropdef.lookup_next_definition(mainmodule, intro.bound_mtype)
+ rt_name = mpropdef.rt_name
+ v.add("this.vft.put(\"{prefix}\", {rt_name}.get{rt_name}());")
+ end
+ end
+ end
+ end
+
+ # Compile the type table for the MClass
+ fun compile_type_table(v: JavaCompilerVisitor) do
+ for pclass in in_hierarchy(v.compiler.mainmodule).greaters do
+ if pclass == self then
+ v.add("supers.put(\"{pclass.jname}\", this);")
+ else
+ v.add("supers.put(\"{pclass.jname}\", {pclass.rt_name}.get{pclass.rt_name}());")
+ end
+ end
+ end
+end
+
+# Used as a common type between MMethod and MMethodDef for `table_send`
+private interface TableCallable
+end
+
+redef class MMethod
+ super TableCallable
+end
+
+redef class MMethodDef
+ super TableCallable
+
+ # Runtime name
+ private fun rt_name: String do
+ return "RTMethod_{mclassdef.mmodule.jname}_{mclassdef.mclass.jname}_{mproperty.jname}"
+ end
+
+ # Generate a Java RTMethod for `self`
+ fun compile_to_java(v: JavaCompilerVisitor) do
+ v.add("public class {rt_name} extends RTMethod \{")
+ v.add(" protected static RTMethod instance;")
+ v.add(" public static RTMethod get{rt_name}() \{")
+ v.add(" if(instance == null) \{")
+ v.add(" instance = new {rt_name}();")
+ v.add(" \}")
+ v.add(" return instance;")
+ v.add(" \}")
+ v.add(" @Override")
+ v.add(" public RTVal exec(RTVal[] args) \{")
+ compile_inside_to_java(v)
+ v.add(" \}")
+ v.add("\}")
+ end
+
+ # Compile the body of this function
+ fun compile_inside_to_java(v: JavaCompilerVisitor) do
+
+ var modelbuilder = v.compiler.modelbuilder
+ var node = modelbuilder.mpropdef2node(self)
+
+ var recv = mclassdef.bound_mtype
+ var arguments = new Array[RuntimeVariable]
+ var frame = new JavaStaticFrame(v, self, recv, arguments)
+ v.frame = frame
+
+ var selfvar = v.decl_var("self", recv)
+ arguments.add(selfvar)
+ var boxed = v.new_expr("args[0]", v.compiler.mainmodule.object_type)
+ v.add "{selfvar} = {v.autobox(boxed, recv)};"
+
+ var msignature = self.msignature
+ var ret = null
+ if msignature != null then
+ ret = msignature.return_mtype
+ if ret != null then
+ var retvar = v.decl_var("ret", ret)
+ if ret.name == "Int" then v.add "{retvar} = 0;"
+ if ret.name == "Float" then v.add "{retvar} = 0.0;"
+ if ret.name == "Bool" then v.add "{retvar} = false;"
+ if ret.name == "Char" then v.add "{retvar} = 0;"
+ if ret.name == "Byte" then v.add "{retvar} = 0;"
+ frame.returnvar = retvar
+ end
+ end
+ frame.returnlabel = v.get_name("RET_LABEL")
+
+ v.current_node = node
+ if is_abstract then
+ v.add_abort("Abstract method `{mproperty.name}` called on `\" + {selfvar}.rtclass.class_name +\"`")
+ v.add("return null;")
+ return
+ end
+ v.current_node = null
+
+ v.add("{frame.returnlabel.as(not null)}: \{")
+
+ if node isa APropdef then
+ node.compile_to_java(v, self, arguments)
+ else if node isa AClassdef then
+ node.compile_to_java(v, self, arguments)
+ else
+ abort
+ end
+
+ v.add("\}")
+ if ret != null then
+ v.add("return {v.autobox(frame.returnvar.as(not null), v.compiler.mainmodule.object_type)};")
+ else
+ v.add("return null;")
+ end
+ end
+end
+
+redef class AClassdef
+ private fun compile_to_java(v: JavaCompilerVisitor, mpropdef: MMethodDef, arguments: Array[RuntimeVariable]) do
+ if mpropdef == self.mfree_init then
+ assert mpropdef.mproperty.is_root_init
+ if not mpropdef.is_intro then
+ v.supercall(mpropdef, arguments.first.mtype.as(MClassType), arguments)
+ end
+ else
+ abort
+ end
+ end
+end
+
+redef class APropdef
+
+ # Compile that property definition to java code
+ fun compile_to_java(v: JavaCompilerVisitor, mpropdef: MMethodDef, arguments: Array[RuntimeVariable]) do
+ v.info("NOT YET IMPLEMENTED {class_name}::compile_to_java")
+ end
+end
+
+redef class AMethPropdef
+ redef fun compile_to_java(v, mpropdef, arguments) do
+ if mpropdef.msignature != null then
+ var i = 0
+ for mparam in mpropdef.msignature.as(not null).mparameters do
+ var variable = n_signature.as(not null).n_params[i].variable
+ if variable == null then continue
+ var argvar = v.variable(variable)
+ v.assign(argvar, v.new_expr("args[{i + 1}]", v.compiler.mainmodule.object_type))
+ arguments.add(argvar)
+ i += 1
+ end
+ end
+
+ # Call the implicit super-init
+ var auto_super_inits = self.auto_super_inits
+ if auto_super_inits != null then
+ var args = [arguments.first]
+ for auto_super_init in auto_super_inits do
+ assert auto_super_init.mproperty != mpropdef.mproperty
+ args.clear
+ for i in [0..auto_super_init.msignature.arity+1[ do
+ args.add(arguments[i])
+ end
+ assert auto_super_init.mproperty != mpropdef.mproperty
+ v.compile_callsite(auto_super_init, args)
+ end
+ end
+ if auto_super_call then
+ v.supercall(mpropdef, arguments.first.mtype.as(MClassType), arguments)
+ end
+
+ compile_inside_to_java(v, mpropdef, arguments)
+ end
+
+ # Compile the inside of the method body
+ private fun compile_inside_to_java(v: JavaCompilerVisitor, mpropdef: MMethodDef, arguments: Array[RuntimeVariable]) do
+ # Compile intern methods
+ if mpropdef.is_intern then
+ if compile_intern_to_java(v, mpropdef, arguments) then return
+ v.info("NOT YET IMPLEMENTED compile_intern for {mpropdef}")
+ v.ret(v.null_instance)
+ return
+ end
+
+ # Compile block if any
+ var n_block = n_block
+ if n_block != null then
+ v.stmt(n_block)
+ return
+ end
+ end
+
+ # Compile an intern method using Java primitives
+ fun compile_intern_to_java(v: JavaCompilerVisitor, mpropdef: MMethodDef, arguments: Array[RuntimeVariable]): Bool do
+ var pname = mpropdef.mproperty.name
+ var cname = mpropdef.mclassdef.mclass.name
+ var ret = mpropdef.msignature.as(not null).return_mtype
+ if cname == "Int" then
+ if pname == "output" then
+ v.add("System.out.println({arguments[0]});")
+ v.ret(v.null_instance)
+ return true
+ else if pname == "object_id" then
+ v.ret(arguments.first)
+ return true
+ else if pname == "+" then
+ v.ret(v.new_expr("{arguments[0]} + {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == "-" then
+ v.ret(v.new_expr("{arguments[0]} - {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == "unary -" then
+ v.ret(v.new_expr("-{arguments[0]}", ret.as(not null)))
+ return true
+ else if pname == "unary +" then
+ v.ret(arguments[0])
+ return true
+ else if pname == "*" then
+ v.ret(v.new_expr("{arguments[0]} * {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == "/" then
+ v.ret(v.new_expr("{arguments[0]} / {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == "%" then
+ v.ret(v.new_expr("{arguments[0]} % {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == "lshift" then
+ v.ret(v.new_expr("{arguments[0]} << {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == "rshift" then
+ v.ret(v.new_expr("{arguments[0]} >> {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == "==" then
+ v.ret(v.equal_test(arguments[0], arguments[1]))
+ return true
+ else if pname == "!=" then
+ var res = v.equal_test(arguments[0], arguments[1])
+ v.ret(v.new_expr("!{res}", ret.as(not null)))
+ return true
+ else if pname == "<" then
+ v.ret(v.new_expr("{arguments[0]} < {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == ">" then
+ v.ret(v.new_expr("{arguments[0]} > {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == "<=" then
+ v.ret(v.new_expr("{arguments[0]} <= {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == ">=" then
+ v.ret(v.new_expr("{arguments[0]} >= {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == "to_f" then
+ v.ret(v.new_expr("(double){arguments[0]}", ret.as(not null)))
+ return true
+ else if pname == "to_b" then
+ v.ret(v.new_expr("(byte){arguments[0]}", ret.as(not null)))
+ return true
+ else if pname == "ascii" then
+ v.ret(v.new_expr("(char){arguments[0]}", ret.as(not null)))
+ return true
+ end
+ else if cname == "Char" then
+ if pname == "output" then
+ v.add("System.out.print({arguments[0]});")
+ v.ret(v.null_instance)
+ return true
+ else if pname == "object_id" then
+ v.ret(v.new_expr("(int){arguments[0]}", ret.as(not null)))
+ return true
+ else if pname == "successor" then
+ v.ret(v.new_expr("(char)({arguments[0]} + {arguments[1]})", ret.as(not null)))
+ return true
+ else if pname == "predecessor" then
+ v.ret(v.new_expr("(char)({arguments[0]} - {arguments[1]})", ret.as(not null)))
+ return true
+ else if pname == "==" then
+ v.ret(v.equal_test(arguments[0], arguments[1]))
+ return true
+ else if pname == "!=" then
+ var res = v.equal_test(arguments[0], arguments[1])
+ v.ret(v.new_expr("!{res}", ret.as(not null)))
+ return true
+ else if pname == "<" then
+ v.ret(v.new_expr("{arguments[0]} < {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == ">" then
+ v.ret(v.new_expr("{arguments[0]} > {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == "<=" then
+ v.ret(v.new_expr("{arguments[0]} <= {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == ">=" then
+ v.ret(v.new_expr("{arguments[0]} >= {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == "to_i" then
+ v.ret(v.new_expr("(int){arguments[0]}", ret.as(not null)))
+ return true
+ else if pname == "ascii" then
+ v.ret(v.new_expr("(int){arguments[0]}", ret.as(not null)))
+ return true
+ end
+ else if cname == "Byte" then
+ if pname == "output" then
+ v.add("System.out.println({arguments[0]});")
+ v.ret(v.null_instance)
+ return true
+ else if pname == "object_id" then
+ v.ret(v.new_expr("(int){arguments[0]}", ret.as(not null)))
+ return true
+ else if pname == "+" then
+ v.ret(v.new_expr("(byte)({arguments[0]} + {arguments[1]})", ret.as(not null)))
+ return true
+ else if pname == "-" then
+ v.ret(v.new_expr("(byte)({arguments[0]} - {arguments[1]})", ret.as(not null)))
+ return true
+ else if pname == "unary -" then
+ v.ret(v.new_expr("(byte)(-{arguments[0]})", ret.as(not null)))
+ return true
+ else if pname == "unary +" then
+ v.ret(arguments[0])
+ return true
+ else if pname == "*" then
+ v.ret(v.new_expr("(byte)({arguments[0]} * {arguments[1]})", ret.as(not null)))
+ return true
+ else if pname == "/" then
+ v.ret(v.new_expr("(byte)({arguments[0]} / {arguments[1]})", ret.as(not null)))
+ return true
+ else if pname == "%" then
+ v.ret(v.new_expr("(byte)({arguments[0]} % {arguments[1]})", ret.as(not null)))
+ return true
+ else if pname == "lshift" then
+ v.ret(v.new_expr("(byte)({arguments[0]} << {arguments[1]})", ret.as(not null)))
+ return true
+ else if pname == "rshift" then
+ v.ret(v.new_expr("(byte)({arguments[0]} >> {arguments[1]})", ret.as(not null)))
+ return true
+ else if pname == "==" then
+ v.ret(v.equal_test(arguments[0], arguments[1]))
+ return true
+ else if pname == "!=" then
+ var res = v.equal_test(arguments[0], arguments[1])
+ v.ret(v.new_expr("!{res}", ret.as(not null)))
+ return true
+ else if pname == "<" then
+ v.ret(v.new_expr("{arguments[0]} < {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == ">" then
+ v.ret(v.new_expr("{arguments[0]} > {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == "<=" then
+ v.ret(v.new_expr("{arguments[0]} <= {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == ">=" then
+ v.ret(v.new_expr("{arguments[0]} >= {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == "to_i" then
+ v.ret(v.new_expr("(int){arguments[0]}", ret.as(not null)))
+ return true
+ else if pname == "to_f" then
+ v.ret(v.new_expr("(double){arguments[0]}", ret.as(not null)))
+ return true
+ else if pname == "ascii" then
+ v.ret(v.new_expr("{arguments[0]}", ret.as(not null)))
+ return true
+ end
+ else if cname == "Bool" then
+ if pname == "output" then
+ v.add("System.out.println({arguments[0]});")
+ v.ret(v.null_instance)
+ return true
+ else if pname == "object_id" then
+ v.ret(v.new_expr("{arguments[0]}?1:0", ret.as(not null)))
+ return true
+ else if pname == "==" then
+ v.ret(v.equal_test(arguments[0], arguments[1]))
+ return true
+ else if pname == "!=" then
+ var res = v.equal_test(arguments[0], arguments[1])
+ v.ret(v.new_expr("!{res}", ret.as(not null)))
+ return true
+ end
+ else if cname == "Float" then
+ if pname == "output" then
+ v.add "if({arguments[0]} == Double.POSITIVE_INFINITY) \{"
+ v.add "System.out.println(\"inf\");"
+ v.add "\} else if({arguments[0]} == Double.POSITIVE_INFINITY) \{"
+ v.add "System.out.println(\"-inf\");"
+ v.add "\} else \{"
+ var df = v.get_name("df")
+ v.add "java.text.DecimalFormat {df} = new java.text.DecimalFormat(\"0.000000\");"
+ v.add "System.out.println({df}.format({arguments[0]}));"
+ v.add "\}"
+ v.ret(v.null_instance)
+ return true
+ else if pname == "object_id" then
+ v.ret(v.new_expr("(int){arguments[0]}", ret.as(not null)))
+ return true
+ else if pname == "+" then
+ v.ret(v.new_expr("{arguments[0]} + {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == "-" then
+ v.ret(v.new_expr("{arguments[0]} - {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == "unary -" then
+ v.ret(v.new_expr("-{arguments[0]}", ret.as(not null)))
+ return true
+ else if pname == "unary +" then
+ v.ret(arguments[0])
+ return true
+ else if pname == "succ" then
+ v.ret(v.new_expr("{arguments[0]} + 1", ret.as(not null)))
+ return true
+ else if pname == "prec" then
+ v.ret(v.new_expr("{arguments[0]} - 1", ret.as(not null)))
+ return true
+ else if pname == "*" then
+ v.ret(v.new_expr("{arguments[0]} * {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == "/" then
+ v.ret(v.new_expr("{arguments[0]} / {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == "==" then
+ v.ret(v.equal_test(arguments[0], arguments[1]))
+ return true
+ else if pname == "!=" then
+ var res = v.equal_test(arguments[0], arguments[1])
+ v.ret(v.new_expr("!{res}", ret.as(not null)))
+ return true
+ else if pname == "<" then
+ v.ret(v.new_expr("{arguments[0]} < {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == ">" then
+ v.ret(v.new_expr("{arguments[0]} > {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == "<=" then
+ v.ret(v.new_expr("{arguments[0]} <= {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == ">=" then
+ v.ret(v.new_expr("{arguments[0]} >= {arguments[1]}", ret.as(not null)))
+ return true
+ else if pname == "to_i" then
+ v.ret(v.new_expr("(int){arguments[0]}", ret.as(not null)))
+ return true
+ else if pname == "to_b" then
+ v.ret(v.new_expr("(byte){arguments[0]}", ret.as(not null)))
+ return true
+ end
+ end
+ if pname == "exit" then
+ v.add("System.exit({arguments[1]});")
+ v.ret(v.null_instance)
+ return true
+ else if pname == "sys" then
+ # TODO singleton
+ var main_type = v.compiler.mainmodule.sys_type.as(not null)
+ var sys = main_type.mclass
+ v.ret(v.new_expr("new RTVal({sys.rt_name}.get{sys.rt_name}())", main_type))
+ return true
+ else if pname == "object_id" then
+ v.ret(v.new_expr("{arguments[0]}.hashCode()", ret.as(not null)))
+ return true
+ else if pname == "is_same_type" then
+ v.ret(v.is_same_type_test(arguments[0], arguments[1]))
+ return true
+ else if pname == "is_same_instance" then
+ v.ret(v.equal_test(arguments[0], arguments[1]))
+ return true
+ else if pname == "output_class_name" then
+ v.add("System.out.println({arguments[0]}.rtclass.class_name);")
+ v.ret(v.null_instance)
+ return true
+ end
+ return false
+ end
+end
+
+redef class AAttrPropdef
+ redef fun compile_to_java(v, mpropdef, arguments) do
+ v.current_node = self
+ if mpropdef == mreadpropdef then
+ compile_getter(v, mpropdef, arguments)
+ else if mpropdef == mwritepropdef then
+ compile_setter(v, mpropdef, arguments)
+ else
+ abort
+ end
+ v.current_node = null
+ end
+
+ # Compile the setter method
+ private fun compile_setter(v: JavaCompilerVisitor, mpropdef: MPropDef, arguments: Array[RuntimeVariable]) do
+ var mtype = v.compiler.mainmodule.object_type
+ var recv = arguments.first
+ var val = v.new_expr("args[1]", mtype)
+ v.write_attribute(self.mpropdef.as(not null).mproperty, recv, val)
+ v.ret v.null_instance
+ end
+
+ # Compile the getter method
+ private fun compile_getter(v: JavaCompilerVisitor, mpropdef: MPropDef, arguments: Array[RuntimeVariable]) do
+ var recv = arguments.first
+ v.ret v.read_attribute(self.mpropdef.as(not null).mproperty, recv)
+ end
+
+ private fun init_expr(v: JavaCompilerVisitor, recv: RuntimeVariable) do
+ if has_value and not is_lazy and not n_expr isa ANullExpr then evaluate_expr(v, recv)
+ end
+
+ # Evaluate, store and return the default value of the attribute
+ private fun evaluate_expr(v: JavaCompilerVisitor, recv: RuntimeVariable): RuntimeVariable do
+ var old = v.frame
+ var frame = new JavaStaticFrame(v, self.mreadpropdef.as(not null), recv.mcasttype.undecorate.as(MClassType), [recv])
+ v.frame = frame
+
+ var value
+ var mtype = self.mtype
+ assert mtype != null
+
+ var nexpr = self.n_expr
+ var nblock = self.n_block
+ if nexpr != null then
+ value = v.expr(nexpr, mtype)
+ else if nblock != null then
+ value = v.new_var(mtype)
+ frame.returnvar = value
+ frame.returnlabel = v.get_name("RET_LABEL")
+ v.add("{frame.returnlabel.as(not null)}: \{")
+ v.stmt(nblock)
+ v.add("\}")
+ else
+ abort
+ end
+
+ v.write_attribute(self.mpropdef.as(not null).mproperty, recv, value)
+ v.frame = old
+ return value
+ end
+end
+
+redef class AExpr
+ # Try to compile self as an expression
+ # Do not call this method directly, use `v.expr` instead
+ private fun expr(v: JavaCompilerVisitor): nullable RuntimeVariable do
+ v.info("NOT YET IMPLEMENTED {class_name}::expr")
+ return null
+ end
+
+ # Try to compile self as a statement
+ # Do not call this method directly, use `v.stmt` instead
+ private fun stmt(v: JavaCompilerVisitor) do expr(v)
+end
+
+redef class ABlockExpr
+ redef fun stmt(v)
+ do
+ for e in self.n_expr do v.stmt(e)
+ end
+ redef fun expr(v)
+ do
+ var last = self.n_expr.last
+ for e in self.n_expr do
+ if e == last then break
+ v.stmt(e)
+ end
+ return v.expr(last, null)
+ end
+end
+
+redef class ASendExpr
+ redef fun expr(v) do
+ var recv = v.expr(n_expr, null)
+ var callsite = callsite.as(not null)
+ var args = v.varargize(callsite.mpropdef, callsite.signaturemap, recv, raw_arguments)
+ return v.compile_callsite(callsite, args)
+ end
+end
+
+redef class ANewExpr
+ redef fun expr(v)
+ do
+ var mtype = self.recvtype
+ assert mtype != null
+
+ if mtype.mclass.name == "NativeArray" then
+ # TODO handle native arrays
+ v.info("NOT YET IMPLEMENTED new NativeArray")
+ end
+
+ var recv = v.init_instance(mtype)
+
+ var callsite = self.callsite
+ if callsite == null then return recv
+
+ var args = v.varargize(callsite.mpropdef, callsite.signaturemap, recv, self.n_args.n_exprs)
+ var res2 = v.compile_callsite(callsite, args)
+ if res2 != null then
+ return res2
+ end
+ return recv
+ end
+end
+
+redef class ASuperExpr
+ redef fun expr(v)
+ do
+ var frame = v.frame
+ assert frame != null
+ var recv = frame.arguments.first
+
+ var callsite = self.callsite
+ if callsite != null then
+ var args
+
+ if self.n_args.n_exprs.is_empty then
+ # Add automatic arguments for the super init call
+ args = [recv]
+ for i in [0..callsite.msignature.arity[ do
+ args.add(frame.arguments[i+1])
+ end
+ else
+ args = v.varargize(callsite.mpropdef, callsite.signaturemap, recv, self.n_args.n_exprs)
+ end
+
+ # Super init call
+ var res = v.compile_callsite(callsite, args)
+ return res
+ end
+
+ var mpropdef = self.mpropdef.as(not null)
+
+ var args
+ if self.n_args.n_exprs.is_empty then
+ args = frame.arguments
+ else
+ args = v.varargize(mpropdef, signaturemap, recv, self.n_args.n_exprs)
+ end
+
+ # Standard call-next-method
+ return v.supercall(mpropdef, recv.mtype.as(MClassType), args)
+ end
+end
+
+redef class ASelfExpr
+ redef fun expr(v) do return v.frame.as(not null).arguments.first
+end
+
+redef class AImplicitSelfExpr
+ redef fun expr(v) do return v.frame.as(not null).arguments.first
+end
+
+redef class AAttrExpr
+ redef fun expr(v) do
+ var recv = v.expr(self.n_expr, null)
+ var mproperty = self.mproperty.as(not null)
+ return v.read_attribute(mproperty, recv)
+ end
+end
+
+redef class AAttrAssignExpr
+ redef fun expr(v) do
+ var recv = v.expr(self.n_expr, null)
+ var i = v.expr(self.n_value, null)
+ var mproperty = self.mproperty.as(not null)
+ v.write_attribute(mproperty, recv, i)
+ return i
+ end
+end
+
+redef class AAttrReassignExpr
+ redef fun stmt(v) do
+ var recv = v.expr(self.n_expr, null)
+ var value = v.expr(self.n_value, null)
+ var mproperty = self.mproperty.as(not null)
+ var attr = v.read_attribute(mproperty, recv)
+ var res = v.compile_callsite(self.reassign_callsite.as(not null), [attr, value])
+ assert res != null
+ v.write_attribute(mproperty, recv, res)
+ end
+end
+
+redef class AIssetAttrExpr
+ redef fun expr(v) do
+ var recv = v.expr(self.n_expr, null)
+ var mproperty = self.mproperty.as(not null)
+ return v.isset_attribute(mproperty, recv)
+ end
+end
+
+redef class AReturnExpr
+ redef fun stmt(v) do
+ var nexpr = self.n_expr
+ var frame = v.frame
+ assert frame != null
+ if nexpr != null then
+ v.ret(v.expr(nexpr, frame.returnvar.as(not null).mtype))
+ else
+ v.ret(v.null_instance)
+ end
+ end
+end
+
+redef class AIfExpr
+ redef fun stmt(v) do
+ var cond = v.expr_bool(self.n_expr)
+ v.add("if ({cond})\{")
+ v.stmt(self.n_then)
+ v.add("\} else \{")
+ v.stmt(self.n_else)
+ v.add("\}")
+ end
+
+ redef fun expr(v) do
+ var res = v.new_var(self.mtype.as(not null))
+ var cond = v.expr_bool(self.n_expr)
+ v.add("if ({cond})\{")
+ v.assign(res, v.expr(self.n_then.as(not null), null))
+ v.add("\} else \{")
+ v.assign(res, v.expr(self.n_else.as(not null), null))
+ v.add("\}")
+ return res
+ end
+end
+
+redef class ADoExpr
+ redef fun stmt(v)
+ do
+ v.add_escape_label(break_mark)
+ v.add "\{"
+ v.stmt(self.n_block)
+ v.add "\}"
+ end
+end
+
+redef class AWhileExpr
+ redef fun stmt(v)
+ do
+ v.add_escape_label(break_mark)
+ v.add_escape_label(continue_mark)
+ v.add("for(;;) \{")
+ var cond = v.expr_bool(self.n_expr)
+ v.add("if (!{cond}) break;")
+ v.stmt(self.n_block)
+ v.add("\}")
+ end
+end
+
+redef class ALoopExpr
+ redef fun stmt(v)
+ do
+ v.add_escape_label(break_mark)
+ v.add_escape_label(continue_mark)
+ v.add("for(;;) \{")
+ v.stmt(self.n_block)
+ v.add("\}")
+ end
+end
+
+redef class AEscapeExpr
+ redef fun stmt(v) do v.add("break BREAK_{v.escapemark_name(escapemark)};")
+end
+
+redef class AVardeclExpr
+ redef fun stmt(v) do
+ var variable = self.variable.as(not null)
+ var ne = self.n_expr
+ var decl = v.variable(variable)
+ if ne != null then
+ var i = v.expr(ne, variable.declared_type)
+ v.assign(decl, i)
+ end
+ end
+end
+
+redef class AVarExpr
+ redef fun expr(v) do
+ return v.variable(self.variable.as(not null))
+ end
+end
+
+redef class AVarAssignExpr
+ redef fun expr(v) do
+ var variable = self.variable.as(not null)
+ var i = v.expr(self.n_value, variable.declared_type)
+ v.assign(v.variable(variable), i)
+ return i
+ end
+end
+
+
+redef class AAssertExpr
+ redef fun stmt(v) do
+ var cond = v.expr_bool(self.n_expr)
+ v.add("if (!{cond}) \{")
+ v.stmt(self.n_else)
+ var nid = self.n_id
+ if nid != null then
+ v.add_abort("Assert '{nid.text}' failed")
+ else
+ v.add_abort("Assert failed")
+ end
+ v.add("\}")
+ end
+end
+
+redef class AImpliesExpr
+ redef fun expr(v) do
+ var res = v.new_var(mtype.as(not null))
+ var i1 = v.expr_bool(n_expr)
+ v.add("if (!{i1}) \{")
+ v.add("{res} = true;")
+ v.add("\} else \{")
+ var i2 = v.expr_bool(n_expr2)
+ v.add("{res} = {i2};")
+ v.add("\}")
+ return res
+ end
+end
+
+redef class AOrElseExpr
+ redef fun expr(v)
+ do
+ var res = v.new_var(self.mtype.as(not null))
+ var i1 = v.expr(self.n_expr, null)
+ v.add("if ({i1} != null && !{i1}.is_null()) \{")
+ v.assign(res, i1)
+ v.add("\} else \{")
+ var i2 = v.expr(self.n_expr2, null)
+ v.assign(res, i2)
+ v.add("\}")
+ return res
+ end
+end
+
+redef class AOrExpr
+ redef fun expr(v) do
+ var res = v.new_var(self.mtype.as(not null))
+ var i1 = v.expr_bool(self.n_expr)
+ v.add("if ({i1}) \{")
+ v.add("{res} = true;")
+ v.add("\} else \{")
+ var i2 = v.expr_bool(self.n_expr2)
+ v.add("{res} = {i2};")
+ v.add("\}")
+ return res
+ end
+end
+
+redef class AAndExpr
+ redef fun expr(v) do
+ var res = v.new_var(self.mtype.as(not null))
+ var i1 = v.expr_bool(self.n_expr)
+ v.add("if (!{i1}) \{")
+ v.add("{res} = false;")
+ v.add("\} else \{")
+ var i2 = v.expr_bool(self.n_expr2)
+ v.add("{res} = {i2};")
+ v.add("\}")
+ return res
+ end
+end
+
+redef class ANotExpr
+ redef fun expr(v) do
+ var cond = v.expr_bool(self.n_expr)
+ return v.new_expr("!{cond}", self.mtype.as(not null))
+ end
+end
+
+redef class AIntegerExpr
+ redef fun expr(v) do
+ if value isa Int then
+ return v.int_instance(self.value.as(Int))
+ else if value isa Byte then
+ return v.byte_instance(self.value.as(Byte))
+ else
+ # Should not happen
+ abort
+ end
+ end
+end
+
+redef class AFloatExpr
+ redef fun expr(v) do return v.float_instance("{self.n_float.text}") # FIXME use value, not n_float
+end
+
+redef class ACharExpr
+ redef fun expr(v) do return v.char_instance(self.value.as(not null))
+end
+
+redef class ATrueExpr
+ redef fun expr(v) do return v.bool_instance(true)
+end
+
+redef class AFalseExpr
+ redef fun expr(v) do return v.bool_instance(false)
+end
+
+redef class ANullExpr
+ redef fun expr(v) do return v.null_instance
+end
+
+redef class AAsCastExpr
+ redef fun expr(v)
+ do
+ var i = v.expr(n_expr, null)
+ v.add_cast(i, mtype.as(not null))
+ return i
+ end
+end
+
+redef class AAsNotnullExpr
+ redef fun expr(v) do
+ var i = v.expr(n_expr, null)
+ if i.mtype.is_java_primitive then return i
+
+ v.add("if ({i} == null || {i}.is_null()) \{")
+ v.add_abort("Cast failed")
+ v.add("\}")
+ return i
+ end
+end
+
+redef class AIsaExpr
+ redef fun expr(v)
+ do
+ var i = v.expr(self.n_expr, null)
+ var cast_type = self.cast_type
+ if cast_type == null then return null # no-no on broken node
+ return v.type_test(i, cast_type)
+ end
+end
+
+redef class AParExpr
+ redef fun expr(v) do return v.expr(self.n_expr, null)
+end
+
+redef class AAbortExpr
+ redef fun stmt(v) do v.add_abort("Aborted")
+end
+
+redef class ADebugTypeExpr
+ redef fun stmt(v) do end # do nothing
+end
var v = new_visitor
var rta = runtime_type_analysis
- var is_dead = rta != null and not rta.live_classes.has(mclass) and not mtype.is_c_primitive and mclass.name != "NativeArray" and mclass.name != "Pointer"
+ var is_dead = rta != null and not rta.live_classes.has(mclass)
+ # While the class may be dead, some part of separately compiled code may use symbols associated to the class, so
+ # in order to compile and link correctly the C code, these symbols should be declared and defined.
+ var need_corpse = is_dead and mtype.is_c_primitive or mclass.kind == extern_kind or mclass.kind == enum_kind
- v.add_decl("/* runtime class {c_name} */")
+ v.add_decl("/* runtime class {c_name}: {mclass.full_name} (dead={is_dead}; need_corpse={need_corpse})*/")
# Build class vft
- if not is_dead then
+ if not is_dead or need_corpse then
self.provide_declaration("class_{c_name}", "extern const struct class class_{c_name};")
v.add_decl("const struct class class_{c_name} = \{")
v.add_decl("{self.box_kind_of(mclass)}, /* box_kind */")
self.header.add_decl("{mtype.ctype_extern} value;")
self.header.add_decl("\};")
- if not rta.live_types.has(mtype) and mtype.mclass.name != "Pointer" then return
+ # Pointer is needed by extern types, live or not
+ if is_dead and mtype.mclass.name != "Pointer" then return
#Build BOX
self.provide_declaration("BOX_{c_name}", "val* BOX_{c_name}({mtype.ctype_extern});")
v.add("return (val*)res;")
v.add("\}")
+ # A Pointer class also need its constructor
if mtype.mclass.name != "Pointer" then return
v = new_visitor
var pointer_type = mainmodule.pointer_type
self.provide_declaration("NEW_{c_name}", "{mtype.ctype} NEW_{c_name}(const struct type* type);")
- v.add_decl("/* allocate {mtype} */")
+ v.add_decl("/* allocate extern {mtype} */")
v.add_decl("{mtype.ctype} NEW_{c_name}(const struct type* type) \{")
if is_dead then
v.add_abort("{mclass} is DEAD")
end
return self.new_expr("((struct instance_{mtype.c_name}*){value})->value; /* autounbox from {value.mtype} to {mtype} */", mtype)
else if not mtype.is_c_primitive then
+ assert value.mtype == value.mcasttype
if value.mtype.is_tagged then
+ var res
if value.mtype.name == "Int" then
- return self.new_expr("(val*)({value}<<2|1)", mtype)
+ res = self.new_expr("(val*)({value}<<2|1)", mtype)
else if value.mtype.name == "Char" then
- return self.new_expr("(val*)((long)({value})<<2|2)", mtype)
+ res = self.new_expr("(val*)((long)({value})<<2|2)", mtype)
else if value.mtype.name == "Bool" then
- return self.new_expr("(val*)((long)({value})<<2|3)", mtype)
+ res = self.new_expr("(val*)((long)({value})<<2|3)", mtype)
else
abort
end
+ # Do not loose type info
+ res.mcasttype = value.mcasttype
+ return res
end
var valtype = value.mtype.as(MClassType)
if mtype isa MClassType and mtype.mclass.kind == extern_kind and mtype.mclass.name != "NativeString" then
valtype = compiler.mainmodule.pointer_type
end
var res = self.new_var(mtype)
- if compiler.runtime_type_analysis != null and not compiler.runtime_type_analysis.live_types.has(valtype) then
- self.add("/*no autobox from {value.mtype} to {mtype}: {value.mtype} is not live! */")
- self.add("PRINT_ERROR(\"Dead code executed!\\n\"); fatal_exit(1);")
- return res
- end
+ # Do not loose type info
+ res.mcasttype = value.mcasttype
self.require_declaration("BOX_{valtype.c_name}")
self.add("{res} = BOX_{valtype.c_name}({value}); /* autobox from {value.mtype} to {mtype} */")
return res
mtype.mclass.name != "NativeString" then
var valtype = compiler.mainmodule.pointer_type
var res = self.new_var(mtype)
- if compiler.runtime_type_analysis != null and not compiler.runtime_type_analysis.live_types.has(value.mtype.as(MClassType)) then
- self.add("/*no boxing of {value.mtype}: {value.mtype} is not live! */")
- self.add("PRINT_ERROR(\"Dead code executed!\\n\"); fatal_exit(1);")
- return res
- end
+ compiler.undead_types.add(mtype)
self.require_declaration("BOX_{valtype.c_name}")
self.add("{res} = BOX_{valtype.c_name}({value}); /* boxing {value.mtype} */")
self.require_declaration("type_{mtype.c_name}")
var id: String is writable
# Item title if any.
- var title: nullable String
+ var title: nullable String is writable
# Does `self` have a `parent`?
fun is_root: Bool do return parent == null
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Parsing of commands understood by documentation tools.
+#
+# This can be through:
+# * `nitx` commands like `code: MEntity::name`
+# * `nitdoc` wikilinks like `[[doc: MEntity::name]]`
+module doc_commands
+
+import doc_base
+
+# A command aimed at a documentation tool like `nitdoc` or `nitx`.
+#
+# `DocCommand` are generally of the form `command: args`.
+interface DocCommand
+
+ # Original command string.
+ fun string: String is abstract
+
+ # Command name.
+ fun name: String is abstract
+
+ # Command arguments.
+ #
+ # FIXME: define a syntax
+ fun args: Array[String] is abstract
+
+ # Command factory.
+ #
+ # Returns a concrete instance of `DocCommand` depending on the string.
+ new(command_string: String) do
+ if command_string.has_prefix("doc:") then
+ return new ArticleCommand(command_string)
+ else if command_string.has_prefix("comment:") then
+ return new CommentCommand(command_string)
+ else if command_string.has_prefix("list:") then
+ return new ListCommand(command_string)
+ else if command_string.has_prefix("param:") then
+ return new ParamCommand(command_string)
+ else if command_string.has_prefix("return:") then
+ return new ReturnCommand(command_string)
+ else if command_string.has_prefix("new:") then
+ return new NewCommand(command_string)
+ else if command_string.has_prefix("call:") then
+ return new CallCommand(command_string)
+ else if command_string.has_prefix("code:") then
+ return new CodeCommand(command_string)
+ end
+ return new UnknownCommand(command_string)
+ end
+
+ redef fun to_s do return string
+end
+
+# Used to factorize initialization of DocCommands.
+abstract class AbstractDocCommand
+ super DocCommand
+
+ redef var string
+ redef var name is noinit
+ redef var args = new Array[String]
+
+ init do
+ # parse command
+ var str = new FlatBuffer
+ var i = 0
+ while i < string.length do
+ var c = string[i]
+ i += 1
+ if c == ':' then break
+ str.add c
+ end
+ name = str.write_to_string
+ # parse args
+ args.add string.substring_from(i).trim
+ end
+end
+
+# A `DocCommand` not recognized by documentation tools.
+#
+# Used to provide warnings or any other behavior for unexisting commands.
+class UnknownCommand
+ super AbstractDocCommand
+end
+
+# A `DocCommand` that includes the documentation article of a `MEntity`.
+#
+# Syntax: `doc: MEntity::name`.
+class ArticleCommand
+ super AbstractDocCommand
+end
+
+# A `DocCommand` that includes the MDoc of a `MEntity`.
+#
+# Syntax: `comment: MEntity::name`.
+class CommentCommand
+ super AbstractDocCommand
+end
+
+# A `DocCommand` that includes a list of something.
+#
+# Syntax: `list:kind: <arg>`.
+class ListCommand
+ super AbstractDocCommand
+end
+
+# A `DocCommand` that includes the list of methods tanking a `MType` as parameter.
+#
+# Syntax: `param: MType`.
+class ParamCommand
+ super AbstractDocCommand
+end
+
+# A `DocCommand` that includes the list of methods returning a `MType` as parameter.
+#
+# Syntax: `param: MType`.
+class ReturnCommand
+ super AbstractDocCommand
+end
+
+# A `DocCommand` that includes the list of methods creating new instances of a specific `MType`
+#
+# Syntax: `new: MType`.
+class NewCommand
+ super AbstractDocCommand
+end
+
+# A `DocCommand` that includes the list of methods calling a specific `MProperty`.
+#
+# Syntax: `call: MEntity::name`.
+class CallCommand
+ super AbstractDocCommand
+end
+
+# A `DocCommand` that includes the source code of a `MEntity`.
+#
+# Syntax:
+# * `code: MEntity::name`
+# * `./src/file.nit` to include source code from a file.
+# * `./src/file.nit:1,2--3,4` to select code between positions.
+class CodeCommand
+ super AbstractDocCommand
+end
private import parser_util
redef class MDoc
- # Comment synopsys HTML escaped
- var short_comment: String is lazy do return content.first.html_escape
- # Full comment HTML escaped
- var full_comment: String is lazy do return content.join("\n").html_escape
+ # Synopsis HTML escaped.
+ var synopsis: String is lazy do return content.first.html_escape
+
+ # Comment without synopsis HTML escaped
+ var comment: String is lazy do
+ var lines = content.to_a
+ if not lines.is_empty then lines.shift
+ return content.join("\n").html_escape
+ end
+
+ # Full comment HTML escaped.
+ var documentation: String is lazy do return content.join("\n").html_escape
private var markdown_proc: MarkdownProcessor is lazy do
return original_mentity.model.nitdoc_md_processor
return original_mentity.model.nitdoc_inline_processor
end
- # Synopsys in a template
- var tpl_short_comment: Writable is lazy do
+ # Renders the synopsis as a HTML comment block.
+ var html_synopsis: Writable is lazy do
var res = new Template
var syn = inline_proc.process(content.first)
res.add "<span class=\"synopsys nitdoc\">{syn}</span>"
end
- # Full comment in a template
- var tpl_comment: Writable is lazy do
- var res = new Template
+ # Renders the comment without the synopsis as a HTML comment block.
+ var html_comment: Writable is lazy do
var lines = content.to_a
+ if not lines.is_empty then lines.shift
+ return lines_to_html(lines)
+ end
+
+ # Renders the synopsis and the comment as a HTML comment block.
+ var html_documentation: Writable is lazy do return lines_to_html(content.to_a)
+
+ # Renders markdown line as a HTML comment block.
+ private fun lines_to_html(lines: Array[String]): Writable do
+ var res = new Template
res.add "<div class=\"nitdoc\">"
# do not use DocUnit as synopsys
- if not content.first.has_prefix(" ") and
- not content.first.has_prefix("\t") then
- # parse synopsys
- var syn = inline_proc.process(lines.shift)
- res.add "<p class=\"synopsys\">{syn}</p>"
+ if not lines.is_empty then
+ if not lines.first.has_prefix(" ") and
+ not lines.first.has_prefix("\t") then
+ # parse synopsys
+ var syn = inline_proc.process(lines.shift)
+ res.add "<p class=\"synopsys\">{syn}</p>"
+ end
end
# check for annotations
for i in [0 .. lines.length[ do
res.add markdown_proc.process(lines.join("\n"))
res.add "</div>"
return res
+
end
end
redef class Model
# Get a markdown processor for Nitdoc comments.
- private var nitdoc_md_processor: MarkdownProcessor is lazy do
+ var nitdoc_md_processor: MarkdownProcessor is lazy do
var proc = new MarkdownProcessor
proc.emitter.decorator = new NitdocDecorator
return proc
# Get a markdown inline processor for Nitdoc comments.
#
# This processor is specificaly designed to inlinable doc elements like synopsys.
- private var nitdoc_inline_processor: MarkdownProcessor is lazy do
+ var nitdoc_inline_processor: MarkdownProcessor is lazy do
var proc = new MarkdownProcessor
proc.emitter.decorator = new InlineDecorator
return proc
module doc_console
import semantize
+import doc_commands
import doc_extract
import doc_poset
import doc::console_templates
# Processes the query string and performs it.
fun do_query(str: String) do
- var query = new NitxQuery(str)
+ var query = new DocCommand(str)
if query isa NitxCommand then
query.execute(self)
return
end
end
-# A query performed on Nitx.
-#
-# Queries are responsible to collect matching results and render them as a
-# DocPage.
-#
-# Used as a factory to concrete instances.
-interface NitxQuery
-
- # Original query string.
- fun query_string: String is abstract
+redef interface DocCommand
- # Query factory.
- #
- # Will return a concrete instance of NitxQuery.
- new(query_string: String) do
+ redef new(query_string) do
if query_string == ":q" then
return new NitxQuit
else if query_string == ":h" then
return new NitxHelp
- else if query_string.has_prefix("comment:") then
- return new CommentQuery(query_string)
- else if query_string.has_prefix("doc:") then
- return new DocQuery(query_string)
- else if query_string.has_prefix("param:") then
- return new ParamQuery(query_string)
- else if query_string.has_prefix("return:") then
- return new ReturnQuery(query_string)
- else if query_string.has_prefix("new:") then
- return new NewQuery(query_string)
- else if query_string.has_prefix("call:") then
- return new CallQuery(query_string)
- else if query_string.has_prefix("code:") then
- return new CodeQuery(query_string)
- else if query_string.has_prefix("parents:") then
- return new ParentsQuery(query_string)
- else if query_string.has_prefix("ancestors:") then
- return new AncestorsQuery(query_string)
- else if query_string.has_prefix("children:") then
- return new ChildrenQuery(query_string)
- else if query_string.has_prefix("descendants:") then
- return new DescendantsQuery(query_string)
end
- return new CommentQuery("comment: {query_string}")
+ var cmd = super(query_string)
+ if cmd isa UnknownCommand then
+ return new CommentCommand("comment: {query_string}")
+ end
+ return cmd
end
# Looks up the `doc` model and returns possible matches.
# Pretty prints the results for the console.
fun make_results(nitx: Nitx, results: Array[NitxMatch]): DocPage do
var page = new DocPage("results", "Results")
- page.root.add_child(new QueryResultArticle("results.article", "Results", self, results))
+ page.root.add_child(new QueryResultArticle("results", "Results", self, results))
return page
end
-
- redef fun to_s do return query_string
end
-# Something that matches a `NitxQuery`.
+# Something that matches a `DocCommand`.
abstract class NitxMatch
# Query matched by `self`.
- var query: NitxQuery
+ var query: DocCommand
# Pretty prints `self` for console.
fun make_list_item: String is abstract
end
-# A query that contains a meta command.
-#
-# In Nitx, commands are written such as `command: args...`.
-abstract class MetaQuery
- super NitxQuery
-
- redef var query_string
-
- # Meta command used.
- var command: String is noinit
-
- # Arguments passed to the `command`.
- var args = new Array[String]
-
- init do
- # parse command
- var str = new FlatBuffer
- var i = 0
- while i < query_string.length do
- var c = query_string[i]
- i += 1
- if c == ':' then break
- str.add c
- end
- command = str.write_to_string
- # parse args
- args.add query_string.substring_from(i).trim
- end
-end
-
-# A match between a `NitxQuery` and a `MEntity`.
+# A match between a `DocCommand` and a `MEntity`.
class MEntityMatch
super NitxMatch
redef fun make_list_item do return mentity.cs_list_item
end
-# A query to search a `MEntity` comment by its name or namespace.
-class CommentQuery
- super MetaQuery
-
+redef class CommentCommand
redef fun perform(nitx, doc) do
var name = args.first
var res = new Array[NitxMatch]
if len == 1 then
var res = results.first.as(MEntityMatch)
var mentity = res.mentity
- var page = new DocPage("results", "Results")
- var article = new DefinitionArticle("results.article", "Results", mentity)
+ var page = new DocPage("resultats", "Results")
+ var article = new DefinitionArticle("results", "Results", mentity)
article.cs_title = mentity.name
article.cs_subtitle = mentity.cs_declaration
page.root.add_child article
end
# A query to search signatures using a specific `MType` as parameter.
-class ParamQuery
- super MetaQuery
-
+redef class ParamCommand
redef fun perform(nitx, doc) do
var res = new Array[NitxMatch]
var mtype_name = args.first
end
# A query to search signatures using a specific `MType` as return.
-class ReturnQuery
- super MetaQuery
-
+redef class ReturnCommand
redef fun perform(nitx, doc) do
var res = new Array[NitxMatch]
var mtype_name = args.first
end
# A query to search methods creating new instances of a specific `MType`.
-class NewQuery
- super MetaQuery
-
+redef class NewCommand
redef fun perform(nitx, doc) do
var res = new Array[NitxMatch]
var mtype_name = args.first
end
# A query to search methods calling a specific `MProperty`.
-class CallQuery
- super MetaQuery
-
+redef class CallCommand
redef fun perform(nitx, doc) do
var res = new Array[NitxMatch]
var mprop_name = args.first
end
# A query to search a Nitdoc documentation page by its name.
-class DocQuery
- super MetaQuery
-
+redef class ArticleCommand
redef fun perform(nitx, doc) do
var res = new Array[NitxMatch]
var name = args.first
# It actually searches for pages about the mentity and extracts the
# pre-calculated hierarchies by the `doc_post` phase.
abstract class HierarchiesQuery
- super DocQuery
+ super DocCommand
redef fun make_results(nitx, results) do
var page = new DocPage("hierarchy", "Hierarchy")
end
# A query to search source code from a file name.
-class CodeQuery
- super MetaQuery
-
+redef class CodeCommand
# FIXME refactor this!
redef fun perform(nitx, doc) do
var res = new Array[NitxMatch]
redef fun make_results(nitx, results) do
var page = new DocPage("results", "Code Results")
for res in results do
- page.add new CodeQueryArticle("results.article", "Results", self, res.as(CodeMatch))
+ page.add new CodeQueryArticle("results", "Results", self, res.as(CodeMatch))
end
return page
end
# These commands are prefixed with `:` and are used to control the execution of
# `nitx` like displaying the help or quiting.
interface NitxCommand
- super NitxQuery
+ super DocCommand
# Executes the command.
fun execute(nitx: Nitx) is abstract
do
node.visit_all(self)
if not node isa ASendExpr then return
- calls.add node.callsite.mproperty
+ calls.add node.callsite.as(not null).mproperty
end
end
super DocArticle
# Query linked to the results to display.
- var query: NitxQuery
+ var query: DocCommand
# Results to display.
var results: Array[NitxMatch]
redef fun render_title do
var len = results.length
if len == 0 then
- add "No result found for '{query.query_string}'..."
+ add "No result found for '{query.string}'..."
else
- add "# {len} result(s) for '{query.query_string}'".green.bold
+ add "# {len} result(s) for '{query.string}'".green.bold
end
end
super DocArticle
# The query linked to the result to display.
- var query: NitxQuery
+ var query: DocCommand
# The result to display.
var result: CodeMatch
end
redef class MEntityPage
- redef var html_url is lazy do return mentity.nitdoc_url
+ redef var html_url is lazy do
+ if mentity isa MGroup and mentity.mdoc != null then
+ return "api_{mentity.nitdoc_url}"
+ end
+ return mentity.nitdoc_url
+ end
+
redef fun init_title(v, doc) do title = mentity.html_name
end
# doc phases. This is to preserve the compatibility with the current
# `doc_templates` module.
+redef class ReadmePage
+ redef var html_url is lazy do return mentity.nitdoc_url
+
+ redef fun init_topmenu(v, doc) do
+ super
+ var mproject = mentity.mproject
+ if not mentity.is_root then
+ topmenu.add_li new ListItem(new Link(mproject.nitdoc_url, mproject.html_name))
+ end
+ topmenu.add_li new ListItem(new Link(html_url, mproject.html_name))
+ topmenu.active_item = topmenu.items.last
+ end
+
+ redef fun init_sidebar(v, doc) do
+ super
+ var api_lnk = """<a href="api_{{{mentity.nitdoc_url}}}">Go to API</a>"""
+ sidebar.boxes.unshift new DocSideBox(api_lnk, "")
+ end
+end
+
redef class MGroupPage
redef fun init_topmenu(v, doc) do
super
redef fun init_sidebar(v, doc) do
super
+ # README link
+ if mentity.mdoc != null then
+ var doc_lnk = """<a href="{{{mentity.nitdoc_url}}}">Go to README</a>"""
+ sidebar.boxes.unshift new DocSideBox(doc_lnk, "")
+ end
+ # MClasses list
var mclasses = new HashSet[MClass]
mclasses.add_all intros
mclasses.add_all redefs
var def_url = "{cls_url}#{mprop.nitdoc_id}.definition"
var lnk = new Link(def_url, mprop.html_name)
var mdoc = mprop.intro.mdoc_or_fallback
- if mdoc != null then lnk.title = mdoc.short_comment
+ if mdoc != null then lnk.title = mdoc.synopsis
var item = new Template
item.add new DocHTMLLabel.with_classes(classes)
item.add lnk
redef class GraphArticle
redef fun init_html_render(v, doc, page) do
- var output_dir = v.ctx.output_dir
- var path = output_dir / graph_id
- var path_sh = path.escape_to_sh
+ var path = v.ctx.output_dir / graph_id
var file = new FileWriter.open("{path}.dot")
file.write(dot)
file.close
- sys.system("\{ test -f {path_sh}.png && test -f {path_sh}.s.dot && diff -- {path_sh}.dot {path_sh}.s.dot >/dev/null 2>&1 ; \} || \{ cp -- {path_sh}.dot {path_sh}.s.dot && dot -Tpng -o{path_sh}.png -Tcmapx -o{path_sh}.map {path_sh}.s.dot ; \}")
- var fmap = new FileReader.open("{path}.map")
- self.map = fmap.read_all
- fmap.close
+ var proc = new ProcessReader("dot", "-Tsvg", "-Tcmapx", "{path}.dot")
+ var svg = new Buffer
+ var i = 0
+ while not proc.eof do
+ i += 1
+ if i < 6 then continue # skip dot default header
+ svg.append proc.read_line
+ end
+ proc.close
+ self.svg = svg.write_to_string
end
end
doc.add_page new OverviewPage("overview", "Overview")
doc.add_page new SearchPage("search", "Index")
for mgroup in doc.mgroups do
+ doc.add_page new ReadmePage(mgroup)
doc.add_page new MGroupPage(mgroup)
end
for mmodule in doc.mmodules do
redef var title is lazy do return mentity.nitdoc_name
end
+# A page that displays a `MGroup` README.
+class ReadmePage
+ super MEntityPage
+
+ redef type MENTITY: MGroup
+ redef var id is lazy do return "readme_{mentity.nitdoc_id}"
+end
+
# A documentation page about a MGroup.
class MGroupPage
super MEntityPage
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# This phase parses README files.
+module doc_readme
+
+import markdown::decorators
+intrude import markdown::wikilinks
+import doc_commands
+import doc_down
+import doc_intros_redefs
+
+# Generate content of `ReadmePage`.
+#
+# This phase extracts the structure of a `ReadmePage` from the markdown content
+# of the README file.
+# It also resolves Wikilinks and commands.
+class ReadmePhase
+ super DocPhase
+
+ redef fun apply do
+ for page in doc.pages.values do page.build_content(self, doc)
+ end
+
+ # Display a warning about something wrong in the readme file.
+ fun warning(location: nullable MDLocation, page: ReadmePage, message: String) do
+ var loc = null
+ if location != null then
+ loc = location.to_location(page.mentity.mdoc.location.file)
+ end
+ ctx.warning(loc, "readme-warning", message)
+ end
+end
+
+redef class DocPage
+ # Build content of `ReadmePage` based on the content of the readme file.
+ private fun build_content(v: ReadmePhase, doc: DocModel) do end
+end
+
+redef class ReadmePage
+ redef fun build_content(v, doc) do
+ if mentity.mdoc == null then
+ v.warning(null, self, "Empty README for group `{mentity}`")
+ return
+ end
+ var proc = new MarkdownProcessor
+ proc.emitter = new ReadmeMdEmitter(proc, self, v)
+ proc.emitter.decorator = new ReadmeDecorator
+ var md = mentity.mdoc.content.join("\n")
+ proc.process(md)
+ end
+end
+
+# Markdown emitter used to produce the `ReadmeArticle`.
+class ReadmeMdEmitter
+ super MarkdownEmitter
+
+ # Readme page being decorated.
+ var page: ReadmePage
+
+ # Phase used to access doc model and toolcontext.
+ var phase: ReadmePhase
+
+ init do open_article
+
+ # Push the article template on top of the buffer stack.
+ #
+ # Subsequent markdown writting will be done in the article template.
+ #
+ # See `ReadmeArticle::md`.
+ private fun push_article(article: ReadmeArticle) do
+ buffer_stack.add article.md
+ end
+
+ private var context = new Array[DocComposite]
+
+ # Creates a new ReadmeSection in `self.toc.page`.
+ #
+ # Called from `add_headline`.
+ private fun open_section(lvl: Int, title: String) do
+ var section = new ReadmeSection(title.escape_to_c, title, lvl, processor)
+ if current_section == null then
+ page.root.add_child(section)
+ else
+ current_section.add_child(section)
+ end
+ current_section = section
+ context.add section
+ end
+ private var current_section: nullable ReadmeSection is noinit
+
+ # Close the current section.
+ #
+ # Ensure `context.last isa ReadmeSection`.
+ private fun close_section do
+ assert context.last isa ReadmeSection
+ context.pop
+ if context.is_empty then
+ current_section = null
+ else
+ current_section = context.last.as(ReadmeSection)
+ end
+ end
+
+ # Add an article at current location.
+ #
+ # This closes the current article, inserts `article` then opens a new article.
+ private fun add_article(article: DocArticle) do
+ close_article
+ if current_section == null then
+ page.root.add_child(article)
+ else
+ current_section.add_child(article)
+ end
+ open_article
+ end
+
+ # Creates a new ReadmeArticle in `self.toc.page`.
+ #
+ # Called from `add_headline`.
+ private fun open_article do
+ var section: DocComposite = page.root
+ if current_section != null then section = current_section.as(not null)
+ var article = new ReadmeArticle("mdarticle-{section.children.length}", null, processor)
+ section.add_child(article)
+ context.add article
+ push_article article
+ end
+
+ # Close the current article.
+ #
+ # Ensure `context.last isa ReadmeArticle`.
+ fun close_article do
+ assert context.last isa ReadmeArticle
+ context.pop
+ pop_buffer
+ end
+end
+
+# MarkdownDecorator used to decorated the Readme file with links between doc entities.
+class ReadmeDecorator
+ super MdDecorator
+
+ redef type EMITTER: ReadmeMdEmitter
+
+ redef fun add_headline(v, block) do
+ var txt = block.block.first_line.value
+ var lvl = block.depth
+ if not v.context.is_empty then
+ v.close_article
+ while v.current_section != null do
+ if v.current_section.depth < lvl then break
+ v.close_section
+ end
+ end
+ v.open_section(lvl, txt)
+ v.open_article
+ end
+
+ redef fun add_wikilink(v, token) do
+ var link = token.link.to_s
+ var cmd = new DocCommand(link)
+ if cmd isa UnknownCommand then
+ # search MEntities by name
+ var res = v.phase.doc.mentities_by_name(link.to_s)
+ # no match, print warning and display wikilink as is
+ if res.is_empty then
+ v.phase.warning(token.location, v.page, "Link to unknown entity `{link}`")
+ super
+ else
+ add_mentity_link(v, res.first, token.name, token.comment)
+ end
+ return
+ end
+ cmd.render(v, token)
+ end
+
+ # Renders a link to a mentity.
+ private fun add_mentity_link(v: EMITTER, mentity: MEntity, name, comment: nullable Text) do
+ # TODO real link
+ var link = mentity.full_name
+ if name == null then name = mentity.name
+ if comment == null and mentity.mdoc != null then
+ comment = mentity.mdoc.synopsis
+ end
+ add_link(v, link, name, comment)
+ end
+end
+
+redef interface DocCommand
+
+ # Render the content of the doc command.
+ fun render(v: ReadmeMdEmitter, token: TokenWikiLink) is abstract
+
+ # Search `doc` model for mentities match `string`.
+ fun search_model(doc: DocModel, string: String): Array[MEntity] do
+ var res
+ if string.has("::") then
+ res = doc.mentities_by_namespace(string).to_a
+ else
+ res = doc.mentities_by_name(string).to_a
+ end
+ return res
+ end
+end
+
+redef class ArticleCommand
+ redef fun render(v, token) do
+ var string = args.first
+ var res = search_model(v.phase.doc, string)
+ res = filter_results(res)
+ if res.is_empty then
+ v.phase.warning(
+ token.location, v.page,
+ "Try to include documentation of unknown entity `{args.first}`")
+ return
+ end
+ if res.length > 1 then
+ v.phase.warning(token.location, v.page, "conflicting article for `{args.first}` (choices : {res.join(", ")})")
+ end
+ v.add_article new DocumentationArticle("readme", "Readme", res.first)
+ end
+
+ private fun filter_results(res: Array[MEntity]): Array[MEntity] do
+ var out = new Array[MEntity]
+ for e in res do
+ if e isa MProject then continue
+ if e isa MGroup then continue
+ out.add e
+ end
+ return out
+ end
+end
+
+redef class ListCommand
+ redef fun render(v, token) do
+ var string = args.first
+ var res = search_model(v.phase.doc, string)
+ if res.is_empty then
+ v.phase.warning(token.location, v.page, "include article for unknown entity `{args.first}`")
+ return
+ end
+ if res.length > 1 then
+ v.phase.warning(token.location, v.page, "conflicting article for `{args.first}` (choices : {res.join(", ")})")
+ end
+ var mentity = res.first
+ if mentity isa MModule then
+ v.add_article new MEntitiesListArticle("Classes", mentity.mclassdefs)
+ else if mentity isa MClass then
+ var mprops = mentity.collect_intro_mproperties(public_visibility)
+ v.add_article new MEntitiesListArticle("Methods", mprops.to_a)
+ else if mentity isa MClassDef then
+ v.add_article new MEntitiesListArticle("Methods", mentity.mpropdefs)
+ end
+ end
+end
+
+
+# A section found in a README.
+#
+# Produced by markdown headlines like `## Section 1.1`.
+class ReadmeSection
+ super DocSection
+
+ # The depth is based on the markdown headline depth.
+ redef var depth
+
+ # Markdown processor used to process the section title.
+ var markdown_processor: MarkdownProcessor
+
+ redef var is_hidden = false
+end
+
+# An article found in a README file.
+#
+# Basically, everything found in a README that is not a headline.
+class ReadmeArticle
+ super DocArticle
+
+ # Markdown processor used to process the article content.
+ var markdown_processor: MarkdownProcessor
+
+ # Markdown content of this article extracted from the README file.
+ var md = new FlatBuffer
+
+ redef fun is_hidden do return super and md.trim.is_empty
+end
+
+# Documentation Article to introduce from the directive `doc: Something`.
+#
+# TODO merge with DefinitionArticle once the html is simplified
+class DocumentationArticle
+ super MEntityArticle
+
+ redef var is_hidden = false
+end
+
+redef class MDLocation
+ # Translate a Markdown location in Nit location.
+ private fun to_location(file: nullable SourceFile): Location do
+ return new Location(file, line_start, line_end, column_start, column_end)
+ end
+end
var tpl = new Link(nitdoc_url, html_name)
var mdoc = mdoc_or_fallback
if mdoc != null then
- tpl.title = mdoc.short_comment
+ tpl.title = mdoc.synopsis
end
return tpl
end
var tpl = new Link("#{nitdoc_id}", html_name)
var mdoc = mdoc_or_fallback
if mdoc != null then
- tpl.title = mdoc.short_comment
+ tpl.title = mdoc.synopsis
end
return tpl
end
# * MPropdef: `mclassdef:mpropdef`
fun html_namespace: Template is abstract
- # Returns the comment of this MEntity formatted as HTML.
- var html_comment: nullable Writable is lazy do
+ # Returns the synopsis and the comment of this MEntity formatted as HTML.
+ var html_documentation: nullable Writable is lazy do
+ var mdoc = mdoc_or_fallback
+ if mdoc == null then return null
+ return mdoc.html_documentation
+ end
+
+ # Returns the synopsis of this MEntity formatted as HTML.
+ var html_synopsis: nullable Writable is lazy do
var mdoc = mdoc_or_fallback
if mdoc == null then return null
- return mdoc.tpl_comment
+ return mdoc.html_synopsis
end
- # Returns the comment of this MEntity formatted as HTML.
- var html_short_comment: nullable Writable is lazy do
+ # Returns the the comment without the synopsis formatted as HTML.
+ var html_comment: nullable Writable is lazy do
var mdoc = mdoc_or_fallback
if mdoc == null then return null
- return mdoc.tpl_short_comment
+ return mdoc.html_comment
end
# Icon that will be displayed before the title
var tpl = new Template
tpl.add new DocHTMLLabel.with_classes(css_classes)
tpl.add html_link
- var comment = html_short_comment
+ var comment = html_synopsis
if comment != null then
tpl.add ": "
tpl.add comment
var lnk = html_link
var tpl = new Template
tpl.add new Link.with_title("#{nitdoc_id}.concern", lnk.text, lnk.title)
- var comment = html_short_comment
+ var comment = html_synopsis
if comment != null then
tpl.add ": "
tpl.add comment
import doc_phases::doc_graphs
import doc_phases::doc_intros_redefs
import doc_phases::doc_lin
+import doc_phases::doc_readme
+intrude import doc_down
# Renders the page as HTML.
redef class DocPage
if html_title != null then
var header = new Header(hlvl, html_title.write_to_string)
header.css_classes.add "signature"
- if hlvl == 2 then header.css_classes.add "well well-sm"
addn header
end
if html_subtitle != null then
redef fun render_body do
var tabs = new DocTabs("{html_id}.tabs", "")
- var comment = mentity.html_comment
+ var comment = mentity.html_documentation
+ if mentity isa MProject then
+ comment = mentity.html_synopsis
+ end
if comment != null then
tabs.add_panel new DocTabPanel("{html_tab_id}-comment", "Comment", comment)
end
var tabs = new DocTabs("{html_id}.tabs", "")
if not is_no_body then
var comment
- if is_short_comment then
- comment = mentity.html_short_comment
+ if is_short_comment or mentity isa MProject then
+ comment = mentity.html_synopsis
else
- comment = mentity.html_comment
+ comment = mentity.html_documentation
end
if comment != null then
tabs.add_panel new DocTabPanel("{html_tab_id}-comment", "Comment", comment)
if not mentity isa MPropDef then continue # TODO handle all mentities
var tpl = new Template
tpl.add mentity.mclassdef.html_namespace
- var comment = mentity.mclassdef.html_short_comment
+ var comment = mentity.mclassdef.html_synopsis
if comment != null then
tpl.add ": "
tpl.add comment
redef class GraphArticle
redef var html_title = null
- # HTML map used to display link.
+ # Graph in SVG with clickable map.
#
# This attribute is set by the `doc_render` phase who knows the context.
- var map: String is noinit, writable
+ var svg: nullable String = null is writable
redef fun render_body do
addn "<div class=\"text-center\">"
- addn " <img src='{graph_id}.png' usemap='#{graph_id}' style='margin:auto'"
- addn " alt='{title or else ""}'/>"
- add map
+ var svg = self.svg
+ if svg != null then add svg
addn "</div>"
end
end
+
+redef class ReadmeSection
+ redef var html_id is lazy do
+ return markdown_processor.emitter.decorator.strip_id(html_title.as(not null).to_s)
+ end
+
+ redef var html_title is lazy do
+ return markdown_processor.process(title.as(not null))
+ end
+end
+
+redef class ReadmeArticle
+ redef var html_id = ""
+ redef var html_title = null
+ redef var is_toc_hidden = true
+
+ redef fun render_body do
+ add markdown_processor.process(md.trim.write_to_string)
+ end
+end
+
+redef class DocumentationArticle
+ redef var html_title is lazy do
+ var synopsis = mentity.html_synopsis
+ if synopsis == null then return mentity.html_link
+ return "{mentity.html_link.write_to_string} – {synopsis.write_to_string}"
+ end
+
+ redef var html_subtitle is lazy do return null
+ redef var html_toc_title is lazy do return mentity.html_name
+ redef var is_toc_hidden is lazy do return depth > 3
+
+ redef fun render_body do
+ var tabs = new DocTabs("{html_id}.tabs", "")
+ var comment = mentity.html_comment
+ if comment != null then
+ tabs.add_panel new DocTabPanel("{html_tab_id}-comment", "Comment", comment)
+ end
+ for child in children do
+ if child.is_hidden then continue
+ var title = child.html_toc_title or else child.toc_title or else ""
+ tabs.add_panel new DocTabPanel(child.html_tab_id, title, child)
+ end
+ addn tabs
+ end
+end
var mmodule: MModule
- redef fun makefile_rule_name do return "{filename.basename("")}.o"
- redef fun makefile_rule_content do return "$(CXX) $(CFLAGS) {mmodule.cppflags[""].join(" ")} -c {filename.basename("")} -o {filename.basename("")}.o"
+ redef fun makefile_rule_name do return "{filename.basename}.o"
+ redef fun makefile_rule_content do return "$(CXX) $(CFLAGS) {mmodule.cppflags[""].join(" ")} -c {filename.basename} -o {filename.basename}.o"
redef fun compiles_to_o_file do return true
end
var extra_java_files = mmodule.extra_java_files
if extra_java_files != null then for file in extra_java_files do
var path = file.filename
- path.file_copy_to("{compdir}/{path.basename("")}")
+ path.file_copy_to("{compdir}/{path.basename}")
end
end
end
super ExternFile
redef fun makefile_rule_name do return "{filename.basename(".java")}.class"
- redef fun makefile_rule_content do return "javac {filename.basename("")} -d ."
+ redef fun makefile_rule_content do return "javac {filename.basename} -d ."
redef fun add_to_jar do return true
end
# JNI type name (in C)
#
# So this is a C type, usually defined in `jni.h`
- private fun jni_type: String do return "jint"
+ private fun jni_type: String do return "long"
# JNI short type name (for signatures)
#
else format.add "V"
end
- return format.join("")
+ return format.join
end
# Similar to `build_c_signature` but adapted to create the signature expected by JNI for C functions
redef fun makefile_rule_name do return "{filename.basename(".m")}_m.o"
redef fun makefile_rule_content do
- return "clang $(CFLAGS) -c {filename.basename("")} -o {makefile_rule_name}"
+ return "clang $(CFLAGS) -c {filename.basename} -o {makefile_rule_name}"
end
redef fun compiles_to_o_file do return true
end
var primtives_annotations_list = """
new_annotation
+conditional
+
deprecated
fixed
lazy
# 2. The second operand must be an integer literal
var op2 = node.n_expr2
- if not op2 isa AIntExpr then return
+ if not op2 isa AIntegerExpr then return
# 3. Its value must be 0
# Note: because of `literal_phase` the `value` method exists
do
if not nclassdef isa AStdClassdef then return
- # Is there a declaration on the classdef or the module?
- var serialize = nclassdef.is_serialize
-
- if not serialize and not nclassdef.is_noserialize then
- # Is the module marked serialize?
- serialize = nclassdef.parent.as(AModule).is_serialize
- end
+ var serialize_by_default = nclassdef.how_serialize
- var per_attribute = false
- if not serialize then
- # Is there an attribute marked serialize?
- for npropdef in nclassdef.n_propdefs do
- if npropdef.is_serialize then
- serialize = true
- per_attribute = true
- break
- end
- end
- end
+ if serialize_by_default != null then
- if serialize then
# Add `super Serializable`
var sc = toolcontext.parse_superclass("Serializable")
sc.location = nclassdef.location
nclassdef.n_propdefs.add sc
# Add services
+ var per_attribute = not serialize_by_default
generate_serialization_method(nclassdef, per_attribute)
generate_deserialization_init(nclassdef, per_attribute)
end
# collect all classes
var auto_serializable_nclassdefs = new Array[AStdClassdef]
for nclassdef in nmodule.n_classdefs do
- if nclassdef isa AStdClassdef and nclassdef.is_serialize then
+ if nclassdef isa AStdClassdef and nclassdef.how_serialize != null then
auto_serializable_nclassdefs.add nclassdef
end
end
for nclassdef in nclassdefs do
var name = nclassdef.n_id.text
if nclassdef.n_formaldefs.is_empty and
- not nclassdef.n_classkind isa AAbstractClasskind then
+ nclassdef.n_classkind isa AConcreteClasskind then
code.add " if name == \"{name}\" then return new {name}.from_deserializer(self)"
end
return null
end
+
+ # Is this classed marked `serialize`? in part or fully?
+ #
+ # This method returns 3 possible values:
+ # * `null`, this class is not to be serialized.
+ # * `true`, the attributes of this class are to be serialized by default.
+ # * `false`, the attributes of this class are to be serialized on demand only.
+ fun how_serialize: nullable Bool
+ do
+ # Is there a declaration on the classdef or the module?
+ var serialize = is_serialize
+
+ if not serialize and not is_noserialize then
+ # Is the module marked serialize?
+ serialize = parent.as(AModule).is_serialize
+ end
+
+ if serialize then return true
+
+ if not serialize then
+ # Is there an attribute marked serialize?
+ for npropdef in n_propdefs do
+ if npropdef.is_serialize then
+ return false
+ end
+ end
+ end
+
+ return null
+ end
end
assert value isa PrimitiveInstance[Float]
self.float = value.val
else if static_type.name == "NativeString" then
- assert value isa PrimitiveInstance[Buffer]
- self.pointer = value.val.to_cstring
+ assert value isa PrimitiveInstance[NativeString]
+ self.pointer = value.val
else if static_type isa MClassType and static_type.mclass.kind == extern_kind then
assert value isa PrimitiveInstance[Pointer] else print value.class_name
self.pointer = value.val
else if name == "Float" then
return v.float_instance(self.float)
else if name == "NativeString" then
- return v.native_string_instance(self.native_string.to_s)
+ var instance = new PrimitiveInstance[NativeString](static_type, self.native_string)
+ v.init_instance_primitive instance
+ return instance
else if static_type isa MClassType and static_type.mclass.kind == extern_kind then
# We tag it with the most precise known type
var instance = new PrimitiveInstance[Pointer](static_type, self.pointer)
var compile_dir = v.compile_dir
var foreign_code_lib_path = v.foreign_code_lib_path(mmodule)
- compile_dir.mkdir
+ if not compile_dir.file_exists then compile_dir.mkdir
# Compile the common FFI part
ensure_compile_ffi_wrapper
# Return a new native string initialized with `txt`
fun native_string_instance(txt: String): Instance
do
- var val = new FlatBuffer.from(txt)
- val.add('\0')
+ var instance = native_string_instance_len(txt.bytelen+1)
+ var val = instance.val
+ val[txt.bytelen] = 0u8
+ txt.to_cstring.copy_to(val, txt.bytelen, 0, 0)
+
+ return instance
+ end
+
+ # Return a new native string initialized of `length`
+ fun native_string_instance_len(length: Int): PrimitiveInstance[NativeString]
+ do
+ var val = new NativeString(length)
+
var t = mainmodule.native_string_type
- var instance = new PrimitiveInstance[Buffer](t, val)
+ var instance = new PrimitiveInstance[NativeString](t, val)
init_instance_primitive(instance)
return instance
end
fun string_instance(txt: String): Instance
do
var nat = native_string_instance(txt)
- var res = self.send(self.force_get_primitive_method("to_s_with_length", nat.mtype), [nat, self.int_instance(txt.length)])
+ var res = self.send(self.force_get_primitive_method("to_s_with_length", nat.mtype), [nat, self.int_instance(txt.bytelen)])
assert res != null
return res
end
return v.int_instance(args[0].to_i.bin_xor(args[1].to_i))
else if pname == "bin_not" then
return v.int_instance(args[0].to_i.bin_not)
- else if pname == "int_to_s_len" then
- return v.int_instance(recvval.to_s.length)
- else if pname == "native_int_to_s" then
- var s = recvval.to_s
- var srecv = args[1].val.as(Buffer)
- srecv.clear
- srecv.append(s)
- srecv.add('\0')
- return null
- else if pname == "strerror_ext" then
- return v.native_string_instance(recvval.strerror)
end
else if cname == "Byte" then
var recvval = args[0].to_b
return v.byte_instance(args[0].to_b.rshift(args[1].to_i))
else if pname == "byte_to_s_len" then
return v.int_instance(recvval.to_s.length)
- else if pname == "native_byte_to_s" then
- var s = recvval.to_s
- var srecv = args[1].val.as(Buffer)
- srecv.clear
- srecv.append(s)
- srecv.add('\0')
- return null
end
else if cname == "Char" then
var recv = args[0].val.as(Char)
end
else if cname == "NativeString" then
if pname == "new" then
- return v.native_string_instance("!" * args[1].to_i)
+ return v.native_string_instance_len(args[1].to_i)
end
- var recvval = args.first.val.as(Buffer)
+ var recvval = args.first.val.as(NativeString)
if pname == "[]" then
var arg1 = args[1].to_i
- if arg1 >= recvval.length or arg1 < 0 then
- debug("Illegal access on {recvval} for element {arg1}/{recvval.length}")
- end
- return v.char_instance(recvval.chars[arg1])
+ return v.byte_instance(recvval[arg1])
else if pname == "[]=" then
var arg1 = args[1].to_i
- if arg1 >= recvval.length or arg1 < 0 then
- debug("Illegal access on {recvval} for element {arg1}/{recvval.length}")
- end
- recvval.chars[arg1] = args[2].val.as(Char)
+ recvval[arg1] = args[2].val.as(Byte)
return null
else if pname == "copy_to" then
# sig= copy_to(dest: NativeString, length: Int, from: Int, to: Int)
- var destval = args[1].val.as(FlatBuffer)
+ var destval = args[1].val.as(NativeString)
var lenval = args[2].to_i
var fromval = args[3].to_i
var toval = args[4].to_i
- if fromval < 0 then
- debug("Illegal access on {recvval} for element {fromval}/{recvval.length}")
- end
- if fromval + lenval > recvval.length then
- debug("Illegal access on {recvval} for element {fromval}+{lenval}/{recvval.length}")
- end
- if toval < 0 then
- debug("Illegal access on {destval} for element {toval}/{destval.length}")
- end
- if toval + lenval > destval.length then
- debug("Illegal access on {destval} for element {toval}+{lenval}/{destval.length}")
- end
- recvval.as(FlatBuffer).copy(fromval, lenval, destval, toval)
+ recvval.copy_to(destval, lenval, fromval, toval)
return null
else if pname == "atoi" then
- return v.int_instance(recvval.to_i)
- else if pname == "file_exists" then
- return v.bool_instance(recvval.to_s.file_exists)
- else if pname == "file_mkdir" then
- var res = recvval.to_s.mkdir
- return v.bool_instance(res == null)
- else if pname == "file_chdir" then
- var res = recvval.to_s.chdir
- return v.bool_instance(res == null)
- else if pname == "file_realpath" then
- return v.native_string_instance(recvval.to_s.realpath)
- else if pname == "get_environ" then
- var txt = recvval.to_s.environ
- return v.native_string_instance(txt)
- else if pname == "system" then
- var res = sys.system(recvval.to_s)
- return v.int_instance(res)
- else if pname == "atof" then
- return v.float_instance(recvval.to_f)
+ return v.int_instance(recvval.atoi)
else if pname == "fast_cstring" then
- var ns = recvval.to_cstring.to_s.substring_from(args[1].to_i)
+ var ns = recvval.to_s.substring_from(args[1].to_i)
return v.native_string_instance(ns)
end
- else if cname == "String" then
- var cs = v.send(v.force_get_primitive_method("to_cstring", args.first.mtype), [args.first])
- var str = cs.val.to_s
- if pname == "files" then
- var res = new Array[Instance]
- for f in str.files do res.add v.string_instance(f)
- return v.array_instance(res, v.mainmodule.string_type)
- end
else if pname == "calloc_string" then
- return v.native_string_instance("!" * args[1].to_i)
+ return v.native_string_instance_len(args[1].to_i)
else if cname == "NativeArray" then
if pname == "new" then
var val = new Array[Instance].filled_with(v.null_instance, args[1].to_i)
end
var recvval = args.first.val.as(Array[Instance])
if pname == "[]" then
- if args[1].to_i >= recvval.length or args[1].to_i < 0 then
- debug("Illegal access on {recvval} for element {args[1].to_i}/{recvval.length}")
- end
return recvval[args[1].to_i]
else if pname == "[]=" then
recvval[args[1].to_i] = args[2]
recvval.copy_to(0, args[2].to_i, args[1].val.as(Array[Instance]), 0)
return null
end
- else if cname == "NativeFile" then
- if pname == "native_stdout" then
- var inst = new PrimitiveNativeFile.native_stdout
- var instance = new PrimitiveInstance[PrimitiveNativeFile](mpropdef.mclassdef.mclass.mclass_type, inst)
- v.init_instance_primitive(instance)
- return instance
- else if pname == "native_stdin" then
- var inst = new PrimitiveNativeFile.native_stdin
- var instance = new PrimitiveInstance[PrimitiveNativeFile](mpropdef.mclassdef.mclass.mclass_type, inst)
- v.init_instance_primitive(instance)
- return instance
- else if pname == "native_stderr" then
- var inst = new PrimitiveNativeFile.native_stderr
- var instance = new PrimitiveInstance[PrimitiveNativeFile](mpropdef.mclassdef.mclass.mclass_type, inst)
- v.init_instance_primitive(instance)
- return instance
- else if pname == "io_open_read" then
- var a1 = args[1].val.as(Buffer)
- var inst = new PrimitiveNativeFile.io_open_read(a1.to_s)
- var instance = new PrimitiveInstance[PrimitiveNativeFile](mpropdef.mclassdef.mclass.mclass_type, inst)
- v.init_instance_primitive(instance)
- return instance
- else if pname == "io_open_write" then
- var a1 = args[1].val.as(Buffer)
- var inst = new PrimitiveNativeFile.io_open_write(a1.to_s)
- var instance = new PrimitiveInstance[PrimitiveNativeFile](mpropdef.mclassdef.mclass.mclass_type, inst)
- v.init_instance_primitive(instance)
- return instance
- end
- var recvval = args.first.val
- if pname == "io_write" then
- var a1 = args[1].val.as(Buffer)
- return v.int_instance(recvval.as(PrimitiveNativeFile).io_write(a1.to_cstring, args[2].to_i))
- else if pname == "io_read" then
- var a1 = args[1].val.as(Buffer)
- var ns = new NativeString(a1.length)
- var len = recvval.as(PrimitiveNativeFile).io_read(ns, args[2].to_i)
- a1.clear
- a1.append(ns.to_s_with_length(len))
- return v.int_instance(len)
- else if pname == "flush" then
- recvval.as(PrimitiveNativeFile).flush
- return null
- else if pname == "io_close" then
- return v.int_instance(recvval.as(PrimitiveNativeFile).io_close)
- else if pname == "set_buffering_type" then
- return v.int_instance(recvval.as(PrimitiveNativeFile).set_buffering_type(args[1].to_i, args[2].to_i))
- end
else if pname == "native_argc" then
return v.int_instance(v.arguments.length)
else if pname == "native_argv" then
else if pname == "native_argv" then
var txt = v.arguments[args[1].to_i]
return v.native_string_instance(txt)
- else if pname == "get_time" then
- return v.int_instance(get_time)
- else if pname == "srand" then
- srand
- return null
- else if pname == "srand_from" then
- srand_from(args[1].to_i)
- return null
- else if pname == "atan2" then
- return v.float_instance(atan2(args[1].to_f, args[2].to_f))
- else if pname == "pi" then
- return v.float_instance(pi)
else if pname == "lexer_goto" then
return v.int_instance(lexer_goto(args[1].to_i, args[2].to_i))
else if pname == "lexer_accept" then
return v.int_instance(parser_goto(args[1].to_i, args[2].to_i))
else if pname == "parser_action" then
return v.int_instance(parser_action(args[1].to_i, args[2].to_i))
- else if pname == "file_getcwd" then
- return v.native_string_instance(getcwd)
- else if pname == "errno" then
- return v.int_instance(sys.errno)
- else if pname == "address_is_null" then
- var recv = args[0]
- if recv isa PrimitiveInstance[PrimitiveNativeFile] then
- return v.bool_instance(recv.val.address_is_null)
- end
- return v.false_instance
end
return v.error_instance
end
end
end
-redef class AIntExpr
- redef fun expr(v)
- do
- return v.int_instance(self.value.as(not null))
- end
-end
-
-redef class AByteExpr
+redef class AIntegerExpr
redef fun expr(v)
do
- return v.byte_instance(self.value.as(not null))
+ if value isa Int then return v.int_instance(value.as(Int))
+ if value isa Byte then return v.byte_instance(value.as(Byte))
+ return null
end
end
var file: Stream
init native_stdin do
- file = sys.stdin
+ init(sys.stdin)
end
init native_stdout do
- file = sys.stdout
+ init(sys.stdout)
end
init native_stderr do
- file = sys.stderr
+ init(sys.stderr)
end
init io_open_read(path: String) do
- file = new FileReader.open(path.to_s)
+ init(new FileReader.open(path.to_s))
end
init io_open_write(path: String) do
- file = new FileWriter.open(path.to_s)
+ init(new FileWriter.open(path.to_s))
end
fun address_is_null: Bool do
return str.length
end
- fun io_write(buf: NativeString, len: Int): Int do
- if file isa FileStream then return file.as(FileStream)._file.io_write(buf, len)
- file.as(Writer).write(buf.to_s_with_length(len))
+ fun io_write(buf: NativeString, from, len: Int): Int do
+ if file isa FileStream then return file.as(FileStream)._file.io_write(buf, from, len)
+ file.as(Writer).write(buf.to_s_with_length(len).substring_from(from))
return len
end
# Return null if not an integer.
fun as_int: nullable Int
do
- if not self isa AIntExpr then return null
- return self.value.as(not null)
- end
-
- # Get `self` as a single identifier.
- # Return null if not a single identifier.
- fun as_id: nullable String
- do
- if self isa AMethidExpr then
- return self.collect_text
- end
- if not self isa ACallExpr then return null
- if not self.n_expr isa AImplicitSelfExpr then return null
- if not self.n_args.n_exprs.is_empty then return null
- return self.n_id.text
- end
-end
-
-redef class Text
- private fun remove_underscores: Text do
- var b = new FlatBuffer
- for i in chars do
- if i == '_' then continue
- b.add i
- end
- return b
+ if not self isa AIntegerExpr then return null
+ return self.value.as(not null).to_i
end
end
-redef class AIntExpr
+redef class AIntegerExpr
# The value of the literal int once computed.
- var value: nullable Int
-end
-
-redef class ADecIntExpr
- redef fun accept_literal(v)
- do
- value = self.n_number.text.to_i
- end
-end
+ var value: nullable Numeric
-redef class AHexIntExpr
- redef fun accept_literal(v)
- do
- var s = self.n_hex_number.text.substring_from(2).remove_underscores
- if s.is_empty then
- v.toolcontext.error(location, "Error: invalid hexadecimal literal")
- return
- end
- value = s.to_hex
- end
-end
-
-redef class ABinIntExpr
- redef fun accept_literal(v)
- do
- var s = self.n_bin_number.text.substring_from(2).remove_underscores
- if s.is_empty then
- v.toolcontext.error(location, "Error: invalid binary literal")
- return
- end
- value = s.to_bin
- end
-end
-
-redef class AOctIntExpr
- redef fun accept_literal(v)
- do
- var s = self.n_oct_number.text.substring_from(2).remove_underscores
- if s.is_empty then
- v.toolcontext.error(location, "Error: invalid octal literal")
- return
- end
- value = s.to_oct
- end
-end
-
-redef class AByteExpr
- # The value of the literal int once computed.
- var value: nullable Byte
-end
-
-redef class ADecByteExpr
- redef fun accept_literal(v)
- do
- var t = self.n_bytenum.text
- value = t.substring(0, t.length - 2).to_i.to_b
- end
-end
-
-redef class AHexByteExpr
- redef fun accept_literal(v)
- do
- var t = self.n_hex_bytenum.text
- var s = t.substring(2, t.length - 4).remove_underscores
- if s.is_empty then
- v.toolcontext.error(location, "Error: invalid hexadecimal literal")
- return
- end
- value = s.to_hex.to_b
- end
-end
-
-redef class ABinByteExpr
- redef fun accept_literal(v)
- do
- var t = self.n_bin_bytenum.text
- var s = t.substring(2, t.length - 4).remove_underscores
- if s.is_empty then
- v.toolcontext.error(location, "Error: invalid binary literal")
- return
- end
- value = s.to_bin.to_b
- end
-end
-
-redef class AOctByteExpr
- redef fun accept_literal(v)
- do
- var t = self.n_oct_bytenum.text
- var s = t.substring(2, t.length - 4).remove_underscores
- if s.is_empty then
- v.toolcontext.error(location, "Error: invalid octal literal")
- return
+ redef fun accept_literal(v) do
+ value = n_integer.text.to_num
+ if value == null then
+ v.toolcontext.error(hot_location, "Error: invalid literal `{n_integer.text}`")
end
- value = s.to_oct.to_b
end
end
do
var path = search_mmodule_by_name(anode, mgroup, name)
if path == null then return null # Forward error
+ return load_module_path(path)
+ end
+
+ # Load and process importation of a given ModulePath.
+ #
+ # Basically chains `load_module` and `build_module_importation`.
+ fun load_module_path(path: ModulePath): nullable MModule
+ do
var res = self.load_module(path.filepath)
if res == null then return null # Forward error
# Load imported module
# special case for not a nit file
if path.file_extension != "nit" then
# search dirless files in known -I paths
- if path.dirname == "" then
+ if path.dirname == "." then
var res = search_module_in_paths(null, path, self.paths)
if res != null then return res
end
if pn == "src" then
# With a src directory, the group name is the name of the parent directory
dirpath2 = rdp.dirname
- pn = dirpath2.basename("")
+ pn = dirpath2.basename
else
# Check a `src` subdirectory
dirpath = dirpath2 / "src"
# Load a markdown file as a documentation object
fun load_markdown(filepath: String): MDoc
do
- var mdoc = new MDoc(new Location(new SourceFile.from_string(filepath, ""),0,0,0,0))
var s = new FileReader.open(filepath)
+ var lines = new Array[String]
+ var line_starts = new Array[Int]
+ var len = 1
while not s.eof do
- mdoc.content.add(s.read_line)
- end
+ var line = s.read_line
+ lines.add(line)
+ line_starts.add(len)
+ len += line.length + 1
+ end
+ s.close
+ var source = new SourceFile.from_string(filepath, lines.join("\n"))
+ source.line_starts.add_all line_starts
+ var mdoc = new MDoc(new Location(source, 1, lines.length, 0, 0))
+ mdoc.content.add_all(lines)
return mdoc
end
return mmodule
end
+ # Resolve the module identification for a given `AModuleName`.
+ #
+ # This method handles qualified names as used in `AModuleName`.
+ fun seach_module_by_amodule_name(n_name: AModuleName, mgroup: nullable MGroup): nullable ModulePath
+ do
+ if n_name.n_quad != null then mgroup = null # Start from top level
+ for grp in n_name.n_path do
+ var path = search_mmodule_by_name(grp, mgroup, grp.text)
+ if path == null then return null # Forward error
+ mgroup = path.mgroup
+ end
+ var mod_name = n_name.n_id.text
+ return search_mmodule_by_name(n_name, mgroup, mod_name)
+ end
+
# Analyze the module importation and fill the module_importation_hierarchy
#
# Unless you used `load_module`, the importation is already done and this method does a no-op.
var stdimport = true
var imported_modules = new Array[MModule]
for aimport in nmodule.n_imports do
+ # Do not imports conditional
+ var atconditionals = aimport.get_annotations("conditional")
+ if atconditionals.not_empty then continue
+
stdimport = false
if not aimport isa AStdImport then
continue
end
- var mgroup = mmodule.mgroup
- if aimport.n_name.n_quad != null then mgroup = null # Start from top level
- for grp in aimport.n_name.n_path do
- var path = search_mmodule_by_name(grp, mgroup, grp.text)
- if path == null then
- nmodule.mmodule = null # invalidate the module
- return # Skip error
- end
- mgroup = path.mgroup
+
+ # Load the imported module
+ var suppath = seach_module_by_amodule_name(aimport.n_name, mmodule.mgroup)
+ if suppath == null then
+ nmodule.mmodule = null # invalidate the module
+ continue # Skip error
end
- var mod_name = aimport.n_name.n_id.text
- var sup = self.get_mmodule_by_name(aimport.n_name, mgroup, mod_name)
+ var sup = load_module_path(suppath)
if sup == null then
nmodule.mmodule = null # invalidate the module
continue # Skip error
end
+
aimport.mmodule = sup
imported_modules.add(sup)
var mvisibility = aimport.n_visibility.mvisibility
mmodule.set_visibility_for(sup, public_visibility)
end
end
- self.toolcontext.info("{mmodule} imports {imported_modules.join(", ")}", 3)
+
+ # Declare conditional importation
+ for aimport in nmodule.n_imports do
+ if not aimport isa AStdImport then continue
+ var atconditionals = aimport.get_annotations("conditional")
+ if atconditionals.is_empty then continue
+
+ var suppath = seach_module_by_amodule_name(aimport.n_name, mmodule.mgroup)
+ if suppath == null then continue # skip error
+
+ for atconditional in atconditionals do
+ var nargs = atconditional.n_args
+ if nargs.is_empty then
+ error(atconditional, "Syntax Error: `conditional` expects module identifiers as arguments.")
+ continue
+ end
+
+ # The rule
+ var rule = new Array[Object]
+
+ # First element is the goal, thus
+ rule.add suppath
+
+ # Second element is the first condition, that is to be a client of the current module
+ rule.add mmodule
+
+ # Other condition are to be also a client of each modules indicated as arguments of the annotation
+ for narg in nargs do
+ var id = narg.as_id
+ if id == null then
+ error(narg, "Syntax Error: `conditional` expects module identifier as arguments.")
+ continue
+ end
+
+ var mp = search_mmodule_by_name(narg, mmodule.mgroup, id)
+ if mp == null then continue
+
+ rule.add mp
+ end
+
+ conditional_importations.add rule
+ end
+ end
+
mmodule.set_imported_mmodules(imported_modules)
+ apply_conditional_importations(mmodule)
+
+ self.toolcontext.info("{mmodule} imports {mmodule.in_importation.direct_greaters.join(", ")}", 3)
+
# Force standard to be public if imported
for sup in mmodule.in_importation.greaters do
if sup.name == "standard" then
end
end
+ # Global list of conditional importation rules.
+ #
+ # Each rule is a "Horn clause"-like sequence of modules.
+ # It means that the first module is the module to automatically import.
+ # The remaining modules are the conditions of the rule.
+ #
+ # Each module is either represented by a MModule (if the module is already loaded)
+ # or by a ModulePath (if the module is not yet loaded).
+ #
+ # Rules are declared by `build_module_importation` and are applied by `apply_conditional_importations`
+ # (and `build_module_importation` that calls it).
+ #
+ # TODO (when the loader will be rewritten): use a better representation and move up rules in the model.
+ private var conditional_importations = new Array[SequenceRead[Object]]
+
+ # Extends the current importations according to imported rules about conditional importation
+ fun apply_conditional_importations(mmodule: MModule)
+ do
+ # Because a conditional importation may cause additional conditional importation, use a fixed point
+ # The rules are checked naively because we assume that it does not worth to be optimized
+ var check_conditional_importations = true
+ while check_conditional_importations do
+ check_conditional_importations = false
+
+ for ci in conditional_importations do
+ # Check conditions
+ for i in [1..ci.length[ do
+ var rule_element = ci[i]
+ # An element of a rule is either a MModule or a ModulePath
+ # We need the mmodule to resonate on the importation
+ var m
+ if rule_element isa MModule then
+ m = rule_element
+ else if rule_element isa ModulePath then
+ m = rule_element.mmodule
+ # Is loaded?
+ if m == null then continue label
+ else
+ abort
+ end
+ # Is imported?
+ if not mmodule.in_importation.greaters.has(m) then continue label
+ end
+ # Still here? It means that all conditions modules are loaded and imported
+
+ # Identify the module to automatically import
+ var suppath = ci.first.as(ModulePath)
+ var sup = load_module_path(suppath)
+ if sup == null then continue
+
+ # Do nothing if already imported
+ if mmodule.in_importation.greaters.has(sup) then continue label
+
+ # Import it
+ self.toolcontext.info("{mmodule} conditionally imports {sup}", 3)
+ # TODO visibility rules (currently always public)
+ mmodule.set_visibility_for(sup, public_visibility)
+ # TODO linearization rules (currently added at the end in the order of the rules)
+ mmodule.set_imported_mmodules([sup])
+
+ # Prepare to reapply the rules
+ check_conditional_importations = true
+ end label
+ end
+ end
+
# All the loaded modules
var nmodules = new Array[AModule]
end
# Create a new sourcefile using a dummy filename and a given content
- init from_string(filename: String, string: String)
+ init from_string(filename: String, string: String) is
+ nosuper
do
self.filename = filename
self.string = string
line_starts[0] = 0
end
- # Position of each line start
+ # Offset of each line start in the content `string`.
+ #
+ # Used for fast access to each line when rendering parts of the `string`.
var line_starts = new Array[Int]
end
# loc = new Location.from_string("location.nit:82--105,8")
# assert loc.to_s == "location.nit:82,0--105,8"
# ~~~
- init from_string(string: String) do
+ init from_string(string: String) is
+ nosuper
+ do
self.line_start = 0
self.line_end = 0
self.column_start = 0
end
# Register the imported modules (ie "import some_module")
- # This function can only invoked once by mmodule.
# The visibility must be set with `set_visibility_for`.
fun set_imported_mmodules(imported_mmodules: Array[MModule])
do
- assert unique_invocation: self.in_importation.direct_greaters.is_empty
for m in imported_mmodules do
self.model.mmodule_importation_hierarchy.add_edge(self, m)
end
mainmodule = new MModule(modelbuilder.model, null, mmodules.first.name + "-m", new Location(mmodules.first.location.file, 0, 0, 0, 0))
mainmodule.is_fictive = true
mainmodule.set_imported_mmodules(mmodules)
+ modelbuilder.apply_conditional_importations(mainmodule)
+ modelbuilder.run_phases
end
return mainmodule
end
var i = 0
for p in spd.initializers do
if p != longest.initializers[i] then
- self.error(nclassdef, "Error: conflict for inherited inits {spd}({spd.initializers.join(", ")}) and {longest}({longest.initializers.join(", ")})")
+ var proposal = new ArraySet[MProperty]
+ for spd2 in spropdefs do
+ proposal.add_all spd2.initializers
+ end
+ proposal.add_all initializers
+ self.error(nclassdef, "Error: cannot generate automatic init for class {mclassdef.mclass}. Conflict in the order in inherited initializers {spd}({spd.initializers.join(", ")}) and {longest}({longest.initializers.join(", ")}). Use `autoinit` to order initializers. eg `autoinit {proposal.join(", ")}`")
# TODO: invalidate the initializer to avoid more errors
return
end
if atwritable != null then
mvisibility = new_property_visibility(modelbuilder, mclassdef, atwritable.n_visibility)
else
- mvisibility = private_visibility
+ mvisibility = mreadprop.visibility
+ # By default, use protected visibility at most
+ if mvisibility > protected_visibility then mvisibility = protected_visibility
end
mwriteprop = new MMethod(mclassdef, writename, mvisibility)
if not self.check_redef_keyword(modelbuilder, mclassdef, nwkwredef, false, mwriteprop) then return
if nexpr != null then
if nexpr isa ANewExpr then
mtype = modelbuilder.resolve_mtype_unchecked(mmodule, mclassdef, nexpr.n_type, true)
- else if nexpr isa AIntExpr then
- var cla = modelbuilder.try_get_mclass_by_name(nexpr, mmodule, "Int")
- if cla != null then mtype = cla.mclass_type
- else if nexpr isa AByteExpr then
- var cla = modelbuilder.try_get_mclass_by_name(nexpr, mmodule, "Byte")
+ else if nexpr isa AIntegerExpr then
+ var cla: nullable MClass = null
+ if nexpr.value isa Int then
+ cla = modelbuilder.try_get_mclass_by_name(nexpr, mmodule, "Int")
+ else if nexpr.value isa Byte then
+ cla = modelbuilder.try_get_mclass_by_name(nexpr, mmodule, "Byte")
+ else
+ # Should not happen, and should be updated as new types are added
+ abort
+ end
if cla != null then mtype = cla.mclass_type
else if nexpr isa AFloatExpr then
var cla = modelbuilder.try_get_mclass_by_name(nexpr, mmodule, "Float")
new InheritanceListsPhase(toolcontext, doc),
new IntroRedefListPhase(toolcontext, doc),
new LinListPhase(toolcontext, doc),
- new GraphPhase(toolcontext, doc): DocPhase]
+ new GraphPhase(toolcontext, doc),
+ new ReadmePhase(toolcontext, doc): DocPhase]
if not toolcontext.opt_test.value then
phases.add new RenderHTMLPhase(toolcontext, doc)
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# Compile Nit into Java code runnable on the Java Virtual Machine.
+module nitj
+
+import compiler::java_compiler
+
+# Create a tool context to handle options and paths
+var toolcontext = new ToolContext
+toolcontext.process_options(args)
+
+# We need a model to collect stufs
+var model = new Model
+# And a model builder to parse files
+var modelbuilder = new ModelBuilder(model, toolcontext)
+
+# Collect arguments
+var arguments = toolcontext.option_context.rest
+if arguments.is_empty then
+ toolcontext.option_context.usage
+ return
+end
+if arguments.length > 1 then
+ print "Too much arguments: {arguments.join(" ")}"
+ toolcontext.option_context.usage
+ return
+end
+var progname = arguments.first
+
+# Here we load an process all modules passed on the command line
+var mmodules = modelbuilder.parse([progname])
+
+if mmodules.is_empty then return
+modelbuilder.run_phases
+
+var mainmodule
+if mmodules.length == 1 then
+ mainmodule = mmodules.first
+else
+ mainmodule = new MModule(model, null, mmodules.first.name, mmodules.first.location)
+ mainmodule.set_imported_mmodules(mmodules)
+end
+
+var analysis = modelbuilder.do_rapid_type_analysis(mainmodule)
+
+# Do compilation
+modelbuilder.run_java_compiler(mainmodule, analysis)
modelbuilder.run_phases
toolcontext.run_global_phases(mmodules)
+if toolcontext.error_count > 0 then exit(1)
else if module_path.has_suffix(".nit") then
module_name = module_path.basename(".nit")
else
- module_name = module_path.basename("")
+ module_name = module_path.basename
module_path += ".nit"
end
end
end
-redef class TNumber
+redef class TInteger
redef fun parser_index: Int
do
return 99
end
end
-redef class THexNumber
- redef fun parser_index: Int
- do
- return 100
- end
-
- init init_tk(loc: Location)
- do
- _location = loc
- end
-end
-
-redef class TBinNumber
- redef fun parser_index: Int
- do
- return 101
- end
-
- init init_tk(loc: Location)
- do
- _location = loc
- end
-end
-
-redef class TOctNumber
- redef fun parser_index: Int
- do
- return 102
- end
-
- init init_tk(loc: Location)
- do
- _location = loc
- end
-end
-
-redef class TBytenum
- redef fun parser_index: Int
- do
- return 103
- end
-
- init init_tk(loc: Location)
- do
- _location = loc
- end
-end
-
-redef class THexBytenum
- redef fun parser_index: Int
- do
- return 104
- end
-
- init init_tk(loc: Location)
- do
- _location = loc
- end
-end
-
-redef class TBinBytenum
- redef fun parser_index: Int
- do
- return 105
- end
-
- init init_tk(loc: Location)
- do
- _location = loc
- end
-end
-
-redef class TOctBytenum
- redef fun parser_index: Int
- do
- return 106
- end
-
- init init_tk(loc: Location)
- do
- _location = loc
- end
-end
-
redef class TFloat
redef fun parser_index: Int
do
- return 107
+ return 100
end
init init_tk(loc: Location)
redef class TString
redef fun parser_index: Int
do
- return 108
+ return 101
end
init init_tk(loc: Location)
redef class TStartString
redef fun parser_index: Int
do
- return 109
+ return 102
end
init init_tk(loc: Location)
redef class TMidString
redef fun parser_index: Int
do
- return 110
+ return 103
end
init init_tk(loc: Location)
redef class TEndString
redef fun parser_index: Int
do
- return 111
+ return 104
end
init init_tk(loc: Location)
redef class TChar
redef fun parser_index: Int
do
- return 112
+ return 105
end
init init_tk(loc: Location)
redef class TBadString
redef fun parser_index: Int
do
- return 113
+ return 106
end
init init_tk(loc: Location)
redef class TBadChar
redef fun parser_index: Int
do
- return 114
+ return 107
end
init init_tk(loc: Location)
redef class TExternCodeSegment
redef fun parser_index: Int
do
- return 115
+ return 108
end
init init_tk(loc: Location)
redef class EOF
redef fun parser_index: Int
do
- return 116
+ return 109
end
end
return new TAttrid.init_tk(location)
end
if accept_token == 100 then
- return new TNumber.init_tk(location)
+ return new TInteger.init_tk(location)
end
if accept_token == 101 then
- return new THexNumber.init_tk(location)
- end
- if accept_token == 102 then
- return new TBinNumber.init_tk(location)
- end
- if accept_token == 103 then
- return new TOctNumber.init_tk(location)
- end
- if accept_token == 104 then
- return new TBytenum.init_tk(location)
- end
- if accept_token == 105 then
- return new THexBytenum.init_tk(location)
- end
- if accept_token == 106 then
- return new TBinBytenum.init_tk(location)
- end
- if accept_token == 107 then
- return new TOctBytenum.init_tk(location)
- end
- if accept_token == 108 then
return new TFloat.init_tk(location)
end
- if accept_token == 109 then
+ if accept_token == 102 then
return new TString.init_tk(location)
end
- if accept_token == 110 then
+ if accept_token == 103 then
return new TStartString.init_tk(location)
end
- if accept_token == 111 then
+ if accept_token == 104 then
return new TMidString.init_tk(location)
end
- if accept_token == 112 then
+ if accept_token == 105 then
return new TEndString.init_tk(location)
end
- if accept_token == 113 then
+ if accept_token == 106 then
return new TChar.init_tk(location)
end
- if accept_token == 114 then
+ if accept_token == 107 then
return new TBadString.init_tk(location)
end
- if accept_token == 115 then
+ if accept_token == 108 then
return new TBadChar.init_tk(location)
end
- if accept_token == 116 then
+ if accept_token == 109 then
return new TExternCodeSegment.init_tk(location)
end
abort # unknown token index `accept_token`
if sp >= string_len then
dfa_state = -1
else
+ # Very ugly hack, this is because of the way SableCC generates its tables.
+ # Due to the 0xFFFF limit of a Java char, when a big Nit char is read (i.e.
+ # code point > 65535), it crashes.
+ #
+ # Hence, if a char has a code point <= 255 (ISO8859 range), it is left as is.
+ # Else, it is replaced by 255.
+ # This does not corrupt the lexer and works perfectly on any character.
+ #
+ # TL;DR: Java fucked up, need retarded solution to cope for retarded decision
var c = string[sp].ascii
+ if c >= 256 then c = 255
sp += 1
var cr = _cr
all = [0 .. 0xFF];
lowercase = ['a' .. 'z'];
uppercase = ['A' .. 'Z'];
+
digit = ['0' .. '9'];
hexdigit = ['0'..'9'] | ['a'..'f'] | ['A'..'F'] | '_';
bindigit = '0' | '1' | '_';
octdigit = ['0' .. '7'] | '_';
+number = digit (digit | '_')*;
+hex_number = ('0x' | '0X') hexdigit+;
+bin_number = ('0b' | '0B') bindigit+;
+oct_number = ('0o' | '0O') octdigit+;
+prec = '8' | '16' | '32';
+
letter = lowercase | uppercase | digit | '_';
tab = 9;
id = lowercase letter*;
attrid = '_' lowercase letter*;
-number = digit+;
-hex_number = ('0x' | '0X') hexdigit+;
-bin_number = ('0b' | '0B') bindigit+;
-oct_number = ('0o' | '0O') octdigit+;
-bytenum = digit+ 'u8';
-hex_bytenum = ('0x' | '0X') hexdigit+ 'u8';
-bin_bytenum = ('0b' | '0B') bindigit+ 'u8';
-oct_bytenum = ('0o' | '0O') octdigit+ 'u8';
+integer = (number | hex_number | bin_number | oct_number) (('u' prec) | ('i' prec) |);
float = digit* '.' digit+ | (digit+ | digit* '.' digit+) ('E'|'e') ('+'|'-'|) digit+;
string = '"' str_body '"' | '"' '"' '"' long_str_body lsend1 | ''' ''' ''' long_sstr_body ''' ''' ''';
start_string = '"' str_body '{' | '"' '"' '"' long_str_body lsend2;
| {true} kwtrue annotations_o {-> New expr.true(kwtrue, annotations_o.annotations)}
| {false} kwfalse annotations_o {-> New expr.false(kwfalse, annotations_o.annotations)}
| {null} kwnull annotations_o {-> New expr.null(kwnull, annotations_o.annotations)}
- | {int} number annotations_o {-> New expr.dec_int(number, annotations_o.annotations)}
- | {hex_int} hex_number annotations_o {-> New expr.hex_int(hex_number, annotations_o.annotations)}
- | {bin_int} bin_number annotations_o {-> New expr.bin_int(bin_number, annotations_o.annotations)}
- | {oct_int} oct_number annotations_o {-> New expr.oct_int(oct_number, annotations_o.annotations)}
- | {byte} bytenum annotations_o {-> New expr.dec_byte(bytenum, annotations_o.annotations)}
- | {hex_byte} hex_bytenum annotations_o {-> New expr.hex_byte(hex_bytenum, annotations_o.annotations)}
- | {bin_byte} bin_bytenum annotations_o {-> New expr.bin_byte(bin_bytenum, annotations_o.annotations)}
- | {oct_byte} oct_bytenum annotations_o {-> New expr.oct_byte(oct_bytenum, annotations_o.annotations)}
+ | {integer} integer annotations_o {-> New expr.integer(integer, annotations_o.annotations)}
| {float} float annotations_o {-> New expr.float(float, annotations_o.annotations)}
| {char} char annotations_o {-> New expr.char(char, annotations_o.annotations)}
| {string} string annotations_o {-> New expr.string(string, annotations_o.annotations)}
| {true} kwtrue annotations?
| {false} kwfalse annotations?
| {null} kwnull annotations?
- | {dec_int} number annotations?
- | {hex_int} hex_number annotations?
- | {bin_int} bin_number annotations?
- | {oct_int} oct_number annotations?
- | {dec_byte} bytenum annotations?
- | {hex_byte} hex_bytenum annotations?
- | {bin_byte} bin_bytenum annotations?
- | {oct_byte} oct_bytenum annotations?
+ | {integer} integer annotations?
| {float} float annotations?
| {char} char annotations?
| {string} string annotations?
redef class Parser
redef fun build_reduce_table
do
- var reduce_table = new Array[ReduceAction].with_capacity(1116)
+ var reduce_table = new Array[ReduceAction].with_capacity(1088)
self.reduce_table = reduce_table
reduce_table.add new ReduceAction0(0)
reduce_table.add new ReduceAction1(0)
reduce_table.add new ReduceAction374(74)
reduce_table.add new ReduceAction375(74)
reduce_table.add new ReduceAction376(74)
- reduce_table.add new ReduceAction377(74)
- reduce_table.add new ReduceAction378(74)
+ reduce_table.add new ReduceAction159(74)
+ reduce_table.add new ReduceAction159(74)
reduce_table.add new ReduceAction379(74)
reduce_table.add new ReduceAction380(74)
reduce_table.add new ReduceAction381(74)
- reduce_table.add new ReduceAction382(74)
- reduce_table.add new ReduceAction383(74)
- reduce_table.add new ReduceAction159(74)
- reduce_table.add new ReduceAction159(74)
- reduce_table.add new ReduceAction386(74)
- reduce_table.add new ReduceAction387(74)
- reduce_table.add new ReduceAction388(74)
- reduce_table.add new ReduceAction389(75)
- reduce_table.add new ReduceAction389(75)
- reduce_table.add new ReduceAction391(76)
- reduce_table.add new ReduceAction392(77)
- reduce_table.add new ReduceAction393(78)
- reduce_table.add new ReduceAction394(78)
- reduce_table.add new ReduceAction392(79)
- reduce_table.add new ReduceAction396(80)
+ reduce_table.add new ReduceAction382(75)
+ reduce_table.add new ReduceAction382(75)
+ reduce_table.add new ReduceAction384(76)
+ reduce_table.add new ReduceAction385(77)
+ reduce_table.add new ReduceAction386(78)
+ reduce_table.add new ReduceAction387(78)
+ reduce_table.add new ReduceAction385(79)
+ reduce_table.add new ReduceAction389(80)
reduce_table.add new ReduceAction272(80)
- reduce_table.add new ReduceAction398(80)
- reduce_table.add new ReduceAction399(81)
- reduce_table.add new ReduceAction400(81)
- reduce_table.add new ReduceAction401(82)
- reduce_table.add new ReduceAction402(82)
- reduce_table.add new ReduceAction403(83)
- reduce_table.add new ReduceAction401(84)
- reduce_table.add new ReduceAction402(84)
- reduce_table.add new ReduceAction406(85)
- reduce_table.add new ReduceAction407(86)
- reduce_table.add new ReduceAction408(87)
- reduce_table.add new ReduceAction409(87)
- reduce_table.add new ReduceAction410(88)
+ reduce_table.add new ReduceAction391(80)
+ reduce_table.add new ReduceAction392(81)
+ reduce_table.add new ReduceAction393(81)
+ reduce_table.add new ReduceAction394(82)
+ reduce_table.add new ReduceAction395(82)
+ reduce_table.add new ReduceAction396(83)
+ reduce_table.add new ReduceAction394(84)
+ reduce_table.add new ReduceAction395(84)
+ reduce_table.add new ReduceAction399(85)
+ reduce_table.add new ReduceAction400(86)
+ reduce_table.add new ReduceAction401(87)
+ reduce_table.add new ReduceAction402(87)
+ reduce_table.add new ReduceAction403(88)
reduce_table.add new ReduceAction22(88)
- reduce_table.add new ReduceAction412(89)
- reduce_table.add new ReduceAction413(89)
- reduce_table.add new ReduceAction414(90)
- reduce_table.add new ReduceAction415(90)
- reduce_table.add new ReduceAction412(91)
- reduce_table.add new ReduceAction413(91)
- reduce_table.add new ReduceAction418(91)
+ reduce_table.add new ReduceAction405(89)
+ reduce_table.add new ReduceAction406(89)
+ reduce_table.add new ReduceAction407(90)
+ reduce_table.add new ReduceAction408(90)
+ reduce_table.add new ReduceAction405(91)
+ reduce_table.add new ReduceAction406(91)
+ reduce_table.add new ReduceAction411(91)
reduce_table.add new ReduceAction159(92)
- reduce_table.add new ReduceAction420(93)
- reduce_table.add new ReduceAction421(94)
- reduce_table.add new ReduceAction422(94)
- reduce_table.add new ReduceAction423(94)
- reduce_table.add new ReduceAction424(94)
- reduce_table.add new ReduceAction425(94)
- reduce_table.add new ReduceAction426(95)
- reduce_table.add new ReduceAction427(95)
- reduce_table.add new ReduceAction428(95)
- reduce_table.add new ReduceAction429(95)
- reduce_table.add new ReduceAction430(95)
- reduce_table.add new ReduceAction393(96)
- reduce_table.add new ReduceAction394(96)
- reduce_table.add new ReduceAction392(97)
- reduce_table.add new ReduceAction434(98)
+ reduce_table.add new ReduceAction413(93)
+ reduce_table.add new ReduceAction414(94)
+ reduce_table.add new ReduceAction415(94)
+ reduce_table.add new ReduceAction416(94)
+ reduce_table.add new ReduceAction417(94)
+ reduce_table.add new ReduceAction418(94)
+ reduce_table.add new ReduceAction419(95)
+ reduce_table.add new ReduceAction420(95)
+ reduce_table.add new ReduceAction421(95)
+ reduce_table.add new ReduceAction422(95)
+ reduce_table.add new ReduceAction423(95)
+ reduce_table.add new ReduceAction386(96)
+ reduce_table.add new ReduceAction387(96)
+ reduce_table.add new ReduceAction385(97)
+ reduce_table.add new ReduceAction427(98)
reduce_table.add new ReduceAction159(98)
reduce_table.add new ReduceAction159(98)
- reduce_table.add new ReduceAction437(98)
- reduce_table.add new ReduceAction438(98)
- reduce_table.add new ReduceAction439(98)
- reduce_table.add new ReduceAction440(99)
- reduce_table.add new ReduceAction441(99)
- reduce_table.add new ReduceAction442(99)
- reduce_table.add new ReduceAction443(100)
- reduce_table.add new ReduceAction444(100)
- reduce_table.add new ReduceAction443(101)
- reduce_table.add new ReduceAction446(101)
- reduce_table.add new ReduceAction444(101)
- reduce_table.add new ReduceAction448(101)
- reduce_table.add new ReduceAction449(102)
- reduce_table.add new ReduceAction402(103)
- reduce_table.add new ReduceAction451(103)
- reduce_table.add new ReduceAction452(104)
- reduce_table.add new ReduceAction453(105)
- reduce_table.add new ReduceAction454(105)
- reduce_table.add new ReduceAction455(106)
- reduce_table.add new ReduceAction456(106)
- reduce_table.add new ReduceAction457(107)
- reduce_table.add new ReduceAction458(107)
- reduce_table.add new ReduceAction459(107)
- reduce_table.add new ReduceAction460(107)
- reduce_table.add new ReduceAction461(108)
- reduce_table.add new ReduceAction462(108)
- reduce_table.add new ReduceAction463(108)
+ reduce_table.add new ReduceAction430(98)
+ reduce_table.add new ReduceAction431(98)
+ reduce_table.add new ReduceAction432(98)
+ reduce_table.add new ReduceAction433(99)
+ reduce_table.add new ReduceAction434(99)
+ reduce_table.add new ReduceAction435(99)
+ reduce_table.add new ReduceAction436(100)
+ reduce_table.add new ReduceAction437(100)
+ reduce_table.add new ReduceAction436(101)
+ reduce_table.add new ReduceAction439(101)
+ reduce_table.add new ReduceAction437(101)
+ reduce_table.add new ReduceAction441(101)
+ reduce_table.add new ReduceAction442(102)
+ reduce_table.add new ReduceAction395(103)
+ reduce_table.add new ReduceAction444(103)
+ reduce_table.add new ReduceAction445(104)
+ reduce_table.add new ReduceAction446(105)
+ reduce_table.add new ReduceAction447(105)
+ reduce_table.add new ReduceAction448(106)
+ reduce_table.add new ReduceAction449(106)
+ reduce_table.add new ReduceAction450(107)
+ reduce_table.add new ReduceAction451(107)
+ reduce_table.add new ReduceAction452(107)
+ reduce_table.add new ReduceAction453(107)
+ reduce_table.add new ReduceAction454(108)
+ reduce_table.add new ReduceAction455(108)
+ reduce_table.add new ReduceAction456(108)
reduce_table.add new ReduceAction22(108)
- reduce_table.add new ReduceAction465(109)
- reduce_table.add new ReduceAction466(109)
- reduce_table.add new ReduceAction467(109)
- reduce_table.add new ReduceAction466(109)
- reduce_table.add new ReduceAction469(110)
- reduce_table.add new ReduceAction470(110)
- reduce_table.add new ReduceAction471(110)
- reduce_table.add new ReduceAction470(110)
- reduce_table.add new ReduceAction473(111)
- reduce_table.add new ReduceAction474(112)
+ reduce_table.add new ReduceAction458(109)
+ reduce_table.add new ReduceAction459(109)
+ reduce_table.add new ReduceAction460(109)
+ reduce_table.add new ReduceAction459(109)
+ reduce_table.add new ReduceAction462(110)
+ reduce_table.add new ReduceAction463(110)
+ reduce_table.add new ReduceAction464(110)
+ reduce_table.add new ReduceAction463(110)
+ reduce_table.add new ReduceAction466(111)
+ reduce_table.add new ReduceAction467(112)
reduce_table.add new ReduceAction22(113)
- reduce_table.add new ReduceAction476(113)
- reduce_table.add new ReduceAction477(114)
- reduce_table.add new ReduceAction477(114)
- reduce_table.add new ReduceAction477(114)
- reduce_table.add new ReduceAction480(115)
- reduce_table.add new ReduceAction481(115)
+ reduce_table.add new ReduceAction469(113)
+ reduce_table.add new ReduceAction470(114)
+ reduce_table.add new ReduceAction470(114)
+ reduce_table.add new ReduceAction470(114)
+ reduce_table.add new ReduceAction473(115)
+ reduce_table.add new ReduceAction474(115)
reduce_table.add new ReduceAction23(115)
reduce_table.add new ReduceAction23(115)
- reduce_table.add new ReduceAction484(115)
- reduce_table.add new ReduceAction484(115)
- reduce_table.add new ReduceAction486(115)
- reduce_table.add new ReduceAction487(115)
- reduce_table.add new ReduceAction488(115)
- reduce_table.add new ReduceAction488(115)
- reduce_table.add new ReduceAction490(115)
+ reduce_table.add new ReduceAction477(115)
+ reduce_table.add new ReduceAction477(115)
+ reduce_table.add new ReduceAction479(115)
+ reduce_table.add new ReduceAction480(115)
+ reduce_table.add new ReduceAction481(115)
+ reduce_table.add new ReduceAction481(115)
+ reduce_table.add new ReduceAction483(115)
reduce_table.add new ReduceAction22(116)
- reduce_table.add new ReduceAction492(116)
- reduce_table.add new ReduceAction493(117)
- reduce_table.add new ReduceAction477(117)
- reduce_table.add new ReduceAction477(118)
- reduce_table.add new ReduceAction496(118)
+ reduce_table.add new ReduceAction485(116)
+ reduce_table.add new ReduceAction486(117)
+ reduce_table.add new ReduceAction470(117)
+ reduce_table.add new ReduceAction470(118)
+ reduce_table.add new ReduceAction489(118)
reduce_table.add new ReduceAction48(119)
reduce_table.add new ReduceAction49(119)
reduce_table.add new ReduceAction50(119)
reduce_table.add new ReduceAction105(121)
reduce_table.add new ReduceAction106(121)
reduce_table.add new ReduceAction107(121)
- reduce_table.add new ReduceAction469(122)
- reduce_table.add new ReduceAction470(122)
- reduce_table.add new ReduceAction471(122)
- reduce_table.add new ReduceAction470(122)
+ reduce_table.add new ReduceAction462(122)
+ reduce_table.add new ReduceAction463(122)
+ reduce_table.add new ReduceAction464(122)
+ reduce_table.add new ReduceAction463(122)
reduce_table.add new ReduceAction146(123)
reduce_table.add new ReduceAction147(123)
reduce_table.add new ReduceAction159(124)
reduce_table.add new ReduceAction374(139)
reduce_table.add new ReduceAction375(139)
reduce_table.add new ReduceAction376(139)
- reduce_table.add new ReduceAction377(139)
- reduce_table.add new ReduceAction378(139)
- reduce_table.add new ReduceAction379(139)
- reduce_table.add new ReduceAction380(139)
- reduce_table.add new ReduceAction381(139)
- reduce_table.add new ReduceAction382(139)
- reduce_table.add new ReduceAction383(139)
reduce_table.add new ReduceAction159(139)
reduce_table.add new ReduceAction159(139)
reduce_table.add new ReduceAction146(140)
reduce_table.add new ReduceAction374(158)
reduce_table.add new ReduceAction375(158)
reduce_table.add new ReduceAction376(158)
- reduce_table.add new ReduceAction377(158)
- reduce_table.add new ReduceAction378(158)
- reduce_table.add new ReduceAction379(158)
- reduce_table.add new ReduceAction380(158)
- reduce_table.add new ReduceAction381(158)
- reduce_table.add new ReduceAction382(158)
- reduce_table.add new ReduceAction383(158)
reduce_table.add new ReduceAction159(158)
- reduce_table.add new ReduceAction408(159)
- reduce_table.add new ReduceAction409(159)
- reduce_table.add new ReduceAction410(160)
+ reduce_table.add new ReduceAction401(159)
+ reduce_table.add new ReduceAction402(159)
+ reduce_table.add new ReduceAction403(160)
reduce_table.add new ReduceAction22(160)
- reduce_table.add new ReduceAction412(161)
- reduce_table.add new ReduceAction412(162)
- reduce_table.add new ReduceAction393(163)
- reduce_table.add new ReduceAction394(163)
- reduce_table.add new ReduceAction434(164)
+ reduce_table.add new ReduceAction405(161)
+ reduce_table.add new ReduceAction405(162)
+ reduce_table.add new ReduceAction386(163)
+ reduce_table.add new ReduceAction387(163)
+ reduce_table.add new ReduceAction427(164)
reduce_table.add new ReduceAction159(164)
reduce_table.add new ReduceAction159(164)
- reduce_table.add new ReduceAction437(164)
- reduce_table.add new ReduceAction438(164)
+ reduce_table.add new ReduceAction430(164)
+ reduce_table.add new ReduceAction431(164)
reduce_table.add new ReduceAction146(165)
reduce_table.add new ReduceAction147(165)
reduce_table.add new ReduceAction159(166)
reduce_table.add new ReduceAction159(178)
reduce_table.add new ReduceAction325(178)
reduce_table.add new ReduceAction326(178)
- reduce_table.add new ReduceAction871(178)
+ reduce_table.add new ReduceAction850(178)
reduce_table.add new ReduceAction159(179)
- reduce_table.add new ReduceAction873(179)
- reduce_table.add new ReduceAction874(179)
- reduce_table.add new ReduceAction875(179)
- reduce_table.add new ReduceAction876(179)
- reduce_table.add new ReduceAction877(179)
+ reduce_table.add new ReduceAction852(179)
+ reduce_table.add new ReduceAction853(179)
+ reduce_table.add new ReduceAction854(179)
+ reduce_table.add new ReduceAction855(179)
+ reduce_table.add new ReduceAction856(179)
reduce_table.add new ReduceAction183(179)
reduce_table.add new ReduceAction333(179)
- reduce_table.add new ReduceAction876(179)
- reduce_table.add new ReduceAction877(179)
+ reduce_table.add new ReduceAction855(179)
+ reduce_table.add new ReduceAction856(179)
reduce_table.add new ReduceAction191(179)
reduce_table.add new ReduceAction349(179)
- reduce_table.add new ReduceAction884(179)
- reduce_table.add new ReduceAction885(179)
+ reduce_table.add new ReduceAction863(179)
+ reduce_table.add new ReduceAction864(179)
reduce_table.add new ReduceAction355(179)
reduce_table.add new ReduceAction356(179)
reduce_table.add new ReduceAction357(179)
reduce_table.add new ReduceAction374(181)
reduce_table.add new ReduceAction375(181)
reduce_table.add new ReduceAction376(181)
- reduce_table.add new ReduceAction377(181)
- reduce_table.add new ReduceAction378(181)
- reduce_table.add new ReduceAction379(181)
- reduce_table.add new ReduceAction380(181)
- reduce_table.add new ReduceAction381(181)
- reduce_table.add new ReduceAction382(181)
- reduce_table.add new ReduceAction383(181)
reduce_table.add new ReduceAction159(181)
- reduce_table.add new ReduceAction916(182)
- reduce_table.add new ReduceAction917(182)
+ reduce_table.add new ReduceAction888(182)
+ reduce_table.add new ReduceAction889(182)
reduce_table.add new ReduceAction156(183)
reduce_table.add new ReduceAction157(183)
reduce_table.add new ReduceAction158(183)
reduce_table.add new ReduceAction159(198)
reduce_table.add new ReduceAction159(198)
reduce_table.add new ReduceAction200(198)
- reduce_table.add new ReduceAction440(199)
- reduce_table.add new ReduceAction442(199)
- reduce_table.add new ReduceAction480(200)
- reduce_table.add new ReduceAction481(200)
+ reduce_table.add new ReduceAction433(199)
+ reduce_table.add new ReduceAction435(199)
+ reduce_table.add new ReduceAction473(200)
+ reduce_table.add new ReduceAction474(200)
reduce_table.add new ReduceAction23(200)
- reduce_table.add new ReduceAction1078(201)
- reduce_table.add new ReduceAction1079(201)
- reduce_table.add new ReduceAction1080(202)
- reduce_table.add new ReduceAction1081(202)
- reduce_table.add new ReduceAction1082(203)
- reduce_table.add new ReduceAction1083(203)
+ reduce_table.add new ReduceAction1050(201)
+ reduce_table.add new ReduceAction1051(201)
+ reduce_table.add new ReduceAction1052(202)
+ reduce_table.add new ReduceAction1053(202)
+ reduce_table.add new ReduceAction1054(203)
+ reduce_table.add new ReduceAction1055(203)
reduce_table.add new ReduceAction37(204)
- reduce_table.add new ReduceAction1085(204)
+ reduce_table.add new ReduceAction1057(204)
reduce_table.add new ReduceAction45(205)
- reduce_table.add new ReduceAction1087(205)
- reduce_table.add new ReduceAction414(206)
- reduce_table.add new ReduceAction1089(206)
- reduce_table.add new ReduceAction1090(207)
- reduce_table.add new ReduceAction1091(207)
- reduce_table.add new ReduceAction1092(208)
- reduce_table.add new ReduceAction1093(208)
+ reduce_table.add new ReduceAction1059(205)
+ reduce_table.add new ReduceAction407(206)
+ reduce_table.add new ReduceAction1061(206)
+ reduce_table.add new ReduceAction1062(207)
+ reduce_table.add new ReduceAction1063(207)
+ reduce_table.add new ReduceAction1064(208)
+ reduce_table.add new ReduceAction1065(208)
reduce_table.add new ReduceAction150(209)
- reduce_table.add new ReduceAction1095(209)
- reduce_table.add new ReduceAction393(210)
- reduce_table.add new ReduceAction1097(210)
- reduce_table.add new ReduceAction393(211)
- reduce_table.add new ReduceAction1097(211)
- reduce_table.add new ReduceAction393(212)
- reduce_table.add new ReduceAction1097(212)
- reduce_table.add new ReduceAction454(213)
- reduce_table.add new ReduceAction1103(213)
- reduce_table.add new ReduceAction414(214)
- reduce_table.add new ReduceAction1089(214)
- reduce_table.add new ReduceAction393(215)
- reduce_table.add new ReduceAction1097(215)
- reduce_table.add new ReduceAction393(216)
- reduce_table.add new ReduceAction1097(216)
- reduce_table.add new ReduceAction455(217)
- reduce_table.add new ReduceAction1111(217)
- reduce_table.add new ReduceAction1112(218)
- reduce_table.add new ReduceAction1113(218)
- reduce_table.add new ReduceAction477(219)
- reduce_table.add new ReduceAction496(219)
+ reduce_table.add new ReduceAction1067(209)
+ reduce_table.add new ReduceAction386(210)
+ reduce_table.add new ReduceAction1069(210)
+ reduce_table.add new ReduceAction386(211)
+ reduce_table.add new ReduceAction1069(211)
+ reduce_table.add new ReduceAction386(212)
+ reduce_table.add new ReduceAction1069(212)
+ reduce_table.add new ReduceAction447(213)
+ reduce_table.add new ReduceAction1075(213)
+ reduce_table.add new ReduceAction407(214)
+ reduce_table.add new ReduceAction1061(214)
+ reduce_table.add new ReduceAction386(215)
+ reduce_table.add new ReduceAction1069(215)
+ reduce_table.add new ReduceAction386(216)
+ reduce_table.add new ReduceAction1069(216)
+ reduce_table.add new ReduceAction448(217)
+ reduce_table.add new ReduceAction1083(217)
+ reduce_table.add new ReduceAction1084(218)
+ reduce_table.add new ReduceAction1085(218)
+ reduce_table.add new ReduceAction470(219)
+ reduce_table.add new ReduceAction489(219)
end
end
var node_list: nullable Object = null
var nodearraylist2 = p.pop
var nodearraylist1 = p.pop
- var tnumbernode2 = nodearraylist1
- assert tnumbernode2 isa nullable TNumber
+ var tintegernode2 = nodearraylist1
+ assert tintegernode2 isa nullable TInteger
var pannotationsnode3 = nodearraylist2
assert pannotationsnode3 isa nullable AAnnotations
- var pexprnode1: nullable ADecIntExpr = new ADecIntExpr.init_adecintexpr(
- tnumbernode2,
+ var pexprnode1: nullable AIntegerExpr = new AIntegerExpr.init_aintegerexpr(
+ tintegernode2,
pannotationsnode3
)
node_list = pexprnode1
var node_list: nullable Object = null
var nodearraylist2 = p.pop
var nodearraylist1 = p.pop
- var thexnumbernode2 = nodearraylist1
- assert thexnumbernode2 isa nullable THexNumber
- var pannotationsnode3 = nodearraylist2
- assert pannotationsnode3 isa nullable AAnnotations
- var pexprnode1: nullable AHexIntExpr = new AHexIntExpr.init_ahexintexpr(
- thexnumbernode2,
- pannotationsnode3
- )
- node_list = pexprnode1
- p.push(p.go_to(_goto), node_list)
- end
-end
-private class ReduceAction375
- super ReduceAction
- redef fun action(p: Parser)
- do
- var node_list: nullable Object = null
- var nodearraylist2 = p.pop
- var nodearraylist1 = p.pop
- var tbinnumbernode2 = nodearraylist1
- assert tbinnumbernode2 isa nullable TBinNumber
- var pannotationsnode3 = nodearraylist2
- assert pannotationsnode3 isa nullable AAnnotations
- var pexprnode1: nullable ABinIntExpr = new ABinIntExpr.init_abinintexpr(
- tbinnumbernode2,
- pannotationsnode3
- )
- node_list = pexprnode1
- p.push(p.go_to(_goto), node_list)
- end
-end
-private class ReduceAction376
- super ReduceAction
- redef fun action(p: Parser)
- do
- var node_list: nullable Object = null
- var nodearraylist2 = p.pop
- var nodearraylist1 = p.pop
- var toctnumbernode2 = nodearraylist1
- assert toctnumbernode2 isa nullable TOctNumber
- var pannotationsnode3 = nodearraylist2
- assert pannotationsnode3 isa nullable AAnnotations
- var pexprnode1: nullable AOctIntExpr = new AOctIntExpr.init_aoctintexpr(
- toctnumbernode2,
- pannotationsnode3
- )
- node_list = pexprnode1
- p.push(p.go_to(_goto), node_list)
- end
-end
-private class ReduceAction377
- super ReduceAction
- redef fun action(p: Parser)
- do
- var node_list: nullable Object = null
- var nodearraylist2 = p.pop
- var nodearraylist1 = p.pop
- var tbytenumnode2 = nodearraylist1
- assert tbytenumnode2 isa nullable TBytenum
- var pannotationsnode3 = nodearraylist2
- assert pannotationsnode3 isa nullable AAnnotations
- var pexprnode1: nullable ADecByteExpr = new ADecByteExpr.init_adecbyteexpr(
- tbytenumnode2,
- pannotationsnode3
- )
- node_list = pexprnode1
- p.push(p.go_to(_goto), node_list)
- end
-end
-private class ReduceAction378
- super ReduceAction
- redef fun action(p: Parser)
- do
- var node_list: nullable Object = null
- var nodearraylist2 = p.pop
- var nodearraylist1 = p.pop
- var thexbytenumnode2 = nodearraylist1
- assert thexbytenumnode2 isa nullable THexBytenum
- var pannotationsnode3 = nodearraylist2
- assert pannotationsnode3 isa nullable AAnnotations
- var pexprnode1: nullable AHexByteExpr = new AHexByteExpr.init_ahexbyteexpr(
- thexbytenumnode2,
- pannotationsnode3
- )
- node_list = pexprnode1
- p.push(p.go_to(_goto), node_list)
- end
-end
-private class ReduceAction379
- super ReduceAction
- redef fun action(p: Parser)
- do
- var node_list: nullable Object = null
- var nodearraylist2 = p.pop
- var nodearraylist1 = p.pop
- var tbinbytenumnode2 = nodearraylist1
- assert tbinbytenumnode2 isa nullable TBinBytenum
- var pannotationsnode3 = nodearraylist2
- assert pannotationsnode3 isa nullable AAnnotations
- var pexprnode1: nullable ABinByteExpr = new ABinByteExpr.init_abinbyteexpr(
- tbinbytenumnode2,
- pannotationsnode3
- )
- node_list = pexprnode1
- p.push(p.go_to(_goto), node_list)
- end
-end
-private class ReduceAction380
- super ReduceAction
- redef fun action(p: Parser)
- do
- var node_list: nullable Object = null
- var nodearraylist2 = p.pop
- var nodearraylist1 = p.pop
- var toctbytenumnode2 = nodearraylist1
- assert toctbytenumnode2 isa nullable TOctBytenum
- var pannotationsnode3 = nodearraylist2
- assert pannotationsnode3 isa nullable AAnnotations
- var pexprnode1: nullable AOctByteExpr = new AOctByteExpr.init_aoctbyteexpr(
- toctbytenumnode2,
- pannotationsnode3
- )
- node_list = pexprnode1
- p.push(p.go_to(_goto), node_list)
- end
-end
-private class ReduceAction381
- super ReduceAction
- redef fun action(p: Parser)
- do
- var node_list: nullable Object = null
- var nodearraylist2 = p.pop
- var nodearraylist1 = p.pop
var tfloatnode2 = nodearraylist1
assert tfloatnode2 isa nullable TFloat
var pannotationsnode3 = nodearraylist2
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction382
+private class ReduceAction375
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction383
+private class ReduceAction376
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction386
+private class ReduceAction379
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction387
+private class ReduceAction380
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction388
+private class ReduceAction381
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction389
+private class ReduceAction382
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction391
+private class ReduceAction384
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction392
+private class ReduceAction385
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction393
+private class ReduceAction386
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction394
+private class ReduceAction387
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction396
+private class ReduceAction389
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction398
+private class ReduceAction391
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction399
+private class ReduceAction392
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction400
+private class ReduceAction393
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction401
+private class ReduceAction394
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction402
+private class ReduceAction395
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction403
+private class ReduceAction396
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction406
+private class ReduceAction399
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction407
+private class ReduceAction400
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction408
+private class ReduceAction401
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction409
+private class ReduceAction402
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction410
+private class ReduceAction403
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction412
+private class ReduceAction405
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction413
+private class ReduceAction406
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction414
+private class ReduceAction407
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction415
+private class ReduceAction408
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction418
+private class ReduceAction411
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction420
+private class ReduceAction413
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction421
+private class ReduceAction414
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction422
+private class ReduceAction415
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction423
+private class ReduceAction416
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction424
+private class ReduceAction417
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction425
+private class ReduceAction418
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction426
+private class ReduceAction419
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction427
+private class ReduceAction420
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction428
+private class ReduceAction421
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction429
+private class ReduceAction422
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction430
+private class ReduceAction423
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction434
+private class ReduceAction427
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction437
+private class ReduceAction430
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction438
+private class ReduceAction431
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction439
+private class ReduceAction432
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction440
+private class ReduceAction433
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction441
+private class ReduceAction434
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction442
+private class ReduceAction435
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction443
+private class ReduceAction436
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction444
+private class ReduceAction437
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction446
+private class ReduceAction439
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction448
+private class ReduceAction441
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction449
+private class ReduceAction442
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction451
+private class ReduceAction444
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction452
+private class ReduceAction445
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction453
+private class ReduceAction446
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction454
+private class ReduceAction447
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction455
+private class ReduceAction448
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction456
+private class ReduceAction449
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction457
+private class ReduceAction450
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction458
+private class ReduceAction451
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction459
+private class ReduceAction452
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction460
+private class ReduceAction453
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction461
+private class ReduceAction454
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction462
+private class ReduceAction455
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction463
+private class ReduceAction456
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction465
+private class ReduceAction458
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction466
+private class ReduceAction459
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction467
+private class ReduceAction460
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction469
+private class ReduceAction462
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction470
+private class ReduceAction463
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction471
+private class ReduceAction464
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction473
+private class ReduceAction466
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction474
+private class ReduceAction467
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction476
+private class ReduceAction469
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction477
+private class ReduceAction470
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction480
+private class ReduceAction473
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction481
+private class ReduceAction474
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction484
+private class ReduceAction477
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction486
+private class ReduceAction479
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction487
+private class ReduceAction480
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction488
+private class ReduceAction481
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction490
+private class ReduceAction483
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction492
+private class ReduceAction485
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction493
+private class ReduceAction486
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction496
+private class ReduceAction489
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction871
+private class ReduceAction850
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction873
+private class ReduceAction852
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction874
+private class ReduceAction853
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction875
+private class ReduceAction854
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction876
+private class ReduceAction855
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction877
+private class ReduceAction856
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction884
+private class ReduceAction863
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction885
+private class ReduceAction864
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction916
+private class ReduceAction888
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction917
+private class ReduceAction889
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction1078
+private class ReduceAction1050
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction1079
+private class ReduceAction1051
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction1080
+private class ReduceAction1052
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction1081
+private class ReduceAction1053
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction1082
+private class ReduceAction1054
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction1083
+private class ReduceAction1055
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction1085
+private class ReduceAction1057
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction1087
+private class ReduceAction1059
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction1089
+private class ReduceAction1061
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction1090
+private class ReduceAction1062
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction1091
+private class ReduceAction1063
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction1092
+private class ReduceAction1064
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction1093
+private class ReduceAction1065
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction1095
+private class ReduceAction1067
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction1097
+private class ReduceAction1069
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction1103
+private class ReduceAction1075
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction1111
+private class ReduceAction1083
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction1112
+private class ReduceAction1084
super ReduceAction
redef fun action(p: Parser)
do
p.push(p.go_to(_goto), node_list)
end
end
-private class ReduceAction1113
+private class ReduceAction1085
super ReduceAction
redef fun action(p: Parser)
do
class TAttrid
super Token
end
-class TNumber
- super Token
-end
-class THexNumber
- super Token
-end
-class TBinNumber
- super Token
-end
-class TOctNumber
- super Token
-end
-class TBytenum
- super Token
-end
-class THexBytenum
- super Token
-end
-class TBinBytenum
- super Token
-end
-class TOctBytenum
+class TInteger
super Token
end
class TFloat
var n_kwnull: TKwnull is writable, noinit
var n_annotations: nullable AAnnotations = null is writable
end
-class ADecIntExpr
- super AExpr
- var n_number: TNumber is writable, noinit
- var n_annotations: nullable AAnnotations = null is writable
-end
-class AHexIntExpr
- super AExpr
- var n_hex_number: THexNumber is writable, noinit
- var n_annotations: nullable AAnnotations = null is writable
-end
-class ABinIntExpr
- super AExpr
- var n_bin_number: TBinNumber is writable, noinit
- var n_annotations: nullable AAnnotations = null is writable
-end
-class AOctIntExpr
- super AExpr
- var n_oct_number: TOctNumber is writable, noinit
- var n_annotations: nullable AAnnotations = null is writable
-end
-class ADecByteExpr
- super AExpr
- var n_bytenum: TBytenum is writable, noinit
- var n_annotations: nullable AAnnotations = null is writable
-end
-class AHexByteExpr
- super AExpr
- var n_hex_bytenum: THexBytenum is writable, noinit
- var n_annotations: nullable AAnnotations = null is writable
-end
-class ABinByteExpr
- super AExpr
- var n_bin_bytenum: TBinBytenum is writable, noinit
- var n_annotations: nullable AAnnotations = null is writable
-end
-class AOctByteExpr
+class AIntegerExpr
super AExpr
- var n_oct_bytenum: TOctBytenum is writable, noinit
+ var n_integer: TInteger is writable, noinit
var n_annotations: nullable AAnnotations = null is writable
end
class AFloatExpr
end
end
-# A literal decimal integer
-class TNumber
- super TokenLiteral
-end
-
-# A literal hexadecimal integer
-class THexNumber
- super TokenLiteral
-end
-
-# A literal binary integer
-class TBinNumber
- super TokenLiteral
-end
-
-# A literal octal integer
-class TOctNumber
- super TokenLiteral
-end
-
-# A literal decimal byte
-class TBytenum
- super TokenLiteral
-end
-
-# A literal hexadecimal byte
-class THexBytenum
- super TokenLiteral
-end
-
-# A literal binary byte
-class TBinBytenum
- super TokenLiteral
-end
-
-# A literal octal byte
-class TOctBytenum
+# A literal integer
+class TInteger
super TokenLiteral
end
end
# An integer literal
-class AIntExpr
+class AIntegerExpr
super AExpr
-end
-
-# An integer literal in decimal format
-class ADecIntExpr
- super AIntExpr
-
- # The decimal token
- var n_number: TNumber is writable, noinit
-end
-
-# An integer literal in hexadecimal format
-class AHexIntExpr
- super AIntExpr
-
- # The hexadecimal token
- var n_hex_number: THexNumber is writable, noinit
-end
-
-# An integer literal in binary format
-class ABinIntExpr
- super AIntExpr
-
- # The binary token
- var n_bin_number: TBinNumber is writable, noinit
-end
-
-# An integer literal in octal format
-class AOctIntExpr
- super AIntExpr
-
- # The octal token
- var n_oct_number: TOctNumber is writable, noinit
-end
-
-# An byte literal
-class AByteExpr
- super AExpr
-end
-
-# An byte literal in decimal format
-class ADecByteExpr
- super AByteExpr
-
- # The decimal token
- var n_bytenum: TBytenum is writable, noinit
-end
-
-# An byte literal in hexadecimal format
-class AHexByteExpr
- super AByteExpr
-
- # The hexadecimal token
- var n_hex_bytenum: THexBytenum is writable, noinit
-end
-
-# An byte literal in binary format
-class ABinByteExpr
- super AByteExpr
-
- # The binary token
- var n_bin_bytenum: TBinBytenum is writable, noinit
-end
-
-# An byte literal in octal format
-class AOctByteExpr
- super AByteExpr
- # The octal token
- var n_oct_bytenum: TOctBytenum is writable, noinit
+ # The integer token
+ var n_integer: TInteger is writable, noinit
end
# A float literal
v.enter_visit(_n_annotations)
end
end
-redef class ADecIntExpr
- init init_adecintexpr (
- n_number: nullable TNumber,
+redef class AIntegerExpr
+ init init_aintegerexpr (
+ n_integer: nullable TInteger,
n_annotations: nullable AAnnotations
)
do
- _n_number = n_number.as(not null)
- n_number.parent = self
+ _n_integer = n_integer.as(not null)
+ n_integer.parent = self
_n_annotations = n_annotations
if n_annotations != null then n_annotations.parent = self
end
redef fun replace_child(old_child: ANode, new_child: nullable ANode)
do
- if _n_number == old_child then
- n_number = new_child.as(TNumber)
+ if _n_integer == old_child then
+ n_integer = new_child.as(TInteger)
return
end
if _n_annotations == old_child then
end
end
- redef fun n_number=(node)
+ redef fun n_integer=(node)
do
- _n_number = node
+ _n_integer = node
node.parent = self
end
redef fun n_annotations=(node)
redef fun visit_all(v: Visitor)
do
- v.enter_visit(_n_number)
- v.enter_visit(_n_annotations)
- end
-end
-redef class AHexIntExpr
- init init_ahexintexpr (
- n_hex_number: nullable THexNumber,
- n_annotations: nullable AAnnotations
- )
- do
- _n_hex_number = n_hex_number.as(not null)
- n_hex_number.parent = self
- _n_annotations = n_annotations
- if n_annotations != null then n_annotations.parent = self
- end
-
- redef fun replace_child(old_child: ANode, new_child: nullable ANode)
- do
- if _n_hex_number == old_child then
- n_hex_number = new_child.as(THexNumber)
- return
- end
- if _n_annotations == old_child then
- n_annotations = new_child.as(nullable AAnnotations)
- return
- end
- end
-
- redef fun n_hex_number=(node)
- do
- _n_hex_number = node
- node.parent = self
- end
- redef fun n_annotations=(node)
- do
- _n_annotations = node
- if node != null then node.parent = self
- end
-
-
- redef fun visit_all(v: Visitor)
- do
- v.enter_visit(_n_hex_number)
- v.enter_visit(_n_annotations)
- end
-end
-redef class ABinIntExpr
- init init_abinintexpr (
- n_bin_number: nullable TBinNumber,
- n_annotations: nullable AAnnotations
- )
- do
- _n_bin_number = n_bin_number.as(not null)
- n_bin_number.parent = self
- _n_annotations = n_annotations
- if n_annotations != null then n_annotations.parent = self
- end
-
- redef fun replace_child(old_child: ANode, new_child: nullable ANode)
- do
- if _n_bin_number == old_child then
- n_bin_number = new_child.as(TBinNumber)
- return
- end
- if _n_annotations == old_child then
- n_annotations = new_child.as(nullable AAnnotations)
- return
- end
- end
-
- redef fun n_bin_number=(node)
- do
- _n_bin_number = node
- node.parent = self
- end
- redef fun n_annotations=(node)
- do
- _n_annotations = node
- if node != null then node.parent = self
- end
-
-
- redef fun visit_all(v: Visitor)
- do
- v.enter_visit(_n_bin_number)
- v.enter_visit(_n_annotations)
- end
-end
-redef class AOctIntExpr
- init init_aoctintexpr (
- n_oct_number: nullable TOctNumber,
- n_annotations: nullable AAnnotations
- )
- do
- _n_oct_number = n_oct_number.as(not null)
- n_oct_number.parent = self
- _n_annotations = n_annotations
- if n_annotations != null then n_annotations.parent = self
- end
-
- redef fun replace_child(old_child: ANode, new_child: nullable ANode)
- do
- if _n_oct_number == old_child then
- n_oct_number = new_child.as(TOctNumber)
- return
- end
- if _n_annotations == old_child then
- n_annotations = new_child.as(nullable AAnnotations)
- return
- end
- end
-
- redef fun n_oct_number=(node)
- do
- _n_oct_number = node
- node.parent = self
- end
- redef fun n_annotations=(node)
- do
- _n_annotations = node
- if node != null then node.parent = self
- end
-
-
- redef fun visit_all(v: Visitor)
- do
- v.enter_visit(_n_oct_number)
- v.enter_visit(_n_annotations)
- end
-end
-redef class ADecByteExpr
- init init_adecbyteexpr (
- n_bytenum: nullable TBytenum,
- n_annotations: nullable AAnnotations
- )
- do
- _n_bytenum = n_bytenum.as(not null)
- n_bytenum.parent = self
- _n_annotations = n_annotations
- if n_annotations != null then n_annotations.parent = self
- end
-
- redef fun replace_child(old_child: ANode, new_child: nullable ANode)
- do
- if _n_bytenum == old_child then
- n_bytenum = new_child.as(TBytenum)
- return
- end
- if _n_annotations == old_child then
- n_annotations = new_child.as(nullable AAnnotations)
- return
- end
- end
-
- redef fun n_bytenum=(node)
- do
- _n_bytenum = node
- node.parent = self
- end
- redef fun n_annotations=(node)
- do
- _n_annotations = node
- if node != null then node.parent = self
- end
-
-
- redef fun visit_all(v: Visitor)
- do
- v.enter_visit(_n_bytenum)
- v.enter_visit(_n_annotations)
- end
-end
-redef class AHexByteExpr
- init init_ahexbyteexpr (
- n_hex_bytenum: nullable THexBytenum,
- n_annotations: nullable AAnnotations
- )
- do
- _n_hex_bytenum = n_hex_bytenum.as(not null)
- n_hex_bytenum.parent = self
- _n_annotations = n_annotations
- if n_annotations != null then n_annotations.parent = self
- end
-
- redef fun replace_child(old_child: ANode, new_child: nullable ANode)
- do
- if _n_hex_bytenum == old_child then
- n_hex_bytenum = new_child.as(THexBytenum)
- return
- end
- if _n_annotations == old_child then
- n_annotations = new_child.as(nullable AAnnotations)
- return
- end
- end
-
- redef fun n_hex_bytenum=(node)
- do
- _n_hex_bytenum = node
- node.parent = self
- end
- redef fun n_annotations=(node)
- do
- _n_annotations = node
- if node != null then node.parent = self
- end
-
-
- redef fun visit_all(v: Visitor)
- do
- v.enter_visit(_n_hex_bytenum)
- v.enter_visit(_n_annotations)
- end
-end
-redef class ABinByteExpr
- init init_abinbyteexpr (
- n_bin_bytenum: nullable TBinBytenum,
- n_annotations: nullable AAnnotations
- )
- do
- _n_bin_bytenum = n_bin_bytenum.as(not null)
- n_bin_bytenum.parent = self
- _n_annotations = n_annotations
- if n_annotations != null then n_annotations.parent = self
- end
-
- redef fun replace_child(old_child: ANode, new_child: nullable ANode)
- do
- if _n_bin_bytenum == old_child then
- n_bin_bytenum = new_child.as(TBinBytenum)
- return
- end
- if _n_annotations == old_child then
- n_annotations = new_child.as(nullable AAnnotations)
- return
- end
- end
-
- redef fun n_bin_bytenum=(node)
- do
- _n_bin_bytenum = node
- node.parent = self
- end
- redef fun n_annotations=(node)
- do
- _n_annotations = node
- if node != null then node.parent = self
- end
-
-
- redef fun visit_all(v: Visitor)
- do
- v.enter_visit(_n_bin_bytenum)
- v.enter_visit(_n_annotations)
- end
-end
-redef class AOctByteExpr
- init init_aoctbyteexpr (
- n_oct_bytenum: nullable TOctBytenum,
- n_annotations: nullable AAnnotations
- )
- do
- _n_oct_bytenum = n_oct_bytenum.as(not null)
- n_oct_bytenum.parent = self
- _n_annotations = n_annotations
- if n_annotations != null then n_annotations.parent = self
- end
-
- redef fun replace_child(old_child: ANode, new_child: nullable ANode)
- do
- if _n_oct_bytenum == old_child then
- n_oct_bytenum = new_child.as(TOctBytenum)
- return
- end
- if _n_annotations == old_child then
- n_annotations = new_child.as(nullable AAnnotations)
- return
- end
- end
-
- redef fun n_oct_bytenum=(node)
- do
- _n_oct_bytenum = node
- node.parent = self
- end
- redef fun n_annotations=(node)
- do
- _n_annotations = node
- if node != null then node.parent = self
- end
-
-
- redef fun visit_all(v: Visitor)
- do
- v.enter_visit(_n_oct_bytenum)
+ v.enter_visit(_n_integer)
v.enter_visit(_n_annotations)
end
end
end
var goto: Int
end
+
+redef class AExpr
+
+ # Get `self` as a single identifier.
+ # Return null if not a single identifier.
+ fun as_id: nullable String
+ do
+ if self isa AMethidExpr then
+ return self.collect_text
+ end
+ if not self isa ACallExpr then return null
+ if not self.n_expr isa AImplicitSelfExpr then return null
+ if not self.n_args.n_exprs.is_empty then return null
+ return self.n_id.text
+ end
+end
61, 61, 75
};
static const int lexer_goto_row20[] = {
- 11,
+ 13,
46, 46, 76,
- 48, 57, 20,
- 66, 66, 77,
- 69, 69, 78,
- 79, 79, 79,
- 88, 88, 80,
- 98, 98, 81,
- 101, 101, 82,
- 111, 111, 83,
- 117, 117, 84,
- 120, 120, 85
+ 48, 57, 77,
+ 66, 66, 78,
+ 69, 69, 79,
+ 79, 79, 80,
+ 88, 88, 81,
+ 95, 95, 82,
+ 98, 98, 83,
+ 101, 101, 84,
+ 105, 105, 85,
+ 111, 111, 86,
+ 117, 117, 87,
+ 120, 120, 88
};
static const int lexer_goto_row21[] = {
- 4,
+ 5,
46, 57, -21,
- 69, 69, 78,
- 101, 101, 82,
- 117, 117, 84
+ 69, 69, 79,
+ 95, 95, 82,
+ 101, 105, -21,
+ 117, 117, 87
};
static const int lexer_goto_row22[] = {
1,
- 58, 58, 86
+ 58, 58, 89
};
static const int lexer_goto_row24[] = {
2,
- 60, 60, 87,
- 61, 61, 88
+ 60, 60, 90,
+ 61, 61, 91
};
static const int lexer_goto_row25[] = {
1,
- 61, 61, 89
+ 61, 61, 92
};
static const int lexer_goto_row26[] = {
2,
- 61, 61, 90,
- 62, 62, 91
+ 61, 61, 93,
+ 62, 62, 94
};
static const int lexer_goto_row28[] = {
4,
- 48, 57, 92,
- 65, 90, 93,
- 95, 95, 94,
- 97, 122, 95
+ 48, 57, 95,
+ 65, 90, 96,
+ 95, 95, 97,
+ 97, 122, 98
};
static const int lexer_goto_row31[] = {
1,
- 61, 61, 96
+ 61, 61, 99
};
static const int lexer_goto_row32[] = {
2,
- 95, 95, 97,
- 97, 122, 98
+ 95, 95, 100,
+ 97, 122, 101
};
static const int lexer_goto_row33[] = {
1,
- 123, 123, 99
+ 123, 123, 102
};
static const int lexer_goto_row34[] = {
10,
- 48, 57, 100,
- 65, 90, 101,
- 95, 95, 102,
- 97, 97, 103,
- 98, 98, 104,
- 99, 109, 103,
- 110, 110, 105,
- 111, 114, 103,
- 115, 115, 106,
- 116, 122, 103
+ 48, 57, 103,
+ 65, 90, 104,
+ 95, 95, 105,
+ 97, 97, 106,
+ 98, 98, 107,
+ 99, 109, 106,
+ 110, 110, 108,
+ 111, 114, 106,
+ 115, 115, 109,
+ 116, 122, 106
};
static const int lexer_goto_row35[] = {
4,
48, 95, -35,
- 97, 113, 103,
- 114, 114, 107,
- 115, 122, 103
+ 97, 113, 106,
+ 114, 114, 110,
+ 115, 122, 106
};
static const int lexer_goto_row36[] = {
6,
48, 95, -35,
- 97, 107, 103,
- 108, 108, 108,
- 109, 110, 103,
- 111, 111, 109,
- 112, 122, 103
+ 97, 107, 106,
+ 108, 108, 111,
+ 109, 110, 106,
+ 111, 111, 112,
+ 112, 122, 106
};
static const int lexer_goto_row37[] = {
4,
48, 95, -35,
- 97, 110, 103,
- 111, 111, 110,
- 112, 122, 103
+ 97, 110, 106,
+ 111, 111, 113,
+ 112, 122, 106
};
static const int lexer_goto_row38[] = {
7,
48, 107, -37,
- 108, 108, 111,
- 109, 109, 103,
- 110, 110, 112,
- 111, 119, 103,
- 120, 120, 113,
- 121, 122, 103
+ 108, 108, 114,
+ 109, 109, 106,
+ 110, 110, 115,
+ 111, 119, 106,
+ 120, 120, 116,
+ 121, 122, 106
};
static const int lexer_goto_row39[] = {
7,
48, 95, -35,
- 97, 97, 114,
- 98, 110, 103,
- 111, 111, 115,
- 112, 116, 103,
- 117, 117, 116,
- 118, 122, 103
+ 97, 97, 117,
+ 98, 110, 106,
+ 111, 111, 118,
+ 112, 116, 106,
+ 117, 117, 119,
+ 118, 122, 106
};
static const int lexer_goto_row40[] = {
2,
48, 95, -35,
- 97, 122, 103
+ 97, 122, 106
};
static const int lexer_goto_row41[] = {
9,
48, 95, -35,
- 97, 101, 103,
- 102, 102, 117,
- 103, 108, 103,
- 109, 109, 118,
- 110, 110, 119,
- 111, 114, 103,
- 115, 115, 120,
- 116, 122, 103
+ 97, 101, 106,
+ 102, 102, 120,
+ 103, 108, 106,
+ 109, 109, 121,
+ 110, 110, 122,
+ 111, 114, 106,
+ 115, 115, 123,
+ 116, 122, 106
};
static const int lexer_goto_row42[] = {
5,
48, 95, -35,
- 97, 97, 121,
- 98, 110, 103,
- 111, 111, 122,
- 112, 122, 103
+ 97, 97, 124,
+ 98, 110, 106,
+ 111, 111, 125,
+ 112, 122, 106
};
static const int lexer_goto_row43[] = {
3,
48, 110, -38,
- 111, 111, 123,
- 112, 122, 103
+ 111, 111, 126,
+ 112, 122, 106
};
static const int lexer_goto_row44[] = {
8,
48, 95, -35,
- 97, 100, 103,
- 101, 101, 124,
- 102, 110, 103,
- 111, 111, 125,
- 112, 116, 103,
- 117, 117, 126,
- 118, 122, 103
+ 97, 100, 106,
+ 101, 101, 127,
+ 102, 110, 106,
+ 111, 111, 128,
+ 112, 116, 106,
+ 117, 117, 129,
+ 118, 122, 106
};
static const int lexer_goto_row45[] = {
6,
48, 95, -35,
- 97, 109, 103,
- 110, 110, 127,
- 111, 113, 103,
- 114, 114, 128,
- 115, 122, 103
+ 97, 109, 106,
+ 110, 110, 130,
+ 111, 113, 106,
+ 114, 114, 131,
+ 115, 122, 106
};
static const int lexer_goto_row46[] = {
7,
48, 95, -35,
- 97, 97, 129,
- 98, 113, 103,
- 114, 114, 130,
- 115, 116, 103,
- 117, 117, 131,
- 118, 122, 103
+ 97, 97, 132,
+ 98, 113, 106,
+ 114, 114, 133,
+ 115, 116, 106,
+ 117, 117, 134,
+ 118, 122, 106
};
static const int lexer_goto_row47[] = {
3,
48, 100, -45,
- 101, 101, 132,
- 102, 122, 103
+ 101, 101, 135,
+ 102, 122, 106
};
static const int lexer_goto_row48[] = {
5,
48, 100, -45,
- 101, 101, 133,
- 102, 116, 103,
- 117, 117, 134,
- 118, 122, 103
+ 101, 101, 136,
+ 102, 116, 106,
+ 117, 117, 137,
+ 118, 122, 106
};
static const int lexer_goto_row49[] = {
8,
48, 95, -35,
- 97, 103, 103,
- 104, 104, 135,
- 105, 113, 103,
- 114, 114, 136,
- 115, 120, 103,
- 121, 121, 137,
- 122, 122, 103
+ 97, 103, 106,
+ 104, 104, 138,
+ 105, 113, 106,
+ 114, 114, 139,
+ 115, 120, 106,
+ 121, 121, 140,
+ 122, 122, 106
};
static const int lexer_goto_row50[] = {
3,
48, 109, -46,
- 110, 110, 138,
- 111, 122, 103
+ 110, 110, 141,
+ 111, 122, 106
};
static const int lexer_goto_row51[] = {
3,
48, 95, -35,
- 97, 97, 139,
- 98, 122, 103
+ 97, 97, 142,
+ 98, 122, 106
};
static const int lexer_goto_row52[] = {
4,
48, 103, -50,
- 104, 104, 140,
- 105, 105, 141,
- 106, 122, 103
+ 104, 104, 143,
+ 105, 105, 144,
+ 106, 122, 106
};
static const int lexer_goto_row53[] = {
1,
- 61, 61, 142
+ 61, 61, 145
};
static const int lexer_goto_row54[] = {
11,
- 0, 9, 143,
- 11, 12, 143,
- 14, 33, 143,
- 34, 34, 144,
- 35, 91, 143,
- 92, 92, 145,
- 93, 122, 143,
- 123, 123, 146,
- 124, 124, 143,
- 125, 125, 147,
- 126, 255, 143
+ 0, 9, 146,
+ 11, 12, 146,
+ 14, 33, 146,
+ 34, 34, 147,
+ 35, 91, 146,
+ 92, 92, 148,
+ 93, 122, 146,
+ 123, 123, 149,
+ 124, 124, 146,
+ 125, 125, 150,
+ 126, 255, 146
};
static const int lexer_goto_row58[] = {
3,
0, 33, -8,
- 34, 34, 148,
+ 34, 34, 151,
35, 255, -8
};
static const int lexer_goto_row59[] = {
1,
- 34, 34, 149
+ 34, 34, 152
};
static const int lexer_goto_row60[] = {
3,
- 0, 9, 150,
- 11, 12, 150,
- 14, 255, 150
+ 0, 9, 153,
+ 11, 12, 153,
+ 14, 255, 153
};
static const int lexer_goto_row62[] = {
1,
};
static const int lexer_goto_row64[] = {
1,
- 10, 10, 151
+ 10, 10, 154
};
static const int lexer_goto_row67[] = {
1,
- 39, 39, 152
+ 39, 39, 155
};
static const int lexer_goto_row68[] = {
1,
- 39, 39, 153
+ 39, 39, 156
};
static const int lexer_goto_row69[] = {
3,
- 0, 9, 154,
- 11, 12, 154,
- 14, 255, 154
+ 0, 9, 157,
+ 11, 12, 157,
+ 14, 255, 157
};
static const int lexer_goto_row70[] = {
1,
- 61, 61, 155
+ 61, 61, 158
};
static const int lexer_goto_row74[] = {
1,
- 46, 46, 156
+ 46, 46, 159
};
static const int lexer_goto_row75[] = {
- 2,
+ 3,
48, 57, 74,
- 69, 101, -22
+ 69, 69, 79,
+ 101, 101, 84
};
static const int lexer_goto_row77[] = {
1,
48, 57, 74
};
static const int lexer_goto_row78[] = {
- 3,
- 48, 48, 157,
- 49, 49, 158,
- 95, 95, 159
+ 1,
+ 46, 117, -22
};
static const int lexer_goto_row79[] = {
3,
- 43, 43, 160,
- 45, 45, 161,
- 48, 57, 162
+ 48, 48, 160,
+ 49, 49, 161,
+ 95, 95, 162
};
static const int lexer_goto_row80[] = {
- 2,
- 48, 55, 163,
- 95, 95, 164
+ 3,
+ 43, 43, 163,
+ 45, 45, 164,
+ 48, 57, 165
};
static const int lexer_goto_row81[] = {
- 4,
- 48, 57, 165,
- 65, 70, 166,
- 95, 95, 167,
- 97, 102, 168
+ 2,
+ 48, 55, 166,
+ 95, 95, 167
};
static const int lexer_goto_row82[] = {
- 1,
- 48, 95, -79
+ 4,
+ 48, 57, 168,
+ 65, 70, 169,
+ 95, 95, 170,
+ 97, 102, 171
};
static const int lexer_goto_row83[] = {
- 1,
- 43, 57, -80
+ 3,
+ 48, 57, 172,
+ 95, 95, 82,
+ 105, 117, -22
};
static const int lexer_goto_row84[] = {
1,
- 48, 95, -81
+ 48, 95, -80
};
static const int lexer_goto_row85[] = {
1,
- 56, 56, 169
+ 43, 57, -81
};
static const int lexer_goto_row86[] = {
+ 3,
+ 49, 49, 173,
+ 51, 51, 174,
+ 56, 56, 175
+};
+static const int lexer_goto_row87[] = {
1,
- 48, 102, -82
+ 48, 95, -82
};
static const int lexer_goto_row88[] = {
- 1,
- 61, 61, 170
+ 3,
+ 49, 49, 176,
+ 51, 51, 177,
+ 56, 56, 178
};
static const int lexer_goto_row89[] = {
1,
- 62, 62, 171
+ 48, 102, -83
+};
+static const int lexer_goto_row91[] = {
+ 1,
+ 61, 61, 179
};
static const int lexer_goto_row92[] = {
1,
- 61, 61, 172
+ 62, 62, 180
};
-static const int lexer_goto_row93[] = {
+static const int lexer_goto_row95[] = {
+ 1,
+ 61, 61, 181
+};
+static const int lexer_goto_row96[] = {
1,
48, 122, -29
};
-static const int lexer_goto_row94[] = {
+static const int lexer_goto_row97[] = {
1,
48, 122, -29
};
-static const int lexer_goto_row95[] = {
+static const int lexer_goto_row98[] = {
1,
48, 122, -29
};
-static const int lexer_goto_row96[] = {
+static const int lexer_goto_row99[] = {
1,
48, 122, -29
};
-static const int lexer_goto_row98[] = {
+static const int lexer_goto_row101[] = {
1,
- 100, 100, 173
+ 100, 100, 182
};
-static const int lexer_goto_row99[] = {
+static const int lexer_goto_row102[] = {
4,
- 48, 57, 174,
- 65, 90, 175,
- 95, 95, 176,
- 97, 122, 177
+ 48, 57, 183,
+ 65, 90, 184,
+ 95, 95, 185,
+ 97, 122, 186
};
-static const int lexer_goto_row100[] = {
+static const int lexer_goto_row103[] = {
5,
- 0, 91, 178,
- 92, 92, 179,
- 93, 95, 178,
- 96, 96, 180,
- 97, 255, 178
+ 0, 91, 187,
+ 92, 92, 188,
+ 93, 95, 187,
+ 96, 96, 189,
+ 97, 255, 187
};
-static const int lexer_goto_row101[] = {
+static const int lexer_goto_row104[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row102[] = {
+static const int lexer_goto_row105[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row103[] = {
+static const int lexer_goto_row106[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row104[] = {
+static const int lexer_goto_row107[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row105[] = {
+static const int lexer_goto_row108[] = {
5,
48, 110, -38,
- 111, 111, 181,
- 112, 114, 103,
- 115, 115, 182,
- 116, 122, 103
+ 111, 111, 190,
+ 112, 114, 106,
+ 115, 115, 191,
+ 116, 122, 106
};
-static const int lexer_goto_row106[] = {
+static const int lexer_goto_row109[] = {
4,
48, 95, -35,
- 97, 99, 103,
- 100, 100, 183,
- 101, 122, 103
+ 97, 99, 106,
+ 100, 100, 192,
+ 101, 122, 106
};
-static const int lexer_goto_row107[] = {
+static const int lexer_goto_row110[] = {
4,
48, 95, -35,
- 97, 114, 103,
- 115, 115, 184,
- 116, 122, 103
+ 97, 114, 106,
+ 115, 115, 193,
+ 116, 122, 106
};
-static const int lexer_goto_row108[] = {
+static const int lexer_goto_row111[] = {
3,
48, 100, -45,
- 101, 101, 185,
- 102, 122, 103
+ 101, 101, 194,
+ 102, 122, 106
};
-static const int lexer_goto_row109[] = {
+static const int lexer_goto_row112[] = {
3,
48, 95, -35,
- 97, 97, 186,
- 98, 122, 103
+ 97, 97, 195,
+ 98, 122, 106
};
-static const int lexer_goto_row110[] = {
+static const int lexer_goto_row113[] = {
3,
48, 109, -46,
- 110, 110, 187,
- 111, 122, 103
+ 110, 110, 196,
+ 111, 122, 106
};
-static const int lexer_goto_row111[] = {
+static const int lexer_goto_row114[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row112[] = {
+static const int lexer_goto_row115[] = {
3,
- 48, 114, -108,
- 115, 115, 188,
- 116, 122, 103
+ 48, 114, -111,
+ 115, 115, 197,
+ 116, 122, 106
};
-static const int lexer_goto_row113[] = {
+static const int lexer_goto_row116[] = {
5,
- 48, 99, -107,
- 100, 100, 189,
- 101, 116, 103,
- 117, 117, 190,
- 118, 122, 103
+ 48, 99, -110,
+ 100, 100, 198,
+ 101, 116, 106,
+ 117, 117, 199,
+ 118, 122, 106
};
-static const int lexer_goto_row114[] = {
+static const int lexer_goto_row117[] = {
4,
48, 95, -35,
- 97, 115, 103,
- 116, 116, 191,
- 117, 122, 103
+ 97, 115, 106,
+ 116, 116, 200,
+ 117, 122, 106
};
-static const int lexer_goto_row115[] = {
+static const int lexer_goto_row118[] = {
3,
48, 107, -37,
- 108, 108, 192,
- 109, 122, 103
+ 108, 108, 201,
+ 109, 122, 106
};
-static const int lexer_goto_row116[] = {
+static const int lexer_goto_row119[] = {
3,
48, 113, -36,
- 114, 114, 193,
- 115, 122, 103
+ 114, 114, 202,
+ 115, 122, 106
};
-static const int lexer_goto_row117[] = {
+static const int lexer_goto_row120[] = {
3,
48, 109, -46,
- 110, 110, 194,
- 111, 122, 103
+ 110, 110, 203,
+ 111, 122, 106
};
-static const int lexer_goto_row118[] = {
+static const int lexer_goto_row121[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row119[] = {
+static const int lexer_goto_row122[] = {
4,
48, 95, -35,
- 97, 111, 103,
- 112, 112, 195,
- 113, 122, 103
+ 97, 111, 106,
+ 112, 112, 204,
+ 113, 122, 106
};
-static const int lexer_goto_row120[] = {
+static const int lexer_goto_row123[] = {
6,
48, 95, -35,
- 97, 104, 103,
- 105, 105, 196,
- 106, 115, 103,
- 116, 116, 197,
- 117, 122, 103
+ 97, 104, 106,
+ 105, 105, 205,
+ 106, 115, 106,
+ 116, 116, 206,
+ 117, 122, 106
};
-static const int lexer_goto_row121[] = {
+static const int lexer_goto_row124[] = {
5,
48, 95, -35,
- 97, 97, 198,
- 98, 114, 103,
- 115, 115, 199,
- 116, 122, 103
+ 97, 97, 207,
+ 98, 114, 106,
+ 115, 115, 208,
+ 116, 122, 106
};
-static const int lexer_goto_row122[] = {
+static const int lexer_goto_row125[] = {
3,
48, 97, -35,
- 98, 98, 200,
- 99, 122, 103
+ 98, 98, 209,
+ 99, 122, 106
};
-static const int lexer_goto_row123[] = {
+static const int lexer_goto_row126[] = {
3,
48, 110, -38,
- 111, 111, 201,
- 112, 122, 103
+ 111, 111, 210,
+ 112, 122, 106
};
-static const int lexer_goto_row124[] = {
+static const int lexer_goto_row127[] = {
3,
- 48, 99, -107,
- 100, 100, 202,
- 101, 122, 103
+ 48, 99, -110,
+ 100, 100, 211,
+ 101, 122, 106
};
-static const int lexer_goto_row125[] = {
+static const int lexer_goto_row128[] = {
4,
48, 95, -35,
- 97, 118, 103,
- 119, 119, 203,
- 120, 122, 103
+ 97, 118, 106,
+ 119, 119, 212,
+ 120, 122, 106
};
-static const int lexer_goto_row126[] = {
+static const int lexer_goto_row129[] = {
3,
- 48, 115, -115,
- 116, 116, 204,
- 117, 122, 103
+ 48, 115, -118,
+ 116, 116, 213,
+ 117, 122, 106
};
-static const int lexer_goto_row127[] = {
+static const int lexer_goto_row130[] = {
3,
48, 107, -37,
- 108, 108, 205,
- 109, 122, 103
+ 108, 108, 214,
+ 109, 122, 106
};
-static const int lexer_goto_row128[] = {
+static const int lexer_goto_row131[] = {
4,
48, 95, -35,
- 97, 98, 103,
- 99, 99, 206,
- 100, 122, 103
+ 97, 98, 106,
+ 99, 99, 215,
+ 100, 122, 106
};
-static const int lexer_goto_row129[] = {
+static const int lexer_goto_row132[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row130[] = {
+static const int lexer_goto_row133[] = {
3,
- 48, 98, -129,
- 99, 99, 207,
- 100, 122, 103
+ 48, 98, -132,
+ 99, 99, 216,
+ 100, 122, 106
};
-static const int lexer_goto_row131[] = {
+static const int lexer_goto_row134[] = {
5,
- 48, 104, -121,
- 105, 105, 208,
- 106, 110, 103,
- 111, 111, 209,
- 112, 122, 103
+ 48, 104, -124,
+ 105, 105, 217,
+ 106, 110, 106,
+ 111, 111, 218,
+ 112, 122, 106
};
-static const int lexer_goto_row132[] = {
+static const int lexer_goto_row135[] = {
3,
48, 97, -35,
- 98, 98, 210,
- 99, 122, 103
+ 98, 98, 219,
+ 99, 122, 106
};
-static const int lexer_goto_row133[] = {
+static const int lexer_goto_row136[] = {
5,
- 48, 99, -107,
- 100, 100, 211,
- 101, 115, 103,
- 116, 116, 212,
- 117, 122, 103
+ 48, 99, -110,
+ 100, 100, 220,
+ 101, 115, 106,
+ 116, 116, 221,
+ 117, 122, 106
};
-static const int lexer_goto_row134[] = {
+static const int lexer_goto_row137[] = {
3,
48, 107, -37,
- 108, 108, 213,
- 109, 122, 103
+ 108, 108, 222,
+ 109, 122, 106
};
-static const int lexer_goto_row135[] = {
+static const int lexer_goto_row138[] = {
3,
- 48, 111, -120,
- 112, 112, 214,
- 113, 122, 103
+ 48, 111, -123,
+ 112, 112, 223,
+ 113, 122, 106
};
-static const int lexer_goto_row136[] = {
+static const int lexer_goto_row139[] = {
3,
48, 100, -45,
- 101, 101, 215,
- 102, 122, 103
+ 101, 101, 224,
+ 102, 122, 106
};
-static const int lexer_goto_row137[] = {
+static const int lexer_goto_row140[] = {
4,
48, 95, -35,
- 97, 116, 103,
- 117, 117, 216,
- 118, 122, 103
+ 97, 116, 106,
+ 117, 117, 225,
+ 118, 122, 106
};
-static const int lexer_goto_row138[] = {
+static const int lexer_goto_row141[] = {
3,
- 48, 111, -120,
- 112, 112, 217,
- 113, 122, 103
+ 48, 111, -123,
+ 112, 112, 226,
+ 113, 122, 106
};
-static const int lexer_goto_row139[] = {
+static const int lexer_goto_row142[] = {
3,
- 48, 104, -121,
- 105, 105, 218,
- 106, 122, 103
+ 48, 104, -124,
+ 105, 105, 227,
+ 106, 122, 106
};
-static const int lexer_goto_row140[] = {
+static const int lexer_goto_row143[] = {
3,
48, 113, -36,
- 114, 114, 219,
- 115, 122, 103
+ 114, 114, 228,
+ 115, 122, 106
};
-static const int lexer_goto_row141[] = {
+static const int lexer_goto_row144[] = {
3,
- 48, 104, -121,
- 105, 105, 220,
- 106, 122, 103
+ 48, 104, -124,
+ 105, 105, 229,
+ 106, 122, 106
};
-static const int lexer_goto_row142[] = {
+static const int lexer_goto_row145[] = {
3,
- 48, 115, -115,
- 116, 116, 221,
- 117, 122, 103
+ 48, 115, -118,
+ 116, 116, 230,
+ 117, 122, 106
};
-static const int lexer_goto_row144[] = {
+static const int lexer_goto_row147[] = {
2,
0, 123, -55,
- 124, 255, 143
+ 124, 255, 146
};
-static const int lexer_goto_row146[] = {
+static const int lexer_goto_row149[] = {
3,
- 0, 9, 222,
- 11, 12, 222,
- 14, 255, 222
+ 0, 9, 231,
+ 11, 12, 231,
+ 14, 255, 231
};
-static const int lexer_goto_row148[] = {
+static const int lexer_goto_row151[] = {
3,
0, 124, -55,
- 125, 125, 223,
- 126, 255, 143
+ 125, 125, 232,
+ 126, 255, 146
};
-static const int lexer_goto_row150[] = {
+static const int lexer_goto_row153[] = {
11,
- 0, 9, 224,
- 10, 10, 225,
- 11, 12, 224,
- 13, 13, 226,
- 14, 33, 224,
- 34, 34, 227,
- 35, 91, 224,
- 92, 92, 228,
- 93, 122, 224,
- 123, 123, 229,
- 124, 255, 224
+ 0, 9, 233,
+ 10, 10, 234,
+ 11, 12, 233,
+ 13, 13, 235,
+ 14, 33, 233,
+ 34, 34, 236,
+ 35, 91, 233,
+ 92, 92, 237,
+ 93, 122, 233,
+ 123, 123, 238,
+ 124, 255, 233
};
-static const int lexer_goto_row151[] = {
+static const int lexer_goto_row154[] = {
1,
0, 255, -59
};
-static const int lexer_goto_row154[] = {
+static const int lexer_goto_row157[] = {
9,
- 0, 9, 230,
- 10, 10, 231,
- 11, 12, 230,
- 13, 13, 232,
- 14, 38, 230,
- 39, 39, 233,
- 40, 91, 230,
- 92, 92, 234,
- 93, 255, 230
-};
-static const int lexer_goto_row155[] = {
- 1,
- 39, 39, 235
+ 0, 9, 239,
+ 10, 10, 240,
+ 11, 12, 239,
+ 13, 13, 241,
+ 14, 38, 239,
+ 39, 39, 242,
+ 40, 91, 239,
+ 92, 92, 243,
+ 93, 255, 239
};
static const int lexer_goto_row158[] = {
- 2,
- 48, 95, -79,
- 117, 117, 236
-};
-static const int lexer_goto_row159[] = {
1,
- 48, 117, -159
-};
-static const int lexer_goto_row160[] = {
- 1,
- 48, 117, -159
+ 39, 39, 244
};
static const int lexer_goto_row161[] = {
- 1,
- 48, 57, 162
+ 2,
+ 48, 95, -80,
+ 105, 117, -22
};
static const int lexer_goto_row162[] = {
1,
- 48, 57, 162
+ 48, 117, -162
};
static const int lexer_goto_row163[] = {
1,
- 48, 57, 162
+ 48, 117, -162
};
static const int lexer_goto_row164[] = {
- 2,
- 48, 95, -81,
- 117, 117, 237
+ 1,
+ 48, 57, 165
};
static const int lexer_goto_row165[] = {
1,
- 48, 117, -165
+ 48, 57, 165
};
static const int lexer_goto_row166[] = {
- 2,
- 48, 102, -82,
- 117, 117, 238
+ 1,
+ 48, 57, 165
};
static const int lexer_goto_row167[] = {
- 1,
- 48, 117, -167
+ 2,
+ 48, 95, -82,
+ 105, 117, -22
};
static const int lexer_goto_row168[] = {
1,
- 48, 117, -167
+ 48, 117, -168
};
static const int lexer_goto_row169[] = {
+ 2,
+ 48, 102, -83,
+ 105, 117, -22
+};
+static const int lexer_goto_row170[] = {
1,
- 48, 117, -167
+ 48, 117, -170
};
-static const int lexer_goto_row174[] = {
+static const int lexer_goto_row171[] = {
1,
- 101, 101, 239
+ 48, 117, -170
};
-static const int lexer_goto_row175[] = {
+static const int lexer_goto_row172[] = {
+ 1,
+ 48, 117, -170
+};
+static const int lexer_goto_row173[] = {
1,
- 48, 122, -100
+ 48, 117, -84
};
-static const int lexer_goto_row176[] = {
+static const int lexer_goto_row174[] = {
+ 1,
+ 54, 54, 245
+};
+static const int lexer_goto_row175[] = {
1,
- 48, 122, -100
+ 50, 50, 246
};
static const int lexer_goto_row177[] = {
1,
- 48, 122, -100
+ 54, 54, 247
};
static const int lexer_goto_row178[] = {
1,
- 48, 122, -100
+ 50, 50, 248
};
-static const int lexer_goto_row179[] = {
+static const int lexer_goto_row183[] = {
+ 1,
+ 101, 101, 249
+};
+static const int lexer_goto_row184[] = {
+ 1,
+ 48, 122, -103
+};
+static const int lexer_goto_row185[] = {
+ 1,
+ 48, 122, -103
+};
+static const int lexer_goto_row186[] = {
+ 1,
+ 48, 122, -103
+};
+static const int lexer_goto_row187[] = {
+ 1,
+ 48, 122, -103
+};
+static const int lexer_goto_row188[] = {
1,
- 0, 255, -101
+ 0, 255, -104
};
-static const int lexer_goto_row180[] = {
+static const int lexer_goto_row189[] = {
1,
- 0, 255, 240
+ 0, 255, 250
};
-static const int lexer_goto_row181[] = {
+static const int lexer_goto_row190[] = {
3,
- 0, 124, 241,
- 125, 125, 242,
- 126, 255, 241
+ 0, 124, 251,
+ 125, 125, 252,
+ 126, 255, 251
};
-static const int lexer_goto_row182[] = {
+static const int lexer_goto_row191[] = {
3,
48, 113, -36,
- 114, 114, 243,
- 115, 122, 103
+ 114, 114, 253,
+ 115, 122, 106
};
-static const int lexer_goto_row183[] = {
+static const int lexer_goto_row192[] = {
3,
- 48, 115, -115,
- 116, 116, 244,
- 117, 122, 103
+ 48, 115, -118,
+ 116, 116, 254,
+ 117, 122, 106
};
-static const int lexer_goto_row184[] = {
+static const int lexer_goto_row193[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row185[] = {
+static const int lexer_goto_row194[] = {
3,
48, 100, -45,
- 101, 101, 245,
- 102, 122, 103
+ 101, 101, 255,
+ 102, 122, 106
};
-static const int lexer_goto_row186[] = {
+static const int lexer_goto_row195[] = {
3,
48, 95, -35,
- 97, 97, 246,
- 98, 122, 103
+ 97, 97, 256,
+ 98, 122, 106
};
-static const int lexer_goto_row187[] = {
+static const int lexer_goto_row196[] = {
3,
- 48, 114, -108,
- 115, 115, 247,
- 116, 122, 103
+ 48, 114, -111,
+ 115, 115, 257,
+ 116, 122, 106
};
-static const int lexer_goto_row188[] = {
+static const int lexer_goto_row197[] = {
3,
- 48, 115, -115,
- 116, 116, 248,
- 117, 122, 103
+ 48, 115, -118,
+ 116, 116, 258,
+ 117, 122, 106
};
-static const int lexer_goto_row189[] = {
+static const int lexer_goto_row198[] = {
3,
48, 100, -45,
- 101, 101, 249,
- 102, 122, 103
+ 101, 101, 259,
+ 102, 122, 106
};
-static const int lexer_goto_row190[] = {
+static const int lexer_goto_row199[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row191[] = {
+static const int lexer_goto_row200[] = {
4,
48, 95, -35,
- 97, 108, 103,
- 109, 109, 250,
- 110, 122, 103
+ 97, 108, 106,
+ 109, 109, 260,
+ 110, 122, 106
};
-static const int lexer_goto_row192[] = {
+static const int lexer_goto_row201[] = {
3,
48, 100, -45,
- 101, 101, 251,
- 102, 122, 103
+ 101, 101, 261,
+ 102, 122, 106
};
-static const int lexer_goto_row193[] = {
+static const int lexer_goto_row202[] = {
3,
- 48, 114, -108,
- 115, 115, 252,
- 116, 122, 103
+ 48, 114, -111,
+ 115, 115, 262,
+ 116, 122, 106
};
-static const int lexer_goto_row194[] = {
+static const int lexer_goto_row203[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row195[] = {
+static const int lexer_goto_row204[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row196[] = {
+static const int lexer_goto_row205[] = {
5,
48, 107, -37,
- 108, 108, 253,
- 109, 110, 103,
- 111, 111, 254,
- 112, 122, 103
+ 108, 108, 263,
+ 109, 110, 106,
+ 111, 111, 264,
+ 112, 122, 106
};
-static const int lexer_goto_row197[] = {
+static const int lexer_goto_row206[] = {
3,
- 48, 115, -115,
- 116, 116, 255,
- 117, 122, 103
+ 48, 115, -118,
+ 116, 116, 265,
+ 117, 122, 106
};
-static const int lexer_goto_row198[] = {
+static const int lexer_goto_row207[] = {
5,
48, 100, -45,
- 101, 101, 256,
- 102, 113, 103,
- 114, 114, 257,
- 115, 122, 103
+ 101, 101, 266,
+ 102, 113, 106,
+ 114, 114, 267,
+ 115, 122, 106
};
-static const int lexer_goto_row199[] = {
+static const int lexer_goto_row208[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row200[] = {
+static const int lexer_goto_row209[] = {
3,
48, 100, -45,
- 101, 101, 258,
- 102, 122, 103
+ 101, 101, 268,
+ 102, 122, 106
};
-static const int lexer_goto_row201[] = {
+static const int lexer_goto_row210[] = {
3,
48, 100, -45,
- 101, 101, 259,
- 102, 122, 103
+ 101, 101, 269,
+ 102, 122, 106
};
-static const int lexer_goto_row202[] = {
+static const int lexer_goto_row211[] = {
3,
- 48, 111, -120,
- 112, 112, 260,
- 113, 122, 103
+ 48, 111, -123,
+ 112, 112, 270,
+ 113, 122, 106
};
-static const int lexer_goto_row203[] = {
+static const int lexer_goto_row212[] = {
3,
- 48, 116, -138,
- 117, 117, 261,
- 118, 122, 103
+ 48, 116, -141,
+ 117, 117, 271,
+ 118, 122, 106
};
-static const int lexer_goto_row204[] = {
+static const int lexer_goto_row213[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row205[] = {
+static const int lexer_goto_row214[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row206[] = {
+static const int lexer_goto_row215[] = {
3,
48, 107, -37,
- 108, 108, 262,
- 109, 122, 103
+ 108, 108, 272,
+ 109, 122, 106
};
-static const int lexer_goto_row207[] = {
+static const int lexer_goto_row216[] = {
3,
48, 100, -45,
- 101, 101, 263,
- 102, 122, 103
+ 101, 101, 273,
+ 102, 122, 106
};
-static const int lexer_goto_row208[] = {
+static const int lexer_goto_row217[] = {
4,
48, 95, -35,
- 97, 106, 103,
- 107, 107, 264,
- 108, 122, 103
+ 97, 106, 106,
+ 107, 107, 274,
+ 108, 122, 106
};
-static const int lexer_goto_row209[] = {
+static const int lexer_goto_row218[] = {
4,
48, 95, -35,
- 97, 117, 103,
- 118, 118, 265,
- 119, 122, 103
+ 97, 117, 106,
+ 118, 118, 275,
+ 119, 122, 106
};
-static const int lexer_goto_row210[] = {
+static const int lexer_goto_row219[] = {
3,
- 48, 115, -115,
- 116, 116, 266,
- 117, 122, 103
+ 48, 115, -118,
+ 116, 116, 276,
+ 117, 122, 106
};
-static const int lexer_goto_row211[] = {
+static const int lexer_goto_row220[] = {
3,
48, 107, -37,
- 108, 108, 267,
- 109, 122, 103
+ 108, 108, 277,
+ 109, 122, 106
};
-static const int lexer_goto_row212[] = {
+static const int lexer_goto_row221[] = {
3,
48, 100, -45,
- 101, 101, 268,
- 102, 122, 103
+ 101, 101, 278,
+ 102, 122, 106
};
-static const int lexer_goto_row213[] = {
+static const int lexer_goto_row222[] = {
3,
- 48, 116, -138,
- 117, 117, 269,
- 118, 122, 103
+ 48, 116, -141,
+ 117, 117, 279,
+ 118, 122, 106
};
-static const int lexer_goto_row214[] = {
+static const int lexer_goto_row223[] = {
3,
48, 101, -42,
- 102, 102, 270,
- 103, 122, 103
+ 102, 102, 280,
+ 103, 122, 106
};
-static const int lexer_goto_row215[] = {
+static const int lexer_goto_row224[] = {
3,
48, 100, -45,
- 101, 101, 271,
- 102, 122, 103
+ 101, 101, 281,
+ 102, 122, 106
};
-static const int lexer_goto_row216[] = {
+static const int lexer_goto_row225[] = {
3,
48, 109, -46,
- 110, 110, 272,
- 111, 122, 103
+ 110, 110, 282,
+ 111, 122, 106
};
-static const int lexer_goto_row217[] = {
+static const int lexer_goto_row226[] = {
3,
48, 100, -45,
- 101, 101, 273,
- 102, 122, 103
+ 101, 101, 283,
+ 102, 122, 106
};
-static const int lexer_goto_row218[] = {
+static const int lexer_goto_row227[] = {
3,
48, 100, -45,
- 101, 101, 274,
- 102, 122, 103
+ 101, 101, 284,
+ 102, 122, 106
};
-static const int lexer_goto_row219[] = {
+static const int lexer_goto_row228[] = {
3,
- 48, 117, -210,
- 118, 118, 275,
- 119, 122, 103
+ 48, 117, -219,
+ 118, 118, 285,
+ 119, 122, 106
};
-static const int lexer_goto_row220[] = {
+static const int lexer_goto_row229[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row221[] = {
+static const int lexer_goto_row230[] = {
3,
48, 107, -37,
- 108, 108, 276,
- 109, 122, 103
+ 108, 108, 286,
+ 109, 122, 106
};
-static const int lexer_goto_row222[] = {
+static const int lexer_goto_row231[] = {
3,
48, 103, -50,
- 104, 104, 277,
- 105, 122, 103
+ 104, 104, 287,
+ 105, 122, 106
};
-static const int lexer_goto_row223[] = {
+static const int lexer_goto_row232[] = {
1,
- 0, 255, -145
+ 0, 255, -148
};
-static const int lexer_goto_row224[] = {
+static const int lexer_goto_row233[] = {
11,
- 0, 9, 278,
- 10, 10, 279,
- 11, 12, 278,
- 13, 13, 280,
- 14, 33, 278,
- 34, 34, 281,
- 35, 91, 278,
- 92, 92, 282,
- 93, 122, 278,
- 123, 123, 283,
- 124, 255, 278
+ 0, 9, 288,
+ 10, 10, 289,
+ 11, 12, 288,
+ 13, 13, 290,
+ 14, 33, 288,
+ 34, 34, 291,
+ 35, 91, 288,
+ 92, 92, 292,
+ 93, 122, 288,
+ 123, 123, 293,
+ 124, 255, 288
};
-static const int lexer_goto_row225[] = {
+static const int lexer_goto_row234[] = {
1,
- 0, 255, -151
+ 0, 255, -154
};
-static const int lexer_goto_row226[] = {
+static const int lexer_goto_row235[] = {
1,
- 0, 255, -151
+ 0, 255, -154
};
-static const int lexer_goto_row227[] = {
+static const int lexer_goto_row236[] = {
1,
- 0, 255, -151
+ 0, 255, -154
};
-static const int lexer_goto_row228[] = {
+static const int lexer_goto_row237[] = {
5,
- 0, 33, -151,
- 34, 34, 284,
- 35, 122, -151,
- 123, 123, 285,
- 124, 255, 224
+ 0, 33, -154,
+ 34, 34, 294,
+ 35, 122, -154,
+ 123, 123, 295,
+ 124, 255, 233
};
-static const int lexer_goto_row229[] = {
+static const int lexer_goto_row238[] = {
3,
- 0, 9, 286,
- 11, 12, 286,
- 14, 255, 286
+ 0, 9, 296,
+ 11, 12, 296,
+ 14, 255, 296
};
-static const int lexer_goto_row230[] = {
+static const int lexer_goto_row239[] = {
5,
- 0, 33, -151,
- 34, 34, 287,
- 35, 122, -151,
- 123, 123, 288,
- 124, 255, 224
+ 0, 33, -154,
+ 34, 34, 297,
+ 35, 122, -154,
+ 123, 123, 298,
+ 124, 255, 233
};
-static const int lexer_goto_row231[] = {
+static const int lexer_goto_row240[] = {
1,
- 0, 255, -155
+ 0, 255, -158
};
-static const int lexer_goto_row232[] = {
+static const int lexer_goto_row241[] = {
1,
- 0, 255, -155
+ 0, 255, -158
};
-static const int lexer_goto_row233[] = {
+static const int lexer_goto_row242[] = {
1,
- 0, 255, -155
+ 0, 255, -158
};
-static const int lexer_goto_row234[] = {
+static const int lexer_goto_row243[] = {
9,
- 0, 9, 289,
- 10, 10, 290,
- 11, 12, 289,
- 13, 13, 291,
- 14, 38, 289,
- 39, 39, 292,
- 40, 91, 289,
- 92, 92, 293,
- 93, 255, 289
+ 0, 9, 299,
+ 10, 10, 300,
+ 11, 12, 299,
+ 13, 13, 301,
+ 14, 38, 299,
+ 39, 39, 302,
+ 40, 91, 299,
+ 92, 92, 303,
+ 93, 255, 299
};
-static const int lexer_goto_row235[] = {
+static const int lexer_goto_row244[] = {
3,
- 0, 9, 294,
- 11, 12, 294,
- 14, 255, 294
-};
-static const int lexer_goto_row237[] = {
- 1,
- 56, 56, 295
-};
-static const int lexer_goto_row238[] = {
- 1,
- 56, 56, 296
-};
-static const int lexer_goto_row239[] = {
- 1,
- 56, 56, 297
+ 0, 9, 304,
+ 11, 12, 304,
+ 14, 255, 304
};
-static const int lexer_goto_row240[] = {
+static const int lexer_goto_row250[] = {
1,
- 98, 98, 298
+ 98, 98, 305
};
-static const int lexer_goto_row241[] = {
+static const int lexer_goto_row251[] = {
1,
- 0, 255, -101
+ 0, 255, -104
};
-static const int lexer_goto_row242[] = {
+static const int lexer_goto_row252[] = {
1,
- 0, 255, -101
+ 0, 255, -104
};
-static const int lexer_goto_row244[] = {
+static const int lexer_goto_row254[] = {
3,
- 48, 115, -115,
- 116, 116, 299,
- 117, 122, 103
+ 48, 115, -118,
+ 116, 116, 306,
+ 117, 122, 106
};
-static const int lexer_goto_row245[] = {
+static const int lexer_goto_row255[] = {
3,
48, 113, -36,
- 114, 114, 300,
- 115, 122, 103
+ 114, 114, 307,
+ 115, 122, 106
};
-static const int lexer_goto_row246[] = {
+static const int lexer_goto_row256[] = {
3,
48, 113, -36,
- 114, 114, 301,
- 115, 122, 103
+ 114, 114, 308,
+ 115, 122, 106
};
-static const int lexer_goto_row247[] = {
+static const int lexer_goto_row257[] = {
3,
- 48, 106, -209,
- 107, 107, 302,
- 108, 122, 103
+ 48, 106, -218,
+ 107, 107, 309,
+ 108, 122, 106
};
-static const int lexer_goto_row248[] = {
+static const int lexer_goto_row258[] = {
3,
- 48, 114, -108,
- 115, 115, 303,
- 116, 122, 103
+ 48, 114, -111,
+ 115, 115, 310,
+ 116, 122, 106
};
-static const int lexer_goto_row249[] = {
+static const int lexer_goto_row259[] = {
3,
- 48, 104, -121,
- 105, 105, 304,
- 106, 122, 103
+ 48, 104, -124,
+ 105, 105, 311,
+ 106, 122, 106
};
-static const int lexer_goto_row250[] = {
+static const int lexer_goto_row260[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row251[] = {
+static const int lexer_goto_row261[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row252[] = {
+static const int lexer_goto_row262[] = {
3,
48, 113, -36,
- 114, 114, 305,
- 115, 122, 103
+ 114, 114, 312,
+ 115, 122, 106
};
-static const int lexer_goto_row253[] = {
+static const int lexer_goto_row263[] = {
3,
48, 100, -45,
- 101, 101, 306,
- 102, 122, 103
+ 101, 101, 313,
+ 102, 122, 106
};
-static const int lexer_goto_row254[] = {
+static const int lexer_goto_row264[] = {
3,
- 48, 104, -121,
- 105, 105, 307,
- 106, 122, 103
+ 48, 104, -124,
+ 105, 105, 314,
+ 106, 122, 106
};
-static const int lexer_goto_row255[] = {
+static const int lexer_goto_row265[] = {
3,
48, 113, -36,
- 114, 114, 308,
- 115, 122, 103
+ 114, 114, 315,
+ 115, 122, 106
};
-static const int lexer_goto_row256[] = {
+static const int lexer_goto_row266[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row257[] = {
+static const int lexer_goto_row267[] = {
3,
48, 113, -36,
- 114, 114, 309,
- 115, 122, 103
+ 114, 114, 316,
+ 115, 122, 106
};
-static const int lexer_goto_row258[] = {
+static const int lexer_goto_row268[] = {
3,
- 48, 116, -138,
- 117, 117, 310,
- 118, 122, 103
+ 48, 116, -141,
+ 117, 117, 317,
+ 118, 122, 106
};
-static const int lexer_goto_row259[] = {
+static const int lexer_goto_row269[] = {
3,
- 48, 115, -115,
- 116, 116, 311,
- 117, 122, 103
+ 48, 115, -118,
+ 116, 116, 318,
+ 117, 122, 106
};
-static const int lexer_goto_row260[] = {
+static const int lexer_goto_row270[] = {
3,
48, 107, -37,
- 108, 108, 312,
- 109, 122, 103
+ 108, 108, 319,
+ 109, 122, 106
};
-static const int lexer_goto_row261[] = {
+static const int lexer_goto_row271[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row262[] = {
+static const int lexer_goto_row272[] = {
3,
48, 107, -37,
- 108, 108, 313,
- 109, 122, 103
+ 108, 108, 320,
+ 109, 122, 106
};
-static const int lexer_goto_row263[] = {
+static const int lexer_goto_row273[] = {
3,
48, 95, -35,
- 97, 97, 314,
- 98, 122, 103
+ 97, 97, 321,
+ 98, 122, 106
};
-static const int lexer_goto_row264[] = {
+static const int lexer_goto_row274[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row265[] = {
+static const int lexer_goto_row275[] = {
3,
48, 95, -35,
- 97, 97, 315,
- 98, 122, 103
+ 97, 97, 322,
+ 98, 122, 106
};
-static const int lexer_goto_row266[] = {
+static const int lexer_goto_row276[] = {
3,
48, 95, -35,
- 97, 97, 316,
- 98, 122, 103
+ 97, 97, 323,
+ 98, 122, 106
};
-static const int lexer_goto_row267[] = {
+static const int lexer_goto_row277[] = {
3,
48, 100, -45,
- 101, 101, 317,
- 102, 122, 103
+ 101, 101, 324,
+ 102, 122, 106
};
-static const int lexer_goto_row268[] = {
+static const int lexer_goto_row278[] = {
3,
- 48, 104, -121,
- 105, 105, 318,
- 106, 122, 103
+ 48, 104, -124,
+ 105, 105, 325,
+ 106, 122, 106
};
-static const int lexer_goto_row269[] = {
+static const int lexer_goto_row279[] = {
3,
48, 101, -42,
- 102, 102, 319,
- 103, 122, 103
+ 102, 102, 326,
+ 103, 122, 106
};
-static const int lexer_goto_row270[] = {
+static const int lexer_goto_row280[] = {
3,
48, 113, -36,
- 114, 114, 320,
- 115, 122, 103
+ 114, 114, 327,
+ 115, 122, 106
};
-static const int lexer_goto_row271[] = {
+static const int lexer_goto_row281[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row272[] = {
+static const int lexer_goto_row282[] = {
3,
48, 113, -36,
- 114, 114, 321,
- 115, 122, 103
+ 114, 114, 328,
+ 115, 122, 106
};
-static const int lexer_goto_row273[] = {
+static const int lexer_goto_row283[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row274[] = {
+static const int lexer_goto_row284[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row275[] = {
+static const int lexer_goto_row285[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row276[] = {
+static const int lexer_goto_row286[] = {
3,
48, 100, -45,
- 101, 101, 322,
- 102, 122, 103
+ 101, 101, 329,
+ 102, 122, 106
};
-static const int lexer_goto_row277[] = {
+static const int lexer_goto_row287[] = {
3,
48, 100, -45,
- 101, 101, 323,
- 102, 122, 103
+ 101, 101, 330,
+ 102, 122, 106
};
-static const int lexer_goto_row278[] = {
+static const int lexer_goto_row288[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row279[] = {
+static const int lexer_goto_row289[] = {
1,
- 0, 255, -225
+ 0, 255, -234
};
-static const int lexer_goto_row280[] = {
+static const int lexer_goto_row290[] = {
11,
- 0, 9, 324,
- 10, 10, 279,
- 11, 12, 324,
- 13, 13, 280,
- 14, 33, 324,
- 34, 34, 325,
- 35, 91, 324,
- 92, 92, 326,
- 93, 122, 324,
- 123, 123, 327,
- 124, 255, 324
+ 0, 9, 331,
+ 10, 10, 289,
+ 11, 12, 331,
+ 13, 13, 290,
+ 14, 33, 331,
+ 34, 34, 332,
+ 35, 91, 331,
+ 92, 92, 333,
+ 93, 122, 331,
+ 123, 123, 334,
+ 124, 255, 331
};
-static const int lexer_goto_row281[] = {
+static const int lexer_goto_row291[] = {
1,
- 0, 255, -281
+ 0, 255, -291
};
-static const int lexer_goto_row282[] = {
+static const int lexer_goto_row292[] = {
5,
- 0, 33, -281,
- 34, 34, 328,
- 35, 122, -281,
- 123, 123, 329,
- 124, 255, 324
+ 0, 33, -291,
+ 34, 34, 335,
+ 35, 122, -291,
+ 123, 123, 336,
+ 124, 255, 331
};
-static const int lexer_goto_row283[] = {
+static const int lexer_goto_row293[] = {
3,
- 0, 9, 330,
- 11, 12, 330,
- 14, 255, 330
+ 0, 9, 337,
+ 11, 12, 337,
+ 14, 255, 337
};
-static const int lexer_goto_row284[] = {
+static const int lexer_goto_row294[] = {
5,
- 0, 33, -281,
- 34, 34, 331,
- 35, 122, -281,
- 123, 123, 332,
- 124, 255, 324
+ 0, 33, -291,
+ 34, 34, 338,
+ 35, 122, -291,
+ 123, 123, 339,
+ 124, 255, 331
};
-static const int lexer_goto_row285[] = {
+static const int lexer_goto_row295[] = {
3,
- 0, 33, -151,
- 34, 34, 333,
- 35, 255, -229
+ 0, 33, -154,
+ 34, 34, 340,
+ 35, 255, -238
};
-static const int lexer_goto_row286[] = {
+static const int lexer_goto_row296[] = {
3,
- 0, 122, -231,
- 123, 123, 334,
- 124, 255, 224
+ 0, 122, -240,
+ 123, 123, 341,
+ 124, 255, 233
};
-static const int lexer_goto_row287[] = {
+static const int lexer_goto_row297[] = {
1,
- 0, 255, -151
+ 0, 255, -154
};
-static const int lexer_goto_row288[] = {
+static const int lexer_goto_row298[] = {
3,
- 0, 33, -151,
- 34, 34, 335,
- 35, 255, -229
+ 0, 33, -154,
+ 34, 34, 342,
+ 35, 255, -238
};
-static const int lexer_goto_row289[] = {
+static const int lexer_goto_row299[] = {
3,
- 0, 122, -231,
- 123, 123, 336,
- 124, 255, 224
+ 0, 122, -240,
+ 123, 123, 343,
+ 124, 255, 233
};
-static const int lexer_goto_row290[] = {
+static const int lexer_goto_row300[] = {
1,
- 0, 255, -155
+ 0, 255, -158
};
-static const int lexer_goto_row291[] = {
+static const int lexer_goto_row301[] = {
1,
- 0, 255, -155
+ 0, 255, -158
};
-static const int lexer_goto_row292[] = {
+static const int lexer_goto_row302[] = {
1,
- 0, 255, -155
+ 0, 255, -158
};
-static const int lexer_goto_row293[] = {
+static const int lexer_goto_row303[] = {
9,
- 0, 9, 337,
- 10, 10, 338,
- 11, 12, 337,
- 13, 13, 339,
- 14, 38, 337,
- 39, 39, 340,
- 40, 91, 337,
- 92, 92, 341,
- 93, 255, 337
+ 0, 9, 344,
+ 10, 10, 345,
+ 11, 12, 344,
+ 13, 13, 346,
+ 14, 38, 344,
+ 39, 39, 347,
+ 40, 91, 344,
+ 92, 92, 348,
+ 93, 255, 344
};
-static const int lexer_goto_row294[] = {
+static const int lexer_goto_row304[] = {
3,
- 0, 9, 342,
- 11, 12, 342,
- 14, 255, 342
+ 0, 9, 349,
+ 11, 12, 349,
+ 14, 255, 349
};
-static const int lexer_goto_row295[] = {
+static const int lexer_goto_row305[] = {
1,
- 0, 255, -155
+ 0, 255, -158
};
-static const int lexer_goto_row299[] = {
+static const int lexer_goto_row306[] = {
1,
- 117, 117, 343
+ 117, 117, 350
};
-static const int lexer_goto_row300[] = {
+static const int lexer_goto_row307[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row301[] = {
+static const int lexer_goto_row308[] = {
3,
48, 95, -35,
- 97, 97, 344,
- 98, 122, 103
+ 97, 97, 351,
+ 98, 122, 106
};
-static const int lexer_goto_row302[] = {
+static const int lexer_goto_row309[] = {
3,
- 48, 115, -115,
- 116, 116, 345,
- 117, 122, 103
+ 48, 115, -118,
+ 116, 116, 352,
+ 117, 122, 106
};
-static const int lexer_goto_row303[] = {
+static const int lexer_goto_row310[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row304[] = {
+static const int lexer_goto_row311[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row305[] = {
+static const int lexer_goto_row312[] = {
3,
48, 109, -46,
- 110, 110, 346,
- 111, 122, 103
+ 110, 110, 353,
+ 111, 122, 106
};
-static const int lexer_goto_row306[] = {
+static const int lexer_goto_row313[] = {
3,
48, 109, -46,
- 110, 110, 347,
- 111, 122, 103
+ 110, 110, 354,
+ 111, 122, 106
};
-static const int lexer_goto_row307[] = {
+static const int lexer_goto_row314[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row308[] = {
+static const int lexer_goto_row315[] = {
3,
48, 100, -45,
- 101, 101, 348,
- 102, 122, 103
+ 101, 101, 355,
+ 102, 122, 106
};
-static const int lexer_goto_row309[] = {
+static const int lexer_goto_row316[] = {
3,
- 48, 115, -115,
- 116, 116, 349,
- 117, 122, 103
+ 48, 115, -118,
+ 116, 116, 356,
+ 117, 122, 106
};
-static const int lexer_goto_row310[] = {
+static const int lexer_goto_row317[] = {
3,
48, 101, -42,
- 102, 102, 350,
- 103, 122, 103
+ 102, 102, 357,
+ 103, 122, 106
};
-static const int lexer_goto_row311[] = {
+static const int lexer_goto_row318[] = {
3,
- 48, 99, -107,
- 100, 100, 351,
- 101, 122, 103
+ 48, 99, -110,
+ 100, 100, 358,
+ 101, 122, 106
};
-static const int lexer_goto_row312[] = {
+static const int lexer_goto_row319[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row313[] = {
+static const int lexer_goto_row320[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row314[] = {
+static const int lexer_goto_row321[] = {
3,
48, 100, -45,
- 101, 101, 352,
- 102, 122, 103
+ 101, 101, 359,
+ 102, 122, 106
};
-static const int lexer_goto_row315[] = {
+static const int lexer_goto_row322[] = {
3,
48, 97, -35,
- 98, 98, 353,
- 99, 122, 103
+ 98, 98, 360,
+ 99, 122, 106
};
-static const int lexer_goto_row316[] = {
+static const int lexer_goto_row323[] = {
4,
48, 95, -35,
- 97, 102, 103,
- 103, 103, 354,
- 104, 122, 103
+ 97, 102, 106,
+ 103, 103, 361,
+ 104, 122, 106
};
-static const int lexer_goto_row317[] = {
+static const int lexer_goto_row324[] = {
3,
- 48, 115, -115,
- 116, 116, 355,
- 117, 122, 103
+ 48, 115, -118,
+ 116, 116, 362,
+ 117, 122, 106
};
-static const int lexer_goto_row318[] = {
+static const int lexer_goto_row325[] = {
3,
- 48, 98, -129,
- 99, 99, 356,
- 100, 122, 103
+ 48, 98, -132,
+ 99, 99, 363,
+ 100, 122, 106
};
-static const int lexer_goto_row319[] = {
+static const int lexer_goto_row326[] = {
3,
- 48, 98, -129,
- 99, 99, 357,
- 100, 122, 103
+ 48, 98, -132,
+ 99, 99, 364,
+ 100, 122, 106
};
-static const int lexer_goto_row320[] = {
+static const int lexer_goto_row327[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row321[] = {
+static const int lexer_goto_row328[] = {
3,
48, 109, -46,
- 110, 110, 358,
- 111, 122, 103
+ 110, 110, 365,
+ 111, 122, 106
};
-static const int lexer_goto_row322[] = {
+static const int lexer_goto_row329[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row323[] = {
+static const int lexer_goto_row330[] = {
3,
48, 113, -36,
- 114, 114, 359,
- 115, 122, 103
+ 114, 114, 366,
+ 115, 122, 106
};
-static const int lexer_goto_row324[] = {
+static const int lexer_goto_row331[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row325[] = {
+static const int lexer_goto_row332[] = {
1,
- 0, 255, -281
+ 0, 255, -291
};
-static const int lexer_goto_row326[] = {
+static const int lexer_goto_row333[] = {
1,
- 0, 255, -283
+ 0, 255, -293
};
-static const int lexer_goto_row327[] = {
+static const int lexer_goto_row334[] = {
3,
- 0, 9, 360,
- 11, 12, 360,
- 14, 255, 360
+ 0, 9, 367,
+ 11, 12, 367,
+ 14, 255, 367
};
-static const int lexer_goto_row328[] = {
+static const int lexer_goto_row335[] = {
1,
- 0, 255, -285
+ 0, 255, -295
};
-static const int lexer_goto_row329[] = {
+static const int lexer_goto_row336[] = {
3,
- 0, 33, -281,
- 34, 34, 361,
- 35, 255, -283
+ 0, 33, -291,
+ 34, 34, 368,
+ 35, 255, -293
};
-static const int lexer_goto_row330[] = {
+static const int lexer_goto_row337[] = {
3,
- 0, 122, -285,
- 123, 123, 362,
- 124, 255, 324
+ 0, 122, -295,
+ 123, 123, 369,
+ 124, 255, 331
};
-static const int lexer_goto_row331[] = {
+static const int lexer_goto_row338[] = {
1,
- 0, 255, -225
+ 0, 255, -234
};
-static const int lexer_goto_row332[] = {
+static const int lexer_goto_row339[] = {
3,
- 0, 33, -281,
- 34, 34, 363,
- 35, 255, -283
+ 0, 33, -291,
+ 34, 34, 370,
+ 35, 255, -293
};
-static const int lexer_goto_row333[] = {
+static const int lexer_goto_row340[] = {
3,
- 0, 122, -285,
- 123, 123, 364,
- 124, 255, 324
+ 0, 122, -295,
+ 123, 123, 371,
+ 124, 255, 331
};
-static const int lexer_goto_row334[] = {
+static const int lexer_goto_row341[] = {
1,
- 34, 34, 365
+ 34, 34, 372
};
-static const int lexer_goto_row335[] = {
+static const int lexer_goto_row342[] = {
1,
- 0, 255, -290
+ 0, 255, -300
};
-static const int lexer_goto_row336[] = {
+static const int lexer_goto_row343[] = {
1,
- 0, 255, -286
+ 0, 255, -296
};
-static const int lexer_goto_row337[] = {
+static const int lexer_goto_row344[] = {
1,
- 123, 123, 366
+ 123, 123, 373
};
-static const int lexer_goto_row338[] = {
+static const int lexer_goto_row345[] = {
1,
- 0, 255, -155
+ 0, 255, -158
};
-static const int lexer_goto_row339[] = {
+static const int lexer_goto_row346[] = {
1,
- 0, 255, -155
+ 0, 255, -158
};
-static const int lexer_goto_row340[] = {
+static const int lexer_goto_row347[] = {
1,
- 0, 255, -155
+ 0, 255, -158
};
-static const int lexer_goto_row342[] = {
+static const int lexer_goto_row349[] = {
3,
- 0, 9, 367,
- 11, 12, 367,
- 14, 255, 367
+ 0, 9, 374,
+ 11, 12, 374,
+ 14, 255, 374
};
-static const int lexer_goto_row343[] = {
+static const int lexer_goto_row350[] = {
1,
- 0, 255, -155
+ 0, 255, -158
};
-static const int lexer_goto_row344[] = {
+static const int lexer_goto_row351[] = {
1,
- 103, 103, 368
+ 103, 103, 375
};
-static const int lexer_goto_row345[] = {
+static const int lexer_goto_row352[] = {
3,
- 48, 98, -129,
- 99, 99, 369,
- 100, 122, 103
+ 48, 98, -132,
+ 99, 99, 376,
+ 100, 122, 106
};
-static const int lexer_goto_row346[] = {
+static const int lexer_goto_row353[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row347[] = {
+static const int lexer_goto_row354[] = {
3,
- 48, 116, -138,
- 117, 117, 370,
- 118, 122, 103
+ 48, 116, -141,
+ 117, 117, 377,
+ 118, 122, 106
};
-static const int lexer_goto_row348[] = {
+static const int lexer_goto_row355[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row349[] = {
+static const int lexer_goto_row356[] = {
3,
- 48, 114, -108,
- 115, 115, 371,
- 116, 122, 103
+ 48, 114, -111,
+ 115, 115, 378,
+ 116, 122, 106
};
-static const int lexer_goto_row350[] = {
+static const int lexer_goto_row357[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row351[] = {
+static const int lexer_goto_row358[] = {
3,
48, 95, -35,
- 97, 97, 372,
- 98, 122, 103
+ 97, 97, 379,
+ 98, 122, 106
};
-static const int lexer_goto_row352[] = {
+static const int lexer_goto_row359[] = {
3,
48, 100, -45,
- 101, 101, 373,
- 102, 122, 103
+ 101, 101, 380,
+ 102, 122, 106
};
-static const int lexer_goto_row353[] = {
+static const int lexer_goto_row360[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row354[] = {
+static const int lexer_goto_row361[] = {
3,
48, 107, -37,
- 108, 108, 374,
- 109, 122, 103
+ 108, 108, 381,
+ 109, 122, 106
};
-static const int lexer_goto_row355[] = {
+static const int lexer_goto_row362[] = {
3,
48, 100, -45,
- 101, 101, 375,
- 102, 122, 103
+ 101, 101, 382,
+ 102, 122, 106
};
-static const int lexer_goto_row356[] = {
+static const int lexer_goto_row363[] = {
3,
48, 100, -45,
- 101, 101, 376,
- 102, 122, 103
+ 101, 101, 383,
+ 102, 122, 106
};
-static const int lexer_goto_row357[] = {
+static const int lexer_goto_row364[] = {
3,
- 48, 115, -115,
- 116, 116, 377,
- 117, 122, 103
+ 48, 115, -118,
+ 116, 116, 384,
+ 117, 122, 106
};
-static const int lexer_goto_row358[] = {
+static const int lexer_goto_row365[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row359[] = {
+static const int lexer_goto_row366[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row360[] = {
+static const int lexer_goto_row367[] = {
3,
- 48, 114, -108,
- 115, 115, 378,
- 116, 122, 103
+ 48, 114, -111,
+ 115, 115, 385,
+ 116, 122, 106
};
-static const int lexer_goto_row361[] = {
+static const int lexer_goto_row368[] = {
1,
- 0, 255, -281
+ 0, 255, -291
};
-static const int lexer_goto_row362[] = {
+static const int lexer_goto_row369[] = {
1,
- 34, 34, 379
+ 34, 34, 386
};
-static const int lexer_goto_row363[] = {
+static const int lexer_goto_row370[] = {
1,
- 0, 255, -334
+ 0, 255, -341
};
-static const int lexer_goto_row364[] = {
+static const int lexer_goto_row371[] = {
1,
- 0, 255, -330
+ 0, 255, -337
};
-static const int lexer_goto_row365[] = {
+static const int lexer_goto_row372[] = {
1,
- 123, 123, 380
+ 123, 123, 387
};
-static const int lexer_goto_row366[] = {
+static const int lexer_goto_row373[] = {
1,
- 34, 34, 365
+ 34, 34, 372
};
-static const int lexer_goto_row367[] = {
+static const int lexer_goto_row374[] = {
1,
- 123, 123, 366
+ 123, 123, 373
};
-static const int lexer_goto_row368[] = {
+static const int lexer_goto_row375[] = {
1,
- 0, 255, -155
+ 0, 255, -158
};
-static const int lexer_goto_row369[] = {
+static const int lexer_goto_row376[] = {
1,
- 95, 95, 381
+ 95, 95, 388
};
-static const int lexer_goto_row370[] = {
+static const int lexer_goto_row377[] = {
3,
- 48, 115, -115,
- 116, 116, 382,
- 117, 122, 103
+ 48, 115, -118,
+ 116, 116, 389,
+ 117, 122, 106
};
-static const int lexer_goto_row371[] = {
+static const int lexer_goto_row378[] = {
3,
48, 100, -45,
- 101, 101, 383,
- 102, 122, 103
+ 101, 101, 390,
+ 102, 122, 106
};
-static const int lexer_goto_row372[] = {
+static const int lexer_goto_row379[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row373[] = {
+static const int lexer_goto_row380[] = {
3,
- 48, 98, -129,
- 99, 99, 384,
- 100, 122, 103
+ 48, 98, -132,
+ 99, 99, 391,
+ 100, 122, 106
};
-static const int lexer_goto_row374[] = {
+static const int lexer_goto_row381[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row375[] = {
+static const int lexer_goto_row382[] = {
3,
48, 100, -45,
- 101, 101, 385,
- 102, 122, 103
+ 101, 101, 392,
+ 102, 122, 106
};
-static const int lexer_goto_row376[] = {
+static const int lexer_goto_row383[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row377[] = {
+static const int lexer_goto_row384[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row378[] = {
+static const int lexer_goto_row385[] = {
3,
48, 100, -45,
- 101, 101, 386,
- 102, 122, 103
+ 101, 101, 393,
+ 102, 122, 106
};
-static const int lexer_goto_row379[] = {
+static const int lexer_goto_row386[] = {
3,
48, 95, -35,
- 97, 97, 387,
- 98, 122, 103
+ 97, 97, 394,
+ 98, 122, 106
};
-static const int lexer_goto_row380[] = {
+static const int lexer_goto_row387[] = {
1,
- 34, 34, 379
+ 34, 34, 386
};
-static const int lexer_goto_row381[] = {
+static const int lexer_goto_row388[] = {
1,
- 123, 123, 380
+ 123, 123, 387
};
-static const int lexer_goto_row382[] = {
+static const int lexer_goto_row389[] = {
1,
- 95, 95, 388
+ 95, 95, 395
};
-static const int lexer_goto_row383[] = {
+static const int lexer_goto_row390[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row384[] = {
+static const int lexer_goto_row391[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row385[] = {
+static const int lexer_goto_row392[] = {
3,
48, 100, -45,
- 101, 101, 389,
- 102, 122, 103
+ 101, 101, 396,
+ 102, 122, 106
};
-static const int lexer_goto_row386[] = {
+static const int lexer_goto_row393[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row387[] = {
+static const int lexer_goto_row394[] = {
3,
- 48, 99, -107,
- 100, 100, 390,
- 101, 122, 103
+ 48, 99, -110,
+ 100, 100, 397,
+ 101, 122, 106
};
-static const int lexer_goto_row388[] = {
+static const int lexer_goto_row395[] = {
3,
48, 107, -37,
- 108, 108, 391,
- 109, 122, 103
+ 108, 108, 398,
+ 109, 122, 106
};
-static const int lexer_goto_row390[] = {
+static const int lexer_goto_row397[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row391[] = {
+static const int lexer_goto_row398[] = {
1,
48, 122, -41
};
-static const int lexer_goto_row392[] = {
+static const int lexer_goto_row399[] = {
1,
48, 122, -41
};
lexer_goto_row84,
lexer_goto_row85,
lexer_goto_row86,
- lexer_goto_row_null,
+ lexer_goto_row87,
lexer_goto_row88,
lexer_goto_row89,
lexer_goto_row_null,
- lexer_goto_row_null,
+ lexer_goto_row91,
lexer_goto_row92,
- lexer_goto_row93,
- lexer_goto_row94,
+ lexer_goto_row_null,
+ lexer_goto_row_null,
lexer_goto_row95,
lexer_goto_row96,
- lexer_goto_row_null,
+ lexer_goto_row97,
lexer_goto_row98,
lexer_goto_row99,
- lexer_goto_row100,
+ lexer_goto_row_null,
lexer_goto_row101,
lexer_goto_row102,
lexer_goto_row103,
lexer_goto_row140,
lexer_goto_row141,
lexer_goto_row142,
- lexer_goto_row_null,
+ lexer_goto_row143,
lexer_goto_row144,
+ lexer_goto_row145,
lexer_goto_row_null,
- lexer_goto_row146,
+ lexer_goto_row147,
lexer_goto_row_null,
- lexer_goto_row148,
+ lexer_goto_row149,
lexer_goto_row_null,
- lexer_goto_row150,
lexer_goto_row151,
lexer_goto_row_null,
- lexer_goto_row_null,
+ lexer_goto_row153,
lexer_goto_row154,
- lexer_goto_row155,
lexer_goto_row_null,
lexer_goto_row_null,
+ lexer_goto_row157,
lexer_goto_row158,
- lexer_goto_row159,
- lexer_goto_row160,
+ lexer_goto_row_null,
+ lexer_goto_row_null,
lexer_goto_row161,
lexer_goto_row162,
lexer_goto_row163,
lexer_goto_row167,
lexer_goto_row168,
lexer_goto_row169,
- lexer_goto_row_null,
- lexer_goto_row_null,
- lexer_goto_row_null,
- lexer_goto_row_null,
+ lexer_goto_row170,
+ lexer_goto_row171,
+ lexer_goto_row172,
+ lexer_goto_row173,
lexer_goto_row174,
lexer_goto_row175,
- lexer_goto_row176,
+ lexer_goto_row_null,
lexer_goto_row177,
lexer_goto_row178,
- lexer_goto_row179,
- lexer_goto_row180,
- lexer_goto_row181,
- lexer_goto_row182,
+ lexer_goto_row_null,
+ lexer_goto_row_null,
+ lexer_goto_row_null,
+ lexer_goto_row_null,
lexer_goto_row183,
lexer_goto_row184,
lexer_goto_row185,
lexer_goto_row233,
lexer_goto_row234,
lexer_goto_row235,
- lexer_goto_row_null,
+ lexer_goto_row236,
lexer_goto_row237,
lexer_goto_row238,
lexer_goto_row239,
lexer_goto_row240,
lexer_goto_row241,
lexer_goto_row242,
- lexer_goto_row_null,
+ lexer_goto_row243,
lexer_goto_row244,
- lexer_goto_row245,
- lexer_goto_row246,
- lexer_goto_row247,
- lexer_goto_row248,
- lexer_goto_row249,
+ lexer_goto_row_null,
+ lexer_goto_row_null,
+ lexer_goto_row_null,
+ lexer_goto_row_null,
+ lexer_goto_row_null,
lexer_goto_row250,
lexer_goto_row251,
lexer_goto_row252,
- lexer_goto_row253,
+ lexer_goto_row_null,
lexer_goto_row254,
lexer_goto_row255,
lexer_goto_row256,
lexer_goto_row293,
lexer_goto_row294,
lexer_goto_row295,
- lexer_goto_row_null,
- lexer_goto_row_null,
- lexer_goto_row_null,
+ lexer_goto_row296,
+ lexer_goto_row297,
+ lexer_goto_row298,
lexer_goto_row299,
lexer_goto_row300,
lexer_goto_row301,
lexer_goto_row338,
lexer_goto_row339,
lexer_goto_row340,
- lexer_goto_row_null,
+ lexer_goto_row341,
lexer_goto_row342,
lexer_goto_row343,
lexer_goto_row344,
lexer_goto_row345,
lexer_goto_row346,
lexer_goto_row347,
- lexer_goto_row348,
+ lexer_goto_row_null,
lexer_goto_row349,
lexer_goto_row350,
lexer_goto_row351,
lexer_goto_row386,
lexer_goto_row387,
lexer_goto_row388,
- lexer_goto_row_null,
+ lexer_goto_row389,
lexer_goto_row390,
lexer_goto_row391,
- lexer_goto_row392
+ lexer_goto_row392,
+ lexer_goto_row393,
+ lexer_goto_row394,
+ lexer_goto_row395,
+ lexer_goto_row_null,
+ lexer_goto_row397,
+ lexer_goto_row398,
+ lexer_goto_row399
};
const int lexer_accept_table[] = {
- -1,0,1,1,0,94,114,2,80,83,-1,53,54,77,75,57,76,74,79,100,100,58,96,87,60,90,95,97,55,56,82,-1,-1,98,98,98,98,98,98,98,98,98,98,98,98,98,98,98,98,98,98,98,81,114,84,1,86,114,109,-1,110,2,2,2,65,69,115,115,115,78,63,61,62,73,108,64,-1,-1,-1,-1,-1,-1,-1,-1,-1,-1,59,89,88,85,91,92,97,97,97,97,68,-1,99,-1,98,98,98,98,98,98,47,98,98,98,16,98,98,98,98,98,98,23,98,29,15,98,98,98,98,98,98,98,31,98,98,98,98,98,98,98,98,98,98,98,98,98,67,114,112,-1,111,114,109,114,114,2,113,114,115,66,72,102,102,102,-1,-1,108,103,103,101,101,101,101,104,70,93,71,-1,99,99,99,99,-1,-1,-1,98,98,30,98,98,98,98,98,10,98,98,98,28,11,98,98,98,40,98,98,98,98,39,32,98,98,98,98,98,98,98,98,98,98,98,98,98,98,17,98,98,114,114,114,114,114,-1,-1,-1,114,114,114,-1,-1,113,-1,-1,-1,-1,-1,-1,116,98,98,98,98,98,98,25,9,98,98,98,98,13,98,98,98,98,27,98,46,41,98,98,98,98,98,98,43,98,24,44,12,98,98,51,114,-1,-1,112,-1,111,-1,-1,114,-1,-1,114,114,114,-1,-1,114,106,107,105,-1,37,98,98,36,6,98,98,45,98,98,98,98,49,50,98,98,98,98,98,98,14,98,42,98,26,-1,-1,-1,-1,-1,-1,114,-1,-1,109,-1,-1,110,114,114,114,109,-1,114,-1,98,38,98,18,98,5,98,98,4,98,98,98,98,19,34,98,-1,112,-1,-1,111,109,110,114,-1,98,98,33,98,22,98,3,21,98,98,112,111,-1,7,35,98,48,98,98,52,8,20,9
+ -1,0,1,1,0,94,107,2,80,83,-1,53,54,77,75,57,76,74,79,100,100,58,96,87,60,90,95,97,55,56,82,-1,-1,98,98,98,98,98,98,98,98,98,98,98,98,98,98,98,98,98,98,98,81,107,84,1,86,107,102,-1,103,2,2,2,65,69,108,108,108,78,63,61,62,73,101,64,-1,100,-1,-1,-1,-1,100,-1,-1,-1,-1,-1,-1,59,89,88,85,91,92,97,97,97,97,68,-1,99,-1,98,98,98,98,98,98,47,98,98,98,16,98,98,98,98,98,98,23,98,29,15,98,98,98,98,98,98,98,31,98,98,98,98,98,98,98,98,98,98,98,98,98,67,107,105,-1,104,107,102,107,107,2,106,107,108,66,72,100,100,100,-1,-1,101,100,100,100,100,100,100,100,-1,-1,100,-1,-1,100,70,93,71,-1,99,99,99,99,-1,-1,-1,98,98,30,98,98,98,98,98,10,98,98,98,28,11,98,98,98,40,98,98,98,98,39,32,98,98,98,98,98,98,98,98,98,98,98,98,98,98,17,98,98,107,107,107,107,107,-1,-1,-1,107,107,107,-1,-1,106,100,100,100,100,-1,-1,-1,109,98,98,98,98,98,98,25,9,98,98,98,98,13,98,98,98,98,27,98,46,41,98,98,98,98,98,98,43,98,24,44,12,98,98,51,107,-1,-1,105,-1,104,-1,-1,107,-1,-1,107,107,107,-1,-1,107,-1,37,98,98,36,6,98,98,45,98,98,98,98,49,50,98,98,98,98,98,98,14,98,42,98,26,-1,-1,-1,-1,-1,-1,107,-1,-1,102,-1,-1,103,107,107,107,102,-1,107,-1,98,38,98,18,98,5,98,98,4,98,98,98,98,19,34,98,-1,105,-1,-1,104,102,103,107,-1,98,98,33,98,22,98,3,21,98,98,105,104,-1,7,35,98,48,98,98,52,8,20,9
};
static int parser_action_row1[] = {
7,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
- 28, 1, 493,
+ 28, 1, 486,
95, 0, 3,
- 115, 1, 493,
- 116, 1, 22
+ 108, 1, 486,
+ 109, 1, 22
};
static int parser_action_row2[] = {
1,
- -1, 1, 495
+ -1, 1, 488
};
static int parser_action_row3[] = {
1,
- -1, 1, 1112
+ -1, 1, 1084
};
static int parser_action_row4[] = {
4,
- -1, 1, 483,
+ -1, 1, 476,
0, 0, 1,
1, 0, 2,
95, 0, 3
static int parser_action_row5[] = {
2,
-1, 3, 4,
- 116, 2, -1
+ 109, 2, -1
};
static int parser_action_row6[] = {
7,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
- 28, 1, 493,
+ 28, 1, 486,
95, 0, 3,
- 115, 1, 493,
- 116, 1, 22
+ 108, 1, 486,
+ 109, 1, 22
};
static int parser_action_row7[] = {
1,
- -1, 1, 1078
+ -1, 1, 1050
};
static int parser_action_row8[] = {
1,
- -1, 1, 1082
+ -1, 1, 1054
};
static int parser_action_row9[] = {
1,
};
static int parser_action_row12[] = {
1,
- -1, 1, 1080
+ -1, 1, 1052
};
static int parser_action_row13[] = {
2,
- -1, 1, 492,
- 116, 1, 23
+ -1, 1, 485,
+ 109, 1, 23
};
static int parser_action_row14[] = {
- 39,
+ 32,
-1, 1, 30,
12, 0, 31,
13, 0, 32,
36, 0, 42,
37, 0, 43,
38, 0, 44,
- 41, 1, 464,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
54, 0, 52,
96, 0, 53,
97, 0, 54,
- 98, 1, 464,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
static int parser_action_row15[] = {
3,
-1, 3, 14,
- 28, 0, 90,
- 115, 0, 91
+ 28, 0, 83,
+ 108, 0, 84
};
static int parser_action_row16[] = {
1,
- -1, 1, 1114
+ -1, 1, 1086
};
static int parser_action_row17[] = {
4,
-1, 3, 16,
- 0, 0, 94,
- 1, 0, 95,
- 95, 0, 96
+ 0, 0, 87,
+ 1, 0, 88,
+ 95, 0, 89
};
static int parser_action_row18[] = {
1,
- -1, 1, 494
+ -1, 1, 487
};
static int parser_action_row19[] = {
7,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
- 28, 1, 493,
+ 28, 1, 486,
95, 0, 3,
- 115, 1, 493,
- 116, 1, 22
+ 108, 1, 486,
+ 109, 1, 22
};
static int parser_action_row20[] = {
7,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
- 28, 1, 493,
+ 28, 1, 486,
95, 0, 3,
- 115, 1, 493,
- 116, 1, 22
+ 108, 1, 486,
+ 109, 1, 22
};
static int parser_action_row21[] = {
5,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
95, 0, 3,
- 116, 1, 22
+ 109, 1, 22
};
static int parser_action_row22[] = {
7,
- -1, 1, 480,
- 0, 0, 108,
- 1, 0, 109,
- 9, 1, 1075,
- 28, 1, 1075,
- 95, 0, 110,
- 115, 1, 1075
+ -1, 1, 473,
+ 0, 0, 101,
+ 1, 0, 102,
+ 9, 1, 1047,
+ 28, 1, 1047,
+ 95, 0, 103,
+ 108, 1, 1047
};
static int parser_action_row23[] = {
7,
- -1, 1, 482,
+ -1, 1, 475,
0, 0, 1,
1, 0, 2,
- 9, 1, 1077,
- 28, 1, 1077,
- 95, 0, 111,
- 115, 1, 1077
+ 9, 1, 1049,
+ 28, 1, 1049,
+ 95, 0, 104,
+ 108, 1, 1049
};
static int parser_action_row24[] = {
1,
- -1, 1, 487
+ -1, 1, 480
};
static int parser_action_row25[] = {
4,
- -1, 1, 480,
- 0, 0, 108,
- 1, 0, 109,
- 95, 0, 110
+ -1, 1, 473,
+ 0, 0, 101,
+ 1, 0, 102,
+ 95, 0, 103
};
static int parser_action_row26[] = {
4,
- -1, 1, 482,
+ -1, 1, 475,
0, 0, 1,
1, 0, 2,
- 95, 0, 111
+ 95, 0, 104
};
static int parser_action_row27[] = {
1,
-1, 1, 1
};
static int parser_action_row28[] = {
- 39,
+ 32,
-1, 1, 30,
12, 0, 31,
13, 0, 32,
36, 0, 42,
37, 0, 43,
38, 0, 44,
- 41, 1, 464,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
54, 0, 52,
96, 0, 53,
97, 0, 54,
- 98, 1, 464,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
static int parser_action_row29[] = {
7,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
- 28, 1, 493,
+ 28, 1, 486,
95, 0, 3,
- 115, 1, 493,
- 116, 1, 22
+ 108, 1, 486,
+ 109, 1, 22
};
static int parser_action_row30[] = {
7,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
- 28, 1, 493,
+ 28, 1, 486,
95, 0, 3,
- 115, 1, 493,
- 116, 1, 22
+ 108, 1, 486,
+ 109, 1, 22
};
static int parser_action_row31[] = {
5,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
95, 0, 3,
- 116, 1, 22
+ 109, 1, 22
};
static int parser_action_row32[] = {
- 33,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 132,
+ 26,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 125,
54, 1, 353,
73, 1, 353,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
static int parser_action_row33[] = {
1,
-1, 1, 31
};
static int parser_action_row34[] = {
- 40,
- -1, 1, 464,
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 169,
+ 9, 0, 155,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
static int parser_action_row35[] = {
2,
-1, 3, 34,
- 97, 0, 174
+ 97, 0, 160
};
static int parser_action_row36[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
static int parser_action_row37[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
static int parser_action_row38[] = {
- 40,
- -1, 1, 464,
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 169,
+ 9, 0, 155,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
static int parser_action_row39[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
static int parser_action_row40[] = {
- 32,
+ 25,
-1, 1, 169,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
static int parser_action_row41[] = {
2,
-1, 1, 174,
- 49, 0, 209
+ 49, 0, 195
};
static int parser_action_row42[] = {
2,
-1, 1, 171,
- 49, 0, 209
+ 49, 0, 195
};
static int parser_action_row43[] = {
1,
-1, 1, 173
};
static int parser_action_row44[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 212,
+ 97, 0, 198,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
static int parser_action_row45[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
static int parser_action_row46[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
static int parser_action_row47[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
static int parser_action_row48[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
static int parser_action_row49[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
static int parser_action_row50[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
static int parser_action_row51[] = {
2,
-1, 3, 50,
- 11, 0, 223
+ 11, 0, 209
};
static int parser_action_row52[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
static int parser_action_row53[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
static int parser_action_row54[] = {
2,
-1, 3, 53,
- 58, 0, 226
+ 58, 0, 212
};
static int parser_action_row55[] = {
- 46,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 132,
+ 39,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 125,
54, 1, 341,
- 58, 0, 227,
- 59, 0, 228,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239,
+ 58, 0, 213,
+ 59, 0, 214,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225,
73, 1, 341,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
static int parser_action_row56[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
static int parser_action_row57[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
static int parser_action_row58[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
static int parser_action_row59[] = {
- 2,
- -1, 1, 411,
- 94, 0, 216
+ 1,
+ -1, 1, 396
};
static int parser_action_row60[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
static int parser_action_row61[] = {
- 2,
- -1, 1, 411,
- 94, 0, 216
-};
-static int parser_action_row62[] = {
- 2,
- -1, 1, 411,
- 94, 0, 216
-};
-static int parser_action_row63[] = {
- 2,
- -1, 1, 411,
- 94, 0, 216
-};
-static int parser_action_row64[] = {
- 2,
- -1, 1, 411,
- 94, 0, 216
-};
-static int parser_action_row65[] = {
- 2,
- -1, 1, 411,
- 94, 0, 216
-};
-static int parser_action_row66[] = {
- 1,
- -1, 1, 403
-};
-static int parser_action_row67[] = {
- 2,
- -1, 1, 411,
- 94, 0, 216
-};
-static int parser_action_row68[] = {
5,
-1, 1, 81,
- 18, 0, 254,
- 19, 0, 255,
- 20, 0, 256,
- 21, 0, 257
+ 18, 0, 233,
+ 19, 0, 234,
+ 20, 0, 235,
+ 21, 0, 236
};
-static int parser_action_row69[] = {
+static int parser_action_row62[] = {
1,
-1, 1, 24
};
-static int parser_action_row70[] = {
+static int parser_action_row63[] = {
1,
-1, 1, 25
};
-static int parser_action_row71[] = {
+static int parser_action_row64[] = {
4,
-1, 1, 160,
0, 0, 1,
1, 0, 2,
95, 0, 3
};
-static int parser_action_row72[] = {
+static int parser_action_row65[] = {
1,
-1, 1, 167
};
-static int parser_action_row73[] = {
+static int parser_action_row66[] = {
1,
-1, 1, 168
};
-static int parser_action_row74[] = {
+static int parser_action_row67[] = {
1,
-1, 1, 176
};
-static int parser_action_row75[] = {
+static int parser_action_row68[] = {
1,
-1, 1, 177
};
-static int parser_action_row76[] = {
+static int parser_action_row69[] = {
1,
-1, 1, 179
};
-static int parser_action_row77[] = {
+static int parser_action_row70[] = {
1,
-1, 1, 178
};
-static int parser_action_row78[] = {
+static int parser_action_row71[] = {
1,
-1, 1, 180
};
-static int parser_action_row79[] = {
+static int parser_action_row72[] = {
1,
-1, 1, 181
};
-static int parser_action_row80[] = {
+static int parser_action_row73[] = {
1,
-1, 1, 182
};
-static int parser_action_row81[] = {
+static int parser_action_row74[] = {
3,
- -1, 3, 80,
- 54, 0, 262,
- 73, 0, 263
+ -1, 3, 73,
+ 54, 0, 241,
+ 73, 0, 242
};
-static int parser_action_row82[] = {
+static int parser_action_row75[] = {
1,
-1, 1, 329
};
-static int parser_action_row83[] = {
+static int parser_action_row76[] = {
1,
- -1, 1, 385
+ -1, 1, 378
};
-static int parser_action_row84[] = {
+static int parser_action_row77[] = {
1,
- -1, 1, 384
+ -1, 1, 377
};
-static int parser_action_row85[] = {
+static int parser_action_row78[] = {
3,
- -1, 3, 84,
- 110, 0, 265,
- 111, 0, 266
+ -1, 3, 77,
+ 103, 0, 244,
+ 104, 0, 245
};
-static int parser_action_row86[] = {
+static int parser_action_row79[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row87[] = {
+static int parser_action_row80[] = {
3,
- -1, 3, 86,
- 41, 0, 272,
- 98, 0, 273
+ -1, 3, 79,
+ 41, 0, 251,
+ 98, 0, 252
};
-static int parser_action_row88[] = {
+static int parser_action_row81[] = {
1,
- -1, 1, 1110
+ -1, 1, 1082
};
-static int parser_action_row89[] = {
+static int parser_action_row82[] = {
3,
- -1, 1, 461,
- 12, 0, 274,
- 97, 0, 275
+ -1, 1, 454,
+ 12, 0, 253,
+ 97, 0, 254
};
-static int parser_action_row90[] = {
+static int parser_action_row83[] = {
4,
- -1, 1, 463,
- 12, 0, 276,
+ -1, 1, 456,
+ 12, 0, 255,
96, 0, 53,
- 97, 0, 277
+ 97, 0, 256
};
-static int parser_action_row91[] = {
+static int parser_action_row84[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row92[] = {
+static int parser_action_row85[] = {
1,
-1, 1, 141
};
-static int parser_action_row93[] = {
+static int parser_action_row86[] = {
2,
- -1, 3, 92,
- 115, 0, 281
+ -1, 3, 85,
+ 108, 0, 260
};
-static int parser_action_row94[] = {
+static int parser_action_row87[] = {
1,
-1, 1, 145
};
-static int parser_action_row95[] = {
+static int parser_action_row88[] = {
1,
- -1, 1, 478
+ -1, 1, 471
};
-static int parser_action_row96[] = {
+static int parser_action_row89[] = {
1,
- -1, 1, 477
+ -1, 1, 470
};
-static int parser_action_row97[] = {
+static int parser_action_row90[] = {
1,
- -1, 1, 479
+ -1, 1, 472
};
-static int parser_action_row98[] = {
+static int parser_action_row91[] = {
1,
-1, 1, 20
};
-static int parser_action_row99[] = {
+static int parser_action_row92[] = {
1,
- -1, 1, 1079
+ -1, 1, 1051
};
-static int parser_action_row100[] = {
+static int parser_action_row93[] = {
1,
-1, 1, 2
};
-static int parser_action_row101[] = {
+static int parser_action_row94[] = {
7,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
- 28, 1, 493,
+ 28, 1, 486,
95, 0, 3,
- 115, 1, 493,
- 116, 1, 22
+ 108, 1, 486,
+ 109, 1, 22
};
-static int parser_action_row102[] = {
+static int parser_action_row95[] = {
5,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
95, 0, 3,
- 116, 1, 22
+ 109, 1, 22
};
-static int parser_action_row103[] = {
+static int parser_action_row96[] = {
1,
-1, 1, 4
};
-static int parser_action_row104[] = {
+static int parser_action_row97[] = {
1,
- -1, 1, 1081
+ -1, 1, 1053
};
-static int parser_action_row105[] = {
- 39,
+static int parser_action_row98[] = {
+ 32,
-1, 1, 30,
12, 0, 31,
13, 0, 32,
36, 0, 42,
37, 0, 43,
38, 0, 44,
- 41, 1, 464,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
54, 0, 52,
96, 0, 53,
97, 0, 54,
- 98, 1, 464,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row106[] = {
+static int parser_action_row99[] = {
5,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
95, 0, 3,
- 116, 1, 22
+ 109, 1, 22
};
-static int parser_action_row107[] = {
+static int parser_action_row100[] = {
1,
- -1, 1, 1083
+ -1, 1, 1055
};
-static int parser_action_row108[] = {
+static int parser_action_row101[] = {
1,
-1, 1, 8
};
-static int parser_action_row109[] = {
+static int parser_action_row102[] = {
1,
- -1, 1, 496
+ -1, 1, 489
};
-static int parser_action_row110[] = {
+static int parser_action_row103[] = {
1,
- -1, 1, 1113
+ -1, 1, 1085
};
-static int parser_action_row111[] = {
+static int parser_action_row104[] = {
4,
- -1, 1, 485,
+ -1, 1, 478,
0, 0, 1,
1, 0, 2,
95, 0, 3
};
-static int parser_action_row112[] = {
+static int parser_action_row105[] = {
4,
- -1, 1, 484,
+ -1, 1, 477,
0, 0, 1,
1, 0, 2,
95, 0, 3
};
-static int parser_action_row113[] = {
+static int parser_action_row106[] = {
1,
- -1, 1, 1115
+ -1, 1, 1087
};
-static int parser_action_row114[] = {
+static int parser_action_row107[] = {
7,
- -1, 1, 481,
- 0, 0, 108,
- 1, 0, 109,
- 9, 1, 1076,
- 28, 1, 1076,
- 95, 0, 289,
- 115, 1, 1076
+ -1, 1, 474,
+ 0, 0, 101,
+ 1, 0, 102,
+ 9, 1, 1048,
+ 28, 1, 1048,
+ 95, 0, 268,
+ 108, 1, 1048
};
-static int parser_action_row115[] = {
+static int parser_action_row108[] = {
4,
- -1, 1, 481,
- 0, 0, 108,
- 1, 0, 109,
- 95, 0, 289
+ -1, 1, 474,
+ 0, 0, 101,
+ 1, 0, 102,
+ 95, 0, 268
};
-static int parser_action_row116[] = {
+static int parser_action_row109[] = {
5,
-1, 1, 81,
- 18, 0, 254,
- 19, 0, 255,
- 20, 0, 256,
- 21, 0, 257
+ 18, 0, 233,
+ 19, 0, 234,
+ 20, 0, 235,
+ 21, 0, 236
};
-static int parser_action_row117[] = {
+static int parser_action_row110[] = {
1,
-1, 1, 3
};
-static int parser_action_row118[] = {
+static int parser_action_row111[] = {
7,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
- 28, 1, 493,
+ 28, 1, 486,
95, 0, 3,
- 115, 1, 493,
- 116, 1, 22
+ 108, 1, 486,
+ 109, 1, 22
};
-static int parser_action_row119[] = {
+static int parser_action_row112[] = {
5,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
95, 0, 3,
- 116, 1, 22
+ 109, 1, 22
};
-static int parser_action_row120[] = {
+static int parser_action_row113[] = {
1,
-1, 1, 5
};
-static int parser_action_row121[] = {
+static int parser_action_row114[] = {
5,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
95, 0, 3,
- 116, 1, 22
+ 109, 1, 22
};
-static int parser_action_row122[] = {
+static int parser_action_row115[] = {
1,
-1, 1, 9
};
-static int parser_action_row123[] = {
+static int parser_action_row116[] = {
2,
- -1, 1, 780,
- 52, 0, 295
+ -1, 1, 766,
+ 52, 0, 274
};
-static int parser_action_row124[] = {
+static int parser_action_row117[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row125[] = {
+static int parser_action_row118[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row126[] = {
+static int parser_action_row119[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row127[] = {
+static int parser_action_row120[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row128[] = {
+static int parser_action_row121[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row129[] = {
+static int parser_action_row122[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row130[] = {
+static int parser_action_row123[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row131[] = {
+static int parser_action_row124[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row132[] = {
- 21,
- -1, 1, 464,
- 12, 0, 122,
- 38, 0, 305,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 96, 0, 53,
- 97, 0, 136,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row125[] = {
+ 14,
+ -1, 1, 457,
+ 12, 0, 115,
+ 38, 0, 284,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 96, 0, 53,
+ 97, 0, 129,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row133[] = {
+static int parser_action_row126[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row134[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row127[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row135[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row128[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row136[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row129[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row137[] = {
+static int parser_action_row130[] = {
3,
- -1, 1, 768,
- 52, 0, 295,
- 58, 0, 227
-};
-static int parser_action_row138[] = {
- 2,
- -1, 1, 411,
- 94, 0, 216
-};
-static int parser_action_row139[] = {
- 2,
- -1, 1, 411,
- 94, 0, 216
-};
-static int parser_action_row140[] = {
- 2,
- -1, 1, 411,
- 94, 0, 216
-};
-static int parser_action_row141[] = {
- 2,
- -1, 1, 411,
- 94, 0, 216
-};
-static int parser_action_row142[] = {
- 2,
- -1, 1, 411,
- 94, 0, 216
-};
-static int parser_action_row143[] = {
- 2,
- -1, 1, 411,
- 94, 0, 216
-};
-static int parser_action_row144[] = {
- 2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 754,
+ 52, 0, 274,
+ 58, 0, 213
};
-static int parser_action_row145[] = {
+static int parser_action_row131[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row146[] = {
+static int parser_action_row132[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row147[] = {
+static int parser_action_row133[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row148[] = {
+static int parser_action_row134[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row149[] = {
+static int parser_action_row135[] = {
1,
- -1, 1, 811
+ -1, 1, 790
};
-static int parser_action_row150[] = {
+static int parser_action_row136[] = {
1,
-1, 1, 352
};
-static int parser_action_row151[] = {
+static int parser_action_row137[] = {
1,
-1, 1, 193
};
-static int parser_action_row152[] = {
+static int parser_action_row138[] = {
3,
- -1, 3, 151,
- 41, 0, 324,
- 98, 0, 325
+ -1, 3, 137,
+ 41, 0, 296,
+ 98, 0, 297
};
-static int parser_action_row153[] = {
+static int parser_action_row139[] = {
2,
- -1, 1, 461,
- 97, 0, 326
+ -1, 1, 454,
+ 97, 0, 298
};
-static int parser_action_row154[] = {
+static int parser_action_row140[] = {
1,
- -1, 1, 446
+ -1, 1, 439
};
-static int parser_action_row155[] = {
+static int parser_action_row141[] = {
4,
- -1, 1, 710,
- 29, 0, 327,
- 30, 0, 328,
- 32, 0, 329
+ -1, 1, 696,
+ 29, 0, 299,
+ 30, 0, 300,
+ 32, 0, 301
};
-static int parser_action_row156[] = {
+static int parser_action_row142[] = {
1,
- -1, 1, 712
+ -1, 1, 698
};
-static int parser_action_row157[] = {
+static int parser_action_row143[] = {
1,
- -1, 1, 717
+ -1, 1, 703
};
-static int parser_action_row158[] = {
+static int parser_action_row144[] = {
10,
- -1, 1, 719,
- 39, 0, 330,
- 80, 0, 331,
- 84, 0, 332,
- 85, 0, 333,
- 86, 0, 334,
- 87, 0, 335,
- 89, 0, 336,
- 90, 0, 337,
- 92, 0, 338
+ -1, 1, 705,
+ 39, 0, 302,
+ 80, 0, 303,
+ 84, 0, 304,
+ 85, 0, 305,
+ 86, 0, 306,
+ 87, 0, 307,
+ 89, 0, 308,
+ 90, 0, 309,
+ 92, 0, 310
};
-static int parser_action_row159[] = {
+static int parser_action_row145[] = {
2,
- -1, 1, 728,
- 81, 0, 339
+ -1, 1, 714,
+ 81, 0, 311
};
-static int parser_action_row160[] = {
+static int parser_action_row146[] = {
2,
- -1, 1, 730,
- 82, 0, 340
+ -1, 1, 716,
+ 82, 0, 312
};
-static int parser_action_row161[] = {
+static int parser_action_row147[] = {
3,
- -1, 1, 732,
- 88, 0, 341,
- 91, 0, 342
+ -1, 1, 718,
+ 88, 0, 313,
+ 91, 0, 314
};
-static int parser_action_row162[] = {
+static int parser_action_row148[] = {
3,
- -1, 1, 734,
- 74, 0, 343,
- 75, 0, 344
+ -1, 1, 720,
+ 74, 0, 315,
+ 75, 0, 316
};
-static int parser_action_row163[] = {
+static int parser_action_row149[] = {
4,
- -1, 1, 737,
- 76, 0, 345,
- 78, 0, 346,
- 79, 0, 347
+ -1, 1, 723,
+ 76, 0, 317,
+ 78, 0, 318,
+ 79, 0, 319
};
-static int parser_action_row164[] = {
+static int parser_action_row150[] = {
1,
- -1, 1, 740
+ -1, 1, 726
};
-static int parser_action_row165[] = {
+static int parser_action_row151[] = {
2,
- -1, 1, 744,
- 77, 0, 348
+ -1, 1, 730,
+ 77, 0, 320
};
-static int parser_action_row166[] = {
+static int parser_action_row152[] = {
1,
- -1, 1, 746
+ -1, 1, 732
};
-static int parser_action_row167[] = {
+static int parser_action_row153[] = {
3,
- -1, 1, 751,
- 54, 0, 262,
- 73, 0, 349
+ -1, 1, 737,
+ 54, 0, 241,
+ 73, 0, 321
};
-static int parser_action_row168[] = {
+static int parser_action_row154[] = {
1,
- -1, 1, 756
+ -1, 1, 742
};
-static int parser_action_row169[] = {
+static int parser_action_row155[] = {
3,
- -1, 1, 463,
+ -1, 1, 456,
96, 0, 53,
- 97, 0, 351
+ 97, 0, 323
};
-static int parser_action_row170[] = {
+static int parser_action_row156[] = {
2,
-1, 1, 158,
- 49, 1, 1005
+ 49, 1, 977
};
-static int parser_action_row171[] = {
+static int parser_action_row157[] = {
1,
-1, 1, 257
};
-static int parser_action_row172[] = {
+static int parser_action_row158[] = {
1,
-1, 1, 159
};
-static int parser_action_row173[] = {
- 37,
- -1, 1, 464,
- 9, 0, 353,
+static int parser_action_row159[] = {
+ 30,
+ -1, 1, 457,
+ 9, 0, 325,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row174[] = {
+static int parser_action_row160[] = {
2,
- -1, 3, 173,
- 49, 0, 209
+ -1, 3, 159,
+ 49, 0, 195
};
-static int parser_action_row175[] = {
+static int parser_action_row161[] = {
3,
-1, 1, 155,
- 57, 0, 357,
- 94, 0, 216
+ 57, 0, 329,
+ 94, 0, 202
};
-static int parser_action_row176[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row162[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row177[] = {
+static int parser_action_row163[] = {
3,
- -1, 1, 1075,
- 0, 0, 108,
- 1, 0, 109
+ -1, 1, 1047,
+ 0, 0, 101,
+ 1, 0, 102
};
-static int parser_action_row178[] = {
+static int parser_action_row164[] = {
3,
- -1, 1, 1077,
+ -1, 1, 1049,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row179[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row165[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row180[] = {
+static int parser_action_row166[] = {
1,
-1, 1, 268
};
-static int parser_action_row181[] = {
+static int parser_action_row167[] = {
2,
- -1, 3, 180,
- 49, 0, 209
+ -1, 3, 166,
+ 49, 0, 195
};
-static int parser_action_row182[] = {
+static int parser_action_row168[] = {
3,
- -1, 3, 181,
- 52, 0, 364,
- 97, 0, 365
+ -1, 3, 167,
+ 52, 0, 336,
+ 97, 0, 337
};
-static int parser_action_row183[] = {
+static int parser_action_row169[] = {
2,
-1, 1, 353,
- 52, 0, 295
+ 52, 0, 274
};
-static int parser_action_row184[] = {
+static int parser_action_row170[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row185[] = {
+static int parser_action_row171[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row186[] = {
+static int parser_action_row172[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row187[] = {
+static int parser_action_row173[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row188[] = {
- 23,
- -1, 1, 464,
- 12, 0, 182,
+static int parser_action_row174[] = {
+ 16,
+ -1, 1, 457,
+ 12, 0, 168,
38, 0, 44,
42, 0, 45,
43, 0, 46,
52, 0, 51,
54, 0, 52,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row189[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row175[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row190[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row176[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row191[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row177[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row192[] = {
+static int parser_action_row178[] = {
3,
-1, 1, 341,
- 52, 0, 295,
- 58, 0, 227
+ 52, 0, 274,
+ 58, 0, 213
};
-static int parser_action_row193[] = {
+static int parser_action_row179[] = {
1,
-1, 1, 170
};
-static int parser_action_row194[] = {
+static int parser_action_row180[] = {
4,
-1, 1, 283,
- 29, 0, 378,
- 30, 0, 379,
- 32, 0, 380
+ 29, 0, 350,
+ 30, 0, 351,
+ 32, 0, 352
};
-static int parser_action_row195[] = {
+static int parser_action_row181[] = {
1,
-1, 1, 285
};
-static int parser_action_row196[] = {
+static int parser_action_row182[] = {
1,
-1, 1, 290
};
-static int parser_action_row197[] = {
+static int parser_action_row183[] = {
10,
-1, 1, 292,
- 39, 0, 381,
- 80, 0, 382,
- 84, 0, 383,
- 85, 0, 384,
- 86, 0, 385,
- 87, 0, 386,
- 89, 0, 387,
- 90, 0, 388,
- 92, 0, 389
+ 39, 0, 353,
+ 80, 0, 354,
+ 84, 0, 355,
+ 85, 0, 356,
+ 86, 0, 357,
+ 87, 0, 358,
+ 89, 0, 359,
+ 90, 0, 360,
+ 92, 0, 361
};
-static int parser_action_row198[] = {
+static int parser_action_row184[] = {
2,
-1, 1, 301,
- 81, 0, 390
+ 81, 0, 362
};
-static int parser_action_row199[] = {
+static int parser_action_row185[] = {
2,
-1, 1, 303,
- 82, 0, 391
+ 82, 0, 363
};
-static int parser_action_row200[] = {
+static int parser_action_row186[] = {
3,
-1, 1, 305,
- 88, 0, 392,
- 91, 0, 393
+ 88, 0, 364,
+ 91, 0, 365
};
-static int parser_action_row201[] = {
+static int parser_action_row187[] = {
3,
-1, 1, 307,
- 74, 0, 394,
- 75, 0, 395
+ 74, 0, 366,
+ 75, 0, 367
};
-static int parser_action_row202[] = {
+static int parser_action_row188[] = {
4,
-1, 1, 310,
- 76, 0, 396,
- 78, 0, 397,
- 79, 0, 398
+ 76, 0, 368,
+ 78, 0, 369,
+ 79, 0, 370
};
-static int parser_action_row203[] = {
+static int parser_action_row189[] = {
1,
-1, 1, 313
};
-static int parser_action_row204[] = {
+static int parser_action_row190[] = {
2,
-1, 1, 317,
- 77, 0, 399
+ 77, 0, 371
};
-static int parser_action_row205[] = {
+static int parser_action_row191[] = {
1,
-1, 1, 319
};
-static int parser_action_row206[] = {
+static int parser_action_row192[] = {
3,
-1, 1, 324,
- 54, 0, 262,
- 73, 0, 400
+ 54, 0, 241,
+ 73, 0, 372
};
-static int parser_action_row207[] = {
+static int parser_action_row193[] = {
3,
- -1, 3, 206,
- 41, 0, 402,
- 98, 0, 403
+ -1, 3, 192,
+ 41, 0, 374,
+ 98, 0, 375
};
-static int parser_action_row208[] = {
+static int parser_action_row194[] = {
2,
- -1, 1, 461,
- 97, 0, 404
+ -1, 1, 454,
+ 97, 0, 376
};
-static int parser_action_row209[] = {
+static int parser_action_row195[] = {
3,
- -1, 1, 463,
+ -1, 1, 456,
96, 0, 53,
- 97, 0, 405
+ 97, 0, 377
};
-static int parser_action_row210[] = {
+static int parser_action_row196[] = {
2,
-1, 1, 201,
- 97, 0, 407
+ 97, 0, 379
};
-static int parser_action_row211[] = {
+static int parser_action_row197[] = {
1,
-1, 1, 175
};
-static int parser_action_row212[] = {
+static int parser_action_row198[] = {
1,
-1, 1, 172
};
-static int parser_action_row213[] = {
+static int parser_action_row199[] = {
4,
-1, 1, 341,
- 52, 0, 295,
- 57, 0, 408,
- 58, 0, 227
+ 52, 0, 274,
+ 57, 0, 380,
+ 58, 0, 213
};
-static int parser_action_row214[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row200[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row215[] = {
+static int parser_action_row201[] = {
2,
-1, 1, 280,
- 24, 0, 410
+ 24, 0, 382
};
-static int parser_action_row216[] = {
+static int parser_action_row202[] = {
3,
- -1, 3, 215,
- 47, 0, 411,
- 96, 0, 412
+ -1, 3, 201,
+ 47, 0, 383,
+ 96, 0, 384
};
-static int parser_action_row217[] = {
+static int parser_action_row203[] = {
3,
-1, 1, 30,
13, 0, 32,
- 52, 0, 414
+ 52, 0, 386
};
-static int parser_action_row218[] = {
+static int parser_action_row204[] = {
1,
- -1, 1, 410
+ -1, 1, 403
};
-static int parser_action_row219[] = {
+static int parser_action_row205[] = {
1,
-1, 1, 369
};
-static int parser_action_row220[] = {
+static int parser_action_row206[] = {
1,
-1, 1, 370
};
-static int parser_action_row221[] = {
+static int parser_action_row207[] = {
1,
-1, 1, 371
};
-static int parser_action_row222[] = {
+static int parser_action_row208[] = {
1,
-1, 1, 372
};
-static int parser_action_row223[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row209[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 417,
+ 97, 0, 389,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row224[] = {
+static int parser_action_row210[] = {
3,
- -1, 3, 223,
- 47, 0, 420,
- 96, 0, 421
+ -1, 3, 209,
+ 47, 0, 392,
+ 96, 0, 393
};
-static int parser_action_row225[] = {
- 60,
- -1, 1, 464,
- 12, 0, 182,
+static int parser_action_row211[] = {
+ 53,
+ -1, 1, 457,
+ 12, 0, 168,
15, 0, 33,
16, 0, 34,
- 22, 0, 183,
+ 22, 0, 169,
25, 0, 36,
26, 0, 37,
27, 0, 38,
- 31, 0, 184,
- 33, 0, 423,
- 34, 0, 424,
- 35, 0, 425,
- 36, 0, 426,
+ 31, 0, 170,
+ 33, 0, 395,
+ 34, 0, 396,
+ 35, 0, 397,
+ 36, 0, 398,
37, 0, 43,
- 38, 0, 185,
- 40, 0, 186,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 47, 0, 420,
- 48, 0, 187,
+ 47, 0, 392,
+ 48, 0, 173,
50, 0, 49,
- 51, 0, 427,
+ 51, 0, 399,
52, 0, 51,
- 54, 0, 428,
- 74, 0, 429,
- 75, 0, 430,
- 76, 0, 431,
- 77, 0, 432,
- 78, 0, 433,
- 79, 0, 434,
- 80, 0, 435,
- 81, 0, 436,
- 82, 0, 437,
- 83, 0, 438,
- 84, 0, 439,
- 85, 0, 440,
- 86, 0, 441,
- 87, 0, 442,
- 88, 0, 443,
- 89, 0, 444,
- 90, 0, 445,
- 91, 0, 446,
- 92, 0, 447,
- 94, 0, 216,
- 96, 0, 448,
- 97, 0, 449,
+ 54, 0, 400,
+ 74, 0, 401,
+ 75, 0, 402,
+ 76, 0, 403,
+ 77, 0, 404,
+ 78, 0, 405,
+ 79, 0, 406,
+ 80, 0, 407,
+ 81, 0, 408,
+ 82, 0, 409,
+ 83, 0, 410,
+ 84, 0, 411,
+ 85, 0, 412,
+ 86, 0, 413,
+ 87, 0, 414,
+ 88, 0, 415,
+ 89, 0, 416,
+ 90, 0, 417,
+ 91, 0, 418,
+ 92, 0, 419,
+ 94, 0, 202,
+ 96, 0, 420,
+ 97, 0, 421,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row226[] = {
- 31,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 470,
- 27, 0, 471,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row212[] = {
+ 24,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 442,
+ 27, 0, 443,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row227[] = {
+static int parser_action_row213[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row228[] = {
+static int parser_action_row214[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row229[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row215[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row230[] = {
+static int parser_action_row216[] = {
1,
-1, 1, 245
};
-static int parser_action_row231[] = {
+static int parser_action_row217[] = {
1,
-1, 1, 246
};
-static int parser_action_row232[] = {
+static int parser_action_row218[] = {
1,
-1, 1, 247
};
-static int parser_action_row233[] = {
+static int parser_action_row219[] = {
1,
-1, 1, 248
};
-static int parser_action_row234[] = {
+static int parser_action_row220[] = {
1,
-1, 1, 249
};
-static int parser_action_row235[] = {
+static int parser_action_row221[] = {
1,
-1, 1, 250
};
-static int parser_action_row236[] = {
+static int parser_action_row222[] = {
1,
-1, 1, 251
};
-static int parser_action_row237[] = {
+static int parser_action_row223[] = {
1,
-1, 1, 252
};
-static int parser_action_row238[] = {
+static int parser_action_row224[] = {
1,
-1, 1, 253
};
-static int parser_action_row239[] = {
+static int parser_action_row225[] = {
1,
-1, 1, 254
};
-static int parser_action_row240[] = {
+static int parser_action_row226[] = {
1,
-1, 1, 255
};
-static int parser_action_row241[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row227[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row242[] = {
+static int parser_action_row228[] = {
13,
-1, 1, 340,
- 59, 0, 479,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ 59, 0, 451,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row243[] = {
+static int parser_action_row229[] = {
1,
-1, 1, 187
};
-static int parser_action_row244[] = {
+static int parser_action_row230[] = {
1,
-1, 1, 373
};
-static int parser_action_row245[] = {
+static int parser_action_row231[] = {
1,
-1, 1, 374
};
-static int parser_action_row246[] = {
- 1,
- -1, 1, 375
-};
-static int parser_action_row247[] = {
+static int parser_action_row232[] = {
1,
-1, 1, 376
};
-static int parser_action_row248[] = {
- 1,
- -1, 1, 377
-};
-static int parser_action_row249[] = {
- 1,
- -1, 1, 378
-};
-static int parser_action_row250[] = {
- 1,
- -1, 1, 379
-};
-static int parser_action_row251[] = {
- 1,
- -1, 1, 380
-};
-static int parser_action_row252[] = {
- 1,
- -1, 1, 381
-};
-static int parser_action_row253[] = {
- 1,
- -1, 1, 383
-};
-static int parser_action_row254[] = {
+static int parser_action_row233[] = {
1,
- -1, 1, 382
+ -1, 1, 375
};
-static int parser_action_row255[] = {
+static int parser_action_row234[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row256[] = {
+static int parser_action_row235[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row257[] = {
+static int parser_action_row236[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row258[] = {
+static int parser_action_row237[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row259[] = {
+static int parser_action_row238[] = {
9,
- -1, 3, 258,
- 3, 0, 485,
- 4, 0, 486,
- 5, 0, 487,
- 6, 0, 488,
- 7, 0, 489,
- 8, 0, 490,
- 10, 0, 491,
- 17, 0, 492
+ -1, 3, 237,
+ 3, 0, 457,
+ 4, 0, 458,
+ 5, 0, 459,
+ 6, 0, 460,
+ 7, 0, 461,
+ 8, 0, 462,
+ 10, 0, 463,
+ 17, 0, 464
};
-static int parser_action_row260[] = {
+static int parser_action_row239[] = {
1,
- -1, 1, 1096
+ -1, 1, 1068
};
-static int parser_action_row261[] = {
- 38,
+static int parser_action_row240[] = {
+ 31,
-1, 1, 162,
12, 0, 31,
15, 0, 33,
36, 0, 42,
37, 0, 43,
38, 0, 44,
- 41, 1, 464,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
54, 0, 52,
96, 0, 53,
97, 0, 54,
- 98, 1, 464,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row262[] = {
+static int parser_action_row241[] = {
4,
-1, 1, 161,
0, 0, 1,
1, 0, 2,
95, 0, 3
};
-static int parser_action_row263[] = {
+static int parser_action_row242[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row264[] = {
+static int parser_action_row243[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row265[] = {
+static int parser_action_row244[] = {
13,
-1, 1, 354,
- 59, 0, 499,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ 59, 0, 471,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row266[] = {
+static int parser_action_row245[] = {
1,
- -1, 1, 406
+ -1, 1, 399
};
-static int parser_action_row267[] = {
+static int parser_action_row246[] = {
1,
- -1, 1, 407
+ -1, 1, 400
};
-static int parser_action_row268[] = {
+static int parser_action_row247[] = {
1,
- -1, 1, 1102
+ -1, 1, 1074
};
-static int parser_action_row269[] = {
+static int parser_action_row248[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row270[] = {
+static int parser_action_row249[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row271[] = {
+static int parser_action_row250[] = {
3,
- -1, 3, 270,
- 110, 0, 265,
- 111, 0, 266
+ -1, 3, 249,
+ 103, 0, 244,
+ 104, 0, 245
};
-static int parser_action_row272[] = {
- 32,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row251[] = {
+ 25,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 110, 1, 402,
- 111, 1, 402,
- 112, 0, 66
+ 103, 1, 395,
+ 104, 1, 395,
+ 105, 0, 59
};
-static int parser_action_row273[] = {
- 33,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 132,
+static int parser_action_row252[] = {
+ 26,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 125,
54, 1, 349,
73, 1, 349,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row274[] = {
+static int parser_action_row253[] = {
13,
-1, 1, 331,
- 59, 0, 508,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ 59, 0, 480,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row275[] = {
- 31,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 510,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row254[] = {
+ 24,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 482,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row276[] = {
- 45,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 132,
+static int parser_action_row255[] = {
+ 38,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 125,
54, 1, 343,
- 59, 0, 512,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239,
+ 59, 0, 484,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225,
73, 1, 343,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row277[] = {
- 31,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 510,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row256[] = {
+ 24,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 482,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row278[] = {
- 46,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 132,
- 54, 1, 347,
- 58, 0, 227,
- 59, 0, 517,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239,
+static int parser_action_row257[] = {
+ 39,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 125,
+ 54, 1, 347,
+ 58, 0, 213,
+ 59, 0, 489,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225,
73, 1, 347,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row279[] = {
+static int parser_action_row258[] = {
1,
- -1, 1, 1111
+ -1, 1, 1083
};
-static int parser_action_row280[] = {
+static int parser_action_row259[] = {
3,
- -1, 1, 462,
- 12, 0, 521,
- 97, 0, 522
+ -1, 1, 455,
+ 12, 0, 493,
+ 97, 0, 494
};
-static int parser_action_row281[] = {
+static int parser_action_row260[] = {
2,
- -1, 3, 280,
- 108, 0, 523
+ -1, 3, 259,
+ 101, 0, 495
};
-static int parser_action_row282[] = {
+static int parser_action_row261[] = {
1,
-1, 1, 142
};
-static int parser_action_row283[] = {
+static int parser_action_row262[] = {
1,
-1, 1, 6
};
-static int parser_action_row284[] = {
+static int parser_action_row263[] = {
5,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
95, 0, 3,
- 116, 1, 22
+ 109, 1, 22
};
-static int parser_action_row285[] = {
+static int parser_action_row264[] = {
1,
-1, 1, 10
};
-static int parser_action_row286[] = {
+static int parser_action_row265[] = {
5,
-1, 1, 81,
- 18, 0, 254,
- 19, 0, 255,
- 20, 0, 256,
- 21, 0, 257
+ 18, 0, 233,
+ 19, 0, 234,
+ 20, 0, 235,
+ 21, 0, 236
};
-static int parser_action_row287[] = {
+static int parser_action_row266[] = {
1,
-1, 1, 12
};
-static int parser_action_row288[] = {
+static int parser_action_row267[] = {
1,
- -1, 1, 489
+ -1, 1, 482
};
-static int parser_action_row289[] = {
+static int parser_action_row268[] = {
1,
- -1, 1, 488
+ -1, 1, 481
};
-static int parser_action_row290[] = {
+static int parser_action_row269[] = {
4,
- -1, 1, 486,
+ -1, 1, 479,
0, 0, 1,
1, 0, 2,
95, 0, 3
};
-static int parser_action_row291[] = {
+static int parser_action_row270[] = {
8,
- -1, 3, 290,
- 4, 0, 486,
- 5, 0, 487,
- 6, 0, 488,
- 7, 0, 489,
- 8, 0, 490,
- 10, 0, 491,
- 17, 0, 492
+ -1, 3, 269,
+ 4, 0, 458,
+ 5, 0, 459,
+ 6, 0, 460,
+ 7, 0, 461,
+ 8, 0, 462,
+ 10, 0, 463,
+ 17, 0, 464
};
-static int parser_action_row292[] = {
+static int parser_action_row271[] = {
1,
-1, 1, 7
};
-static int parser_action_row293[] = {
+static int parser_action_row272[] = {
5,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
95, 0, 3,
- 116, 1, 22
+ 109, 1, 22
};
-static int parser_action_row294[] = {
+static int parser_action_row273[] = {
1,
-1, 1, 11
};
-static int parser_action_row295[] = {
+static int parser_action_row274[] = {
1,
-1, 1, 13
};
-static int parser_action_row296[] = {
+static int parser_action_row275[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row297[] = {
+static int parser_action_row276[] = {
1,
- -1, 1, 779
+ -1, 1, 765
};
-static int parser_action_row298[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row277[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row299[] = {
- 27,
- -1, 1, 464,
- 12, 0, 122,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row278[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 115,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row300[] = {
+static int parser_action_row279[] = {
3,
- -1, 3, 299,
- 47, 0, 411,
- 96, 0, 412
+ -1, 3, 278,
+ 47, 0, 383,
+ 96, 0, 384
};
-static int parser_action_row301[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row280[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row302[] = {
+static int parser_action_row281[] = {
1,
- -1, 1, 796
+ -1, 1, 782
};
-static int parser_action_row303[] = {
+static int parser_action_row282[] = {
1,
- -1, 1, 797
+ -1, 1, 783
};
-static int parser_action_row304[] = {
+static int parser_action_row283[] = {
1,
- -1, 1, 798
+ -1, 1, 784
};
-static int parser_action_row305[] = {
+static int parser_action_row284[] = {
1,
- -1, 1, 799
+ -1, 1, 785
};
-static int parser_action_row306[] = {
+static int parser_action_row285[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row307[] = {
+static int parser_action_row286[] = {
3,
- -1, 3, 306,
- 41, 0, 324,
- 98, 0, 534
+ -1, 3, 285,
+ 41, 0, 296,
+ 98, 0, 506
};
-static int parser_action_row308[] = {
+static int parser_action_row287[] = {
3,
- -1, 3, 307,
- 54, 0, 262,
- 73, 0, 535
+ -1, 3, 286,
+ 54, 0, 241,
+ 73, 0, 507
};
-static int parser_action_row309[] = {
- 31,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row288[] = {
+ 24,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
- 53, 0, 536,
+ 53, 0, 508,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 537,
+ 97, 0, 509,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
-};
-static int parser_action_row310[] = {
- 1,
- -1, 1, 748
-};
-static int parser_action_row311[] = {
- 1,
- -1, 1, 747
-};
-static int parser_action_row312[] = {
- 1,
- -1, 1, 749
-};
-static int parser_action_row313[] = {
- 1,
- -1, 1, 767
-};
-static int parser_action_row314[] = {
- 1,
- -1, 1, 800
-};
-static int parser_action_row315[] = {
- 1,
- -1, 1, 801
-};
-static int parser_action_row316[] = {
- 1,
- -1, 1, 802
+ 105, 0, 59
};
-static int parser_action_row317[] = {
+static int parser_action_row289[] = {
1,
- -1, 1, 803
+ -1, 1, 734
};
-static int parser_action_row318[] = {
+static int parser_action_row290[] = {
1,
- -1, 1, 804
+ -1, 1, 733
};
-static int parser_action_row319[] = {
+static int parser_action_row291[] = {
1,
- -1, 1, 805
+ -1, 1, 735
};
-static int parser_action_row320[] = {
+static int parser_action_row292[] = {
1,
- -1, 1, 806
+ -1, 1, 753
};
-static int parser_action_row321[] = {
+static int parser_action_row293[] = {
1,
- -1, 1, 807
+ -1, 1, 786
};
-static int parser_action_row322[] = {
+static int parser_action_row294[] = {
1,
- -1, 1, 808
+ -1, 1, 787
};
-static int parser_action_row323[] = {
+static int parser_action_row295[] = {
1,
- -1, 1, 810
+ -1, 1, 789
};
-static int parser_action_row324[] = {
+static int parser_action_row296[] = {
1,
- -1, 1, 809
+ -1, 1, 788
};
-static int parser_action_row325[] = {
+static int parser_action_row297[] = {
2,
- -1, 1, 776,
- 52, 0, 295
+ -1, 1, 762,
+ 52, 0, 274
};
-static int parser_action_row326[] = {
+static int parser_action_row298[] = {
1,
- -1, 1, 758
+ -1, 1, 744
};
-static int parser_action_row327[] = {
+static int parser_action_row299[] = {
2,
- -1, 1, 770,
- 52, 0, 295
+ -1, 1, 756,
+ 52, 0, 274
};
-static int parser_action_row328[] = {
+static int parser_action_row300[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row329[] = {
+static int parser_action_row301[] = {
4,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2,
- 24, 0, 544
+ 24, 0, 516
};
-static int parser_action_row330[] = {
+static int parser_action_row302[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row331[] = {
+static int parser_action_row303[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row332[] = {
+static int parser_action_row304[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row333[] = {
+static int parser_action_row305[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row334[] = {
+static int parser_action_row306[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row335[] = {
+static int parser_action_row307[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row336[] = {
+static int parser_action_row308[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row337[] = {
+static int parser_action_row309[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row338[] = {
+static int parser_action_row310[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row339[] = {
+static int parser_action_row311[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row340[] = {
+static int parser_action_row312[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row341[] = {
+static int parser_action_row313[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row342[] = {
+static int parser_action_row314[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row343[] = {
+static int parser_action_row315[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row344[] = {
+static int parser_action_row316[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row345[] = {
+static int parser_action_row317[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row346[] = {
+static int parser_action_row318[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row347[] = {
+static int parser_action_row319[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row348[] = {
+static int parser_action_row320[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row349[] = {
+static int parser_action_row321[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row350[] = {
+static int parser_action_row322[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row351[] = {
+static int parser_action_row323[] = {
1,
- -1, 1, 781
+ -1, 1, 767
};
-static int parser_action_row352[] = {
+static int parser_action_row324[] = {
3,
- -1, 1, 774,
- 52, 0, 295,
- 58, 0, 227
+ -1, 1, 760,
+ 52, 0, 274,
+ 58, 0, 213
};
-static int parser_action_row353[] = {
+static int parser_action_row325[] = {
2,
- -1, 1, 462,
- 97, 0, 568
+ -1, 1, 455,
+ 97, 0, 540
};
-static int parser_action_row354[] = {
+static int parser_action_row326[] = {
2,
-1, 1, 157,
- 49, 1, 1004
+ 49, 1, 976
};
-static int parser_action_row355[] = {
+static int parser_action_row327[] = {
2,
-1, 1, 156,
- 49, 1, 1003
+ 49, 1, 975
};
-static int parser_action_row356[] = {
+static int parser_action_row328[] = {
4,
- -1, 3, 355,
+ -1, 3, 327,
0, 0, 1,
1, 0, 2,
95, 0, 3
};
-static int parser_action_row357[] = {
+static int parser_action_row329[] = {
1,
-1, 1, 256
};
-static int parser_action_row358[] = {
+static int parser_action_row330[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row359[] = {
+static int parser_action_row331[] = {
2,
-1, 1, 203,
- 59, 0, 572
+ 59, 0, 544
};
-static int parser_action_row360[] = {
+static int parser_action_row332[] = {
2,
-1, 1, 155,
- 57, 0, 357
+ 57, 0, 329
};
-static int parser_action_row361[] = {
+static int parser_action_row333[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row362[] = {
+static int parser_action_row334[] = {
3,
- -1, 1, 1076,
- 0, 0, 108,
- 1, 0, 109
+ -1, 1, 1048,
+ 0, 0, 101,
+ 1, 0, 102
};
-static int parser_action_row363[] = {
+static int parser_action_row335[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row364[] = {
+static int parser_action_row336[] = {
1,
-1, 1, 267
};
-static int parser_action_row365[] = {
+static int parser_action_row337[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row366[] = {
+static int parser_action_row338[] = {
1,
- -1, 1, 455
+ -1, 1, 448
};
-static int parser_action_row367[] = {
+static int parser_action_row339[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row368[] = {
+static int parser_action_row340[] = {
2,
- -1, 1, 454,
- 56, 0, 578
+ -1, 1, 447,
+ 56, 0, 550
};
-static int parser_action_row369[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row341[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row370[] = {
- 29,
- -1, 1, 464,
- 12, 0, 182,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row342[] = {
+ 22,
+ -1, 1, 457,
+ 12, 0, 168,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row371[] = {
+static int parser_action_row343[] = {
3,
- -1, 3, 370,
- 47, 0, 411,
- 96, 0, 412
+ -1, 3, 342,
+ 47, 0, 383,
+ 96, 0, 384
};
-static int parser_action_row372[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row344[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row373[] = {
+static int parser_action_row345[] = {
3,
- -1, 3, 372,
- 54, 0, 262,
- 73, 0, 583
+ -1, 3, 344,
+ 54, 0, 241,
+ 73, 0, 555
};
-static int parser_action_row374[] = {
+static int parser_action_row346[] = {
3,
- -1, 3, 373,
- 41, 0, 402,
- 98, 0, 584
+ -1, 3, 345,
+ 41, 0, 374,
+ 98, 0, 556
};
-static int parser_action_row375[] = {
+static int parser_action_row347[] = {
1,
-1, 1, 321
};
-static int parser_action_row376[] = {
+static int parser_action_row348[] = {
1,
-1, 1, 320
};
-static int parser_action_row377[] = {
+static int parser_action_row349[] = {
1,
-1, 1, 322
};
-static int parser_action_row378[] = {
+static int parser_action_row350[] = {
1,
-1, 1, 340
};
-static int parser_action_row379[] = {
+static int parser_action_row351[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row380[] = {
+static int parser_action_row352[] = {
4,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2,
- 24, 0, 586
+ 24, 0, 558
};
-static int parser_action_row381[] = {
+static int parser_action_row353[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row382[] = {
+static int parser_action_row354[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row383[] = {
+static int parser_action_row355[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row384[] = {
+static int parser_action_row356[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row385[] = {
+static int parser_action_row357[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row386[] = {
+static int parser_action_row358[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row387[] = {
+static int parser_action_row359[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row388[] = {
+static int parser_action_row360[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row389[] = {
+static int parser_action_row361[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row390[] = {
+static int parser_action_row362[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row391[] = {
+static int parser_action_row363[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row392[] = {
+static int parser_action_row364[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row393[] = {
+static int parser_action_row365[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row394[] = {
+static int parser_action_row366[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row395[] = {
+static int parser_action_row367[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row396[] = {
+static int parser_action_row368[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row397[] = {
+static int parser_action_row369[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row398[] = {
+static int parser_action_row370[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row399[] = {
+static int parser_action_row371[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row400[] = {
+static int parser_action_row372[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row401[] = {
+static int parser_action_row373[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row402[] = {
+static int parser_action_row374[] = {
1,
-1, 1, 354
};
-static int parser_action_row403[] = {
+static int parser_action_row375[] = {
2,
-1, 1, 349,
- 52, 0, 295
+ 52, 0, 274
};
-static int parser_action_row404[] = {
+static int parser_action_row376[] = {
1,
-1, 1, 331
};
-static int parser_action_row405[] = {
+static int parser_action_row377[] = {
2,
-1, 1, 343,
- 52, 0, 295
+ 52, 0, 274
};
-static int parser_action_row406[] = {
+static int parser_action_row378[] = {
3,
-1, 1, 347,
- 52, 0, 295,
- 58, 0, 227
+ 52, 0, 274,
+ 58, 0, 213
};
-static int parser_action_row407[] = {
+static int parser_action_row379[] = {
2,
- -1, 1, 462,
- 97, 0, 611
+ -1, 1, 455,
+ 97, 0, 583
};
-static int parser_action_row408[] = {
+static int parser_action_row380[] = {
1,
-1, 1, 202
};
-static int parser_action_row409[] = {
+static int parser_action_row381[] = {
1,
-1, 1, 282
};
-static int parser_action_row410[] = {
+static int parser_action_row382[] = {
2,
-1, 1, 281,
- 24, 0, 612
+ 24, 0, 584
};
-static int parser_action_row411[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row383[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 613,
+ 9, 0, 585,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row412[] = {
+static int parser_action_row384[] = {
2,
- -1, 3, 411,
- 96, 0, 616
+ -1, 3, 383,
+ 96, 0, 588
};
-static int parser_action_row413[] = {
+static int parser_action_row385[] = {
3,
- -1, 1, 815,
- 54, 0, 617,
- 94, 0, 618
+ -1, 1, 794,
+ 54, 0, 589,
+ 94, 0, 590
};
-static int parser_action_row414[] = {
+static int parser_action_row386[] = {
2,
- -1, 3, 413,
- 73, 0, 621
+ -1, 3, 385,
+ 73, 0, 593
};
-static int parser_action_row415[] = {
+static int parser_action_row387[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row416[] = {
+static int parser_action_row388[] = {
5,
-1, 1, 81,
- 18, 0, 254,
- 19, 0, 255,
- 20, 0, 256,
- 21, 0, 257
+ 18, 0, 233,
+ 19, 0, 234,
+ 20, 0, 235,
+ 21, 0, 236
};
-static int parser_action_row417[] = {
+static int parser_action_row389[] = {
1,
- -1, 1, 408
+ -1, 1, 401
};
-static int parser_action_row418[] = {
+static int parser_action_row390[] = {
6,
-1, 1, 341,
- 52, 0, 295,
- 57, 0, 357,
- 58, 0, 227,
+ 52, 0, 274,
+ 57, 0, 329,
+ 58, 0, 213,
59, 1, 155,
- 94, 0, 216
+ 94, 0, 202
};
-static int parser_action_row419[] = {
+static int parser_action_row391[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row420[] = {
+static int parser_action_row392[] = {
1,
-1, 1, 277
};
-static int parser_action_row421[] = {
+static int parser_action_row393[] = {
2,
- -1, 3, 420,
- 96, 0, 627
+ -1, 3, 392,
+ 96, 0, 599
};
-static int parser_action_row422[] = {
+static int parser_action_row394[] = {
3,
- -1, 1, 411,
- 54, 0, 628,
- 94, 0, 216
+ -1, 1, 404,
+ 54, 0, 600,
+ 94, 0, 202
};
-static int parser_action_row423[] = {
+static int parser_action_row395[] = {
2,
- -1, 3, 422,
- 57, 0, 630
+ -1, 3, 394,
+ 57, 0, 602
};
-static int parser_action_row424[] = {
- 32,
- -1, 1, 1011,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+static int parser_action_row396[] = {
+ 25,
+ -1, 1, 983,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row425[] = {
+static int parser_action_row397[] = {
2,
- -1, 1, 1016,
- 49, 0, 209
+ -1, 1, 988,
+ 49, 0, 195
};
-static int parser_action_row426[] = {
+static int parser_action_row398[] = {
2,
- -1, 1, 1013,
- 49, 0, 209
+ -1, 1, 985,
+ 49, 0, 195
};
-static int parser_action_row427[] = {
+static int parser_action_row399[] = {
1,
- -1, 1, 1015
+ -1, 1, 987
};
-static int parser_action_row428[] = {
+static int parser_action_row400[] = {
2,
- -1, 3, 427,
- 11, 0, 634
+ -1, 3, 399,
+ 11, 0, 606
};
-static int parser_action_row429[] = {
+static int parser_action_row401[] = {
4,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2,
- 55, 0, 635
+ 55, 0, 607
};
-static int parser_action_row430[] = {
- 30,
- -1, 1, 504,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+static int parser_action_row402[] = {
+ 23,
+ -1, 1, 497,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row431[] = {
- 30,
- -1, 1, 505,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+static int parser_action_row403[] = {
+ 23,
+ -1, 1, 498,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row432[] = {
+static int parser_action_row404[] = {
1,
- -1, 1, 506
+ -1, 1, 499
};
-static int parser_action_row433[] = {
+static int parser_action_row405[] = {
1,
- -1, 1, 507
+ -1, 1, 500
};
-static int parser_action_row434[] = {
+static int parser_action_row406[] = {
1,
- -1, 1, 508
+ -1, 1, 501
};
-static int parser_action_row435[] = {
+static int parser_action_row407[] = {
1,
- -1, 1, 509
+ -1, 1, 502
};
-static int parser_action_row436[] = {
+static int parser_action_row408[] = {
1,
- -1, 1, 510
+ -1, 1, 503
};
-static int parser_action_row437[] = {
+static int parser_action_row409[] = {
1,
- -1, 1, 511
+ -1, 1, 504
};
-static int parser_action_row438[] = {
+static int parser_action_row410[] = {
1,
- -1, 1, 512
+ -1, 1, 505
};
-static int parser_action_row439[] = {
- 30,
- -1, 1, 513,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+static int parser_action_row411[] = {
+ 23,
+ -1, 1, 506,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row440[] = {
+static int parser_action_row412[] = {
1,
- -1, 1, 514
+ -1, 1, 507
};
-static int parser_action_row441[] = {
+static int parser_action_row413[] = {
1,
- -1, 1, 515
+ -1, 1, 508
};
-static int parser_action_row442[] = {
+static int parser_action_row414[] = {
1,
- -1, 1, 518
+ -1, 1, 511
};
-static int parser_action_row443[] = {
+static int parser_action_row415[] = {
1,
- -1, 1, 516
+ -1, 1, 509
};
-static int parser_action_row444[] = {
+static int parser_action_row416[] = {
1,
- -1, 1, 520
+ -1, 1, 513
};
-static int parser_action_row445[] = {
+static int parser_action_row417[] = {
1,
- -1, 1, 519
+ -1, 1, 512
};
-static int parser_action_row446[] = {
+static int parser_action_row418[] = {
1,
- -1, 1, 517
+ -1, 1, 510
};
-static int parser_action_row447[] = {
+static int parser_action_row419[] = {
1,
- -1, 1, 521
+ -1, 1, 514
};
-static int parser_action_row448[] = {
+static int parser_action_row420[] = {
1,
- -1, 1, 523
+ -1, 1, 516
};
-static int parser_action_row449[] = {
+static int parser_action_row421[] = {
4,
- -1, 1, 411,
- 54, 0, 628,
- 58, 0, 226,
- 94, 0, 216
+ -1, 1, 404,
+ 54, 0, 600,
+ 58, 0, 212,
+ 94, 0, 202
};
-static int parser_action_row450[] = {
+static int parser_action_row422[] = {
15,
-1, 1, 341,
- 52, 0, 295,
- 58, 0, 227,
- 59, 0, 636,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ 52, 0, 274,
+ 58, 0, 213,
+ 59, 0, 608,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row451[] = {
+static int parser_action_row423[] = {
1,
- -1, 1, 434
+ -1, 1, 427
};
-static int parser_action_row452[] = {
+static int parser_action_row424[] = {
1,
- -1, 1, 1009
+ -1, 1, 981
};
-static int parser_action_row453[] = {
+static int parser_action_row425[] = {
1,
- -1, 1, 1010
+ -1, 1, 982
};
-static int parser_action_row454[] = {
+static int parser_action_row426[] = {
1,
- -1, 1, 1018
+ -1, 1, 990
};
-static int parser_action_row455[] = {
+static int parser_action_row427[] = {
1,
- -1, 1, 1020
+ -1, 1, 992
};
-static int parser_action_row456[] = {
+static int parser_action_row428[] = {
1,
- -1, 1, 1019
+ -1, 1, 991
};
-static int parser_action_row457[] = {
+static int parser_action_row429[] = {
1,
- -1, 1, 1021
+ -1, 1, 993
};
-static int parser_action_row458[] = {
+static int parser_action_row430[] = {
1,
- -1, 1, 1022
+ -1, 1, 994
};
-static int parser_action_row459[] = {
+static int parser_action_row431[] = {
1,
- -1, 1, 1023
+ -1, 1, 995
};
-static int parser_action_row460[] = {
+static int parser_action_row432[] = {
1,
- -1, 1, 435
+ -1, 1, 428
};
-static int parser_action_row461[] = {
+static int parser_action_row433[] = {
3,
-1, 1, 324,
- 54, 0, 262,
- 73, 0, 637
+ 54, 0, 241,
+ 73, 0, 609
};
-static int parser_action_row462[] = {
+static int parser_action_row434[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row463[] = {
+static int parser_action_row435[] = {
1,
- -1, 1, 439
+ -1, 1, 432
};
-static int parser_action_row464[] = {
+static int parser_action_row436[] = {
4,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2,
- 56, 0, 639
+ 56, 0, 611
};
-static int parser_action_row465[] = {
+static int parser_action_row437[] = {
3,
- -1, 3, 464,
- 41, 0, 402,
- 98, 0, 273
+ -1, 3, 436,
+ 41, 0, 374,
+ 98, 0, 252
};
-static int parser_action_row466[] = {
+static int parser_action_row438[] = {
22,
- -1, 1, 461,
- 54, 0, 643,
- 74, 0, 644,
- 75, 0, 645,
- 76, 0, 431,
- 77, 0, 432,
- 78, 0, 433,
- 79, 0, 434,
- 80, 0, 435,
- 81, 0, 436,
- 82, 0, 437,
- 83, 0, 646,
- 84, 0, 439,
- 85, 0, 440,
- 86, 0, 441,
- 87, 0, 442,
- 88, 0, 443,
- 89, 0, 444,
- 90, 0, 445,
- 91, 0, 446,
- 92, 0, 447,
- 97, 0, 647
+ -1, 1, 454,
+ 54, 0, 615,
+ 74, 0, 616,
+ 75, 0, 617,
+ 76, 0, 403,
+ 77, 0, 404,
+ 78, 0, 405,
+ 79, 0, 406,
+ 80, 0, 407,
+ 81, 0, 408,
+ 82, 0, 409,
+ 83, 0, 618,
+ 84, 0, 411,
+ 85, 0, 412,
+ 86, 0, 413,
+ 87, 0, 414,
+ 88, 0, 415,
+ 89, 0, 416,
+ 90, 0, 417,
+ 91, 0, 418,
+ 92, 0, 419,
+ 97, 0, 619
};
-static int parser_action_row467[] = {
+static int parser_action_row439[] = {
1,
- -1, 1, 526
+ -1, 1, 519
};
-static int parser_action_row468[] = {
+static int parser_action_row440[] = {
1,
- -1, 1, 438
+ -1, 1, 431
};
-static int parser_action_row469[] = {
+static int parser_action_row441[] = {
1,
- -1, 1, 436
+ -1, 1, 429
};
-static int parser_action_row470[] = {
+static int parser_action_row442[] = {
23,
- -1, 1, 463,
- 54, 0, 643,
- 74, 0, 644,
- 75, 0, 645,
- 76, 0, 431,
- 77, 0, 432,
- 78, 0, 433,
- 79, 0, 434,
- 80, 0, 435,
- 81, 0, 436,
- 82, 0, 437,
- 83, 0, 646,
- 84, 0, 439,
- 85, 0, 440,
- 86, 0, 441,
- 87, 0, 442,
- 88, 0, 443,
- 89, 0, 444,
- 90, 0, 445,
- 91, 0, 446,
- 92, 0, 447,
- 96, 0, 53,
- 97, 0, 649
+ -1, 1, 456,
+ 54, 0, 615,
+ 74, 0, 616,
+ 75, 0, 617,
+ 76, 0, 403,
+ 77, 0, 404,
+ 78, 0, 405,
+ 79, 0, 406,
+ 80, 0, 407,
+ 81, 0, 408,
+ 82, 0, 409,
+ 83, 0, 618,
+ 84, 0, 411,
+ 85, 0, 412,
+ 86, 0, 413,
+ 87, 0, 414,
+ 88, 0, 415,
+ 89, 0, 416,
+ 90, 0, 417,
+ 91, 0, 418,
+ 92, 0, 419,
+ 96, 0, 53,
+ 97, 0, 621
};
-static int parser_action_row471[] = {
+static int parser_action_row443[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row472[] = {
+static int parser_action_row444[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row473[] = {
+static int parser_action_row445[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row474[] = {
+static int parser_action_row446[] = {
2,
-1, 1, 155,
- 57, 0, 357
+ 57, 0, 329
};
-static int parser_action_row475[] = {
+static int parser_action_row447[] = {
2,
- -1, 1, 393,
- 56, 0, 656
+ -1, 1, 386,
+ 56, 0, 628
};
-static int parser_action_row476[] = {
+static int parser_action_row448[] = {
1,
- -1, 1, 474
+ -1, 1, 467
};
-static int parser_action_row477[] = {
+static int parser_action_row449[] = {
1,
- -1, 1, 473
+ -1, 1, 466
};
-static int parser_action_row478[] = {
+static int parser_action_row450[] = {
1,
-1, 1, 218
};
-static int parser_action_row479[] = {
+static int parser_action_row451[] = {
1,
-1, 1, 237
};
-static int parser_action_row480[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row452[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row481[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row453[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row482[] = {
+static int parser_action_row454[] = {
1,
-1, 1, 82
};
-static int parser_action_row483[] = {
+static int parser_action_row455[] = {
1,
-1, 1, 84
};
-static int parser_action_row484[] = {
+static int parser_action_row456[] = {
1,
-1, 1, 83
};
-static int parser_action_row485[] = {
+static int parser_action_row457[] = {
1,
-1, 1, 85
};
-static int parser_action_row486[] = {
+static int parser_action_row458[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row487[] = {
+static int parser_action_row459[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row488[] = {
+static int parser_action_row460[] = {
1,
-1, 1, 32
};
-static int parser_action_row489[] = {
+static int parser_action_row461[] = {
2,
- -1, 3, 488,
- 5, 0, 663
+ -1, 3, 460,
+ 5, 0, 635
};
-static int parser_action_row490[] = {
+static int parser_action_row462[] = {
1,
-1, 1, 34
};
-static int parser_action_row491[] = {
+static int parser_action_row463[] = {
1,
-1, 1, 35
};
-static int parser_action_row492[] = {
+static int parser_action_row464[] = {
23,
- -1, 3, 491,
- 54, 0, 664,
- 74, 0, 665,
- 75, 0, 666,
- 76, 0, 667,
- 77, 0, 668,
- 78, 0, 669,
- 79, 0, 670,
- 80, 0, 671,
- 81, 0, 672,
- 82, 0, 673,
- 83, 0, 674,
- 84, 0, 675,
- 85, 0, 676,
- 86, 0, 677,
- 87, 0, 678,
- 88, 0, 679,
- 89, 0, 680,
- 90, 0, 681,
- 91, 0, 682,
- 92, 0, 683,
- 96, 0, 53,
- 97, 0, 684
+ -1, 3, 463,
+ 54, 0, 636,
+ 74, 0, 637,
+ 75, 0, 638,
+ 76, 0, 639,
+ 77, 0, 640,
+ 78, 0, 641,
+ 79, 0, 642,
+ 80, 0, 643,
+ 81, 0, 644,
+ 82, 0, 645,
+ 83, 0, 646,
+ 84, 0, 647,
+ 85, 0, 648,
+ 86, 0, 649,
+ 87, 0, 650,
+ 88, 0, 651,
+ 89, 0, 652,
+ 90, 0, 653,
+ 91, 0, 654,
+ 92, 0, 655,
+ 96, 0, 53,
+ 97, 0, 656
};
-static int parser_action_row493[] = {
+static int parser_action_row465[] = {
2,
- -1, 3, 492,
- 5, 0, 689
+ -1, 3, 464,
+ 5, 0, 661
};
-static int parser_action_row494[] = {
+static int parser_action_row466[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row495[] = {
+static int parser_action_row467[] = {
1,
-1, 1, 166
};
-static int parser_action_row496[] = {
+static int parser_action_row468[] = {
1,
- -1, 1, 1097
+ -1, 1, 1069
};
-static int parser_action_row497[] = {
- 38,
+static int parser_action_row469[] = {
+ 31,
-1, 1, 163,
12, 0, 31,
15, 0, 33,
36, 0, 42,
37, 0, 43,
38, 0, 44,
- 41, 1, 464,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
54, 0, 52,
96, 0, 53,
97, 0, 54,
- 98, 1, 464,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row498[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row470[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 537,
+ 97, 0, 509,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row499[] = {
+static int parser_action_row471[] = {
5,
- -1, 1, 464,
- 12, 0, 692,
- 46, 0, 693,
+ -1, 1, 457,
+ 12, 0, 664,
+ 46, 0, 665,
96, 0, 53,
- 97, 0, 694
+ 97, 0, 666
};
-static int parser_action_row500[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row472[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row501[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row473[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row502[] = {
- 32,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row474[] = {
+ 25,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 110, 1, 405,
- 111, 1, 405,
- 112, 0, 66
+ 103, 1, 398,
+ 104, 1, 398,
+ 105, 0, 59
};
-static int parser_action_row503[] = {
+static int parser_action_row475[] = {
1,
- -1, 1, 399
+ -1, 1, 392
};
-static int parser_action_row504[] = {
+static int parser_action_row476[] = {
1,
- -1, 1, 1103
+ -1, 1, 1075
};
-static int parser_action_row505[] = {
+static int parser_action_row477[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row506[] = {
+static int parser_action_row478[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row507[] = {
+static int parser_action_row479[] = {
1,
-1, 1, 348
};
-static int parser_action_row508[] = {
+static int parser_action_row480[] = {
1,
-1, 1, 191
};
-static int parser_action_row509[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row481[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row510[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row482[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row511[] = {
+static int parser_action_row483[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row512[] = {
+static int parser_action_row484[] = {
1,
-1, 1, 197
};
-static int parser_action_row513[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row485[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row514[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row486[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row515[] = {
+static int parser_action_row487[] = {
13,
-1, 1, 342,
- 59, 0, 708,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ 59, 0, 680,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row516[] = {
+static int parser_action_row488[] = {
1,
-1, 1, 188
};
-static int parser_action_row517[] = {
+static int parser_action_row489[] = {
1,
-1, 1, 199
};
-static int parser_action_row518[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row490[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row519[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row491[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row520[] = {
+static int parser_action_row492[] = {
13,
-1, 1, 346,
- 59, 0, 712,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ 59, 0, 684,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row521[] = {
+static int parser_action_row493[] = {
1,
-1, 1, 190
};
-static int parser_action_row522[] = {
- 31,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 510,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row494[] = {
+ 24,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 482,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row523[] = {
- 45,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 132,
+static int parser_action_row495[] = {
+ 38,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 125,
54, 1, 345,
- 59, 0, 715,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239,
+ 59, 0, 687,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225,
73, 1, 345,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row524[] = {
+static int parser_action_row496[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row525[] = {
+static int parser_action_row497[] = {
1,
-1, 1, 14
};
-static int parser_action_row526[] = {
+static int parser_action_row498[] = {
7,
- -1, 3, 525,
- 5, 0, 487,
- 6, 0, 488,
- 7, 0, 489,
- 8, 0, 490,
- 10, 0, 491,
- 17, 0, 492
+ -1, 3, 497,
+ 5, 0, 459,
+ 6, 0, 460,
+ 7, 0, 461,
+ 8, 0, 462,
+ 10, 0, 463,
+ 17, 0, 464
};
-static int parser_action_row527[] = {
+static int parser_action_row499[] = {
1,
- -1, 1, 490
+ -1, 1, 483
};
-static int parser_action_row528[] = {
+static int parser_action_row500[] = {
1,
-1, 1, 15
};
-static int parser_action_row529[] = {
- 31,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row501[] = {
+ 24,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
- 53, 0, 720,
+ 53, 0, 692,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 537,
+ 97, 0, 509,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row530[] = {
+static int parser_action_row502[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row531[] = {
+static int parser_action_row503[] = {
1,
- -1, 1, 718
+ -1, 1, 704
};
-static int parser_action_row532[] = {
+static int parser_action_row504[] = {
3,
- -1, 1, 753,
- 52, 0, 295,
- 73, 0, 723
+ -1, 1, 739,
+ 52, 0, 274,
+ 73, 0, 695
};
-static int parser_action_row533[] = {
+static int parser_action_row505[] = {
1,
- -1, 1, 750
+ -1, 1, 736
};
-static int parser_action_row534[] = {
+static int parser_action_row506[] = {
3,
- -1, 3, 533,
- 47, 0, 411,
- 96, 0, 412
+ -1, 3, 505,
+ 47, 0, 383,
+ 96, 0, 384
};
-static int parser_action_row535[] = {
+static int parser_action_row507[] = {
3,
- -1, 1, 755,
- 54, 1, 758,
- 73, 1, 758
+ -1, 1, 741,
+ 54, 1, 744,
+ 73, 1, 744
};
-static int parser_action_row536[] = {
+static int parser_action_row508[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row537[] = {
+static int parser_action_row509[] = {
9,
- -1, 1, 444,
- 0, 1, 447,
- 1, 1, 447,
- 9, 1, 447,
- 24, 1, 447,
- 53, 1, 447,
- 56, 1, 447,
- 95, 1, 447,
- 116, 1, 447
+ -1, 1, 437,
+ 0, 1, 440,
+ 1, 1, 440,
+ 9, 1, 440,
+ 24, 1, 440,
+ 53, 1, 440,
+ 56, 1, 440,
+ 95, 1, 440,
+ 109, 1, 440
};
-static int parser_action_row538[] = {
+static int parser_action_row510[] = {
4,
-1, 1, 341,
- 52, 0, 295,
- 58, 0, 227,
- 59, 0, 727
+ 52, 0, 274,
+ 58, 0, 213,
+ 59, 0, 699
};
-static int parser_action_row539[] = {
+static int parser_action_row511[] = {
2,
-1, 1, 366,
- 71, 0, 728
+ 71, 0, 700
};
-static int parser_action_row540[] = {
+static int parser_action_row512[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row541[] = {
+static int parser_action_row513[] = {
2,
- -1, 3, 540,
- 53, 0, 730
+ -1, 3, 512,
+ 53, 0, 702
};
-static int parser_action_row542[] = {
+static int parser_action_row514[] = {
1,
- -1, 1, 775
+ -1, 1, 761
};
-static int parser_action_row543[] = {
+static int parser_action_row515[] = {
1,
- -1, 1, 769
+ -1, 1, 755
};
-static int parser_action_row544[] = {
- 27,
- -1, 1, 464,
- 12, 0, 122,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row516[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 115,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row545[] = {
+static int parser_action_row517[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row546[] = {
- 27,
- -1, 1, 464,
- 12, 0, 122,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row518[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 115,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row547[] = {
- 27,
- -1, 1, 464,
- 12, 0, 122,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row519[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 115,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row548[] = {
+static int parser_action_row520[] = {
3,
- -1, 3, 547,
- 47, 0, 420,
- 96, 0, 421
+ -1, 3, 519,
+ 47, 0, 392,
+ 96, 0, 393
};
-static int parser_action_row549[] = {
- 26,
- -1, 1, 464,
- 12, 0, 122,
- 38, 0, 125,
- 40, 0, 126,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row521[] = {
+ 19,
+ -1, 1, 457,
+ 12, 0, 115,
+ 38, 0, 118,
+ 40, 0, 119,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row550[] = {
- 26,
- -1, 1, 464,
- 12, 0, 122,
- 38, 0, 125,
- 40, 0, 126,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row522[] = {
+ 19,
+ -1, 1, 457,
+ 12, 0, 115,
+ 38, 0, 118,
+ 40, 0, 119,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row551[] = {
- 26,
- -1, 1, 464,
- 12, 0, 122,
- 38, 0, 125,
- 40, 0, 126,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row523[] = {
+ 19,
+ -1, 1, 457,
+ 12, 0, 115,
+ 38, 0, 118,
+ 40, 0, 119,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row552[] = {
- 26,
- -1, 1, 464,
- 12, 0, 122,
- 38, 0, 125,
- 40, 0, 126,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row524[] = {
+ 19,
+ -1, 1, 457,
+ 12, 0, 115,
+ 38, 0, 118,
+ 40, 0, 119,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row553[] = {
- 26,
- -1, 1, 464,
- 12, 0, 122,
- 38, 0, 125,
- 40, 0, 126,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row525[] = {
+ 19,
+ -1, 1, 457,
+ 12, 0, 115,
+ 38, 0, 118,
+ 40, 0, 119,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row554[] = {
- 26,
- -1, 1, 464,
- 12, 0, 122,
- 38, 0, 125,
- 40, 0, 126,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row526[] = {
+ 19,
+ -1, 1, 457,
+ 12, 0, 115,
+ 38, 0, 118,
+ 40, 0, 119,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row555[] = {
- 26,
- -1, 1, 464,
- 12, 0, 122,
- 38, 0, 125,
- 40, 0, 126,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row527[] = {
+ 19,
+ -1, 1, 457,
+ 12, 0, 115,
+ 38, 0, 118,
+ 40, 0, 119,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row556[] = {
- 26,
- -1, 1, 464,
- 12, 0, 122,
- 38, 0, 125,
- 40, 0, 126,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row528[] = {
+ 19,
+ -1, 1, 457,
+ 12, 0, 115,
+ 38, 0, 118,
+ 40, 0, 119,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row557[] = {
- 26,
- -1, 1, 464,
- 12, 0, 122,
- 38, 0, 125,
- 40, 0, 126,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row529[] = {
+ 19,
+ -1, 1, 457,
+ 12, 0, 115,
+ 38, 0, 118,
+ 40, 0, 119,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row558[] = {
- 26,
- -1, 1, 464,
- 12, 0, 122,
- 38, 0, 125,
- 40, 0, 126,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row530[] = {
+ 19,
+ -1, 1, 457,
+ 12, 0, 115,
+ 38, 0, 118,
+ 40, 0, 119,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row559[] = {
- 26,
- -1, 1, 464,
- 12, 0, 122,
- 38, 0, 125,
- 40, 0, 126,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row531[] = {
+ 19,
+ -1, 1, 457,
+ 12, 0, 115,
+ 38, 0, 118,
+ 40, 0, 119,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row560[] = {
- 26,
- -1, 1, 464,
- 12, 0, 122,
- 38, 0, 125,
- 40, 0, 126,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row532[] = {
+ 19,
+ -1, 1, 457,
+ 12, 0, 115,
+ 38, 0, 118,
+ 40, 0, 119,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row561[] = {
- 26,
- -1, 1, 464,
- 12, 0, 122,
- 38, 0, 125,
- 40, 0, 126,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row533[] = {
+ 19,
+ -1, 1, 457,
+ 12, 0, 115,
+ 38, 0, 118,
+ 40, 0, 119,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row562[] = {
- 26,
- -1, 1, 464,
- 12, 0, 122,
- 38, 0, 125,
- 40, 0, 126,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row534[] = {
+ 19,
+ -1, 1, 457,
+ 12, 0, 115,
+ 38, 0, 118,
+ 40, 0, 119,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row563[] = {
- 26,
- -1, 1, 464,
- 12, 0, 122,
- 38, 0, 125,
- 40, 0, 126,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row535[] = {
+ 19,
+ -1, 1, 457,
+ 12, 0, 115,
+ 38, 0, 118,
+ 40, 0, 119,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row564[] = {
- 26,
- -1, 1, 464,
- 12, 0, 122,
- 38, 0, 125,
- 40, 0, 126,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row536[] = {
+ 19,
+ -1, 1, 457,
+ 12, 0, 115,
+ 38, 0, 118,
+ 40, 0, 119,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row565[] = {
- 26,
- -1, 1, 464,
- 12, 0, 122,
- 38, 0, 125,
- 40, 0, 126,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row537[] = {
+ 19,
+ -1, 1, 457,
+ 12, 0, 115,
+ 38, 0, 118,
+ 40, 0, 119,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row566[] = {
- 26,
- -1, 1, 464,
- 12, 0, 122,
- 38, 0, 125,
- 40, 0, 126,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row538[] = {
+ 19,
+ -1, 1, 457,
+ 12, 0, 115,
+ 38, 0, 118,
+ 40, 0, 119,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row567[] = {
+static int parser_action_row539[] = {
5,
- -1, 1, 464,
- 12, 0, 754,
- 46, 0, 755,
+ -1, 1, 457,
+ 12, 0, 726,
+ 46, 0, 727,
96, 0, 53,
- 97, 0, 756
+ 97, 0, 728
};
-static int parser_action_row568[] = {
+static int parser_action_row540[] = {
1,
- -1, 1, 773
+ -1, 1, 759
};
-static int parser_action_row569[] = {
+static int parser_action_row541[] = {
2,
- -1, 1, 772,
- 52, 0, 295
+ -1, 1, 758,
+ 52, 0, 274
};
-static int parser_action_row570[] = {
- 37,
- -1, 1, 464,
- 9, 0, 761,
+static int parser_action_row542[] = {
+ 30,
+ -1, 1, 457,
+ 9, 0, 733,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row571[] = {
+static int parser_action_row543[] = {
4,
- -1, 3, 570,
+ -1, 3, 542,
0, 0, 1,
1, 0, 2,
95, 0, 3
};
-static int parser_action_row572[] = {
+static int parser_action_row544[] = {
3,
- -1, 3, 571,
- 47, 0, 420,
- 96, 0, 421
+ -1, 3, 543,
+ 47, 0, 392,
+ 96, 0, 393
};
-static int parser_action_row573[] = {
+static int parser_action_row545[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row574[] = {
+static int parser_action_row546[] = {
2,
-1, 1, 204,
- 59, 0, 765
+ 59, 0, 737
};
-static int parser_action_row575[] = {
+static int parser_action_row547[] = {
2,
- -1, 3, 574,
- 23, 0, 766
+ -1, 3, 546,
+ 23, 0, 738
};
-static int parser_action_row576[] = {
+static int parser_action_row548[] = {
2,
- -1, 3, 575,
- 15, 0, 767
+ -1, 3, 547,
+ 15, 0, 739
};
-static int parser_action_row577[] = {
+static int parser_action_row549[] = {
2,
- -1, 3, 576,
- 97, 0, 365
+ -1, 3, 548,
+ 97, 0, 337
};
-static int parser_action_row578[] = {
+static int parser_action_row550[] = {
2,
- -1, 3, 577,
- 28, 0, 769
+ -1, 3, 549,
+ 28, 0, 741
};
-static int parser_action_row579[] = {
+static int parser_action_row551[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row580[] = {
+static int parser_action_row552[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row581[] = {
+static int parser_action_row553[] = {
1,
-1, 1, 291
};
-static int parser_action_row582[] = {
+static int parser_action_row554[] = {
3,
-1, 1, 326,
- 52, 0, 295,
- 73, 0, 621
+ 52, 0, 274,
+ 73, 0, 593
};
-static int parser_action_row583[] = {
+static int parser_action_row555[] = {
1,
-1, 1, 323
};
-static int parser_action_row584[] = {
+static int parser_action_row556[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row585[] = {
+static int parser_action_row557[] = {
3,
-1, 1, 328,
54, 1, 331,
73, 1, 331
};
-static int parser_action_row586[] = {
- 29,
- -1, 1, 464,
- 12, 0, 182,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row558[] = {
+ 22,
+ -1, 1, 457,
+ 12, 0, 168,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row587[] = {
+static int parser_action_row559[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row588[] = {
- 29,
- -1, 1, 464,
- 12, 0, 182,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row560[] = {
+ 22,
+ -1, 1, 457,
+ 12, 0, 168,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row589[] = {
- 29,
- -1, 1, 464,
- 12, 0, 182,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row561[] = {
+ 22,
+ -1, 1, 457,
+ 12, 0, 168,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row590[] = {
+static int parser_action_row562[] = {
3,
- -1, 3, 589,
- 47, 0, 420,
- 96, 0, 421
+ -1, 3, 561,
+ 47, 0, 392,
+ 96, 0, 393
};
-static int parser_action_row591[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row563[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row592[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row564[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row593[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row565[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row594[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row566[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row595[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row567[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row596[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row568[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row597[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row569[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row598[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row570[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row599[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row571[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row600[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row572[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row601[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row573[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row602[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row574[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row603[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row575[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row604[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row576[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row605[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row577[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row606[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row578[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row607[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row579[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row608[] = {
- 28,
- -1, 1, 464,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row580[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row609[] = {
+static int parser_action_row581[] = {
5,
- -1, 1, 464,
- 12, 0, 797,
- 46, 0, 693,
+ -1, 1, 457,
+ 12, 0, 769,
+ 46, 0, 665,
96, 0, 53,
- 97, 0, 798
+ 97, 0, 770
};
-static int parser_action_row610[] = {
+static int parser_action_row582[] = {
1,
-1, 1, 342
};
-static int parser_action_row611[] = {
+static int parser_action_row583[] = {
1,
-1, 1, 346
};
-static int parser_action_row612[] = {
+static int parser_action_row584[] = {
2,
-1, 1, 345,
- 52, 0, 295
+ 52, 0, 274
};
-static int parser_action_row613[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row585[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 613,
+ 9, 0, 585,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row614[] = {
+static int parser_action_row586[] = {
1,
-1, 1, 158
};
-static int parser_action_row615[] = {
+static int parser_action_row587[] = {
1,
-1, 1, 278
};
-static int parser_action_row616[] = {
- 37,
- -1, 1, 464,
- 9, 0, 804,
+static int parser_action_row588[] = {
+ 30,
+ -1, 1, 457,
+ 9, 0, 776,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row617[] = {
+static int parser_action_row589[] = {
3,
- -1, 1, 815,
- 54, 0, 806,
- 94, 0, 618
+ -1, 1, 794,
+ 54, 0, 778,
+ 94, 0, 590
};
-static int parser_action_row618[] = {
+static int parser_action_row590[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row619[] = {
+static int parser_action_row591[] = {
3,
-1, 1, 30,
13, 0, 32,
- 52, 0, 809
+ 52, 0, 781
};
-static int parser_action_row620[] = {
+static int parser_action_row592[] = {
1,
- -1, 1, 814
+ -1, 1, 793
};
-static int parser_action_row621[] = {
+static int parser_action_row593[] = {
1,
- -1, 1, 634
+ -1, 1, 620
};
-static int parser_action_row622[] = {
+static int parser_action_row594[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row623[] = {
+static int parser_action_row595[] = {
2,
-1, 1, 30,
13, 0, 32
};
-static int parser_action_row624[] = {
+static int parser_action_row596[] = {
4,
- -1, 3, 623,
- 6, 0, 816,
- 17, 0, 817,
- 97, 0, 818
+ -1, 3, 595,
+ 6, 0, 788,
+ 17, 0, 789,
+ 97, 0, 790
};
-static int parser_action_row625[] = {
+static int parser_action_row597[] = {
2,
- -1, 3, 624,
- 59, 0, 820
+ -1, 3, 596,
+ 59, 0, 792
};
-static int parser_action_row626[] = {
+static int parser_action_row598[] = {
2,
-1, 1, 155,
- 57, 0, 357
+ 57, 0, 329
};
-static int parser_action_row627[] = {
+static int parser_action_row599[] = {
2,
- -1, 3, 626,
- 15, 0, 822
+ -1, 3, 598,
+ 15, 0, 794
};
-static int parser_action_row628[] = {
+static int parser_action_row600[] = {
3,
- -1, 1, 411,
- 54, 0, 823,
- 94, 0, 216
+ -1, 1, 404,
+ 54, 0, 795,
+ 94, 0, 202
};
-static int parser_action_row629[] = {
+static int parser_action_row601[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row630[] = {
+static int parser_action_row602[] = {
1,
-1, 1, 146
};
-static int parser_action_row631[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row603[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row632[] = {
+static int parser_action_row604[] = {
1,
- -1, 1, 1012
+ -1, 1, 984
};
-static int parser_action_row633[] = {
+static int parser_action_row605[] = {
1,
- -1, 1, 1017
+ -1, 1, 989
};
-static int parser_action_row634[] = {
+static int parser_action_row606[] = {
1,
- -1, 1, 1014
+ -1, 1, 986
};
-static int parser_action_row635[] = {
+static int parser_action_row607[] = {
3,
- -1, 3, 634,
- 47, 0, 420,
- 96, 0, 421
+ -1, 3, 606,
+ 47, 0, 392,
+ 96, 0, 393
};
-static int parser_action_row636[] = {
+static int parser_action_row608[] = {
2,
- -1, 1, 522,
- 59, 0, 828
+ -1, 1, 515,
+ 59, 0, 800
};
-static int parser_action_row637[] = {
- 32,
- -1, 1, 524,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+static int parser_action_row609[] = {
+ 25,
+ -1, 1, 517,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row638[] = {
+static int parser_action_row610[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row639[] = {
+static int parser_action_row611[] = {
2,
- -1, 3, 638,
- 53, 0, 830
+ -1, 3, 610,
+ 53, 0, 802
};
-static int parser_action_row640[] = {
+static int parser_action_row612[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row641[] = {
+static int parser_action_row613[] = {
1,
- -1, 1, 1098
+ -1, 1, 1070
};
-static int parser_action_row642[] = {
+static int parser_action_row614[] = {
2,
- -1, 3, 641,
- 53, 0, 832
+ -1, 3, 613,
+ 53, 0, 804
};
-static int parser_action_row643[] = {
+static int parser_action_row615[] = {
2,
- -1, 1, 391,
- 56, 0, 639
+ -1, 1, 384,
+ 56, 0, 611
};
-static int parser_action_row644[] = {
+static int parser_action_row616[] = {
2,
- -1, 3, 643,
- 55, 0, 635
+ -1, 3, 615,
+ 55, 0, 607
};
-static int parser_action_row645[] = {
+static int parser_action_row617[] = {
1,
- -1, 1, 504
+ -1, 1, 497
};
-static int parser_action_row646[] = {
+static int parser_action_row618[] = {
1,
- -1, 1, 505
+ -1, 1, 498
};
-static int parser_action_row647[] = {
+static int parser_action_row619[] = {
1,
- -1, 1, 513
+ -1, 1, 506
};
-static int parser_action_row648[] = {
+static int parser_action_row620[] = {
14,
-1, 1, 343,
- 52, 0, 295,
- 59, 0, 834,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ 52, 0, 274,
+ 59, 0, 806,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row649[] = {
+static int parser_action_row621[] = {
1,
- -1, 1, 527
+ -1, 1, 520
};
-static int parser_action_row650[] = {
+static int parser_action_row622[] = {
15,
-1, 1, 347,
- 52, 0, 295,
- 58, 0, 227,
- 59, 0, 835,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ 52, 0, 274,
+ 58, 0, 213,
+ 59, 0, 807,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row651[] = {
+static int parser_action_row623[] = {
22,
- -1, 1, 462,
- 54, 0, 643,
- 74, 0, 644,
- 75, 0, 645,
- 76, 0, 431,
- 77, 0, 432,
- 78, 0, 433,
- 79, 0, 434,
- 80, 0, 435,
- 81, 0, 436,
- 82, 0, 437,
- 83, 0, 646,
- 84, 0, 439,
- 85, 0, 440,
- 86, 0, 441,
- 87, 0, 442,
- 88, 0, 443,
- 89, 0, 444,
- 90, 0, 445,
- 91, 0, 446,
- 92, 0, 447,
- 97, 0, 836
+ -1, 1, 455,
+ 54, 0, 615,
+ 74, 0, 616,
+ 75, 0, 617,
+ 76, 0, 403,
+ 77, 0, 404,
+ 78, 0, 405,
+ 79, 0, 406,
+ 80, 0, 407,
+ 81, 0, 408,
+ 82, 0, 409,
+ 83, 0, 618,
+ 84, 0, 411,
+ 85, 0, 412,
+ 86, 0, 413,
+ 87, 0, 414,
+ 88, 0, 415,
+ 89, 0, 416,
+ 90, 0, 417,
+ 91, 0, 418,
+ 92, 0, 419,
+ 97, 0, 808
};
-static int parser_action_row652[] = {
+static int parser_action_row624[] = {
1,
- -1, 1, 529
+ -1, 1, 522
};
-static int parser_action_row653[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row625[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row654[] = {
+static int parser_action_row626[] = {
3,
- -1, 3, 653,
- 52, 0, 364,
- 97, 0, 365
+ -1, 3, 625,
+ 52, 0, 336,
+ 97, 0, 337
};
-static int parser_action_row655[] = {
+static int parser_action_row627[] = {
2,
- -1, 1, 396,
- 72, 0, 840
+ -1, 1, 389,
+ 72, 0, 812
};
-static int parser_action_row656[] = {
+static int parser_action_row628[] = {
2,
- -1, 3, 655,
- 55, 0, 841
+ -1, 3, 627,
+ 55, 0, 813
};
-static int parser_action_row657[] = {
+static int parser_action_row629[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row658[] = {
+static int parser_action_row630[] = {
1,
- -1, 1, 1100
+ -1, 1, 1072
};
-static int parser_action_row659[] = {
+static int parser_action_row631[] = {
2,
- -1, 1, 394,
- 56, 0, 656
+ -1, 1, 387,
+ 56, 0, 628
};
-static int parser_action_row660[] = {
+static int parser_action_row632[] = {
1,
-1, 1, 217
};
-static int parser_action_row661[] = {
+static int parser_action_row633[] = {
1,
-1, 1, 236
};
-static int parser_action_row662[] = {
+static int parser_action_row634[] = {
3,
- -1, 3, 661,
- 58, 0, 844,
- 97, 0, 845
+ -1, 3, 633,
+ 58, 0, 816,
+ 97, 0, 817
};
-static int parser_action_row663[] = {
+static int parser_action_row635[] = {
4,
- -1, 3, 662,
- 9, 0, 848,
- 58, 0, 844,
- 97, 0, 845
+ -1, 3, 634,
+ 9, 0, 820,
+ 58, 0, 816,
+ 97, 0, 817
};
-static int parser_action_row664[] = {
+static int parser_action_row636[] = {
1,
-1, 1, 33
};
-static int parser_action_row665[] = {
+static int parser_action_row637[] = {
2,
- -1, 3, 664,
- 55, 0, 850
+ -1, 3, 636,
+ 55, 0, 822
};
-static int parser_action_row666[] = {
+static int parser_action_row638[] = {
1,
-1, 1, 86
};
-static int parser_action_row667[] = {
+static int parser_action_row639[] = {
1,
-1, 1, 87
};
-static int parser_action_row668[] = {
+static int parser_action_row640[] = {
1,
-1, 1, 88
};
-static int parser_action_row669[] = {
+static int parser_action_row641[] = {
1,
-1, 1, 89
};
-static int parser_action_row670[] = {
+static int parser_action_row642[] = {
1,
-1, 1, 90
};
-static int parser_action_row671[] = {
+static int parser_action_row643[] = {
1,
-1, 1, 91
};
-static int parser_action_row672[] = {
+static int parser_action_row644[] = {
1,
-1, 1, 92
};
-static int parser_action_row673[] = {
+static int parser_action_row645[] = {
1,
-1, 1, 93
};
-static int parser_action_row674[] = {
+static int parser_action_row646[] = {
1,
-1, 1, 94
};
-static int parser_action_row675[] = {
+static int parser_action_row647[] = {
1,
-1, 1, 95
};
-static int parser_action_row676[] = {
+static int parser_action_row648[] = {
1,
-1, 1, 96
};
-static int parser_action_row677[] = {
+static int parser_action_row649[] = {
1,
-1, 1, 97
};
-static int parser_action_row678[] = {
+static int parser_action_row650[] = {
1,
-1, 1, 100
};
-static int parser_action_row679[] = {
+static int parser_action_row651[] = {
1,
-1, 1, 98
};
-static int parser_action_row680[] = {
+static int parser_action_row652[] = {
1,
-1, 1, 102
};
-static int parser_action_row681[] = {
+static int parser_action_row653[] = {
1,
-1, 1, 101
};
-static int parser_action_row682[] = {
+static int parser_action_row654[] = {
1,
-1, 1, 99
};
-static int parser_action_row683[] = {
+static int parser_action_row655[] = {
1,
-1, 1, 103
};
-static int parser_action_row684[] = {
+static int parser_action_row656[] = {
1,
-1, 1, 105
};
-static int parser_action_row685[] = {
+static int parser_action_row657[] = {
3,
-1, 1, 108,
- 58, 0, 227,
- 59, 0, 851
+ 58, 0, 213,
+ 59, 0, 823
};
-static int parser_action_row686[] = {
+static int parser_action_row658[] = {
1,
- -1, 1, 469
+ -1, 1, 462
};
-static int parser_action_row687[] = {
+static int parser_action_row659[] = {
5,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2,
- 52, 0, 852,
- 57, 0, 853
+ 52, 0, 824,
+ 57, 0, 825
};
-static int parser_action_row688[] = {
+static int parser_action_row660[] = {
22,
- -1, 3, 687,
- 54, 0, 664,
- 74, 0, 665,
- 75, 0, 666,
- 76, 0, 667,
- 77, 0, 668,
- 78, 0, 669,
- 79, 0, 670,
- 80, 0, 671,
- 81, 0, 672,
- 82, 0, 673,
- 83, 0, 674,
- 84, 0, 675,
- 85, 0, 676,
- 86, 0, 677,
- 87, 0, 678,
- 88, 0, 679,
- 89, 0, 680,
- 90, 0, 681,
- 91, 0, 682,
- 92, 0, 683,
- 97, 0, 857
+ -1, 3, 659,
+ 54, 0, 636,
+ 74, 0, 637,
+ 75, 0, 638,
+ 76, 0, 639,
+ 77, 0, 640,
+ 78, 0, 641,
+ 79, 0, 642,
+ 80, 0, 643,
+ 81, 0, 644,
+ 82, 0, 645,
+ 83, 0, 646,
+ 84, 0, 647,
+ 85, 0, 648,
+ 86, 0, 649,
+ 87, 0, 650,
+ 88, 0, 651,
+ 89, 0, 652,
+ 90, 0, 653,
+ 91, 0, 654,
+ 92, 0, 655,
+ 97, 0, 829
};
-static int parser_action_row689[] = {
+static int parser_action_row661[] = {
23,
- -1, 3, 688,
- 54, 0, 664,
- 74, 0, 665,
- 75, 0, 666,
- 76, 0, 667,
- 77, 0, 668,
- 78, 0, 669,
- 79, 0, 670,
- 80, 0, 671,
- 81, 0, 672,
- 82, 0, 673,
- 83, 0, 674,
- 84, 0, 675,
- 85, 0, 676,
- 86, 0, 677,
- 87, 0, 678,
- 88, 0, 679,
- 89, 0, 680,
- 90, 0, 681,
- 91, 0, 682,
- 92, 0, 683,
- 96, 0, 53,
- 97, 0, 684
+ -1, 3, 660,
+ 54, 0, 636,
+ 74, 0, 637,
+ 75, 0, 638,
+ 76, 0, 639,
+ 77, 0, 640,
+ 78, 0, 641,
+ 79, 0, 642,
+ 80, 0, 643,
+ 81, 0, 644,
+ 82, 0, 645,
+ 83, 0, 646,
+ 84, 0, 647,
+ 85, 0, 648,
+ 86, 0, 649,
+ 87, 0, 650,
+ 88, 0, 651,
+ 89, 0, 652,
+ 90, 0, 653,
+ 91, 0, 654,
+ 92, 0, 655,
+ 96, 0, 53,
+ 97, 0, 656
};
-static int parser_action_row690[] = {
+static int parser_action_row662[] = {
1,
-1, 1, 36
};
-static int parser_action_row691[] = {
+static int parser_action_row663[] = {
3,
- -1, 3, 690,
- 96, 0, 861,
- 97, 0, 862
+ -1, 3, 662,
+ 96, 0, 833,
+ 97, 0, 834
};
-static int parser_action_row692[] = {
+static int parser_action_row664[] = {
2,
- -1, 3, 691,
- 55, 0, 866
+ -1, 3, 663,
+ 55, 0, 838
};
-static int parser_action_row693[] = {
- 33,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 132,
+static int parser_action_row665[] = {
+ 26,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 125,
54, 1, 351,
73, 1, 351,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row694[] = {
+static int parser_action_row666[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row695[] = {
- 46,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 132,
+static int parser_action_row667[] = {
+ 39,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 125,
54, 1, 333,
- 58, 0, 227,
- 59, 0, 870,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239,
+ 58, 0, 213,
+ 59, 0, 842,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225,
73, 1, 333,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row696[] = {
+static int parser_action_row668[] = {
2,
- -1, 3, 695,
- 98, 0, 874
+ -1, 3, 667,
+ 98, 0, 846
};
-static int parser_action_row697[] = {
+static int parser_action_row669[] = {
3,
- -1, 1, 461,
- 12, 0, 875,
- 97, 0, 876
+ -1, 1, 454,
+ 12, 0, 847,
+ 97, 0, 848
};
-static int parser_action_row698[] = {
+static int parser_action_row670[] = {
4,
- -1, 1, 463,
- 12, 0, 877,
+ -1, 1, 456,
+ 12, 0, 849,
96, 0, 53,
- 97, 0, 878
+ 97, 0, 850
};
-static int parser_action_row699[] = {
+static int parser_action_row671[] = {
1,
-1, 1, 225
};
-static int parser_action_row700[] = {
+static int parser_action_row672[] = {
1,
-1, 1, 244
};
-static int parser_action_row701[] = {
+static int parser_action_row673[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row702[] = {
+static int parser_action_row674[] = {
1,
- -1, 1, 400
+ -1, 1, 393
};
-static int parser_action_row703[] = {
+static int parser_action_row675[] = {
1,
- -1, 1, 401
+ -1, 1, 394
};
-static int parser_action_row704[] = {
+static int parser_action_row676[] = {
1,
-1, 1, 208
};
-static int parser_action_row705[] = {
+static int parser_action_row677[] = {
1,
-1, 1, 227
};
-static int parser_action_row706[] = {
- 31,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row678[] = {
+ 24,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
- 53, 0, 881,
+ 53, 0, 853,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 537,
+ 97, 0, 509,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row707[] = {
+static int parser_action_row679[] = {
1,
-1, 1, 220
};
-static int parser_action_row708[] = {
+static int parser_action_row680[] = {
1,
-1, 1, 239
};
-static int parser_action_row709[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row681[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row710[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row682[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row711[] = {
+static int parser_action_row683[] = {
1,
-1, 1, 224
};
-static int parser_action_row712[] = {
+static int parser_action_row684[] = {
1,
-1, 1, 243
};
-static int parser_action_row713[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row685[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row714[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row686[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row715[] = {
+static int parser_action_row687[] = {
1,
-1, 1, 198
};
-static int parser_action_row716[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row688[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row717[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row689[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row718[] = {
+static int parser_action_row690[] = {
13,
-1, 1, 344,
- 59, 0, 889,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ 59, 0, 861,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row719[] = {
+static int parser_action_row691[] = {
1,
-1, 1, 189
};
-static int parser_action_row720[] = {
+static int parser_action_row692[] = {
1,
-1, 1, 140
};
-static int parser_action_row721[] = {
+static int parser_action_row693[] = {
1,
- -1, 1, 444
+ -1, 1, 437
};
-static int parser_action_row722[] = {
+static int parser_action_row694[] = {
2,
- -1, 3, 721,
- 53, 0, 891
+ -1, 3, 693,
+ 53, 0, 863
};
-static int parser_action_row723[] = {
+static int parser_action_row695[] = {
2,
- -1, 3, 722,
- 23, 0, 892
+ -1, 3, 694,
+ 23, 0, 864
};
-static int parser_action_row724[] = {
+static int parser_action_row696[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row725[] = {
+static int parser_action_row697[] = {
1,
- -1, 1, 752
+ -1, 1, 738
};
-static int parser_action_row726[] = {
+static int parser_action_row698[] = {
2,
- -1, 3, 725,
- 73, 0, 723
+ -1, 3, 697,
+ 73, 0, 695
};
-static int parser_action_row727[] = {
+static int parser_action_row699[] = {
5,
- -1, 1, 464,
- 12, 0, 754,
- 46, 0, 755,
+ -1, 1, 457,
+ 12, 0, 726,
+ 46, 0, 727,
96, 0, 53,
- 97, 0, 756
+ 97, 0, 728
};
-static int parser_action_row728[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row700[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row729[] = {
+static int parser_action_row701[] = {
1,
-1, 1, 367
};
-static int parser_action_row730[] = {
+static int parser_action_row702[] = {
2,
- -1, 1, 450,
- 56, 0, 896
+ -1, 1, 443,
+ 56, 0, 868
};
-static int parser_action_row731[] = {
+static int parser_action_row703[] = {
9,
- -1, 1, 443,
- 0, 1, 445,
- 1, 1, 445,
- 9, 1, 445,
- 24, 1, 445,
- 53, 1, 445,
- 56, 1, 445,
- 95, 1, 445,
- 116, 1, 445
+ -1, 1, 436,
+ 0, 1, 438,
+ 1, 1, 438,
+ 9, 1, 438,
+ 24, 1, 438,
+ 53, 1, 438,
+ 56, 1, 438,
+ 95, 1, 438,
+ 109, 1, 438
};
-static int parser_action_row732[] = {
+static int parser_action_row704[] = {
1,
- -1, 1, 714
+ -1, 1, 700
};
-static int parser_action_row733[] = {
- 27,
- -1, 1, 464,
- 12, 0, 122,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row705[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 115,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row734[] = {
+static int parser_action_row706[] = {
1,
- -1, 1, 713
+ -1, 1, 699
};
-static int parser_action_row735[] = {
+static int parser_action_row707[] = {
1,
- -1, 1, 716
+ -1, 1, 702
};
-static int parser_action_row736[] = {
+static int parser_action_row708[] = {
1,
- -1, 1, 727
+ -1, 1, 713
};
-static int parser_action_row737[] = {
+static int parser_action_row709[] = {
2,
- -1, 1, 729,
- 81, 0, 339
+ -1, 1, 715,
+ 81, 0, 311
};
-static int parser_action_row738[] = {
+static int parser_action_row710[] = {
2,
- -1, 1, 720,
- 80, 0, 331
+ -1, 1, 706,
+ 80, 0, 303
};
-static int parser_action_row739[] = {
+static int parser_action_row711[] = {
2,
- -1, 1, 721,
- 80, 0, 331
+ -1, 1, 707,
+ 80, 0, 303
};
-static int parser_action_row740[] = {
+static int parser_action_row712[] = {
2,
- -1, 1, 722,
- 80, 0, 331
+ -1, 1, 708,
+ 80, 0, 303
};
-static int parser_action_row741[] = {
+static int parser_action_row713[] = {
2,
- -1, 1, 723,
- 80, 0, 331
+ -1, 1, 709,
+ 80, 0, 303
};
-static int parser_action_row742[] = {
+static int parser_action_row714[] = {
2,
- -1, 1, 724,
- 80, 0, 331
+ -1, 1, 710,
+ 80, 0, 303
};
-static int parser_action_row743[] = {
+static int parser_action_row715[] = {
2,
- -1, 1, 725,
- 80, 0, 331
+ -1, 1, 711,
+ 80, 0, 303
};
-static int parser_action_row744[] = {
+static int parser_action_row716[] = {
2,
- -1, 1, 726,
- 80, 0, 331
+ -1, 1, 712,
+ 80, 0, 303
};
-static int parser_action_row745[] = {
+static int parser_action_row717[] = {
2,
- -1, 1, 731,
- 82, 0, 340
+ -1, 1, 717,
+ 82, 0, 312
};
-static int parser_action_row746[] = {
+static int parser_action_row718[] = {
3,
- -1, 1, 733,
- 88, 0, 341,
- 91, 0, 342
+ -1, 1, 719,
+ 88, 0, 313,
+ 91, 0, 314
};
-static int parser_action_row747[] = {
+static int parser_action_row719[] = {
3,
- -1, 1, 735,
- 74, 0, 343,
- 75, 0, 344
+ -1, 1, 721,
+ 74, 0, 315,
+ 75, 0, 316
};
-static int parser_action_row748[] = {
+static int parser_action_row720[] = {
3,
- -1, 1, 736,
- 74, 0, 343,
- 75, 0, 344
+ -1, 1, 722,
+ 74, 0, 315,
+ 75, 0, 316
};
-static int parser_action_row749[] = {
+static int parser_action_row721[] = {
4,
- -1, 1, 738,
- 76, 0, 345,
- 78, 0, 346,
- 79, 0, 347
+ -1, 1, 724,
+ 76, 0, 317,
+ 78, 0, 318,
+ 79, 0, 319
};
-static int parser_action_row750[] = {
+static int parser_action_row722[] = {
4,
- -1, 1, 739,
- 76, 0, 345,
- 78, 0, 346,
- 79, 0, 347
+ -1, 1, 725,
+ 76, 0, 317,
+ 78, 0, 318,
+ 79, 0, 319
};
-static int parser_action_row751[] = {
+static int parser_action_row723[] = {
1,
- -1, 1, 741
+ -1, 1, 727
};
-static int parser_action_row752[] = {
+static int parser_action_row724[] = {
1,
- -1, 1, 742
+ -1, 1, 728
};
-static int parser_action_row753[] = {
+static int parser_action_row725[] = {
1,
- -1, 1, 743
+ -1, 1, 729
};
-static int parser_action_row754[] = {
+static int parser_action_row726[] = {
1,
- -1, 1, 745
+ -1, 1, 731
};
-static int parser_action_row755[] = {
+static int parser_action_row727[] = {
2,
- -1, 1, 778,
- 52, 0, 295
+ -1, 1, 764,
+ 52, 0, 274
};
-static int parser_action_row756[] = {
+static int parser_action_row728[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row757[] = {
+static int parser_action_row729[] = {
3,
- -1, 1, 760,
- 52, 0, 295,
- 58, 0, 227
+ -1, 1, 746,
+ 52, 0, 274,
+ 58, 0, 213
};
-static int parser_action_row758[] = {
+static int parser_action_row730[] = {
2,
- -1, 3, 757,
- 98, 0, 903
+ -1, 3, 729,
+ 98, 0, 875
};
-static int parser_action_row759[] = {
+static int parser_action_row731[] = {
2,
- -1, 1, 461,
- 97, 0, 904
+ -1, 1, 454,
+ 97, 0, 876
};
-static int parser_action_row760[] = {
+static int parser_action_row732[] = {
3,
- -1, 1, 463,
+ -1, 1, 456,
96, 0, 53,
- 97, 0, 905
+ 97, 0, 877
};
-static int parser_action_row761[] = {
+static int parser_action_row733[] = {
1,
- -1, 1, 771
+ -1, 1, 757
};
-static int parser_action_row762[] = {
+static int parser_action_row734[] = {
1,
-1, 1, 164
};
-static int parser_action_row763[] = {
- 37,
- -1, 1, 464,
- 9, 0, 907,
+static int parser_action_row735[] = {
+ 30,
+ -1, 1, 457,
+ 9, 0, 879,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row764[] = {
+static int parser_action_row736[] = {
1,
-1, 1, 154
};
-static int parser_action_row765[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row737[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row766[] = {
+static int parser_action_row738[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row767[] = {
- 41,
- -1, 1, 464,
+static int parser_action_row739[] = {
+ 34,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 910,
- 12, 0, 911,
- 15, 0, 912,
+ 9, 0, 882,
+ 12, 0, 883,
+ 15, 0, 884,
16, 0, 34,
- 22, 0, 913,
- 24, 0, 914,
- 25, 0, 915,
- 26, 0, 916,
- 27, 0, 917,
- 33, 0, 918,
- 34, 0, 919,
- 35, 0, 920,
- 36, 0, 921,
- 37, 0, 922,
+ 22, 0, 885,
+ 24, 0, 886,
+ 25, 0, 887,
+ 26, 0, 888,
+ 27, 0, 889,
+ 33, 0, 890,
+ 34, 0, 891,
+ 35, 0, 892,
+ 36, 0, 893,
+ 37, 0, 894,
38, 0, 44,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 50, 0, 923,
- 51, 0, 924,
+ 50, 0, 895,
+ 51, 0, 896,
52, 0, 51,
54, 0, 52,
95, 0, 3,
96, 0, 53,
- 97, 0, 925,
+ 97, 0, 897,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row768[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row740[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 169,
+ 9, 0, 155,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row769[] = {
+static int parser_action_row741[] = {
4,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2,
- 56, 0, 578
+ 56, 0, 550
};
-static int parser_action_row770[] = {
+static int parser_action_row742[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row771[] = {
+static int parser_action_row743[] = {
2,
- -1, 3, 770,
- 97, 0, 947
+ -1, 3, 742,
+ 97, 0, 919
};
-static int parser_action_row772[] = {
+static int parser_action_row744[] = {
2,
- -1, 3, 771,
- 23, 0, 948
+ -1, 3, 743,
+ 23, 0, 920
};
-static int parser_action_row773[] = {
+static int parser_action_row745[] = {
1,
-1, 1, 325
};
-static int parser_action_row774[] = {
+static int parser_action_row746[] = {
5,
- -1, 1, 464,
- 12, 0, 797,
- 46, 0, 693,
+ -1, 1, 457,
+ 12, 0, 769,
+ 46, 0, 665,
96, 0, 53,
- 97, 0, 798
+ 97, 0, 770
};
-static int parser_action_row775[] = {
+static int parser_action_row747[] = {
1,
-1, 1, 287
};
-static int parser_action_row776[] = {
- 29,
- -1, 1, 464,
- 12, 0, 182,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row748[] = {
+ 22,
+ -1, 1, 457,
+ 12, 0, 168,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row777[] = {
+static int parser_action_row749[] = {
1,
-1, 1, 286
};
-static int parser_action_row778[] = {
+static int parser_action_row750[] = {
1,
-1, 1, 289
};
-static int parser_action_row779[] = {
+static int parser_action_row751[] = {
1,
-1, 1, 300
};
-static int parser_action_row780[] = {
+static int parser_action_row752[] = {
2,
-1, 1, 302,
- 81, 0, 390
+ 81, 0, 362
};
-static int parser_action_row781[] = {
+static int parser_action_row753[] = {
2,
-1, 1, 293,
- 80, 0, 382
+ 80, 0, 354
};
-static int parser_action_row782[] = {
+static int parser_action_row754[] = {
2,
-1, 1, 294,
- 80, 0, 382
+ 80, 0, 354
};
-static int parser_action_row783[] = {
+static int parser_action_row755[] = {
2,
-1, 1, 295,
- 80, 0, 382
+ 80, 0, 354
};
-static int parser_action_row784[] = {
+static int parser_action_row756[] = {
2,
-1, 1, 296,
- 80, 0, 382
+ 80, 0, 354
};
-static int parser_action_row785[] = {
+static int parser_action_row757[] = {
2,
-1, 1, 297,
- 80, 0, 382
+ 80, 0, 354
};
-static int parser_action_row786[] = {
+static int parser_action_row758[] = {
2,
-1, 1, 298,
- 80, 0, 382
+ 80, 0, 354
};
-static int parser_action_row787[] = {
+static int parser_action_row759[] = {
2,
-1, 1, 299,
- 80, 0, 382
+ 80, 0, 354
};
-static int parser_action_row788[] = {
+static int parser_action_row760[] = {
2,
-1, 1, 304,
- 82, 0, 391
+ 82, 0, 363
};
-static int parser_action_row789[] = {
+static int parser_action_row761[] = {
3,
-1, 1, 306,
- 88, 0, 392,
- 91, 0, 393
+ 88, 0, 364,
+ 91, 0, 365
};
-static int parser_action_row790[] = {
+static int parser_action_row762[] = {
3,
-1, 1, 308,
- 74, 0, 394,
- 75, 0, 395
+ 74, 0, 366,
+ 75, 0, 367
};
-static int parser_action_row791[] = {
+static int parser_action_row763[] = {
3,
-1, 1, 309,
- 74, 0, 394,
- 75, 0, 395
+ 74, 0, 366,
+ 75, 0, 367
};
-static int parser_action_row792[] = {
+static int parser_action_row764[] = {
4,
-1, 1, 311,
- 76, 0, 396,
- 78, 0, 397,
- 79, 0, 398
+ 76, 0, 368,
+ 78, 0, 369,
+ 79, 0, 370
};
-static int parser_action_row793[] = {
+static int parser_action_row765[] = {
4,
-1, 1, 312,
- 76, 0, 396,
- 78, 0, 397,
- 79, 0, 398
+ 76, 0, 368,
+ 78, 0, 369,
+ 79, 0, 370
};
-static int parser_action_row794[] = {
+static int parser_action_row766[] = {
1,
-1, 1, 314
};
-static int parser_action_row795[] = {
+static int parser_action_row767[] = {
1,
-1, 1, 315
};
-static int parser_action_row796[] = {
+static int parser_action_row768[] = {
1,
-1, 1, 316
};
-static int parser_action_row797[] = {
+static int parser_action_row769[] = {
1,
-1, 1, 318
};
-static int parser_action_row798[] = {
+static int parser_action_row770[] = {
2,
-1, 1, 351,
- 52, 0, 295
+ 52, 0, 274
};
-static int parser_action_row799[] = {
+static int parser_action_row771[] = {
3,
-1, 1, 333,
- 52, 0, 295,
- 58, 0, 227
+ 52, 0, 274,
+ 58, 0, 213
};
-static int parser_action_row800[] = {
+static int parser_action_row772[] = {
2,
- -1, 3, 799,
- 98, 0, 952
+ -1, 3, 771,
+ 98, 0, 924
};
-static int parser_action_row801[] = {
+static int parser_action_row773[] = {
2,
- -1, 1, 461,
- 97, 0, 953
+ -1, 1, 454,
+ 97, 0, 925
};
-static int parser_action_row802[] = {
+static int parser_action_row774[] = {
3,
- -1, 1, 463,
+ -1, 1, 456,
96, 0, 53,
- 97, 0, 954
+ 97, 0, 926
};
-static int parser_action_row803[] = {
+static int parser_action_row775[] = {
1,
-1, 1, 344
};
-static int parser_action_row804[] = {
+static int parser_action_row776[] = {
1,
-1, 1, 279
};
-static int parser_action_row805[] = {
+static int parser_action_row777[] = {
1,
-1, 1, 157
};
-static int parser_action_row806[] = {
+static int parser_action_row778[] = {
1,
-1, 1, 156
};
-static int parser_action_row807[] = {
+static int parser_action_row779[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row808[] = {
+static int parser_action_row780[] = {
1,
- -1, 1, 635
+ -1, 1, 621
};
-static int parser_action_row809[] = {
+static int parser_action_row781[] = {
3,
- -1, 3, 808,
- 47, 0, 420,
- 96, 0, 421
+ -1, 3, 780,
+ 47, 0, 392,
+ 96, 0, 393
};
-static int parser_action_row810[] = {
+static int parser_action_row782[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row811[] = {
+static int parser_action_row783[] = {
5,
-1, 1, 81,
- 18, 0, 254,
- 19, 0, 255,
- 20, 0, 256,
- 21, 0, 257
+ 18, 0, 233,
+ 19, 0, 234,
+ 20, 0, 235,
+ 21, 0, 236
};
-static int parser_action_row812[] = {
+static int parser_action_row784[] = {
1,
- -1, 1, 812
+ -1, 1, 791
};
-static int parser_action_row813[] = {
+static int parser_action_row785[] = {
3,
- -1, 3, 812,
+ -1, 3, 784,
96, 0, 53,
- 97, 0, 961
+ 97, 0, 933
};
-static int parser_action_row814[] = {
+static int parser_action_row786[] = {
5,
-1, 1, 81,
- 18, 0, 254,
- 19, 0, 255,
- 20, 0, 256,
- 21, 0, 257
+ 18, 0, 233,
+ 19, 0, 234,
+ 20, 0, 235,
+ 21, 0, 236
};
-static int parser_action_row815[] = {
+static int parser_action_row787[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row816[] = {
+static int parser_action_row788[] = {
2,
- -1, 1, 414,
- 56, 0, 966
+ -1, 1, 407,
+ 56, 0, 938
};
-static int parser_action_row817[] = {
+static int parser_action_row789[] = {
1,
- -1, 1, 442
+ -1, 1, 435
};
-static int parser_action_row818[] = {
+static int parser_action_row790[] = {
1,
- -1, 1, 441
+ -1, 1, 434
};
-static int parser_action_row819[] = {
+static int parser_action_row791[] = {
1,
- -1, 1, 440
+ -1, 1, 433
};
-static int parser_action_row820[] = {
+static int parser_action_row792[] = {
3,
- -1, 1, 411,
- 52, 0, 969,
- 94, 0, 216
+ -1, 1, 404,
+ 52, 0, 941,
+ 94, 0, 202
};
-static int parser_action_row821[] = {
+static int parser_action_row793[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row822[] = {
+static int parser_action_row794[] = {
2,
- -1, 3, 821,
- 59, 0, 972
+ -1, 3, 793,
+ 59, 0, 944
};
-static int parser_action_row823[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row795[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 169,
+ 9, 0, 155,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row824[] = {
+static int parser_action_row796[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row825[] = {
+static int parser_action_row797[] = {
1,
-1, 1, 147
};
-static int parser_action_row826[] = {
+static int parser_action_row798[] = {
3,
- -1, 3, 825,
- 47, 0, 420,
- 96, 0, 421
+ -1, 3, 797,
+ 47, 0, 392,
+ 96, 0, 393
};
-static int parser_action_row827[] = {
+static int parser_action_row799[] = {
1,
-1, 1, 200
};
-static int parser_action_row828[] = {
+static int parser_action_row800[] = {
2,
- -1, 3, 827,
- 57, 0, 977
+ -1, 3, 799,
+ 57, 0, 949
};
-static int parser_action_row829[] = {
+static int parser_action_row801[] = {
1,
- -1, 1, 525
+ -1, 1, 518
};
-static int parser_action_row830[] = {
+static int parser_action_row802[] = {
25,
- -1, 1, 464,
- 12, 0, 797,
- 46, 0, 693,
- 54, 0, 643,
- 74, 0, 644,
- 75, 0, 645,
- 76, 0, 431,
- 77, 0, 432,
- 78, 0, 433,
- 79, 0, 434,
- 80, 0, 435,
- 81, 0, 436,
- 82, 0, 437,
- 83, 0, 646,
- 84, 0, 439,
- 85, 0, 440,
- 86, 0, 441,
- 87, 0, 442,
- 88, 0, 443,
- 89, 0, 444,
- 90, 0, 445,
- 91, 0, 446,
- 92, 0, 447,
- 96, 0, 53,
- 97, 0, 978
+ -1, 1, 457,
+ 12, 0, 769,
+ 46, 0, 665,
+ 54, 0, 615,
+ 74, 0, 616,
+ 75, 0, 617,
+ 76, 0, 403,
+ 77, 0, 404,
+ 78, 0, 405,
+ 79, 0, 406,
+ 80, 0, 407,
+ 81, 0, 408,
+ 82, 0, 409,
+ 83, 0, 618,
+ 84, 0, 411,
+ 85, 0, 412,
+ 86, 0, 413,
+ 87, 0, 414,
+ 88, 0, 415,
+ 89, 0, 416,
+ 90, 0, 417,
+ 91, 0, 418,
+ 92, 0, 419,
+ 96, 0, 53,
+ 97, 0, 950
};
-static int parser_action_row831[] = {
+static int parser_action_row803[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row832[] = {
- 60,
- -1, 1, 464,
- 12, 0, 182,
+static int parser_action_row804[] = {
+ 53,
+ -1, 1, 457,
+ 12, 0, 168,
15, 0, 33,
16, 0, 34,
- 22, 0, 183,
+ 22, 0, 169,
25, 0, 36,
26, 0, 37,
27, 0, 38,
- 31, 0, 184,
- 33, 0, 423,
- 34, 0, 424,
- 35, 0, 425,
- 36, 0, 426,
+ 31, 0, 170,
+ 33, 0, 395,
+ 34, 0, 396,
+ 35, 0, 397,
+ 36, 0, 398,
37, 0, 43,
- 38, 0, 185,
- 40, 0, 186,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 47, 0, 420,
- 48, 0, 187,
+ 47, 0, 392,
+ 48, 0, 173,
50, 0, 49,
- 51, 0, 427,
+ 51, 0, 399,
52, 0, 51,
- 54, 0, 428,
- 74, 0, 429,
- 75, 0, 430,
- 76, 0, 431,
- 77, 0, 432,
- 78, 0, 433,
- 79, 0, 434,
- 80, 0, 435,
- 81, 0, 436,
- 82, 0, 437,
- 83, 0, 438,
- 84, 0, 439,
- 85, 0, 440,
- 86, 0, 441,
- 87, 0, 442,
- 88, 0, 443,
- 89, 0, 444,
- 90, 0, 445,
- 91, 0, 446,
- 92, 0, 447,
- 94, 0, 216,
- 96, 0, 448,
- 97, 0, 449,
+ 54, 0, 400,
+ 74, 0, 401,
+ 75, 0, 402,
+ 76, 0, 403,
+ 77, 0, 404,
+ 78, 0, 405,
+ 79, 0, 406,
+ 80, 0, 407,
+ 81, 0, 408,
+ 82, 0, 409,
+ 83, 0, 410,
+ 84, 0, 411,
+ 85, 0, 412,
+ 86, 0, 413,
+ 87, 0, 414,
+ 88, 0, 415,
+ 89, 0, 416,
+ 90, 0, 417,
+ 91, 0, 418,
+ 92, 0, 419,
+ 94, 0, 202,
+ 96, 0, 420,
+ 97, 0, 421,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row833[] = {
+static int parser_action_row805[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row834[] = {
+static int parser_action_row806[] = {
1,
- -1, 1, 1099
+ -1, 1, 1071
};
-static int parser_action_row835[] = {
- 32,
- -1, 1, 524,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+static int parser_action_row807[] = {
+ 25,
+ -1, 1, 517,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row836[] = {
- 32,
- -1, 1, 524,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+static int parser_action_row808[] = {
+ 25,
+ -1, 1, 517,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row837[] = {
+static int parser_action_row809[] = {
14,
-1, 1, 345,
- 52, 0, 295,
- 59, 0, 985,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ 52, 0, 274,
+ 59, 0, 957,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row838[] = {
+static int parser_action_row810[] = {
1,
- -1, 1, 528
+ -1, 1, 521
};
-static int parser_action_row839[] = {
+static int parser_action_row811[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row840[] = {
+static int parser_action_row812[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row841[] = {
+static int parser_action_row813[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row842[] = {
+static int parser_action_row814[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row843[] = {
- 31,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 470,
- 27, 0, 471,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row815[] = {
+ 24,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 442,
+ 27, 0, 443,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row844[] = {
+static int parser_action_row816[] = {
1,
- -1, 1, 1101
+ -1, 1, 1073
};
-static int parser_action_row845[] = {
+static int parser_action_row817[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row846[] = {
+static int parser_action_row818[] = {
2,
- -1, 1, 457,
- 58, 0, 227
+ -1, 1, 450,
+ 58, 0, 213
};
-static int parser_action_row847[] = {
+static int parser_action_row819[] = {
2,
-1, 1, 78,
- 14, 0, 993
+ 14, 0, 965
};
-static int parser_action_row848[] = {
+static int parser_action_row820[] = {
2,
- -1, 3, 847,
- 97, 0, 995
+ -1, 3, 819,
+ 97, 0, 967
};
-static int parser_action_row849[] = {
+static int parser_action_row821[] = {
4,
- -1, 3, 848,
- 0, 0, 94,
- 1, 0, 95,
- 95, 0, 96
+ -1, 3, 820,
+ 0, 0, 87,
+ 1, 0, 88,
+ 95, 0, 89
};
-static int parser_action_row850[] = {
+static int parser_action_row822[] = {
2,
-1, 1, 78,
- 14, 0, 993
+ 14, 0, 965
};
-static int parser_action_row851[] = {
+static int parser_action_row823[] = {
2,
-1, 1, 104,
- 59, 0, 998
+ 59, 0, 970
};
-static int parser_action_row852[] = {
+static int parser_action_row824[] = {
1,
-1, 1, 106
};
-static int parser_action_row853[] = {
+static int parser_action_row825[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row854[] = {
+static int parser_action_row826[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row855[] = {
+static int parser_action_row827[] = {
4,
-1, 1, 124,
- 4, 0, 1001,
- 14, 0, 1002,
- 15, 0, 1003
+ 4, 0, 973,
+ 14, 0, 974,
+ 15, 0, 975
};
-static int parser_action_row856[] = {
+static int parser_action_row828[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row857[] = {
+static int parser_action_row829[] = {
1,
-1, 1, 112
};
-static int parser_action_row858[] = {
+static int parser_action_row830[] = {
2,
-1, 1, 108,
- 59, 0, 851
+ 59, 0, 823
};
-static int parser_action_row859[] = {
+static int parser_action_row831[] = {
1,
- -1, 1, 470
+ -1, 1, 463
};
-static int parser_action_row860[] = {
+static int parser_action_row832[] = {
1,
- -1, 1, 472
+ -1, 1, 465
};
-static int parser_action_row861[] = {
+static int parser_action_row833[] = {
22,
- -1, 3, 860,
- 54, 0, 664,
- 74, 0, 665,
- 75, 0, 666,
- 76, 0, 667,
- 77, 0, 668,
- 78, 0, 669,
- 79, 0, 670,
- 80, 0, 671,
- 81, 0, 672,
- 82, 0, 673,
- 83, 0, 674,
- 84, 0, 675,
- 85, 0, 676,
- 86, 0, 677,
- 87, 0, 678,
- 88, 0, 679,
- 89, 0, 680,
- 90, 0, 681,
- 91, 0, 682,
- 92, 0, 683,
- 97, 0, 857
+ -1, 3, 832,
+ 54, 0, 636,
+ 74, 0, 637,
+ 75, 0, 638,
+ 76, 0, 639,
+ 77, 0, 640,
+ 78, 0, 641,
+ 79, 0, 642,
+ 80, 0, 643,
+ 81, 0, 644,
+ 82, 0, 645,
+ 83, 0, 646,
+ 84, 0, 647,
+ 85, 0, 648,
+ 86, 0, 649,
+ 87, 0, 650,
+ 88, 0, 651,
+ 89, 0, 652,
+ 90, 0, 653,
+ 91, 0, 654,
+ 92, 0, 655,
+ 97, 0, 829
};
-static int parser_action_row862[] = {
+static int parser_action_row834[] = {
2,
- -1, 1, 465,
- 58, 0, 226
+ -1, 1, 458,
+ 58, 0, 212
};
-static int parser_action_row863[] = {
+static int parser_action_row835[] = {
2,
- -1, 3, 862,
- 58, 0, 227
+ -1, 3, 834,
+ 58, 0, 213
};
-static int parser_action_row864[] = {
+static int parser_action_row836[] = {
7,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
- 28, 0, 90,
- 54, 0, 1009,
+ 28, 0, 83,
+ 54, 0, 981,
95, 0, 3,
- 115, 0, 91
+ 108, 0, 84
};
-static int parser_action_row865[] = {
+static int parser_action_row837[] = {
2,
- -1, 3, 864,
- 96, 0, 1019
+ -1, 3, 836,
+ 96, 0, 991
};
-static int parser_action_row866[] = {
+static int parser_action_row838[] = {
3,
- -1, 3, 865,
- 96, 0, 1020,
- 97, 0, 862
+ -1, 3, 837,
+ 96, 0, 992,
+ 97, 0, 834
};
-static int parser_action_row867[] = {
+static int parser_action_row839[] = {
1,
- -1, 1, 449
+ -1, 1, 442
};
-static int parser_action_row868[] = {
+static int parser_action_row840[] = {
1,
-1, 1, 350
};
-static int parser_action_row869[] = {
+static int parser_action_row841[] = {
1,
-1, 1, 192
};
-static int parser_action_row870[] = {
+static int parser_action_row842[] = {
3,
- -1, 3, 869,
- 31, 0, 1022,
- 52, 0, 1023
+ -1, 3, 841,
+ 31, 0, 994,
+ 52, 0, 995
};
-static int parser_action_row871[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row843[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row872[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row844[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row873[] = {
+static int parser_action_row845[] = {
13,
-1, 1, 332,
- 59, 0, 1026,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ 59, 0, 998,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row874[] = {
+static int parser_action_row846[] = {
1,
-1, 1, 183
};
-static int parser_action_row875[] = {
+static int parser_action_row847[] = {
13,
-1, 1, 330,
- 59, 0, 1028,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ 59, 0, 1000,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row876[] = {
- 31,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 510,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row848[] = {
+ 24,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 482,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row877[] = {
- 45,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 132,
+static int parser_action_row849[] = {
+ 38,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 125,
54, 1, 335,
- 59, 0, 1031,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239,
+ 59, 0, 1003,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225,
73, 1, 335,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row878[] = {
- 31,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 510,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row850[] = {
+ 24,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 482,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row879[] = {
- 46,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 132,
+static int parser_action_row851[] = {
+ 39,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 125,
54, 1, 339,
- 58, 0, 227,
- 59, 0, 1036,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239,
+ 58, 0, 213,
+ 59, 0, 1008,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225,
73, 1, 339,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row880[] = {
+static int parser_action_row852[] = {
3,
- -1, 1, 462,
- 12, 0, 1040,
- 97, 0, 1041
+ -1, 1, 455,
+ 12, 0, 1012,
+ 97, 0, 1013
};
-static int parser_action_row881[] = {
+static int parser_action_row853[] = {
1,
- -1, 1, 404
+ -1, 1, 397
};
-static int parser_action_row882[] = {
+static int parser_action_row854[] = {
1,
- -1, 1, 447
+ -1, 1, 440
};
-static int parser_action_row883[] = {
+static int parser_action_row855[] = {
2,
- -1, 3, 882,
- 53, 0, 1042
+ -1, 3, 854,
+ 53, 0, 1014
};
-static int parser_action_row884[] = {
+static int parser_action_row856[] = {
1,
-1, 1, 219
};
-static int parser_action_row885[] = {
+static int parser_action_row857[] = {
1,
-1, 1, 238
};
-static int parser_action_row886[] = {
+static int parser_action_row858[] = {
1,
-1, 1, 223
};
-static int parser_action_row887[] = {
+static int parser_action_row859[] = {
1,
-1, 1, 242
};
-static int parser_action_row888[] = {
+static int parser_action_row860[] = {
1,
-1, 1, 222
};
-static int parser_action_row889[] = {
+static int parser_action_row861[] = {
1,
-1, 1, 241
};
-static int parser_action_row890[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row862[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row891[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row863[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row892[] = {
+static int parser_action_row864[] = {
1,
- -1, 1, 443
+ -1, 1, 436
};
-static int parser_action_row893[] = {
+static int parser_action_row865[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row894[] = {
+static int parser_action_row866[] = {
3,
- -1, 3, 893,
+ -1, 3, 865,
96, 0, 53,
- 97, 0, 1046
+ 97, 0, 1018
};
-static int parser_action_row895[] = {
+static int parser_action_row867[] = {
2,
- -1, 3, 894,
- 98, 0, 1049
+ -1, 3, 866,
+ 98, 0, 1021
};
-static int parser_action_row896[] = {
+static int parser_action_row868[] = {
1,
-1, 1, 368
};
-static int parser_action_row897[] = {
+static int parser_action_row869[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row898[] = {
+static int parser_action_row870[] = {
1,
- -1, 1, 1108
+ -1, 1, 1080
};
-static int parser_action_row899[] = {
+static int parser_action_row871[] = {
2,
- -1, 1, 451,
- 56, 0, 896
+ -1, 1, 444,
+ 56, 0, 868
};
-static int parser_action_row900[] = {
+static int parser_action_row872[] = {
1,
- -1, 1, 715
+ -1, 1, 701
};
-static int parser_action_row901[] = {
+static int parser_action_row873[] = {
1,
- -1, 1, 777
+ -1, 1, 763
};
-static int parser_action_row902[] = {
+static int parser_action_row874[] = {
3,
- -1, 3, 901,
- 31, 0, 1052,
- 52, 0, 1053
+ -1, 3, 873,
+ 31, 0, 1024,
+ 52, 0, 1025
};
-static int parser_action_row903[] = {
+static int parser_action_row875[] = {
1,
- -1, 1, 759
+ -1, 1, 745
};
-static int parser_action_row904[] = {
+static int parser_action_row876[] = {
1,
- -1, 1, 757
+ -1, 1, 743
};
-static int parser_action_row905[] = {
+static int parser_action_row877[] = {
2,
- -1, 1, 762,
- 52, 0, 295
+ -1, 1, 748,
+ 52, 0, 274
};
-static int parser_action_row906[] = {
+static int parser_action_row878[] = {
3,
- -1, 1, 766,
- 52, 0, 295,
- 58, 0, 227
+ -1, 1, 752,
+ 52, 0, 274,
+ 58, 0, 213
};
-static int parser_action_row907[] = {
+static int parser_action_row879[] = {
2,
- -1, 1, 462,
- 97, 0, 1056
+ -1, 1, 455,
+ 97, 0, 1028
};
-static int parser_action_row908[] = {
+static int parser_action_row880[] = {
1,
-1, 1, 165
};
-static int parser_action_row909[] = {
+static int parser_action_row881[] = {
1,
-1, 1, 205
};
-static int parser_action_row910[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row882[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row911[] = {
+static int parser_action_row883[] = {
1,
-1, 1, 266
};
-static int parser_action_row912[] = {
- 33,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 132,
+static int parser_action_row884[] = {
+ 26,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 125,
54, 1, 353,
73, 1, 353,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row913[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row885[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 1059,
- 12, 0, 911,
- 15, 0, 912,
+ 9, 0, 1031,
+ 12, 0, 883,
+ 15, 0, 884,
16, 0, 34,
- 22, 0, 913,
- 25, 0, 915,
- 26, 0, 916,
- 27, 0, 917,
- 33, 0, 918,
- 34, 0, 919,
- 35, 0, 920,
- 36, 0, 921,
- 37, 0, 922,
+ 22, 0, 885,
+ 25, 0, 887,
+ 26, 0, 888,
+ 27, 0, 889,
+ 33, 0, 890,
+ 34, 0, 891,
+ 35, 0, 892,
+ 36, 0, 893,
+ 37, 0, 894,
38, 0, 44,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 50, 0, 923,
- 51, 0, 924,
+ 50, 0, 895,
+ 51, 0, 896,
52, 0, 51,
54, 0, 52,
95, 0, 3,
96, 0, 53,
- 97, 0, 925,
+ 97, 0, 897,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row914[] = {
+static int parser_action_row886[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row915[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row887[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 613,
+ 9, 0, 585,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row916[] = {
+static int parser_action_row888[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row917[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row889[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 1059,
- 12, 0, 911,
- 15, 0, 912,
+ 9, 0, 1031,
+ 12, 0, 883,
+ 15, 0, 884,
16, 0, 34,
- 22, 0, 913,
- 25, 0, 915,
- 26, 0, 916,
- 27, 0, 917,
- 33, 0, 918,
- 34, 0, 919,
- 35, 0, 920,
- 36, 0, 921,
- 37, 0, 922,
+ 22, 0, 885,
+ 25, 0, 887,
+ 26, 0, 888,
+ 27, 0, 889,
+ 33, 0, 890,
+ 34, 0, 891,
+ 35, 0, 892,
+ 36, 0, 893,
+ 37, 0, 894,
38, 0, 44,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 50, 0, 923,
- 51, 0, 924,
+ 50, 0, 895,
+ 51, 0, 896,
52, 0, 51,
54, 0, 52,
95, 0, 3,
96, 0, 53,
- 97, 0, 925,
+ 97, 0, 897,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row918[] = {
+static int parser_action_row890[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row919[] = {
- 33,
+static int parser_action_row891[] = {
+ 26,
-1, 1, 169,
- 12, 0, 182,
- 22, 0, 183,
- 24, 1, 924,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+ 12, 0, 168,
+ 22, 0, 169,
+ 24, 1, 896,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row920[] = {
+static int parser_action_row892[] = {
3,
-1, 1, 174,
- 24, 1, 929,
- 49, 0, 209
+ 24, 1, 901,
+ 49, 0, 195
};
-static int parser_action_row921[] = {
+static int parser_action_row893[] = {
3,
-1, 1, 171,
- 24, 1, 926,
- 49, 0, 209
+ 24, 1, 898,
+ 49, 0, 195
};
-static int parser_action_row922[] = {
+static int parser_action_row894[] = {
2,
-1, 1, 173,
- 24, 1, 928
+ 24, 1, 900
};
-static int parser_action_row923[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row895[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 212,
+ 97, 0, 198,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row924[] = {
+static int parser_action_row896[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row925[] = {
+static int parser_action_row897[] = {
2,
- -1, 3, 924,
- 11, 0, 1076
+ -1, 3, 896,
+ 11, 0, 1048
};
-static int parser_action_row926[] = {
- 46,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 132,
+static int parser_action_row898[] = {
+ 39,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 125,
54, 1, 341,
- 58, 0, 227,
- 59, 0, 228,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239,
+ 58, 0, 213,
+ 59, 0, 214,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225,
73, 1, 341,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row927[] = {
+static int parser_action_row899[] = {
1,
-1, 1, 259
};
-static int parser_action_row928[] = {
+static int parser_action_row900[] = {
2,
-1, 1, 167,
- 24, 1, 922
+ 24, 1, 894
};
-static int parser_action_row929[] = {
+static int parser_action_row901[] = {
2,
-1, 1, 168,
- 24, 1, 923
+ 24, 1, 895
};
-static int parser_action_row930[] = {
+static int parser_action_row902[] = {
1,
-1, 1, 264
};
-static int parser_action_row931[] = {
+static int parser_action_row903[] = {
3,
- -1, 3, 930,
- 54, 0, 262,
- 73, 0, 1078
+ -1, 3, 902,
+ 54, 0, 241,
+ 73, 0, 1050
};
-static int parser_action_row932[] = {
+static int parser_action_row904[] = {
3,
- -1, 3, 931,
- 41, 0, 1079,
- 98, 0, 273
+ -1, 3, 903,
+ 41, 0, 1051,
+ 98, 0, 252
};
-static int parser_action_row933[] = {
+static int parser_action_row905[] = {
3,
- -1, 1, 461,
- 12, 0, 1080,
- 97, 0, 1081
+ -1, 1, 454,
+ 12, 0, 1052,
+ 97, 0, 1053
};
-static int parser_action_row934[] = {
- 38,
- -1, 1, 464,
- 9, 0, 910,
+static int parser_action_row906[] = {
+ 31,
+ -1, 1, 457,
+ 9, 0, 882,
12, 0, 31,
15, 0, 33,
16, 0, 34,
22, 0, 35,
- 24, 0, 1082,
+ 24, 0, 1054,
25, 0, 36,
26, 0, 37,
27, 0, 38,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row935[] = {
+static int parser_action_row907[] = {
2,
- -1, 3, 934,
- 24, 0, 1086
+ -1, 3, 906,
+ 24, 0, 1058
};
-static int parser_action_row936[] = {
+static int parser_action_row908[] = {
1,
- -1, 1, 931
+ -1, 1, 903
};
-static int parser_action_row937[] = {
+static int parser_action_row909[] = {
1,
- -1, 1, 932
+ -1, 1, 904
};
-static int parser_action_row938[] = {
+static int parser_action_row910[] = {
1,
- -1, 1, 934
+ -1, 1, 906
};
-static int parser_action_row939[] = {
+static int parser_action_row911[] = {
1,
- -1, 1, 933
+ -1, 1, 905
};
-static int parser_action_row940[] = {
+static int parser_action_row912[] = {
1,
- -1, 1, 935
+ -1, 1, 907
};
-static int parser_action_row941[] = {
+static int parser_action_row913[] = {
1,
- -1, 1, 936
+ -1, 1, 908
};
-static int parser_action_row942[] = {
+static int parser_action_row914[] = {
1,
- -1, 1, 937
+ -1, 1, 909
};
-static int parser_action_row943[] = {
+static int parser_action_row915[] = {
4,
- -1, 1, 463,
- 12, 0, 1087,
+ -1, 1, 456,
+ 12, 0, 1059,
96, 0, 53,
- 97, 0, 1088
+ 97, 0, 1060
};
-static int parser_action_row944[] = {
+static int parser_action_row916[] = {
1,
-1, 1, 270
};
-static int parser_action_row945[] = {
+static int parser_action_row917[] = {
2,
- -1, 3, 944,
- 49, 0, 209
+ -1, 3, 916,
+ 49, 0, 195
};
-static int parser_action_row946[] = {
+static int parser_action_row918[] = {
2,
- -1, 3, 945,
- 53, 0, 1091
+ -1, 3, 917,
+ 53, 0, 1063
};
-static int parser_action_row947[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row919[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row948[] = {
+static int parser_action_row920[] = {
1,
- -1, 1, 456
+ -1, 1, 449
};
-static int parser_action_row949[] = {
+static int parser_action_row921[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row950[] = {
+static int parser_action_row922[] = {
2,
- -1, 3, 949,
- 98, 0, 1094
+ -1, 3, 921,
+ 98, 0, 1066
};
-static int parser_action_row951[] = {
+static int parser_action_row923[] = {
1,
-1, 1, 288
};
-static int parser_action_row952[] = {
+static int parser_action_row924[] = {
1,
-1, 1, 332
};
-static int parser_action_row953[] = {
+static int parser_action_row925[] = {
1,
-1, 1, 330
};
-static int parser_action_row954[] = {
+static int parser_action_row926[] = {
2,
-1, 1, 335,
- 52, 0, 295
+ 52, 0, 274
};
-static int parser_action_row955[] = {
+static int parser_action_row927[] = {
3,
-1, 1, 339,
- 52, 0, 295,
- 58, 0, 227
+ 52, 0, 274,
+ 58, 0, 213
};
-static int parser_action_row956[] = {
+static int parser_action_row928[] = {
2,
- -1, 1, 462,
- 97, 0, 1097
+ -1, 1, 455,
+ 97, 0, 1069
};
-static int parser_action_row957[] = {
+static int parser_action_row929[] = {
3,
- -1, 3, 956,
- 47, 0, 420,
- 96, 0, 421
+ -1, 3, 928,
+ 47, 0, 392,
+ 96, 0, 393
};
-static int parser_action_row958[] = {
+static int parser_action_row930[] = {
2,
-1, 1, 150,
- 56, 0, 1099
+ 56, 0, 1071
};
-static int parser_action_row959[] = {
+static int parser_action_row931[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row960[] = {
+static int parser_action_row932[] = {
2,
-1, 1, 30,
13, 0, 32
};
-static int parser_action_row961[] = {
+static int parser_action_row933[] = {
4,
- -1, 3, 960,
- 6, 0, 816,
- 17, 0, 817,
- 97, 0, 818
+ -1, 3, 932,
+ 6, 0, 788,
+ 17, 0, 789,
+ 97, 0, 790
};
-static int parser_action_row962[] = {
+static int parser_action_row934[] = {
3,
-1, 1, 356,
- 52, 0, 295,
- 58, 0, 227
+ 52, 0, 274,
+ 58, 0, 213
};
-static int parser_action_row963[] = {
+static int parser_action_row935[] = {
2,
- -1, 3, 962,
- 97, 0, 1106
+ -1, 3, 934,
+ 97, 0, 1078
};
-static int parser_action_row964[] = {
+static int parser_action_row936[] = {
3,
- -1, 3, 963,
+ -1, 3, 935,
96, 0, 53,
- 97, 0, 1107
+ 97, 0, 1079
};
-static int parser_action_row965[] = {
+static int parser_action_row937[] = {
4,
- -1, 3, 964,
- 6, 0, 816,
- 17, 0, 817,
- 97, 0, 818
+ -1, 3, 936,
+ 6, 0, 788,
+ 17, 0, 789,
+ 97, 0, 790
};
-static int parser_action_row966[] = {
+static int parser_action_row938[] = {
2,
- -1, 3, 965,
- 53, 0, 1110
+ -1, 3, 937,
+ 53, 0, 1082
};
-static int parser_action_row967[] = {
+static int parser_action_row939[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row968[] = {
+static int parser_action_row940[] = {
1,
- -1, 1, 1104
+ -1, 1, 1076
};
-static int parser_action_row969[] = {
+static int parser_action_row941[] = {
2,
- -1, 1, 415,
- 56, 0, 966
+ -1, 1, 408,
+ 56, 0, 938
};
-static int parser_action_row970[] = {
+static int parser_action_row942[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row971[] = {
+static int parser_action_row943[] = {
1,
- -1, 1, 412
+ -1, 1, 405
};
-static int parser_action_row972[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row944[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row973[] = {
+static int parser_action_row945[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row974[] = {
+static int parser_action_row946[] = {
1,
-1, 1, 274
};
-static int parser_action_row975[] = {
+static int parser_action_row947[] = {
2,
- -1, 3, 974,
- 49, 0, 209
+ -1, 3, 946,
+ 49, 0, 195
};
-static int parser_action_row976[] = {
+static int parser_action_row948[] = {
3,
- -1, 3, 975,
- 47, 0, 420,
- 96, 0, 421
+ -1, 3, 947,
+ 47, 0, 392,
+ 96, 0, 393
};
-static int parser_action_row977[] = {
+static int parser_action_row949[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row978[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row950[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row979[] = {
+static int parser_action_row951[] = {
15,
-1, 1, 333,
- 52, 0, 295,
- 58, 0, 227,
- 59, 0, 1120,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ 52, 0, 274,
+ 58, 0, 213,
+ 59, 0, 1092,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row980[] = {
+static int parser_action_row952[] = {
22,
- -1, 1, 461,
- 54, 0, 643,
- 74, 0, 644,
- 75, 0, 645,
- 76, 0, 431,
- 77, 0, 432,
- 78, 0, 433,
- 79, 0, 434,
- 80, 0, 435,
- 81, 0, 436,
- 82, 0, 437,
- 83, 0, 646,
- 84, 0, 439,
- 85, 0, 440,
- 86, 0, 441,
- 87, 0, 442,
- 88, 0, 443,
- 89, 0, 444,
- 90, 0, 445,
- 91, 0, 446,
- 92, 0, 447,
- 97, 0, 1121
+ -1, 1, 454,
+ 54, 0, 615,
+ 74, 0, 616,
+ 75, 0, 617,
+ 76, 0, 403,
+ 77, 0, 404,
+ 78, 0, 405,
+ 79, 0, 406,
+ 80, 0, 407,
+ 81, 0, 408,
+ 82, 0, 409,
+ 83, 0, 618,
+ 84, 0, 411,
+ 85, 0, 412,
+ 86, 0, 413,
+ 87, 0, 414,
+ 88, 0, 415,
+ 89, 0, 416,
+ 90, 0, 417,
+ 91, 0, 418,
+ 92, 0, 419,
+ 97, 0, 1093
};
-static int parser_action_row981[] = {
+static int parser_action_row953[] = {
1,
- -1, 1, 437
+ -1, 1, 430
};
-static int parser_action_row982[] = {
+static int parser_action_row954[] = {
23,
- -1, 1, 463,
- 54, 0, 643,
- 74, 0, 644,
- 75, 0, 645,
- 76, 0, 431,
- 77, 0, 432,
- 78, 0, 433,
- 79, 0, 434,
- 80, 0, 435,
- 81, 0, 436,
- 82, 0, 437,
- 83, 0, 646,
- 84, 0, 439,
- 85, 0, 440,
- 86, 0, 441,
- 87, 0, 442,
- 88, 0, 443,
- 89, 0, 444,
- 90, 0, 445,
- 91, 0, 446,
- 92, 0, 447,
- 96, 0, 53,
- 97, 0, 1122
+ -1, 1, 456,
+ 54, 0, 615,
+ 74, 0, 616,
+ 75, 0, 617,
+ 76, 0, 403,
+ 77, 0, 404,
+ 78, 0, 405,
+ 79, 0, 406,
+ 80, 0, 407,
+ 81, 0, 408,
+ 82, 0, 409,
+ 83, 0, 618,
+ 84, 0, 411,
+ 85, 0, 412,
+ 86, 0, 413,
+ 87, 0, 414,
+ 88, 0, 415,
+ 89, 0, 416,
+ 90, 0, 417,
+ 91, 0, 418,
+ 92, 0, 419,
+ 96, 0, 53,
+ 97, 0, 1094
};
-static int parser_action_row983[] = {
+static int parser_action_row955[] = {
1,
- -1, 1, 390
+ -1, 1, 383
};
-static int parser_action_row984[] = {
+static int parser_action_row956[] = {
1,
- -1, 1, 392
+ -1, 1, 385
};
-static int parser_action_row985[] = {
+static int parser_action_row957[] = {
1,
- -1, 1, 389
+ -1, 1, 382
};
-static int parser_action_row986[] = {
- 32,
- -1, 1, 524,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+static int parser_action_row958[] = {
+ 25,
+ -1, 1, 517,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row987[] = {
+static int parser_action_row959[] = {
2,
- -1, 3, 986,
- 23, 0, 1124
+ -1, 3, 958,
+ 23, 0, 1096
};
-static int parser_action_row988[] = {
+static int parser_action_row960[] = {
2,
- -1, 3, 987,
- 28, 0, 1125
+ -1, 3, 959,
+ 28, 0, 1097
};
-static int parser_action_row989[] = {
- 29,
- -1, 1, 464,
- 12, 0, 1126,
- 22, 0, 1127,
- 31, 0, 1128,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row961[] = {
+ 22,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 22, 0, 1099,
+ 31, 0, 1100,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row990[] = {
+static int parser_action_row962[] = {
1,
- -1, 1, 388
+ -1, 1, 381
};
-static int parser_action_row991[] = {
+static int parser_action_row963[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row992[] = {
+static int parser_action_row964[] = {
1,
- -1, 1, 395
+ -1, 1, 388
};
-static int parser_action_row993[] = {
+static int parser_action_row965[] = {
2,
- -1, 3, 992,
- 97, 0, 1172
+ -1, 3, 964,
+ 97, 0, 1137
};
-static int parser_action_row994[] = {
+static int parser_action_row966[] = {
5,
-1, 1, 30,
- 0, 0, 94,
- 1, 0, 95,
+ 0, 0, 87,
+ 1, 0, 88,
13, 0, 32,
- 95, 0, 96
+ 95, 0, 89
};
-static int parser_action_row995[] = {
+static int parser_action_row967[] = {
4,
- -1, 3, 994,
- 0, 0, 94,
- 1, 0, 95,
- 95, 0, 96
+ -1, 3, 966,
+ 0, 0, 87,
+ 1, 0, 88,
+ 95, 0, 89
};
-static int parser_action_row996[] = {
+static int parser_action_row968[] = {
2,
- -1, 1, 458,
- 58, 0, 227
+ -1, 1, 451,
+ 58, 0, 213
};
-static int parser_action_row997[] = {
+static int parser_action_row969[] = {
1,
-1, 1, 18
};
-static int parser_action_row998[] = {
+static int parser_action_row970[] = {
4,
- -1, 3, 997,
- 0, 0, 94,
- 1, 0, 95,
- 95, 0, 96
+ -1, 3, 969,
+ 0, 0, 87,
+ 1, 0, 88,
+ 95, 0, 89
};
-static int parser_action_row999[] = {
+static int parser_action_row971[] = {
1,
-1, 1, 107
};
-static int parser_action_row1000[] = {
+static int parser_action_row972[] = {
2,
-1, 1, 115,
- 97, 0, 1178
+ 97, 0, 1143
};
-static int parser_action_row1001[] = {
+static int parser_action_row973[] = {
3,
- -1, 3, 1000,
- 47, 0, 420,
- 96, 0, 421
+ -1, 3, 972,
+ 47, 0, 392,
+ 96, 0, 393
};
-static int parser_action_row1002[] = {
+static int parser_action_row974[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1003[] = {
+static int parser_action_row975[] = {
5,
-1, 1, 30,
- 0, 0, 94,
- 1, 0, 95,
+ 0, 0, 87,
+ 1, 0, 88,
13, 0, 32,
- 95, 0, 96
+ 95, 0, 89
};
-static int parser_action_row1004[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row976[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 613,
+ 9, 0, 585,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1005[] = {
+static int parser_action_row977[] = {
3,
-1, 1, 124,
- 4, 0, 1001,
- 15, 0, 1186
+ 4, 0, 973,
+ 15, 0, 1151
};
-static int parser_action_row1006[] = {
+static int parser_action_row978[] = {
3,
- -1, 3, 1005,
- 28, 0, 90,
- 115, 0, 91
+ -1, 3, 977,
+ 28, 0, 83,
+ 108, 0, 84
};
-static int parser_action_row1007[] = {
+static int parser_action_row979[] = {
1,
- -1, 1, 499
+ -1, 1, 492
};
-static int parser_action_row1008[] = {
+static int parser_action_row980[] = {
1,
-1, 1, 111
};
-static int parser_action_row1009[] = {
+static int parser_action_row981[] = {
1,
- -1, 1, 471
+ -1, 1, 464
};
-static int parser_action_row1010[] = {
+static int parser_action_row982[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1011[] = {
+static int parser_action_row983[] = {
2,
-1, 1, 75,
9, 1, 45
};
-static int parser_action_row1012[] = {
+static int parser_action_row984[] = {
2,
- -1, 3, 1011,
- 9, 0, 1190
+ -1, 3, 983,
+ 9, 0, 1155
};
-static int parser_action_row1013[] = {
+static int parser_action_row985[] = {
1,
- -1, 1, 1086
+ -1, 1, 1058
};
-static int parser_action_row1014[] = {
+static int parser_action_row986[] = {
4,
- -1, 3, 1013,
- 0, 0, 94,
- 1, 0, 95,
- 95, 0, 96
+ -1, 3, 985,
+ 0, 0, 87,
+ 1, 0, 88,
+ 95, 0, 89
};
-static int parser_action_row1015[] = {
+static int parser_action_row987[] = {
4,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
95, 0, 3
};
-static int parser_action_row1016[] = {
+static int parser_action_row988[] = {
1,
-1, 1, 74
};
-static int parser_action_row1017[] = {
+static int parser_action_row989[] = {
1,
- -1, 1, 492
+ -1, 1, 485
};
-static int parser_action_row1018[] = {
+static int parser_action_row990[] = {
5,
-1, 1, 30,
- 6, 0, 1193,
+ 6, 0, 1158,
9, 1, 46,
13, 0, 32,
- 97, 0, 1194
+ 97, 0, 1159
};
-static int parser_action_row1019[] = {
+static int parser_action_row991[] = {
5,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
- 9, 1, 493,
+ 9, 1, 486,
95, 0, 3
};
-static int parser_action_row1020[] = {
+static int parser_action_row992[] = {
1,
- -1, 1, 466
+ -1, 1, 459
};
-static int parser_action_row1021[] = {
+static int parser_action_row993[] = {
2,
- -1, 1, 468,
- 58, 0, 226
+ -1, 1, 461,
+ 58, 0, 212
};
-static int parser_action_row1022[] = {
+static int parser_action_row994[] = {
2,
- -1, 3, 1021,
- 96, 0, 1201
+ -1, 3, 993,
+ 96, 0, 1166
};
-static int parser_action_row1023[] = {
+static int parser_action_row995[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1024[] = {
+static int parser_action_row996[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1025[] = {
+static int parser_action_row997[] = {
1,
-1, 1, 210
};
-static int parser_action_row1026[] = {
+static int parser_action_row998[] = {
1,
-1, 1, 229
};
-static int parser_action_row1027[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row999[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1028[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1000[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1029[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1001[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1030[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1002[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1031[] = {
+static int parser_action_row1003[] = {
1,
-1, 1, 194
};
-static int parser_action_row1032[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1004[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1033[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1005[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1034[] = {
+static int parser_action_row1006[] = {
13,
-1, 1, 334,
- 59, 0, 1210,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ 59, 0, 1175,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row1035[] = {
+static int parser_action_row1007[] = {
1,
-1, 1, 184
};
-static int parser_action_row1036[] = {
+static int parser_action_row1008[] = {
1,
-1, 1, 196
};
-static int parser_action_row1037[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1009[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1038[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1010[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1039[] = {
+static int parser_action_row1011[] = {
13,
-1, 1, 338,
- 59, 0, 1214,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ 59, 0, 1179,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row1040[] = {
+static int parser_action_row1012[] = {
1,
-1, 1, 186
};
-static int parser_action_row1041[] = {
- 31,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 510,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row1013[] = {
+ 24,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 482,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row1042[] = {
- 45,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 132,
+static int parser_action_row1014[] = {
+ 38,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 125,
54, 1, 337,
- 59, 0, 1217,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239,
+ 59, 0, 1182,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225,
73, 1, 337,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row1043[] = {
+static int parser_action_row1015[] = {
1,
- -1, 1, 445
+ -1, 1, 438
};
-static int parser_action_row1044[] = {
+static int parser_action_row1016[] = {
1,
-1, 1, 221
};
-static int parser_action_row1045[] = {
+static int parser_action_row1017[] = {
1,
-1, 1, 240
};
-static int parser_action_row1046[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1018[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1047[] = {
+static int parser_action_row1019[] = {
3,
- -1, 1, 783,
- 52, 0, 295,
- 58, 0, 227
+ -1, 1, 769,
+ 52, 0, 274,
+ 58, 0, 213
};
-static int parser_action_row1048[] = {
+static int parser_action_row1020[] = {
2,
- -1, 3, 1047,
- 97, 0, 1223
+ -1, 3, 1019,
+ 97, 0, 1188
};
-static int parser_action_row1049[] = {
+static int parser_action_row1021[] = {
3,
- -1, 3, 1048,
+ -1, 3, 1020,
96, 0, 53,
- 97, 0, 1224
+ 97, 0, 1189
};
-static int parser_action_row1050[] = {
+static int parser_action_row1022[] = {
3,
- -1, 1, 754,
- 54, 1, 757,
- 73, 1, 757
+ -1, 1, 740,
+ 54, 1, 743,
+ 73, 1, 743
};
-static int parser_action_row1051[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1023[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 537,
+ 97, 0, 509,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1052[] = {
+static int parser_action_row1024[] = {
1,
- -1, 1, 1109
+ -1, 1, 1081
};
-static int parser_action_row1053[] = {
+static int parser_action_row1025[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1054[] = {
+static int parser_action_row1026[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1055[] = {
+static int parser_action_row1027[] = {
1,
- -1, 1, 761
+ -1, 1, 747
};
-static int parser_action_row1056[] = {
+static int parser_action_row1028[] = {
1,
- -1, 1, 765
+ -1, 1, 751
};
-static int parser_action_row1057[] = {
+static int parser_action_row1029[] = {
2,
- -1, 1, 764,
- 52, 0, 295
+ -1, 1, 750,
+ 52, 0, 274
};
-static int parser_action_row1058[] = {
+static int parser_action_row1030[] = {
1,
-1, 1, 206
};
-static int parser_action_row1059[] = {
+static int parser_action_row1031[] = {
2,
-1, 1, 193,
- 24, 1, 948
+ 24, 1, 920
};
-static int parser_action_row1060[] = {
+static int parser_action_row1032[] = {
3,
-1, 1, 158,
- 24, 1, 920,
- 49, 1, 1005
+ 24, 1, 892,
+ 49, 1, 977
};
-static int parser_action_row1061[] = {
- 37,
- -1, 1, 464,
- 9, 0, 1230,
+static int parser_action_row1033[] = {
+ 30,
+ -1, 1, 457,
+ 9, 0, 1195,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1062[] = {
+static int parser_action_row1034[] = {
1,
- -1, 1, 957
+ -1, 1, 929
};
-static int parser_action_row1063[] = {
+static int parser_action_row1035[] = {
1,
- -1, 1, 921
+ -1, 1, 893
};
-static int parser_action_row1064[] = {
+static int parser_action_row1036[] = {
2,
- -1, 3, 1063,
- 49, 0, 209
+ -1, 3, 1035,
+ 49, 0, 195
};
-static int parser_action_row1065[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1037[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1066[] = {
+static int parser_action_row1038[] = {
1,
-1, 1, 261
};
-static int parser_action_row1067[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1039[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1068[] = {
+static int parser_action_row1040[] = {
1,
- -1, 1, 960
+ -1, 1, 932
};
-static int parser_action_row1069[] = {
+static int parser_action_row1041[] = {
2,
- -1, 3, 1068,
- 49, 0, 209
+ -1, 3, 1040,
+ 49, 0, 195
};
-static int parser_action_row1070[] = {
+static int parser_action_row1042[] = {
3,
- -1, 3, 1069,
- 52, 0, 364,
- 97, 0, 365
+ -1, 3, 1041,
+ 52, 0, 336,
+ 97, 0, 337
};
-static int parser_action_row1071[] = {
+static int parser_action_row1043[] = {
2,
-1, 1, 170,
- 24, 1, 925
+ 24, 1, 897
};
-static int parser_action_row1072[] = {
+static int parser_action_row1044[] = {
2,
-1, 1, 175,
- 24, 1, 930
+ 24, 1, 902
};
-static int parser_action_row1073[] = {
+static int parser_action_row1045[] = {
2,
-1, 1, 172,
- 24, 1, 927
+ 24, 1, 899
};
-static int parser_action_row1074[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1046[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1075[] = {
+static int parser_action_row1047[] = {
2,
-1, 1, 280,
- 24, 0, 1238
+ 24, 0, 1203
};
-static int parser_action_row1076[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1048[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 417,
+ 97, 0, 389,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1077[] = {
+static int parser_action_row1049[] = {
3,
- -1, 3, 1076,
- 47, 0, 420,
- 96, 0, 421
+ -1, 3, 1048,
+ 47, 0, 392,
+ 96, 0, 393
};
-static int parser_action_row1078[] = {
+static int parser_action_row1050[] = {
2,
-1, 1, 187,
- 24, 1, 942
+ 24, 1, 914
};
-static int parser_action_row1079[] = {
+static int parser_action_row1051[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1080[] = {
- 33,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 132,
+static int parser_action_row1052[] = {
+ 26,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 125,
54, 1, 349,
73, 1, 349,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row1081[] = {
- 31,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 510,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row1053[] = {
+ 24,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 482,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row1082[] = {
- 45,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 132,
+static int parser_action_row1054[] = {
+ 38,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 125,
54, 1, 343,
- 59, 0, 512,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239,
+ 59, 0, 484,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225,
73, 1, 343,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row1083[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row1055[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 613,
+ 9, 0, 585,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1084[] = {
+static int parser_action_row1056[] = {
3,
- -1, 3, 1083,
- 9, 0, 910,
- 24, 0, 1246
+ -1, 3, 1055,
+ 9, 0, 882,
+ 24, 0, 1211
};
-static int parser_action_row1085[] = {
+static int parser_action_row1057[] = {
4,
- -1, 3, 1084,
+ -1, 3, 1056,
0, 0, 1,
1, 0, 2,
95, 0, 3
};
-static int parser_action_row1086[] = {
+static int parser_action_row1058[] = {
1,
-1, 1, 265
};
-static int parser_action_row1087[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row1059[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 613,
+ 9, 0, 585,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1088[] = {
- 31,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 510,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row1060[] = {
+ 24,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 482,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row1089[] = {
- 46,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 132,
+static int parser_action_row1061[] = {
+ 39,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 125,
54, 1, 347,
- 58, 0, 227,
- 59, 0, 517,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239,
+ 58, 0, 213,
+ 59, 0, 489,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225,
73, 1, 347,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row1090[] = {
+static int parser_action_row1062[] = {
3,
- -1, 1, 462,
- 12, 0, 1252,
- 97, 0, 1253
+ -1, 1, 455,
+ 12, 0, 1217,
+ 97, 0, 1218
};
-static int parser_action_row1091[] = {
+static int parser_action_row1063[] = {
1,
-1, 1, 269
};
-static int parser_action_row1092[] = {
+static int parser_action_row1064[] = {
1,
- -1, 1, 453
+ -1, 1, 446
};
-static int parser_action_row1093[] = {
+static int parser_action_row1065[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1094[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1066[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1095[] = {
+static int parser_action_row1067[] = {
3,
-1, 1, 327,
54, 1, 330,
73, 1, 330
};
-static int parser_action_row1096[] = {
+static int parser_action_row1068[] = {
1,
-1, 1, 334
};
-static int parser_action_row1097[] = {
+static int parser_action_row1069[] = {
1,
-1, 1, 338
};
-static int parser_action_row1098[] = {
+static int parser_action_row1070[] = {
2,
-1, 1, 337,
- 52, 0, 295
+ 52, 0, 274
};
-static int parser_action_row1099[] = {
+static int parser_action_row1071[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1100[] = {
+static int parser_action_row1072[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1101[] = {
+static int parser_action_row1073[] = {
1,
- -1, 1, 1094
+ -1, 1, 1066
};
-static int parser_action_row1102[] = {
+static int parser_action_row1074[] = {
2,
-1, 1, 151,
- 56, 0, 1099
+ 56, 0, 1071
};
-static int parser_action_row1103[] = {
+static int parser_action_row1075[] = {
2,
- -1, 3, 1102,
- 55, 0, 1260
+ -1, 3, 1074,
+ 55, 0, 1225
};
-static int parser_action_row1104[] = {
+static int parser_action_row1076[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1105[] = {
+static int parser_action_row1077[] = {
2,
- -1, 1, 815,
- 94, 0, 618
+ -1, 1, 794,
+ 94, 0, 590
};
-static int parser_action_row1106[] = {
+static int parser_action_row1078[] = {
1,
-1, 1, 355
};
-static int parser_action_row1107[] = {
+static int parser_action_row1079[] = {
2,
-1, 1, 358,
- 52, 0, 295
+ 52, 0, 274
};
-static int parser_action_row1108[] = {
+static int parser_action_row1080[] = {
3,
-1, 1, 362,
- 52, 0, 295,
- 58, 0, 227
+ 52, 0, 274,
+ 58, 0, 213
};
-static int parser_action_row1109[] = {
+static int parser_action_row1081[] = {
2,
- -1, 3, 1108,
- 97, 0, 1265
+ -1, 3, 1080,
+ 97, 0, 1230
};
-static int parser_action_row1110[] = {
- 19,
- -1, 1, 411,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 52, 0, 1266,
- 94, 0, 216,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row1082[] = {
+ 12,
+ -1, 1, 404,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 52, 0, 1231,
+ 94, 0, 202,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row1111[] = {
+static int parser_action_row1083[] = {
1,
- -1, 1, 409
+ -1, 1, 402
};
-static int parser_action_row1112[] = {
+static int parser_action_row1084[] = {
2,
-1, 1, 30,
13, 0, 32
};
-static int parser_action_row1113[] = {
+static int parser_action_row1085[] = {
1,
- -1, 1, 1105
+ -1, 1, 1077
};
-static int parser_action_row1114[] = {
- 60,
- -1, 1, 464,
- 12, 0, 182,
+static int parser_action_row1086[] = {
+ 53,
+ -1, 1, 457,
+ 12, 0, 168,
15, 0, 33,
16, 0, 34,
- 22, 0, 183,
+ 22, 0, 169,
25, 0, 36,
26, 0, 37,
27, 0, 38,
- 31, 0, 184,
- 33, 0, 423,
- 34, 0, 424,
- 35, 0, 425,
- 36, 0, 426,
+ 31, 0, 170,
+ 33, 0, 395,
+ 34, 0, 396,
+ 35, 0, 397,
+ 36, 0, 398,
37, 0, 43,
- 38, 0, 185,
- 40, 0, 186,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 47, 0, 420,
- 48, 0, 187,
+ 47, 0, 392,
+ 48, 0, 173,
50, 0, 49,
- 51, 0, 427,
+ 51, 0, 399,
52, 0, 51,
- 54, 0, 428,
- 74, 0, 429,
- 75, 0, 430,
- 76, 0, 431,
- 77, 0, 432,
- 78, 0, 433,
- 79, 0, 434,
- 80, 0, 435,
- 81, 0, 436,
- 82, 0, 437,
- 83, 0, 438,
- 84, 0, 439,
- 85, 0, 440,
- 86, 0, 441,
- 87, 0, 442,
- 88, 0, 443,
- 89, 0, 444,
- 90, 0, 445,
- 91, 0, 446,
- 92, 0, 447,
- 94, 0, 216,
- 96, 0, 448,
- 97, 0, 449,
+ 54, 0, 400,
+ 74, 0, 401,
+ 75, 0, 402,
+ 76, 0, 403,
+ 77, 0, 404,
+ 78, 0, 405,
+ 79, 0, 406,
+ 80, 0, 407,
+ 81, 0, 408,
+ 82, 0, 409,
+ 83, 0, 410,
+ 84, 0, 411,
+ 85, 0, 412,
+ 86, 0, 413,
+ 87, 0, 414,
+ 88, 0, 415,
+ 89, 0, 416,
+ 90, 0, 417,
+ 91, 0, 418,
+ 92, 0, 419,
+ 94, 0, 202,
+ 96, 0, 420,
+ 97, 0, 421,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1115[] = {
+static int parser_action_row1087[] = {
1,
-1, 1, 275
};
-static int parser_action_row1116[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1088[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1117[] = {
+static int parser_action_row1089[] = {
1,
-1, 1, 273
};
-static int parser_action_row1118[] = {
+static int parser_action_row1090[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1119[] = {
+static int parser_action_row1091[] = {
2,
- -1, 3, 1118,
- 55, 0, 1275
+ -1, 3, 1090,
+ 55, 0, 1240
};
-static int parser_action_row1120[] = {
+static int parser_action_row1092[] = {
1,
- -1, 1, 1024
+ -1, 1, 996
};
-static int parser_action_row1121[] = {
- 32,
- -1, 1, 524,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+static int parser_action_row1093[] = {
+ 25,
+ -1, 1, 517,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1122[] = {
+static int parser_action_row1094[] = {
14,
-1, 1, 335,
- 52, 0, 295,
- 59, 0, 1276,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ 52, 0, 274,
+ 59, 0, 1241,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row1123[] = {
+static int parser_action_row1095[] = {
15,
-1, 1, 339,
- 52, 0, 295,
- 58, 0, 227,
- 59, 0, 1277,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ 52, 0, 274,
+ 58, 0, 213,
+ 59, 0, 1242,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row1124[] = {
+static int parser_action_row1096[] = {
22,
- -1, 1, 462,
- 54, 0, 643,
- 74, 0, 644,
- 75, 0, 645,
- 76, 0, 431,
- 77, 0, 432,
- 78, 0, 433,
- 79, 0, 434,
- 80, 0, 435,
- 81, 0, 436,
- 82, 0, 437,
- 83, 0, 646,
- 84, 0, 439,
- 85, 0, 440,
- 86, 0, 441,
- 87, 0, 442,
- 88, 0, 443,
- 89, 0, 444,
- 90, 0, 445,
- 91, 0, 446,
- 92, 0, 447,
- 97, 0, 1278
+ -1, 1, 455,
+ 54, 0, 615,
+ 74, 0, 616,
+ 75, 0, 617,
+ 76, 0, 403,
+ 77, 0, 404,
+ 78, 0, 405,
+ 79, 0, 406,
+ 80, 0, 407,
+ 81, 0, 408,
+ 82, 0, 409,
+ 83, 0, 618,
+ 84, 0, 411,
+ 85, 0, 412,
+ 86, 0, 413,
+ 87, 0, 414,
+ 88, 0, 415,
+ 89, 0, 416,
+ 90, 0, 417,
+ 91, 0, 418,
+ 92, 0, 419,
+ 97, 0, 1243
};
-static int parser_action_row1125[] = {
+static int parser_action_row1097[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1126[] = {
+static int parser_action_row1098[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1127[] = {
+static int parser_action_row1099[] = {
2,
- -1, 1, 602,
- 52, 0, 295
+ -1, 1, 595,
+ 52, 0, 274
};
-static int parser_action_row1128[] = {
+static int parser_action_row1100[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1129[] = {
+static int parser_action_row1101[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1130[] = {
+static int parser_action_row1102[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1131[] = {
+static int parser_action_row1103[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1132[] = {
+static int parser_action_row1104[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row1133[] = {
+static int parser_action_row1105[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row1134[] = {
+static int parser_action_row1106[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row1135[] = {
+static int parser_action_row1107[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row1136[] = {
- 22,
- -1, 1, 464,
- 12, 0, 1126,
- 38, 0, 1290,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
+static int parser_action_row1108[] = {
+ 15,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 38, 0, 1255,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
52, 0, 51,
96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1137[] = {
- 27,
- -1, 1, 464,
- 12, 0, 1126,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1109[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1138[] = {
- 27,
- -1, 1, 464,
- 12, 0, 1126,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1110[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1139[] = {
- 27,
- -1, 1, 464,
- 12, 0, 1126,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1111[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1140[] = {
+static int parser_action_row1112[] = {
3,
- -1, 1, 584,
- 52, 0, 295,
- 58, 0, 227
-};
-static int parser_action_row1141[] = {
- 2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 577,
+ 52, 0, 274,
+ 58, 0, 213
};
-static int parser_action_row1142[] = {
+static int parser_action_row1113[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row1143[] = {
+static int parser_action_row1114[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row1144[] = {
+static int parser_action_row1115[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row1145[] = {
+static int parser_action_row1116[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row1146[] = {
- 2,
- -1, 1, 411,
- 94, 0, 216
-};
-static int parser_action_row1147[] = {
- 2,
- -1, 1, 411,
- 94, 0, 216
-};
-static int parser_action_row1148[] = {
- 2,
- -1, 1, 411,
- 94, 0, 216
-};
-static int parser_action_row1149[] = {
- 2,
- -1, 1, 411,
- 94, 0, 216
-};
-static int parser_action_row1150[] = {
- 2,
- -1, 1, 411,
- 94, 0, 216
-};
-static int parser_action_row1151[] = {
- 2,
- -1, 1, 411,
- 94, 0, 216
-};
-static int parser_action_row1152[] = {
+static int parser_action_row1117[] = {
1,
- -1, 1, 633
+ -1, 1, 619
};
-static int parser_action_row1153[] = {
+static int parser_action_row1118[] = {
1,
- -1, 1, 632
+ -1, 1, 618
};
-static int parser_action_row1154[] = {
+static int parser_action_row1119[] = {
3,
- -1, 3, 1153,
- 41, 0, 1308,
- 98, 0, 1309
+ -1, 3, 1118,
+ 41, 0, 1266,
+ 98, 0, 1267
};
-static int parser_action_row1155[] = {
+static int parser_action_row1120[] = {
2,
- -1, 1, 461,
- 97, 0, 1310
+ -1, 1, 454,
+ 97, 0, 1268
};
-static int parser_action_row1156[] = {
+static int parser_action_row1121[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1157[] = {
+static int parser_action_row1122[] = {
4,
- -1, 1, 532,
- 29, 0, 1312,
- 30, 0, 1313,
- 32, 0, 1314
+ -1, 1, 525,
+ 29, 0, 1270,
+ 30, 0, 1271,
+ 32, 0, 1272
};
-static int parser_action_row1158[] = {
+static int parser_action_row1123[] = {
1,
- -1, 1, 534
+ -1, 1, 527
};
-static int parser_action_row1159[] = {
+static int parser_action_row1124[] = {
1,
- -1, 1, 539
+ -1, 1, 532
};
-static int parser_action_row1160[] = {
+static int parser_action_row1125[] = {
10,
- -1, 1, 541,
- 39, 0, 1315,
- 80, 0, 1316,
- 84, 0, 1317,
- 85, 0, 1318,
- 86, 0, 1319,
- 87, 0, 1320,
- 89, 0, 1321,
- 90, 0, 1322,
- 92, 0, 1323
+ -1, 1, 534,
+ 39, 0, 1273,
+ 80, 0, 1274,
+ 84, 0, 1275,
+ 85, 0, 1276,
+ 86, 0, 1277,
+ 87, 0, 1278,
+ 89, 0, 1279,
+ 90, 0, 1280,
+ 92, 0, 1281
};
-static int parser_action_row1161[] = {
+static int parser_action_row1126[] = {
2,
- -1, 1, 550,
- 81, 0, 1324
+ -1, 1, 543,
+ 81, 0, 1282
};
-static int parser_action_row1162[] = {
+static int parser_action_row1127[] = {
2,
- -1, 1, 552,
- 82, 0, 1325
+ -1, 1, 545,
+ 82, 0, 1283
};
-static int parser_action_row1163[] = {
+static int parser_action_row1128[] = {
3,
- -1, 1, 554,
- 88, 0, 1326,
- 91, 0, 1327
+ -1, 1, 547,
+ 88, 0, 1284,
+ 91, 0, 1285
};
-static int parser_action_row1164[] = {
+static int parser_action_row1129[] = {
3,
- -1, 1, 556,
- 74, 0, 1328,
- 75, 0, 1329
+ -1, 1, 549,
+ 74, 0, 1286,
+ 75, 0, 1287
};
-static int parser_action_row1165[] = {
+static int parser_action_row1130[] = {
4,
- -1, 1, 559,
- 76, 0, 1330,
- 78, 0, 1331,
- 79, 0, 1332
+ -1, 1, 552,
+ 76, 0, 1288,
+ 78, 0, 1289,
+ 79, 0, 1290
};
-static int parser_action_row1166[] = {
+static int parser_action_row1131[] = {
1,
- -1, 1, 562
+ -1, 1, 555
};
-static int parser_action_row1167[] = {
+static int parser_action_row1132[] = {
2,
- -1, 1, 566,
- 77, 0, 1333
+ -1, 1, 559,
+ 77, 0, 1291
};
-static int parser_action_row1168[] = {
+static int parser_action_row1133[] = {
1,
- -1, 1, 568
+ -1, 1, 561
};
-static int parser_action_row1169[] = {
+static int parser_action_row1134[] = {
2,
- -1, 1, 573,
- 73, 0, 1334
+ -1, 1, 566,
+ 73, 0, 1292
};
-static int parser_action_row1170[] = {
+static int parser_action_row1135[] = {
1,
- -1, 1, 578
+ -1, 1, 571
};
-static int parser_action_row1171[] = {
+static int parser_action_row1136[] = {
3,
- -1, 1, 463,
+ -1, 1, 456,
96, 0, 53,
- 97, 0, 1335
+ 97, 0, 1293
};
-static int parser_action_row1172[] = {
+static int parser_action_row1137[] = {
1,
- -1, 1, 396
+ -1, 1, 389
};
-static int parser_action_row1173[] = {
+static int parser_action_row1138[] = {
2,
- -1, 1, 459,
- 58, 0, 227
+ -1, 1, 452,
+ 58, 0, 213
};
-static int parser_action_row1174[] = {
+static int parser_action_row1139[] = {
2,
- -1, 3, 1173,
- 97, 0, 1337
+ -1, 3, 1138,
+ 97, 0, 1295
};
-static int parser_action_row1175[] = {
+static int parser_action_row1140[] = {
1,
-1, 1, 76
};
-static int parser_action_row1176[] = {
+static int parser_action_row1141[] = {
4,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
95, 0, 3
};
-static int parser_action_row1177[] = {
+static int parser_action_row1142[] = {
1,
-1, 1, 16
};
-static int parser_action_row1178[] = {
+static int parser_action_row1143[] = {
1,
-1, 1, 17
};
-static int parser_action_row1179[] = {
+static int parser_action_row1144[] = {
3,
- -1, 1, 411,
- 57, 0, 853,
- 94, 0, 216
+ -1, 1, 404,
+ 57, 0, 825,
+ 94, 0, 202
};
-static int parser_action_row1180[] = {
+static int parser_action_row1145[] = {
2,
- -1, 3, 1179,
- 53, 0, 1344
+ -1, 3, 1144,
+ 53, 0, 1302
};
-static int parser_action_row1181[] = {
+static int parser_action_row1146[] = {
4,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2,
- 56, 0, 1345
+ 56, 0, 1303
};
-static int parser_action_row1182[] = {
+static int parser_action_row1147[] = {
1,
-1, 1, 153
};
-static int parser_action_row1183[] = {
+static int parser_action_row1148[] = {
25,
- -1, 3, 1182,
- 41, 0, 1349,
- 47, 0, 420,
- 54, 0, 664,
- 74, 0, 665,
- 75, 0, 666,
- 76, 0, 667,
- 77, 0, 668,
- 78, 0, 669,
- 79, 0, 670,
- 80, 0, 671,
- 81, 0, 672,
- 82, 0, 673,
- 83, 0, 674,
- 84, 0, 675,
- 85, 0, 676,
- 86, 0, 677,
- 87, 0, 678,
- 88, 0, 679,
- 89, 0, 680,
- 90, 0, 681,
- 91, 0, 682,
- 92, 0, 683,
- 96, 0, 448,
- 97, 0, 684
+ -1, 3, 1147,
+ 41, 0, 1307,
+ 47, 0, 392,
+ 54, 0, 636,
+ 74, 0, 637,
+ 75, 0, 638,
+ 76, 0, 639,
+ 77, 0, 640,
+ 78, 0, 641,
+ 79, 0, 642,
+ 80, 0, 643,
+ 81, 0, 644,
+ 82, 0, 645,
+ 83, 0, 646,
+ 84, 0, 647,
+ 85, 0, 648,
+ 86, 0, 649,
+ 87, 0, 650,
+ 88, 0, 651,
+ 89, 0, 652,
+ 90, 0, 653,
+ 91, 0, 654,
+ 92, 0, 655,
+ 96, 0, 420,
+ 97, 0, 656
};
-static int parser_action_row1184[] = {
+static int parser_action_row1149[] = {
4,
-1, 1, 79,
- 0, 1, 502,
- 1, 1, 502,
- 95, 1, 502
+ 0, 1, 495,
+ 1, 1, 495,
+ 95, 1, 495
};
-static int parser_action_row1185[] = {
+static int parser_action_row1150[] = {
4,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
95, 0, 3
};
-static int parser_action_row1186[] = {
+static int parser_action_row1151[] = {
2,
- -1, 1, 475,
- 9, 0, 1356
+ -1, 1, 468,
+ 9, 0, 1314
};
-static int parser_action_row1187[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row1152[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 613,
+ 9, 0, 585,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1188[] = {
+static int parser_action_row1153[] = {
3,
- -1, 3, 1187,
- 28, 0, 90,
- 115, 0, 91
+ -1, 3, 1152,
+ 28, 0, 83,
+ 108, 0, 84
};
-static int parser_action_row1189[] = {
+static int parser_action_row1154[] = {
1,
- -1, 1, 500
+ -1, 1, 493
};
-static int parser_action_row1190[] = {
+static int parser_action_row1155[] = {
2,
-1, 1, 39,
- 96, 0, 1360
+ 96, 0, 1318
};
-static int parser_action_row1191[] = {
+static int parser_action_row1156[] = {
1,
-1, 1, 26
};
-static int parser_action_row1192[] = {
+static int parser_action_row1157[] = {
1,
-1, 1, 47
};
-static int parser_action_row1193[] = {
+static int parser_action_row1158[] = {
2,
- -1, 3, 1192,
- 9, 0, 1363
+ -1, 3, 1157,
+ 9, 0, 1321
};
-static int parser_action_row1194[] = {
+static int parser_action_row1159[] = {
1,
- -1, 1, 1074
+ -1, 1, 1046
};
-static int parser_action_row1195[] = {
+static int parser_action_row1160[] = {
1,
- -1, 1, 1073
+ -1, 1, 1045
};
-static int parser_action_row1196[] = {
+static int parser_action_row1161[] = {
5,
-1, 1, 81,
- 18, 0, 254,
- 19, 0, 255,
- 20, 0, 256,
- 21, 0, 257
+ 18, 0, 233,
+ 19, 0, 234,
+ 20, 0, 235,
+ 21, 0, 236
};
-static int parser_action_row1197[] = {
- 62,
- -1, 1, 426,
- 12, 0, 122,
+static int parser_action_row1162[] = {
+ 55,
+ -1, 1, 419,
+ 12, 0, 115,
15, 0, 33,
16, 0, 34,
- 22, 0, 123,
+ 22, 0, 116,
25, 0, 36,
26, 0, 37,
27, 0, 38,
- 31, 0, 124,
- 33, 0, 1365,
- 34, 0, 1366,
- 35, 0, 1367,
- 36, 0, 1368,
+ 31, 0, 117,
+ 33, 0, 1323,
+ 34, 0, 1324,
+ 35, 0, 1325,
+ 36, 0, 1326,
37, 0, 43,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 47, 0, 420,
- 48, 0, 131,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 47, 0, 392,
+ 48, 0, 124,
50, 0, 49,
- 51, 0, 1369,
- 52, 0, 1370,
- 54, 0, 643,
- 74, 0, 1371,
- 75, 0, 1372,
- 76, 0, 431,
- 77, 0, 432,
- 78, 0, 433,
- 79, 0, 434,
- 80, 0, 435,
- 81, 0, 436,
- 82, 0, 437,
- 83, 0, 1373,
- 84, 0, 439,
- 85, 0, 440,
- 86, 0, 441,
- 87, 0, 442,
- 88, 0, 443,
- 89, 0, 444,
- 90, 0, 445,
- 91, 0, 446,
- 92, 0, 447,
- 94, 0, 216,
- 96, 0, 448,
- 97, 0, 1374,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+ 51, 0, 1327,
+ 52, 0, 1328,
+ 54, 0, 615,
+ 74, 0, 1329,
+ 75, 0, 1330,
+ 76, 0, 403,
+ 77, 0, 404,
+ 78, 0, 405,
+ 79, 0, 406,
+ 80, 0, 407,
+ 81, 0, 408,
+ 82, 0, 409,
+ 83, 0, 1331,
+ 84, 0, 411,
+ 85, 0, 412,
+ 86, 0, 413,
+ 87, 0, 414,
+ 88, 0, 415,
+ 89, 0, 416,
+ 90, 0, 417,
+ 91, 0, 418,
+ 92, 0, 419,
+ 94, 0, 202,
+ 96, 0, 420,
+ 97, 0, 1332,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row1198[] = {
+static int parser_action_row1163[] = {
1,
-1, 1, 75
};
-static int parser_action_row1199[] = {
+static int parser_action_row1164[] = {
1,
- -1, 1, 1087
+ -1, 1, 1059
};
-static int parser_action_row1200[] = {
+static int parser_action_row1165[] = {
4,
-1, 1, 30,
- 6, 0, 1193,
+ 6, 0, 1158,
13, 0, 32,
- 97, 0, 1194
+ 97, 0, 1159
};
-static int parser_action_row1201[] = {
+static int parser_action_row1166[] = {
1,
-1, 1, 44
};
-static int parser_action_row1202[] = {
+static int parser_action_row1167[] = {
1,
- -1, 1, 467
+ -1, 1, 460
};
-static int parser_action_row1203[] = {
+static int parser_action_row1168[] = {
2,
- -1, 3, 1202,
- 45, 0, 1394
+ -1, 3, 1167,
+ 45, 0, 1352
};
-static int parser_action_row1204[] = {
+static int parser_action_row1169[] = {
4,
- -1, 3, 1203,
- 31, 0, 1395,
- 47, 0, 420,
- 96, 0, 421
+ -1, 3, 1168,
+ 31, 0, 1353,
+ 47, 0, 392,
+ 96, 0, 393
};
-static int parser_action_row1205[] = {
+static int parser_action_row1170[] = {
1,
-1, 1, 209
};
-static int parser_action_row1206[] = {
+static int parser_action_row1171[] = {
1,
-1, 1, 228
};
-static int parser_action_row1207[] = {
+static int parser_action_row1172[] = {
1,
-1, 1, 207
};
-static int parser_action_row1208[] = {
+static int parser_action_row1173[] = {
1,
-1, 1, 226
};
-static int parser_action_row1209[] = {
+static int parser_action_row1174[] = {
1,
-1, 1, 212
};
-static int parser_action_row1210[] = {
+static int parser_action_row1175[] = {
1,
-1, 1, 231
};
-static int parser_action_row1211[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1176[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1212[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1177[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1213[] = {
+static int parser_action_row1178[] = {
1,
-1, 1, 216
};
-static int parser_action_row1214[] = {
+static int parser_action_row1179[] = {
1,
-1, 1, 235
};
-static int parser_action_row1215[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1180[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1216[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1181[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1217[] = {
+static int parser_action_row1182[] = {
1,
-1, 1, 195
};
-static int parser_action_row1218[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1183[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1219[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1184[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1220[] = {
+static int parser_action_row1185[] = {
13,
-1, 1, 336,
- 59, 0, 1403,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ 59, 0, 1361,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row1221[] = {
+static int parser_action_row1186[] = {
1,
-1, 1, 185
};
-static int parser_action_row1222[] = {
+static int parser_action_row1187[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1223[] = {
+static int parser_action_row1188[] = {
1,
- -1, 1, 782
+ -1, 1, 768
};
-static int parser_action_row1224[] = {
+static int parser_action_row1189[] = {
2,
- -1, 1, 785,
- 52, 0, 295
+ -1, 1, 771,
+ 52, 0, 274
};
-static int parser_action_row1225[] = {
+static int parser_action_row1190[] = {
3,
- -1, 1, 789,
- 52, 0, 295,
- 58, 0, 227
+ -1, 1, 775,
+ 52, 0, 274,
+ 58, 0, 213
};
-static int parser_action_row1226[] = {
+static int parser_action_row1191[] = {
2,
- -1, 3, 1225,
- 97, 0, 1408
+ -1, 3, 1190,
+ 97, 0, 1366
};
-static int parser_action_row1227[] = {
+static int parser_action_row1192[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1228[] = {
+static int parser_action_row1193[] = {
2,
- -1, 3, 1227,
- 45, 0, 1410
+ -1, 3, 1192,
+ 45, 0, 1368
};
-static int parser_action_row1229[] = {
+static int parser_action_row1194[] = {
4,
- -1, 3, 1228,
- 31, 0, 1411,
- 47, 0, 420,
- 96, 0, 421
+ -1, 3, 1193,
+ 31, 0, 1369,
+ 47, 0, 392,
+ 96, 0, 393
};
-static int parser_action_row1230[] = {
+static int parser_action_row1195[] = {
1,
- -1, 1, 763
+ -1, 1, 749
};
-static int parser_action_row1231[] = {
+static int parser_action_row1196[] = {
3,
-1, 1, 157,
- 24, 1, 919,
- 49, 1, 1004
+ 24, 1, 891,
+ 49, 1, 976
};
-static int parser_action_row1232[] = {
+static int parser_action_row1197[] = {
3,
-1, 1, 156,
- 24, 1, 918,
- 49, 1, 1003
+ 24, 1, 890,
+ 49, 1, 975
};
-static int parser_action_row1233[] = {
+static int parser_action_row1198[] = {
2,
-1, 1, 256,
- 24, 1, 956
+ 24, 1, 928
};
-static int parser_action_row1234[] = {
+static int parser_action_row1199[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1235[] = {
+static int parser_action_row1200[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1236[] = {
+static int parser_action_row1201[] = {
2,
-1, 1, 267,
- 24, 1, 959
+ 24, 1, 931
};
-static int parser_action_row1237[] = {
+static int parser_action_row1202[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1238[] = {
+static int parser_action_row1203[] = {
2,
-1, 1, 281,
- 24, 0, 1416
+ 24, 0, 1374
};
-static int parser_action_row1239[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row1204[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 1417,
- 12, 0, 911,
- 15, 0, 912,
+ 9, 0, 1375,
+ 12, 0, 883,
+ 15, 0, 884,
16, 0, 34,
- 22, 0, 913,
- 25, 0, 915,
- 26, 0, 916,
- 27, 0, 917,
- 33, 0, 918,
- 34, 0, 919,
- 35, 0, 920,
- 36, 0, 921,
- 37, 0, 922,
+ 22, 0, 885,
+ 25, 0, 887,
+ 26, 0, 888,
+ 27, 0, 889,
+ 33, 0, 890,
+ 34, 0, 891,
+ 35, 0, 892,
+ 36, 0, 893,
+ 37, 0, 894,
38, 0, 44,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 50, 0, 923,
- 51, 0, 924,
+ 50, 0, 895,
+ 51, 0, 896,
52, 0, 51,
54, 0, 52,
95, 0, 3,
96, 0, 53,
- 97, 0, 925,
+ 97, 0, 897,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1240[] = {
+static int parser_action_row1205[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1241[] = {
+static int parser_action_row1206[] = {
2,
- -1, 3, 1240,
- 57, 0, 1421
+ -1, 3, 1205,
+ 57, 0, 1379
};
-static int parser_action_row1242[] = {
+static int parser_action_row1207[] = {
5,
- -1, 1, 464,
- 12, 0, 1422,
- 46, 0, 693,
+ -1, 1, 457,
+ 12, 0, 1380,
+ 46, 0, 665,
96, 0, 53,
- 97, 0, 1423
+ 97, 0, 1381
};
-static int parser_action_row1243[] = {
+static int parser_action_row1208[] = {
2,
-1, 1, 191,
- 24, 1, 946
+ 24, 1, 918
};
-static int parser_action_row1244[] = {
+static int parser_action_row1209[] = {
2,
-1, 1, 197,
- 24, 1, 952
+ 24, 1, 924
};
-static int parser_action_row1245[] = {
+static int parser_action_row1210[] = {
2,
-1, 1, 188,
- 24, 1, 943
+ 24, 1, 915
};
-static int parser_action_row1246[] = {
+static int parser_action_row1211[] = {
1,
-1, 1, 262
};
-static int parser_action_row1247[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row1212[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 613,
+ 9, 0, 585,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1248[] = {
+static int parser_action_row1213[] = {
1,
-1, 1, 263
};
-static int parser_action_row1249[] = {
+static int parser_action_row1214[] = {
4,
- -1, 3, 1248,
+ -1, 3, 1213,
0, 0, 1,
1, 0, 2,
95, 0, 3
};
-static int parser_action_row1250[] = {
+static int parser_action_row1215[] = {
1,
-1, 1, 258
};
-static int parser_action_row1251[] = {
+static int parser_action_row1216[] = {
2,
-1, 1, 199,
- 24, 1, 954
+ 24, 1, 926
};
-static int parser_action_row1252[] = {
+static int parser_action_row1217[] = {
2,
-1, 1, 190,
- 24, 1, 945
+ 24, 1, 917
};
-static int parser_action_row1253[] = {
- 31,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 510,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row1218[] = {
+ 24,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 482,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row1254[] = {
- 45,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 132,
+static int parser_action_row1219[] = {
+ 38,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 125,
54, 1, 345,
- 59, 0, 715,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239,
+ 59, 0, 687,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225,
73, 1, 345,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row1255[] = {
+static int parser_action_row1220[] = {
2,
- -1, 3, 1254,
- 15, 0, 1429
+ -1, 3, 1219,
+ 15, 0, 1387
};
-static int parser_action_row1256[] = {
+static int parser_action_row1221[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1257[] = {
+static int parser_action_row1222[] = {
1,
-1, 1, 336
};
-static int parser_action_row1258[] = {
+static int parser_action_row1223[] = {
2,
- -1, 3, 1257,
- 55, 0, 1431
+ -1, 3, 1222,
+ 55, 0, 1389
};
-static int parser_action_row1259[] = {
+static int parser_action_row1224[] = {
3,
- -1, 3, 1258,
- 47, 0, 420,
- 96, 0, 421
+ -1, 3, 1223,
+ 47, 0, 392,
+ 96, 0, 393
};
-static int parser_action_row1260[] = {
+static int parser_action_row1225[] = {
1,
- -1, 1, 1095
+ -1, 1, 1067
};
-static int parser_action_row1261[] = {
+static int parser_action_row1226[] = {
2,
- -1, 1, 815,
- 94, 0, 618
+ -1, 1, 794,
+ 94, 0, 590
};
-static int parser_action_row1262[] = {
+static int parser_action_row1227[] = {
2,
- -1, 3, 1261,
- 53, 0, 1434
+ -1, 3, 1226,
+ 53, 0, 1392
};
-static int parser_action_row1263[] = {
+static int parser_action_row1228[] = {
1,
- -1, 1, 816
+ -1, 1, 795
};
-static int parser_action_row1264[] = {
+static int parser_action_row1229[] = {
1,
-1, 1, 357
};
-static int parser_action_row1265[] = {
+static int parser_action_row1230[] = {
1,
-1, 1, 361
};
-static int parser_action_row1266[] = {
+static int parser_action_row1231[] = {
2,
-1, 1, 360,
- 52, 0, 295
+ 52, 0, 274
};
-static int parser_action_row1267[] = {
+static int parser_action_row1232[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1268[] = {
+static int parser_action_row1233[] = {
1,
- -1, 1, 416
+ -1, 1, 409
};
-static int parser_action_row1269[] = {
+static int parser_action_row1234[] = {
1,
- -1, 1, 418
+ -1, 1, 411
};
-static int parser_action_row1270[] = {
+static int parser_action_row1235[] = {
1,
- -1, 1, 419
+ -1, 1, 412
};
-static int parser_action_row1271[] = {
+static int parser_action_row1236[] = {
1,
- -1, 1, 420
+ -1, 1, 413
};
-static int parser_action_row1272[] = {
+static int parser_action_row1237[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1273[] = {
+static int parser_action_row1238[] = {
2,
- -1, 1, 431,
- 56, 0, 1438
+ -1, 1, 424,
+ 56, 0, 1396
};
-static int parser_action_row1274[] = {
+static int parser_action_row1239[] = {
1,
-1, 1, 276
};
-static int parser_action_row1275[] = {
+static int parser_action_row1240[] = {
2,
- -1, 3, 1274,
- 55, 0, 1441
+ -1, 3, 1239,
+ 55, 0, 1399
};
-static int parser_action_row1276[] = {
+static int parser_action_row1241[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row1277[] = {
- 32,
- -1, 1, 524,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+static int parser_action_row1242[] = {
+ 25,
+ -1, 1, 517,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1278[] = {
- 32,
- -1, 1, 524,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+static int parser_action_row1243[] = {
+ 25,
+ -1, 1, 517,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1279[] = {
+static int parser_action_row1244[] = {
14,
-1, 1, 337,
- 52, 0, 295,
- 59, 0, 1443,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ 52, 0, 274,
+ 59, 0, 1401,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row1280[] = {
- 31,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 470,
- 27, 0, 471,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1245[] = {
+ 24,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 442,
+ 27, 0, 443,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1281[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1246[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1282[] = {
+static int parser_action_row1247[] = {
1,
- -1, 1, 600
+ -1, 1, 593
};
-static int parser_action_row1283[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1248[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1284[] = {
- 28,
- -1, 1, 464,
- 12, 0, 1126,
- 31, 0, 1128,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1249[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 31, 0, 1100,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1285[] = {
+static int parser_action_row1250[] = {
3,
- -1, 3, 1284,
- 47, 0, 1449,
- 96, 0, 1450
+ -1, 3, 1249,
+ 47, 0, 1407,
+ 96, 0, 1408
};
-static int parser_action_row1286[] = {
- 27,
- -1, 1, 464,
- 12, 0, 1126,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1251[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1287[] = {
+static int parser_action_row1252[] = {
1,
- -1, 1, 617
+ -1, 1, 610
};
-static int parser_action_row1288[] = {
+static int parser_action_row1253[] = {
1,
- -1, 1, 618
+ -1, 1, 611
};
-static int parser_action_row1289[] = {
+static int parser_action_row1254[] = {
1,
- -1, 1, 619
+ -1, 1, 612
};
-static int parser_action_row1290[] = {
+static int parser_action_row1255[] = {
1,
- -1, 1, 620
+ -1, 1, 613
};
-static int parser_action_row1291[] = {
+static int parser_action_row1256[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1292[] = {
+static int parser_action_row1257[] = {
3,
- -1, 3, 1291,
- 41, 0, 1308,
- 98, 0, 1454
+ -1, 3, 1256,
+ 41, 0, 1266,
+ 98, 0, 1412
};
-static int parser_action_row1293[] = {
+static int parser_action_row1258[] = {
2,
- -1, 3, 1292,
- 73, 0, 1455
-};
-static int parser_action_row1294[] = {
- 1,
- -1, 1, 570
-};
-static int parser_action_row1295[] = {
- 1,
- -1, 1, 569
-};
-static int parser_action_row1296[] = {
- 1,
- -1, 1, 571
-};
-static int parser_action_row1297[] = {
- 1,
- -1, 1, 582
-};
-static int parser_action_row1298[] = {
- 1,
- -1, 1, 621
-};
-static int parser_action_row1299[] = {
- 1,
- -1, 1, 622
-};
-static int parser_action_row1300[] = {
- 1,
- -1, 1, 623
+ -1, 3, 1257,
+ 73, 0, 1413
};
-static int parser_action_row1301[] = {
+static int parser_action_row1259[] = {
1,
- -1, 1, 624
+ -1, 1, 563
};
-static int parser_action_row1302[] = {
+static int parser_action_row1260[] = {
1,
- -1, 1, 625
+ -1, 1, 562
};
-static int parser_action_row1303[] = {
+static int parser_action_row1261[] = {
1,
- -1, 1, 626
+ -1, 1, 564
};
-static int parser_action_row1304[] = {
+static int parser_action_row1262[] = {
1,
- -1, 1, 627
+ -1, 1, 575
};
-static int parser_action_row1305[] = {
+static int parser_action_row1263[] = {
1,
- -1, 1, 628
+ -1, 1, 614
};
-static int parser_action_row1306[] = {
+static int parser_action_row1264[] = {
1,
- -1, 1, 629
+ -1, 1, 615
};
-static int parser_action_row1307[] = {
+static int parser_action_row1265[] = {
1,
- -1, 1, 631
+ -1, 1, 617
};
-static int parser_action_row1308[] = {
+static int parser_action_row1266[] = {
1,
- -1, 1, 630
+ -1, 1, 616
};
-static int parser_action_row1309[] = {
+static int parser_action_row1267[] = {
2,
- -1, 1, 598,
- 52, 0, 295
+ -1, 1, 591,
+ 52, 0, 274
};
-static int parser_action_row1310[] = {
+static int parser_action_row1268[] = {
1,
- -1, 1, 580
+ -1, 1, 573
};
-static int parser_action_row1311[] = {
+static int parser_action_row1269[] = {
2,
- -1, 1, 588,
- 52, 0, 295
+ -1, 1, 581,
+ 52, 0, 274
};
-static int parser_action_row1312[] = {
+static int parser_action_row1270[] = {
3,
- -1, 3, 1311,
- 54, 0, 1458,
- 55, 0, 1459
+ -1, 3, 1269,
+ 54, 0, 1416,
+ 55, 0, 1417
};
-static int parser_action_row1313[] = {
+static int parser_action_row1271[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1314[] = {
+static int parser_action_row1272[] = {
4,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2,
- 24, 0, 1461
+ 24, 0, 1419
};
-static int parser_action_row1315[] = {
+static int parser_action_row1273[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1316[] = {
+static int parser_action_row1274[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1317[] = {
+static int parser_action_row1275[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1318[] = {
+static int parser_action_row1276[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1319[] = {
+static int parser_action_row1277[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1320[] = {
+static int parser_action_row1278[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1321[] = {
+static int parser_action_row1279[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1322[] = {
+static int parser_action_row1280[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1323[] = {
+static int parser_action_row1281[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1324[] = {
+static int parser_action_row1282[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1325[] = {
+static int parser_action_row1283[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1326[] = {
+static int parser_action_row1284[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1327[] = {
+static int parser_action_row1285[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1328[] = {
+static int parser_action_row1286[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1329[] = {
+static int parser_action_row1287[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1330[] = {
+static int parser_action_row1288[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1331[] = {
+static int parser_action_row1289[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1332[] = {
+static int parser_action_row1290[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1333[] = {
+static int parser_action_row1291[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1334[] = {
+static int parser_action_row1292[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1335[] = {
+static int parser_action_row1293[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1336[] = {
+static int parser_action_row1294[] = {
3,
- -1, 1, 596,
- 52, 0, 295,
- 58, 0, 227
+ -1, 1, 589,
+ 52, 0, 274,
+ 58, 0, 213
};
-static int parser_action_row1337[] = {
+static int parser_action_row1295[] = {
2,
- -1, 1, 462,
- 97, 0, 1485
+ -1, 1, 455,
+ 97, 0, 1443
};
-static int parser_action_row1338[] = {
+static int parser_action_row1296[] = {
2,
- -1, 1, 460,
- 58, 0, 227
+ -1, 1, 453,
+ 58, 0, 213
};
-static int parser_action_row1339[] = {
+static int parser_action_row1297[] = {
1,
- -1, 1, 1088
+ -1, 1, 1060
};
-static int parser_action_row1340[] = {
+static int parser_action_row1298[] = {
2,
-1, 1, 30,
13, 0, 32
};
-static int parser_action_row1341[] = {
+static int parser_action_row1299[] = {
5,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
- 9, 0, 1487,
+ 9, 0, 1445,
95, 0, 3
};
-static int parser_action_row1342[] = {
+static int parser_action_row1300[] = {
2,
-1, 1, 118,
- 71, 0, 1489
+ 71, 0, 1447
};
-static int parser_action_row1343[] = {
+static int parser_action_row1301[] = {
2,
- -1, 1, 410,
- 57, 0, 853
+ -1, 1, 403,
+ 57, 0, 825
};
-static int parser_action_row1344[] = {
+static int parser_action_row1302[] = {
1,
-1, 1, 117
};
-static int parser_action_row1345[] = {
+static int parser_action_row1303[] = {
4,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2,
- 57, 0, 853
+ 57, 0, 825
};
-static int parser_action_row1346[] = {
+static int parser_action_row1304[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1347[] = {
+static int parser_action_row1305[] = {
1,
- -1, 1, 1090
+ -1, 1, 1062
};
-static int parser_action_row1348[] = {
+static int parser_action_row1306[] = {
1,
-1, 1, 113
};
-static int parser_action_row1349[] = {
+static int parser_action_row1307[] = {
4,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2,
- 56, 0, 1345
+ 56, 0, 1303
};
-static int parser_action_row1350[] = {
+static int parser_action_row1308[] = {
1,
-1, 1, 128
};
-static int parser_action_row1351[] = {
+static int parser_action_row1309[] = {
2,
-1, 1, 122,
- 56, 0, 1496
+ 56, 0, 1454
};
-static int parser_action_row1352[] = {
+static int parser_action_row1310[] = {
1,
-1, 1, 126
};
-static int parser_action_row1353[] = {
+static int parser_action_row1311[] = {
1,
-1, 1, 127
};
-static int parser_action_row1354[] = {
+static int parser_action_row1312[] = {
2,
-1, 1, 131,
- 73, 0, 1499
+ 73, 0, 1457
};
-static int parser_action_row1355[] = {
+static int parser_action_row1313[] = {
1,
-1, 1, 129
};
-static int parser_action_row1356[] = {
+static int parser_action_row1314[] = {
9,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
4, 1, 80,
- 9, 0, 1500,
+ 9, 0, 1458,
15, 1, 80,
28, 1, 80,
95, 0, 3,
- 115, 1, 80
+ 108, 1, 80
};
-static int parser_action_row1357[] = {
+static int parser_action_row1315[] = {
1,
- -1, 1, 476
+ -1, 1, 469
};
-static int parser_action_row1358[] = {
+static int parser_action_row1316[] = {
1,
- -1, 1, 497
+ -1, 1, 490
};
-static int parser_action_row1359[] = {
+static int parser_action_row1317[] = {
2,
- -1, 1, 475,
- 9, 0, 1356
+ -1, 1, 468,
+ 9, 0, 1314
};
-static int parser_action_row1360[] = {
+static int parser_action_row1318[] = {
1,
- -1, 1, 501
+ -1, 1, 494
};
-static int parser_action_row1361[] = {
+static int parser_action_row1319[] = {
3,
-1, 1, 155,
- 57, 0, 357,
- 94, 0, 216
+ 57, 0, 329,
+ 94, 0, 202
};
-static int parser_action_row1362[] = {
+static int parser_action_row1320[] = {
2,
- -1, 3, 1361,
- 55, 0, 1504
+ -1, 3, 1319,
+ 55, 0, 1462
};
-static int parser_action_row1363[] = {
+static int parser_action_row1321[] = {
2,
-1, 1, 37,
- 56, 0, 1505
+ 56, 0, 1463
};
-static int parser_action_row1364[] = {
+static int parser_action_row1322[] = {
1,
-1, 1, 27
};
-static int parser_action_row1365[] = {
+static int parser_action_row1323[] = {
7,
- -1, 3, 1364,
- 10, 0, 1508,
- 11, 0, 1509,
- 12, 0, 1510,
- 16, 0, 1511,
- 38, 0, 1512,
- 41, 0, 1513
+ -1, 3, 1322,
+ 10, 0, 1466,
+ 11, 0, 1467,
+ 12, 0, 1468,
+ 16, 0, 1469,
+ 38, 0, 1470,
+ 41, 0, 1471
};
-static int parser_action_row1366[] = {
- 32,
- -1, 1, 1027,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+static int parser_action_row1324[] = {
+ 25,
+ -1, 1, 999,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1367[] = {
+static int parser_action_row1325[] = {
2,
- -1, 1, 1032,
- 49, 0, 209
+ -1, 1, 1004,
+ 49, 0, 195
};
-static int parser_action_row1368[] = {
+static int parser_action_row1326[] = {
2,
- -1, 1, 1029,
- 49, 0, 209
+ -1, 1, 1001,
+ 49, 0, 195
};
-static int parser_action_row1369[] = {
+static int parser_action_row1327[] = {
1,
- -1, 1, 1031
+ -1, 1, 1003
};
-static int parser_action_row1370[] = {
+static int parser_action_row1328[] = {
2,
- -1, 3, 1369,
- 11, 0, 1517
+ -1, 3, 1327,
+ 11, 0, 1475
};
-static int parser_action_row1371[] = {
+static int parser_action_row1329[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1372[] = {
- 30,
- -1, 1, 504,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+static int parser_action_row1330[] = {
+ 23,
+ -1, 1, 497,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1373[] = {
- 30,
- -1, 1, 505,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+static int parser_action_row1331[] = {
+ 23,
+ -1, 1, 498,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1374[] = {
- 30,
- -1, 1, 513,
- 12, 0, 182,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+static int parser_action_row1332[] = {
+ 23,
+ -1, 1, 506,
+ 12, 0, 168,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1375[] = {
+static int parser_action_row1333[] = {
15,
- -1, 1, 768,
- 52, 0, 295,
- 58, 0, 227,
- 59, 0, 1519,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ -1, 1, 754,
+ 52, 0, 274,
+ 58, 0, 213,
+ 59, 0, 1477,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row1376[] = {
+static int parser_action_row1334[] = {
1,
- -1, 1, 820
+ -1, 1, 799
};
-static int parser_action_row1377[] = {
+static int parser_action_row1335[] = {
1,
- -1, 1, 1025
+ -1, 1, 997
};
-static int parser_action_row1378[] = {
+static int parser_action_row1336[] = {
1,
- -1, 1, 1034
+ -1, 1, 1006
};
-static int parser_action_row1379[] = {
+static int parser_action_row1337[] = {
1,
- -1, 1, 1036
+ -1, 1, 1008
};
-static int parser_action_row1380[] = {
+static int parser_action_row1338[] = {
1,
- -1, 1, 1035
+ -1, 1, 1007
};
-static int parser_action_row1381[] = {
+static int parser_action_row1339[] = {
1,
- -1, 1, 1037
+ -1, 1, 1009
};
-static int parser_action_row1382[] = {
+static int parser_action_row1340[] = {
1,
- -1, 1, 1038
+ -1, 1, 1010
};
-static int parser_action_row1383[] = {
+static int parser_action_row1341[] = {
1,
- -1, 1, 1039
+ -1, 1, 1011
};
-static int parser_action_row1384[] = {
+static int parser_action_row1342[] = {
1,
- -1, 1, 427
+ -1, 1, 420
};
-static int parser_action_row1385[] = {
+static int parser_action_row1343[] = {
3,
- -1, 3, 1384,
- 41, 0, 324,
- 98, 0, 1522
+ -1, 3, 1342,
+ 41, 0, 296,
+ 98, 0, 1480
};
-static int parser_action_row1386[] = {
+static int parser_action_row1344[] = {
22,
- -1, 1, 461,
- 54, 0, 643,
- 74, 0, 644,
- 75, 0, 645,
- 76, 0, 431,
- 77, 0, 432,
- 78, 0, 433,
- 79, 0, 434,
- 80, 0, 435,
- 81, 0, 436,
- 82, 0, 437,
- 83, 0, 646,
- 84, 0, 439,
- 85, 0, 440,
- 86, 0, 441,
- 87, 0, 442,
- 88, 0, 443,
- 89, 0, 444,
- 90, 0, 445,
- 91, 0, 446,
- 92, 0, 447,
- 97, 0, 1523
+ -1, 1, 454,
+ 54, 0, 615,
+ 74, 0, 616,
+ 75, 0, 617,
+ 76, 0, 403,
+ 77, 0, 404,
+ 78, 0, 405,
+ 79, 0, 406,
+ 80, 0, 407,
+ 81, 0, 408,
+ 82, 0, 409,
+ 83, 0, 618,
+ 84, 0, 411,
+ 85, 0, 412,
+ 86, 0, 413,
+ 87, 0, 414,
+ 88, 0, 415,
+ 89, 0, 416,
+ 90, 0, 417,
+ 91, 0, 418,
+ 92, 0, 419,
+ 97, 0, 1481
};
-static int parser_action_row1387[] = {
+static int parser_action_row1345[] = {
1,
- -1, 1, 824
+ -1, 1, 803
};
-static int parser_action_row1388[] = {
+static int parser_action_row1346[] = {
1,
- -1, 1, 1026
+ -1, 1, 998
};
-static int parser_action_row1389[] = {
+static int parser_action_row1347[] = {
1,
- -1, 1, 821
+ -1, 1, 800
};
-static int parser_action_row1390[] = {
+static int parser_action_row1348[] = {
3,
- -1, 1, 751,
- 54, 0, 262,
- 73, 0, 1524
+ -1, 1, 737,
+ 54, 0, 241,
+ 73, 0, 1482
};
-static int parser_action_row1391[] = {
+static int parser_action_row1349[] = {
1,
- -1, 1, 430
+ -1, 1, 423
};
-static int parser_action_row1392[] = {
+static int parser_action_row1350[] = {
2,
- -1, 1, 818,
- 56, 0, 1438
+ -1, 1, 797,
+ 56, 0, 1396
};
-static int parser_action_row1393[] = {
+static int parser_action_row1351[] = {
1,
- -1, 1, 822
+ -1, 1, 801
};
-static int parser_action_row1394[] = {
+static int parser_action_row1352[] = {
23,
- -1, 1, 463,
- 54, 0, 643,
- 74, 0, 644,
- 75, 0, 645,
- 76, 0, 431,
- 77, 0, 432,
- 78, 0, 433,
- 79, 0, 434,
- 80, 0, 435,
- 81, 0, 436,
- 82, 0, 437,
- 83, 0, 646,
- 84, 0, 439,
- 85, 0, 440,
- 86, 0, 441,
- 87, 0, 442,
- 88, 0, 443,
- 89, 0, 444,
- 90, 0, 445,
- 91, 0, 446,
- 92, 0, 447,
- 96, 0, 53,
- 97, 0, 1527
+ -1, 1, 456,
+ 54, 0, 615,
+ 74, 0, 616,
+ 75, 0, 617,
+ 76, 0, 403,
+ 77, 0, 404,
+ 78, 0, 405,
+ 79, 0, 406,
+ 80, 0, 407,
+ 81, 0, 408,
+ 82, 0, 409,
+ 83, 0, 618,
+ 84, 0, 411,
+ 85, 0, 412,
+ 86, 0, 413,
+ 87, 0, 414,
+ 88, 0, 415,
+ 89, 0, 416,
+ 90, 0, 417,
+ 91, 0, 418,
+ 92, 0, 419,
+ 96, 0, 53,
+ 97, 0, 1485
};
-static int parser_action_row1395[] = {
+static int parser_action_row1353[] = {
1,
-1, 1, 365
};
-static int parser_action_row1396[] = {
+static int parser_action_row1354[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1397[] = {
+static int parser_action_row1355[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1398[] = {
+static int parser_action_row1356[] = {
1,
-1, 1, 211
};
-static int parser_action_row1399[] = {
+static int parser_action_row1357[] = {
1,
-1, 1, 230
};
-static int parser_action_row1400[] = {
+static int parser_action_row1358[] = {
1,
-1, 1, 215
};
-static int parser_action_row1401[] = {
+static int parser_action_row1359[] = {
1,
-1, 1, 234
};
-static int parser_action_row1402[] = {
+static int parser_action_row1360[] = {
1,
-1, 1, 214
};
-static int parser_action_row1403[] = {
+static int parser_action_row1361[] = {
1,
-1, 1, 233
};
-static int parser_action_row1404[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1362[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1405[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1363[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1406[] = {
+static int parser_action_row1364[] = {
2,
- -1, 3, 1405,
- 24, 0, 1533
+ -1, 3, 1363,
+ 24, 0, 1491
};
-static int parser_action_row1407[] = {
+static int parser_action_row1365[] = {
1,
- -1, 1, 784
+ -1, 1, 770
};
-static int parser_action_row1408[] = {
+static int parser_action_row1366[] = {
1,
- -1, 1, 788
+ -1, 1, 774
};
-static int parser_action_row1409[] = {
+static int parser_action_row1367[] = {
2,
- -1, 1, 787,
- 52, 0, 295
+ -1, 1, 773,
+ 52, 0, 274
};
-static int parser_action_row1410[] = {
+static int parser_action_row1368[] = {
1,
- -1, 1, 452
+ -1, 1, 445
};
-static int parser_action_row1411[] = {
+static int parser_action_row1369[] = {
1,
- -1, 1, 792
+ -1, 1, 778
};
-static int parser_action_row1412[] = {
+static int parser_action_row1370[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1413[] = {
+static int parser_action_row1371[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1414[] = {
+static int parser_action_row1372[] = {
2,
- -1, 3, 1413,
- 23, 0, 1537
+ -1, 3, 1371,
+ 23, 0, 1495
};
-static int parser_action_row1415[] = {
+static int parser_action_row1373[] = {
2,
- -1, 3, 1414,
- 15, 0, 1538
+ -1, 3, 1372,
+ 15, 0, 1496
};
-static int parser_action_row1416[] = {
+static int parser_action_row1374[] = {
2,
- -1, 3, 1415,
- 28, 0, 1539
+ -1, 3, 1373,
+ 28, 0, 1497
};
-static int parser_action_row1417[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row1375[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 1417,
- 12, 0, 911,
- 15, 0, 912,
+ 9, 0, 1375,
+ 12, 0, 883,
+ 15, 0, 884,
16, 0, 34,
- 22, 0, 913,
- 25, 0, 915,
- 26, 0, 916,
- 27, 0, 917,
- 33, 0, 918,
- 34, 0, 919,
- 35, 0, 920,
- 36, 0, 921,
- 37, 0, 922,
+ 22, 0, 885,
+ 25, 0, 887,
+ 26, 0, 888,
+ 27, 0, 889,
+ 33, 0, 890,
+ 34, 0, 891,
+ 35, 0, 892,
+ 36, 0, 893,
+ 37, 0, 894,
38, 0, 44,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 50, 0, 923,
- 51, 0, 924,
+ 50, 0, 895,
+ 51, 0, 896,
52, 0, 51,
54, 0, 52,
95, 0, 3,
96, 0, 53,
- 97, 0, 925,
+ 97, 0, 897,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1418[] = {
+static int parser_action_row1376[] = {
2,
-1, 1, 158,
- 24, 1, 920
+ 24, 1, 892
};
-static int parser_action_row1419[] = {
- 37,
- -1, 1, 464,
- 9, 0, 1541,
+static int parser_action_row1377[] = {
+ 30,
+ -1, 1, 457,
+ 9, 0, 1499,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1420[] = {
+static int parser_action_row1378[] = {
1,
- -1, 1, 967
+ -1, 1, 939
};
-static int parser_action_row1421[] = {
+static int parser_action_row1379[] = {
2,
- -1, 3, 1420,
- 15, 0, 1543
+ -1, 3, 1378,
+ 15, 0, 1501
};
-static int parser_action_row1422[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1380[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1423[] = {
- 33,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 132,
+static int parser_action_row1381[] = {
+ 26,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 125,
54, 1, 351,
73, 1, 351,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row1424[] = {
- 46,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 132,
+static int parser_action_row1382[] = {
+ 39,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 125,
54, 1, 333,
- 58, 0, 227,
- 59, 0, 870,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239,
+ 58, 0, 213,
+ 59, 0, 842,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225,
73, 1, 333,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row1425[] = {
+static int parser_action_row1383[] = {
3,
- -1, 1, 461,
- 12, 0, 1547,
- 97, 0, 1548
+ -1, 1, 454,
+ 12, 0, 1505,
+ 97, 0, 1506
};
-static int parser_action_row1426[] = {
+static int parser_action_row1384[] = {
4,
- -1, 1, 463,
- 12, 0, 1549,
+ -1, 1, 456,
+ 12, 0, 1507,
96, 0, 53,
- 97, 0, 1550
+ 97, 0, 1508
};
-static int parser_action_row1427[] = {
+static int parser_action_row1385[] = {
1,
-1, 1, 260
};
-static int parser_action_row1428[] = {
+static int parser_action_row1386[] = {
2,
-1, 1, 198,
- 24, 1, 953
+ 24, 1, 925
};
-static int parser_action_row1429[] = {
+static int parser_action_row1387[] = {
2,
-1, 1, 189,
- 24, 1, 944
+ 24, 1, 916
};
-static int parser_action_row1430[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row1388[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 169,
+ 9, 0, 155,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1431[] = {
+static int parser_action_row1389[] = {
2,
- -1, 3, 1430,
- 24, 0, 1554
+ -1, 3, 1388,
+ 24, 0, 1512
};
-static int parser_action_row1432[] = {
+static int parser_action_row1390[] = {
2,
- -1, 1, 815,
- 94, 0, 618
+ -1, 1, 794,
+ 94, 0, 590
};
-static int parser_action_row1433[] = {
+static int parser_action_row1391[] = {
1,
-1, 1, 152
};
-static int parser_action_row1434[] = {
+static int parser_action_row1392[] = {
1,
- -1, 1, 636
+ -1, 1, 622
};
-static int parser_action_row1435[] = {
+static int parser_action_row1393[] = {
1,
- -1, 1, 813
+ -1, 1, 792
};
-static int parser_action_row1436[] = {
+static int parser_action_row1394[] = {
1,
-1, 1, 359
};
-static int parser_action_row1437[] = {
- 60,
- -1, 1, 464,
- 12, 0, 182,
+static int parser_action_row1395[] = {
+ 53,
+ -1, 1, 457,
+ 12, 0, 168,
15, 0, 33,
16, 0, 34,
- 22, 0, 183,
+ 22, 0, 169,
25, 0, 36,
26, 0, 37,
27, 0, 38,
- 31, 0, 184,
- 33, 0, 423,
- 34, 0, 424,
- 35, 0, 425,
- 36, 0, 426,
+ 31, 0, 170,
+ 33, 0, 395,
+ 34, 0, 396,
+ 35, 0, 397,
+ 36, 0, 398,
37, 0, 43,
- 38, 0, 185,
- 40, 0, 186,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 47, 0, 420,
- 48, 0, 187,
+ 47, 0, 392,
+ 48, 0, 173,
50, 0, 49,
- 51, 0, 427,
+ 51, 0, 399,
52, 0, 51,
- 54, 0, 428,
- 74, 0, 429,
- 75, 0, 430,
- 76, 0, 431,
- 77, 0, 432,
- 78, 0, 433,
- 79, 0, 434,
- 80, 0, 435,
- 81, 0, 436,
- 82, 0, 437,
- 83, 0, 438,
- 84, 0, 439,
- 85, 0, 440,
- 86, 0, 441,
- 87, 0, 442,
- 88, 0, 443,
- 89, 0, 444,
- 90, 0, 445,
- 91, 0, 446,
- 92, 0, 447,
- 94, 0, 216,
- 96, 0, 448,
- 97, 0, 449,
+ 54, 0, 400,
+ 74, 0, 401,
+ 75, 0, 402,
+ 76, 0, 403,
+ 77, 0, 404,
+ 78, 0, 405,
+ 79, 0, 406,
+ 80, 0, 407,
+ 81, 0, 408,
+ 82, 0, 409,
+ 83, 0, 410,
+ 84, 0, 411,
+ 85, 0, 412,
+ 86, 0, 413,
+ 87, 0, 414,
+ 88, 0, 415,
+ 89, 0, 416,
+ 90, 0, 417,
+ 91, 0, 418,
+ 92, 0, 419,
+ 94, 0, 202,
+ 96, 0, 420,
+ 97, 0, 421,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1438[] = {
+static int parser_action_row1396[] = {
2,
- -1, 3, 1437,
- 53, 0, 1557
+ -1, 3, 1395,
+ 53, 0, 1515
};
-static int parser_action_row1439[] = {
+static int parser_action_row1397[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1440[] = {
+static int parser_action_row1398[] = {
1,
- -1, 1, 1106
+ -1, 1, 1078
};
-static int parser_action_row1441[] = {
+static int parser_action_row1399[] = {
2,
- -1, 1, 432,
- 56, 0, 1438
+ -1, 1, 425,
+ 56, 0, 1396
};
-static int parser_action_row1442[] = {
+static int parser_action_row1400[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row1443[] = {
+static int parser_action_row1401[] = {
1,
-1, 1, 148
};
-static int parser_action_row1444[] = {
- 32,
- -1, 1, 524,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+static int parser_action_row1402[] = {
+ 25,
+ -1, 1, 517,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1445[] = {
+static int parser_action_row1403[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1446[] = {
+static int parser_action_row1404[] = {
1,
- -1, 1, 398
+ -1, 1, 391
};
-static int parser_action_row1447[] = {
+static int parser_action_row1405[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1448[] = {
+static int parser_action_row1406[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1449[] = {
+static int parser_action_row1407[] = {
1,
- -1, 1, 540
+ -1, 1, 533
};
-static int parser_action_row1450[] = {
+static int parser_action_row1408[] = {
2,
- -1, 3, 1449,
- 96, 0, 1564
+ -1, 3, 1407,
+ 96, 0, 1522
};
-static int parser_action_row1451[] = {
+static int parser_action_row1409[] = {
2,
- -1, 1, 815,
- 94, 0, 618
+ -1, 1, 794,
+ 94, 0, 590
};
-static int parser_action_row1452[] = {
+static int parser_action_row1410[] = {
3,
- -1, 1, 575,
- 52, 0, 295,
- 73, 0, 1566
+ -1, 1, 568,
+ 52, 0, 274,
+ 73, 0, 1524
};
-static int parser_action_row1453[] = {
+static int parser_action_row1411[] = {
1,
- -1, 1, 572
+ -1, 1, 565
};
-static int parser_action_row1454[] = {
+static int parser_action_row1412[] = {
3,
- -1, 3, 1453,
- 47, 0, 1449,
- 96, 0, 1450
+ -1, 3, 1411,
+ 47, 0, 1407,
+ 96, 0, 1408
};
-static int parser_action_row1455[] = {
+static int parser_action_row1413[] = {
2,
- -1, 1, 577,
- 73, 1, 580
+ -1, 1, 570,
+ 73, 1, 573
};
-static int parser_action_row1456[] = {
+static int parser_action_row1414[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1457[] = {
+static int parser_action_row1415[] = {
1,
- -1, 1, 597
+ -1, 1, 590
};
-static int parser_action_row1458[] = {
+static int parser_action_row1416[] = {
1,
- -1, 1, 586
+ -1, 1, 579
};
-static int parser_action_row1459[] = {
+static int parser_action_row1417[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row1460[] = {
+static int parser_action_row1418[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row1461[] = {
- 28,
- -1, 1, 464,
- 12, 0, 1126,
- 31, 0, 1128,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1419[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 31, 0, 1100,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1462[] = {
+static int parser_action_row1420[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1463[] = {
- 28,
- -1, 1, 464,
- 12, 0, 1126,
- 31, 0, 1128,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1421[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 31, 0, 1100,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1464[] = {
- 28,
- -1, 1, 464,
- 12, 0, 1126,
- 31, 0, 1128,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1422[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 31, 0, 1100,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1465[] = {
+static int parser_action_row1423[] = {
3,
- -1, 3, 1464,
- 47, 0, 1576,
- 96, 0, 1577
+ -1, 3, 1422,
+ 47, 0, 1534,
+ 96, 0, 1535
};
-static int parser_action_row1466[] = {
- 27,
- -1, 1, 464,
- 12, 0, 1126,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1424[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1467[] = {
- 27,
- -1, 1, 464,
- 12, 0, 1126,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1425[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1468[] = {
- 27,
- -1, 1, 464,
- 12, 0, 1126,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1426[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1469[] = {
- 27,
- -1, 1, 464,
- 12, 0, 1126,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1427[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1470[] = {
- 27,
- -1, 1, 464,
- 12, 0, 1126,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1428[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1471[] = {
- 27,
- -1, 1, 464,
- 12, 0, 1126,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1429[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1472[] = {
- 27,
- -1, 1, 464,
- 12, 0, 1126,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1430[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1473[] = {
- 27,
- -1, 1, 464,
- 12, 0, 1126,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1431[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1474[] = {
- 27,
- -1, 1, 464,
- 12, 0, 1126,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1432[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1475[] = {
- 27,
- -1, 1, 464,
- 12, 0, 1126,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1433[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1476[] = {
- 27,
- -1, 1, 464,
- 12, 0, 1126,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1434[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1477[] = {
- 27,
- -1, 1, 464,
- 12, 0, 1126,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1435[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1478[] = {
- 27,
- -1, 1, 464,
- 12, 0, 1126,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1436[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1479[] = {
- 27,
- -1, 1, 464,
- 12, 0, 1126,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1437[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1480[] = {
- 27,
- -1, 1, 464,
- 12, 0, 1126,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1438[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1481[] = {
- 27,
- -1, 1, 464,
- 12, 0, 1126,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1439[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1482[] = {
- 27,
- -1, 1, 464,
- 12, 0, 1126,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1440[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1483[] = {
- 27,
- -1, 1, 464,
- 12, 0, 1126,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1441[] = {
+ 20,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1484[] = {
+static int parser_action_row1442[] = {
5,
- -1, 1, 464,
- 12, 0, 1597,
- 46, 0, 1598,
+ -1, 1, 457,
+ 12, 0, 1555,
+ 46, 0, 1556,
96, 0, 53,
- 97, 0, 1599
+ 97, 0, 1557
};
-static int parser_action_row1485[] = {
+static int parser_action_row1443[] = {
1,
- -1, 1, 594
+ -1, 1, 587
};
-static int parser_action_row1486[] = {
+static int parser_action_row1444[] = {
2,
- -1, 1, 592,
- 52, 0, 295
+ -1, 1, 585,
+ 52, 0, 274
};
-static int parser_action_row1487[] = {
+static int parser_action_row1445[] = {
5,
-1, 1, 81,
- 18, 0, 254,
- 19, 0, 255,
- 20, 0, 256,
- 21, 0, 257
+ 18, 0, 233,
+ 19, 0, 234,
+ 20, 0, 235,
+ 21, 0, 236
};
-static int parser_action_row1488[] = {
+static int parser_action_row1446[] = {
1,
-1, 1, 77
};
-static int parser_action_row1489[] = {
+static int parser_action_row1447[] = {
1,
- -1, 1, 1089
+ -1, 1, 1061
};
-static int parser_action_row1490[] = {
+static int parser_action_row1448[] = {
1,
-1, 1, 120
};
-static int parser_action_row1491[] = {
+static int parser_action_row1449[] = {
2,
-1, 1, 119,
- 71, 0, 1605
+ 71, 0, 1563
};
-static int parser_action_row1492[] = {
+static int parser_action_row1450[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1493[] = {
+static int parser_action_row1451[] = {
1,
-1, 1, 110
};
-static int parser_action_row1494[] = {
+static int parser_action_row1452[] = {
2,
- -1, 3, 1493,
- 97, 0, 1178
+ -1, 3, 1451,
+ 97, 0, 1143
};
-static int parser_action_row1495[] = {
+static int parser_action_row1453[] = {
1,
- -1, 1, 1091
+ -1, 1, 1063
};
-static int parser_action_row1496[] = {
+static int parser_action_row1454[] = {
1,
-1, 1, 114
};
-static int parser_action_row1497[] = {
+static int parser_action_row1455[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1498[] = {
+static int parser_action_row1456[] = {
1,
- -1, 1, 1092
+ -1, 1, 1064
};
-static int parser_action_row1499[] = {
+static int parser_action_row1457[] = {
2,
-1, 1, 123,
- 56, 0, 1496
+ 56, 0, 1454
};
-static int parser_action_row1500[] = {
+static int parser_action_row1458[] = {
24,
- -1, 3, 1499,
- 46, 0, 1610,
- 54, 0, 664,
- 74, 0, 665,
- 75, 0, 666,
- 76, 0, 667,
- 77, 0, 668,
- 78, 0, 669,
- 79, 0, 670,
- 80, 0, 671,
- 81, 0, 672,
- 82, 0, 673,
- 83, 0, 674,
- 84, 0, 675,
- 85, 0, 676,
- 86, 0, 677,
- 87, 0, 678,
- 88, 0, 679,
- 89, 0, 680,
- 90, 0, 681,
- 91, 0, 682,
- 92, 0, 683,
- 96, 0, 53,
- 97, 0, 684
+ -1, 3, 1457,
+ 46, 0, 1568,
+ 54, 0, 636,
+ 74, 0, 637,
+ 75, 0, 638,
+ 76, 0, 639,
+ 77, 0, 640,
+ 78, 0, 641,
+ 79, 0, 642,
+ 80, 0, 643,
+ 81, 0, 644,
+ 82, 0, 645,
+ 83, 0, 646,
+ 84, 0, 647,
+ 85, 0, 648,
+ 86, 0, 649,
+ 87, 0, 650,
+ 88, 0, 651,
+ 89, 0, 652,
+ 90, 0, 653,
+ 91, 0, 654,
+ 92, 0, 655,
+ 96, 0, 53,
+ 97, 0, 656
};
-static int parser_action_row1501[] = {
+static int parser_action_row1459[] = {
1,
- -1, 1, 503
+ -1, 1, 496
};
-static int parser_action_row1502[] = {
+static int parser_action_row1460[] = {
1,
- -1, 1, 498
+ -1, 1, 491
};
-static int parser_action_row1503[] = {
+static int parser_action_row1461[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1504[] = {
+static int parser_action_row1462[] = {
2,
-1, 1, 155,
- 57, 0, 357
+ 57, 0, 329
};
-static int parser_action_row1505[] = {
+static int parser_action_row1463[] = {
6,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
- 28, 0, 90,
+ 28, 0, 83,
95, 0, 3,
- 115, 0, 91
+ 108, 0, 84
};
-static int parser_action_row1506[] = {
+static int parser_action_row1464[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1507[] = {
+static int parser_action_row1465[] = {
1,
- -1, 1, 1084
+ -1, 1, 1056
};
-static int parser_action_row1508[] = {
+static int parser_action_row1466[] = {
2,
-1, 1, 38,
- 56, 0, 1505
+ 56, 0, 1463
};
-static int parser_action_row1509[] = {
+static int parser_action_row1467[] = {
23,
- -1, 3, 1508,
- 54, 0, 664,
- 74, 0, 665,
- 75, 0, 666,
- 76, 0, 667,
- 77, 0, 668,
- 78, 0, 669,
- 79, 0, 670,
- 80, 0, 671,
- 81, 0, 672,
- 82, 0, 673,
- 83, 0, 674,
- 84, 0, 675,
- 85, 0, 676,
- 86, 0, 677,
- 87, 0, 678,
- 88, 0, 679,
- 89, 0, 680,
- 90, 0, 681,
- 91, 0, 682,
- 92, 0, 683,
- 96, 0, 53,
- 97, 0, 684
+ -1, 3, 1466,
+ 54, 0, 636,
+ 74, 0, 637,
+ 75, 0, 638,
+ 76, 0, 639,
+ 77, 0, 640,
+ 78, 0, 641,
+ 79, 0, 642,
+ 80, 0, 643,
+ 81, 0, 644,
+ 82, 0, 645,
+ 83, 0, 646,
+ 84, 0, 647,
+ 85, 0, 648,
+ 86, 0, 649,
+ 87, 0, 650,
+ 88, 0, 651,
+ 89, 0, 652,
+ 90, 0, 653,
+ 91, 0, 654,
+ 92, 0, 655,
+ 96, 0, 53,
+ 97, 0, 656
};
-static int parser_action_row1510[] = {
+static int parser_action_row1468[] = {
2,
- -1, 3, 1509,
- 96, 0, 1619
+ -1, 3, 1467,
+ 96, 0, 1577
};
-static int parser_action_row1511[] = {
+static int parser_action_row1469[] = {
27,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2,
- 52, 0, 852,
- 54, 0, 664,
- 57, 0, 853,
- 74, 0, 665,
- 75, 0, 666,
- 76, 0, 667,
- 77, 0, 668,
- 78, 0, 669,
- 79, 0, 670,
- 80, 0, 671,
- 81, 0, 672,
- 82, 0, 673,
- 83, 0, 674,
- 84, 0, 675,
- 85, 0, 676,
- 86, 0, 677,
- 87, 0, 678,
- 88, 0, 679,
- 89, 0, 680,
- 90, 0, 681,
- 91, 0, 682,
- 92, 0, 683,
- 96, 0, 53,
- 97, 0, 684
+ 52, 0, 824,
+ 54, 0, 636,
+ 57, 0, 825,
+ 74, 0, 637,
+ 75, 0, 638,
+ 76, 0, 639,
+ 77, 0, 640,
+ 78, 0, 641,
+ 79, 0, 642,
+ 80, 0, 643,
+ 81, 0, 644,
+ 82, 0, 645,
+ 83, 0, 646,
+ 84, 0, 647,
+ 85, 0, 648,
+ 86, 0, 649,
+ 87, 0, 650,
+ 88, 0, 651,
+ 89, 0, 652,
+ 90, 0, 653,
+ 91, 0, 654,
+ 92, 0, 655,
+ 96, 0, 53,
+ 97, 0, 656
};
-static int parser_action_row1512[] = {
+static int parser_action_row1470[] = {
2,
- -1, 3, 1511,
- 97, 0, 1622
+ -1, 3, 1469,
+ 97, 0, 1580
};
-static int parser_action_row1513[] = {
+static int parser_action_row1471[] = {
27,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2,
- 52, 0, 852,
- 54, 0, 664,
- 57, 0, 853,
- 74, 0, 665,
- 75, 0, 666,
- 76, 0, 667,
- 77, 0, 668,
- 78, 0, 669,
- 79, 0, 670,
- 80, 0, 671,
- 81, 0, 672,
- 82, 0, 673,
- 83, 0, 674,
- 84, 0, 675,
- 85, 0, 676,
- 86, 0, 677,
- 87, 0, 678,
- 88, 0, 679,
- 89, 0, 680,
- 90, 0, 681,
- 91, 0, 682,
- 92, 0, 683,
- 96, 0, 53,
- 97, 0, 684
+ 52, 0, 824,
+ 54, 0, 636,
+ 57, 0, 825,
+ 74, 0, 637,
+ 75, 0, 638,
+ 76, 0, 639,
+ 77, 0, 640,
+ 78, 0, 641,
+ 79, 0, 642,
+ 80, 0, 643,
+ 81, 0, 644,
+ 82, 0, 645,
+ 83, 0, 646,
+ 84, 0, 647,
+ 85, 0, 648,
+ 86, 0, 649,
+ 87, 0, 650,
+ 88, 0, 651,
+ 89, 0, 652,
+ 90, 0, 653,
+ 91, 0, 654,
+ 92, 0, 655,
+ 96, 0, 53,
+ 97, 0, 656
};
-static int parser_action_row1514[] = {
+static int parser_action_row1472[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1515[] = {
+static int parser_action_row1473[] = {
1,
- -1, 1, 1028
+ -1, 1, 1000
};
-static int parser_action_row1516[] = {
+static int parser_action_row1474[] = {
1,
- -1, 1, 1033
+ -1, 1, 1005
};
-static int parser_action_row1517[] = {
+static int parser_action_row1475[] = {
1,
- -1, 1, 1030
+ -1, 1, 1002
};
-static int parser_action_row1518[] = {
+static int parser_action_row1476[] = {
3,
- -1, 3, 1517,
- 47, 0, 420,
- 96, 0, 421
+ -1, 3, 1475,
+ 47, 0, 392,
+ 96, 0, 393
};
-static int parser_action_row1519[] = {
- 60,
- -1, 1, 464,
- 12, 0, 182,
+static int parser_action_row1477[] = {
+ 53,
+ -1, 1, 457,
+ 12, 0, 168,
15, 0, 33,
16, 0, 34,
- 22, 0, 183,
+ 22, 0, 169,
25, 0, 36,
26, 0, 37,
27, 0, 38,
- 31, 0, 184,
- 33, 0, 423,
- 34, 0, 424,
- 35, 0, 425,
- 36, 0, 426,
+ 31, 0, 170,
+ 33, 0, 395,
+ 34, 0, 396,
+ 35, 0, 397,
+ 36, 0, 398,
37, 0, 43,
- 38, 0, 185,
- 40, 0, 186,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 47, 0, 420,
- 48, 0, 187,
+ 47, 0, 392,
+ 48, 0, 173,
50, 0, 49,
- 51, 0, 427,
+ 51, 0, 399,
52, 0, 51,
- 54, 0, 428,
- 74, 0, 429,
- 75, 0, 430,
- 76, 0, 431,
- 77, 0, 432,
- 78, 0, 433,
- 79, 0, 434,
- 80, 0, 435,
- 81, 0, 436,
- 82, 0, 437,
- 83, 0, 438,
- 84, 0, 439,
- 85, 0, 440,
- 86, 0, 441,
- 87, 0, 442,
- 88, 0, 443,
- 89, 0, 444,
- 90, 0, 445,
- 91, 0, 446,
- 92, 0, 447,
- 94, 0, 216,
- 96, 0, 448,
- 97, 0, 449,
+ 54, 0, 400,
+ 74, 0, 401,
+ 75, 0, 402,
+ 76, 0, 403,
+ 77, 0, 404,
+ 78, 0, 405,
+ 79, 0, 406,
+ 80, 0, 407,
+ 81, 0, 408,
+ 82, 0, 409,
+ 83, 0, 410,
+ 84, 0, 411,
+ 85, 0, 412,
+ 86, 0, 413,
+ 87, 0, 414,
+ 88, 0, 415,
+ 89, 0, 416,
+ 90, 0, 417,
+ 91, 0, 418,
+ 92, 0, 419,
+ 94, 0, 202,
+ 96, 0, 420,
+ 97, 0, 421,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1520[] = {
- 32,
- -1, 1, 524,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+static int parser_action_row1478[] = {
+ 25,
+ -1, 1, 517,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1521[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1479[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1522[] = {
+static int parser_action_row1480[] = {
13,
- -1, 1, 767,
- 59, 0, 1630,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ -1, 1, 753,
+ 59, 0, 1588,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row1523[] = {
+static int parser_action_row1481[] = {
13,
- -1, 1, 758,
- 59, 0, 1632,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ -1, 1, 744,
+ 59, 0, 1590,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row1524[] = {
+static int parser_action_row1482[] = {
14,
- -1, 1, 770,
- 52, 0, 295,
- 59, 0, 1634,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ -1, 1, 756,
+ 52, 0, 274,
+ 59, 0, 1592,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row1525[] = {
+static int parser_action_row1483[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1526[] = {
+static int parser_action_row1484[] = {
13,
- -1, 1, 781,
- 59, 0, 1638,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ -1, 1, 767,
+ 59, 0, 1596,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row1527[] = {
+static int parser_action_row1485[] = {
2,
- -1, 1, 819,
- 56, 0, 1438
+ -1, 1, 798,
+ 56, 0, 1396
};
-static int parser_action_row1528[] = {
+static int parser_action_row1486[] = {
15,
- -1, 1, 774,
- 52, 0, 295,
- 58, 0, 227,
- 59, 0, 1640,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ -1, 1, 760,
+ 52, 0, 274,
+ 58, 0, 213,
+ 59, 0, 1598,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row1529[] = {
+static int parser_action_row1487[] = {
22,
- -1, 1, 462,
- 54, 0, 643,
- 74, 0, 644,
- 75, 0, 645,
- 76, 0, 431,
- 77, 0, 432,
- 78, 0, 433,
- 79, 0, 434,
- 80, 0, 435,
- 81, 0, 436,
- 82, 0, 437,
- 83, 0, 646,
- 84, 0, 439,
- 85, 0, 440,
- 86, 0, 441,
- 87, 0, 442,
- 88, 0, 443,
- 89, 0, 444,
- 90, 0, 445,
- 91, 0, 446,
- 92, 0, 447,
- 97, 0, 1643
+ -1, 1, 455,
+ 54, 0, 615,
+ 74, 0, 616,
+ 75, 0, 617,
+ 76, 0, 403,
+ 77, 0, 404,
+ 78, 0, 405,
+ 79, 0, 406,
+ 80, 0, 407,
+ 81, 0, 408,
+ 82, 0, 409,
+ 83, 0, 618,
+ 84, 0, 411,
+ 85, 0, 412,
+ 86, 0, 413,
+ 87, 0, 414,
+ 88, 0, 415,
+ 89, 0, 416,
+ 90, 0, 417,
+ 91, 0, 418,
+ 92, 0, 419,
+ 97, 0, 1601
};
-static int parser_action_row1530[] = {
+static int parser_action_row1488[] = {
2,
- -1, 3, 1529,
- 45, 0, 1644
+ -1, 3, 1487,
+ 45, 0, 1602
};
-static int parser_action_row1531[] = {
+static int parser_action_row1489[] = {
2,
- -1, 3, 1530,
- 53, 0, 1645
+ -1, 3, 1488,
+ 53, 0, 1603
};
-static int parser_action_row1532[] = {
+static int parser_action_row1490[] = {
1,
-1, 1, 213
};
-static int parser_action_row1533[] = {
+static int parser_action_row1491[] = {
1,
-1, 1, 232
};
-static int parser_action_row1534[] = {
+static int parser_action_row1492[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1535[] = {
+static int parser_action_row1493[] = {
1,
- -1, 1, 786
+ -1, 1, 772
};
-static int parser_action_row1536[] = {
+static int parser_action_row1494[] = {
2,
- -1, 3, 1535,
- 45, 0, 1647
+ -1, 3, 1493,
+ 45, 0, 1605
};
-static int parser_action_row1537[] = {
+static int parser_action_row1495[] = {
2,
- -1, 3, 1536,
- 53, 0, 1648
+ -1, 3, 1494,
+ 53, 0, 1606
};
-static int parser_action_row1538[] = {
- 41,
- -1, 1, 464,
+static int parser_action_row1496[] = {
+ 34,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 910,
- 12, 0, 911,
- 15, 0, 912,
+ 9, 0, 882,
+ 12, 0, 883,
+ 15, 0, 884,
16, 0, 34,
- 22, 0, 913,
- 24, 0, 914,
- 25, 0, 915,
- 26, 0, 916,
- 27, 0, 917,
- 33, 0, 918,
- 34, 0, 919,
- 35, 0, 920,
- 36, 0, 921,
- 37, 0, 922,
+ 22, 0, 885,
+ 24, 0, 886,
+ 25, 0, 887,
+ 26, 0, 888,
+ 27, 0, 889,
+ 33, 0, 890,
+ 34, 0, 891,
+ 35, 0, 892,
+ 36, 0, 893,
+ 37, 0, 894,
38, 0, 44,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 50, 0, 923,
- 51, 0, 924,
+ 50, 0, 895,
+ 51, 0, 896,
52, 0, 51,
54, 0, 52,
95, 0, 3,
96, 0, 53,
- 97, 0, 925,
+ 97, 0, 897,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1539[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row1497[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 1059,
- 12, 0, 911,
- 15, 0, 912,
+ 9, 0, 1031,
+ 12, 0, 883,
+ 15, 0, 884,
16, 0, 34,
- 22, 0, 913,
- 25, 0, 915,
- 26, 0, 916,
- 27, 0, 917,
- 33, 0, 918,
- 34, 0, 919,
- 35, 0, 920,
- 36, 0, 921,
- 37, 0, 922,
+ 22, 0, 885,
+ 25, 0, 887,
+ 26, 0, 888,
+ 27, 0, 889,
+ 33, 0, 890,
+ 34, 0, 891,
+ 35, 0, 892,
+ 36, 0, 893,
+ 37, 0, 894,
38, 0, 44,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 50, 0, 923,
- 51, 0, 924,
+ 50, 0, 895,
+ 51, 0, 896,
52, 0, 51,
54, 0, 52,
95, 0, 3,
96, 0, 53,
- 97, 0, 925,
+ 97, 0, 897,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1540[] = {
+static int parser_action_row1498[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1541[] = {
+static int parser_action_row1499[] = {
1,
- -1, 1, 968
+ -1, 1, 940
};
-static int parser_action_row1542[] = {
+static int parser_action_row1500[] = {
2,
-1, 1, 157,
- 24, 1, 919
+ 24, 1, 891
};
-static int parser_action_row1543[] = {
+static int parser_action_row1501[] = {
2,
-1, 1, 156,
- 24, 1, 918
+ 24, 1, 890
};
-static int parser_action_row1544[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row1502[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 1059,
- 12, 0, 911,
- 15, 0, 912,
+ 9, 0, 1031,
+ 12, 0, 883,
+ 15, 0, 884,
16, 0, 34,
- 22, 0, 913,
- 25, 0, 915,
- 26, 0, 916,
- 27, 0, 917,
- 33, 0, 918,
- 34, 0, 919,
- 35, 0, 920,
- 36, 0, 921,
- 37, 0, 922,
+ 22, 0, 885,
+ 25, 0, 887,
+ 26, 0, 888,
+ 27, 0, 889,
+ 33, 0, 890,
+ 34, 0, 891,
+ 35, 0, 892,
+ 36, 0, 893,
+ 37, 0, 894,
38, 0, 44,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 50, 0, 923,
- 51, 0, 924,
+ 50, 0, 895,
+ 51, 0, 896,
52, 0, 51,
54, 0, 52,
95, 0, 3,
96, 0, 53,
- 97, 0, 925,
+ 97, 0, 897,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1545[] = {
+static int parser_action_row1503[] = {
2,
-1, 1, 200,
- 24, 1, 955
+ 24, 1, 927
};
-static int parser_action_row1546[] = {
+static int parser_action_row1504[] = {
2,
-1, 1, 192,
- 24, 1, 947
+ 24, 1, 919
};
-static int parser_action_row1547[] = {
+static int parser_action_row1505[] = {
2,
-1, 1, 183,
- 24, 1, 938
+ 24, 1, 910
};
-static int parser_action_row1548[] = {
- 31,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 510,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row1506[] = {
+ 24,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 482,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row1549[] = {
- 45,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 132,
+static int parser_action_row1507[] = {
+ 38,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 125,
54, 1, 335,
- 59, 0, 1031,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239,
+ 59, 0, 1003,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225,
73, 1, 335,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row1550[] = {
- 31,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 510,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row1508[] = {
+ 24,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 482,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row1551[] = {
- 46,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 132,
+static int parser_action_row1509[] = {
+ 39,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 125,
54, 1, 339,
- 58, 0, 227,
- 59, 0, 1036,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239,
+ 58, 0, 213,
+ 59, 0, 1008,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225,
73, 1, 339,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row1552[] = {
+static int parser_action_row1510[] = {
3,
- -1, 1, 462,
- 12, 0, 1659,
- 97, 0, 1660
+ -1, 1, 455,
+ 12, 0, 1617,
+ 97, 0, 1618
};
-static int parser_action_row1553[] = {
+static int parser_action_row1511[] = {
1,
-1, 1, 272
};
-static int parser_action_row1554[] = {
+static int parser_action_row1512[] = {
2,
- -1, 3, 1553,
- 49, 0, 209
+ -1, 3, 1511,
+ 49, 0, 195
};
-static int parser_action_row1555[] = {
+static int parser_action_row1513[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1556[] = {
+static int parser_action_row1514[] = {
1,
- -1, 1, 637
+ -1, 1, 623
};
-static int parser_action_row1557[] = {
+static int parser_action_row1515[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1558[] = {
+static int parser_action_row1516[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row1559[] = {
- 60,
- -1, 1, 464,
- 12, 0, 182,
+static int parser_action_row1517[] = {
+ 53,
+ -1, 1, 457,
+ 12, 0, 168,
15, 0, 33,
16, 0, 34,
- 22, 0, 183,
+ 22, 0, 169,
25, 0, 36,
26, 0, 37,
27, 0, 38,
- 31, 0, 184,
- 33, 0, 423,
- 34, 0, 424,
- 35, 0, 425,
- 36, 0, 426,
+ 31, 0, 170,
+ 33, 0, 395,
+ 34, 0, 396,
+ 35, 0, 397,
+ 36, 0, 398,
37, 0, 43,
- 38, 0, 185,
- 40, 0, 186,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 47, 0, 420,
- 48, 0, 187,
+ 47, 0, 392,
+ 48, 0, 173,
50, 0, 49,
- 51, 0, 427,
+ 51, 0, 399,
52, 0, 51,
- 54, 0, 428,
- 74, 0, 429,
- 75, 0, 430,
- 76, 0, 431,
- 77, 0, 432,
- 78, 0, 433,
- 79, 0, 434,
- 80, 0, 435,
- 81, 0, 436,
- 82, 0, 437,
- 83, 0, 438,
- 84, 0, 439,
- 85, 0, 440,
- 86, 0, 441,
- 87, 0, 442,
- 88, 0, 443,
- 89, 0, 444,
- 90, 0, 445,
- 91, 0, 446,
- 92, 0, 447,
- 94, 0, 216,
- 96, 0, 448,
- 97, 0, 449,
+ 54, 0, 400,
+ 74, 0, 401,
+ 75, 0, 402,
+ 76, 0, 403,
+ 77, 0, 404,
+ 78, 0, 405,
+ 79, 0, 406,
+ 80, 0, 407,
+ 81, 0, 408,
+ 82, 0, 409,
+ 83, 0, 410,
+ 84, 0, 411,
+ 85, 0, 412,
+ 86, 0, 413,
+ 87, 0, 414,
+ 88, 0, 415,
+ 89, 0, 416,
+ 90, 0, 417,
+ 91, 0, 418,
+ 92, 0, 419,
+ 94, 0, 202,
+ 96, 0, 420,
+ 97, 0, 421,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1560[] = {
+static int parser_action_row1518[] = {
1,
- -1, 1, 1107
+ -1, 1, 1079
};
-static int parser_action_row1561[] = {
+static int parser_action_row1519[] = {
1,
-1, 1, 149
};
-static int parser_action_row1562[] = {
+static int parser_action_row1520[] = {
2,
- -1, 1, 396,
- 24, 0, 1554
+ -1, 1, 389,
+ 24, 0, 1512
};
-static int parser_action_row1563[] = {
+static int parser_action_row1521[] = {
2,
- -1, 3, 1562,
- 15, 0, 1666
+ -1, 3, 1520,
+ 15, 0, 1624
};
-static int parser_action_row1564[] = {
+static int parser_action_row1522[] = {
2,
- -1, 3, 1563,
- 23, 0, 1667
+ -1, 3, 1521,
+ 23, 0, 1625
};
-static int parser_action_row1565[] = {
+static int parser_action_row1523[] = {
2,
- -1, 1, 815,
- 94, 0, 618
+ -1, 1, 794,
+ 94, 0, 590
};
-static int parser_action_row1566[] = {
+static int parser_action_row1524[] = {
1,
- -1, 1, 825
+ -1, 1, 804
};
-static int parser_action_row1567[] = {
+static int parser_action_row1525[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1568[] = {
+static int parser_action_row1526[] = {
1,
- -1, 1, 574
+ -1, 1, 567
};
-static int parser_action_row1569[] = {
+static int parser_action_row1527[] = {
2,
- -1, 3, 1568,
- 73, 0, 1566
+ -1, 3, 1526,
+ 73, 0, 1524
};
-static int parser_action_row1570[] = {
+static int parser_action_row1528[] = {
5,
- -1, 1, 464,
- 12, 0, 1597,
- 46, 0, 1598,
+ -1, 1, 457,
+ 12, 0, 1555,
+ 46, 0, 1556,
96, 0, 53,
- 97, 0, 1599
+ 97, 0, 1557
};
-static int parser_action_row1571[] = {
+static int parser_action_row1529[] = {
1,
- -1, 1, 387
+ -1, 1, 380
};
-static int parser_action_row1572[] = {
+static int parser_action_row1530[] = {
1,
- -1, 1, 386
+ -1, 1, 379
};
-static int parser_action_row1573[] = {
+static int parser_action_row1531[] = {
1,
- -1, 1, 536
+ -1, 1, 529
};
-static int parser_action_row1574[] = {
- 28,
- -1, 1, 464,
- 12, 0, 1126,
- 31, 0, 1128,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+static int parser_action_row1532[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 31, 0, 1100,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
};
-static int parser_action_row1575[] = {
+static int parser_action_row1533[] = {
1,
- -1, 1, 535
+ -1, 1, 528
};
-static int parser_action_row1576[] = {
+static int parser_action_row1534[] = {
1,
- -1, 1, 538
+ -1, 1, 531
};
-static int parser_action_row1577[] = {
+static int parser_action_row1535[] = {
2,
- -1, 3, 1576,
- 96, 0, 1672
+ -1, 3, 1534,
+ 96, 0, 1630
};
-static int parser_action_row1578[] = {
+static int parser_action_row1536[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row1579[] = {
+static int parser_action_row1537[] = {
1,
- -1, 1, 549
+ -1, 1, 542
};
-static int parser_action_row1580[] = {
+static int parser_action_row1538[] = {
2,
- -1, 1, 551,
- 81, 0, 1324
+ -1, 1, 544,
+ 81, 0, 1282
};
-static int parser_action_row1581[] = {
+static int parser_action_row1539[] = {
2,
- -1, 1, 542,
- 80, 0, 1316
+ -1, 1, 535,
+ 80, 0, 1274
};
-static int parser_action_row1582[] = {
+static int parser_action_row1540[] = {
2,
- -1, 1, 543,
- 80, 0, 1316
+ -1, 1, 536,
+ 80, 0, 1274
};
-static int parser_action_row1583[] = {
+static int parser_action_row1541[] = {
2,
- -1, 1, 544,
- 80, 0, 1316
+ -1, 1, 537,
+ 80, 0, 1274
};
-static int parser_action_row1584[] = {
+static int parser_action_row1542[] = {
2,
- -1, 1, 545,
- 80, 0, 1316
+ -1, 1, 538,
+ 80, 0, 1274
};
-static int parser_action_row1585[] = {
+static int parser_action_row1543[] = {
2,
- -1, 1, 546,
- 80, 0, 1316
+ -1, 1, 539,
+ 80, 0, 1274
};
-static int parser_action_row1586[] = {
+static int parser_action_row1544[] = {
2,
- -1, 1, 547,
- 80, 0, 1316
+ -1, 1, 540,
+ 80, 0, 1274
};
-static int parser_action_row1587[] = {
+static int parser_action_row1545[] = {
2,
- -1, 1, 548,
- 80, 0, 1316
+ -1, 1, 541,
+ 80, 0, 1274
};
-static int parser_action_row1588[] = {
+static int parser_action_row1546[] = {
2,
- -1, 1, 553,
- 82, 0, 1325
+ -1, 1, 546,
+ 82, 0, 1283
};
-static int parser_action_row1589[] = {
+static int parser_action_row1547[] = {
3,
- -1, 1, 555,
- 88, 0, 1326,
- 91, 0, 1327
+ -1, 1, 548,
+ 88, 0, 1284,
+ 91, 0, 1285
};
-static int parser_action_row1590[] = {
+static int parser_action_row1548[] = {
3,
- -1, 1, 557,
- 74, 0, 1328,
- 75, 0, 1329
+ -1, 1, 550,
+ 74, 0, 1286,
+ 75, 0, 1287
};
-static int parser_action_row1591[] = {
+static int parser_action_row1549[] = {
3,
- -1, 1, 558,
- 74, 0, 1328,
- 75, 0, 1329
+ -1, 1, 551,
+ 74, 0, 1286,
+ 75, 0, 1287
};
-static int parser_action_row1592[] = {
+static int parser_action_row1550[] = {
4,
- -1, 1, 560,
- 76, 0, 1330,
- 78, 0, 1331,
- 79, 0, 1332
+ -1, 1, 553,
+ 76, 0, 1288,
+ 78, 0, 1289,
+ 79, 0, 1290
};
-static int parser_action_row1593[] = {
+static int parser_action_row1551[] = {
4,
- -1, 1, 561,
- 76, 0, 1330,
- 78, 0, 1331,
- 79, 0, 1332
+ -1, 1, 554,
+ 76, 0, 1288,
+ 78, 0, 1289,
+ 79, 0, 1290
};
-static int parser_action_row1594[] = {
+static int parser_action_row1552[] = {
1,
- -1, 1, 563
+ -1, 1, 556
};
-static int parser_action_row1595[] = {
+static int parser_action_row1553[] = {
1,
- -1, 1, 564
+ -1, 1, 557
};
-static int parser_action_row1596[] = {
+static int parser_action_row1554[] = {
1,
- -1, 1, 565
+ -1, 1, 558
};
-static int parser_action_row1597[] = {
+static int parser_action_row1555[] = {
1,
- -1, 1, 567
+ -1, 1, 560
};
-static int parser_action_row1598[] = {
+static int parser_action_row1556[] = {
2,
- -1, 1, 601,
- 52, 0, 295
+ -1, 1, 594,
+ 52, 0, 274
};
-static int parser_action_row1599[] = {
+static int parser_action_row1557[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1600[] = {
+static int parser_action_row1558[] = {
3,
- -1, 1, 583,
- 52, 0, 295,
- 58, 0, 227
+ -1, 1, 576,
+ 52, 0, 274,
+ 58, 0, 213
};
-static int parser_action_row1601[] = {
+static int parser_action_row1559[] = {
2,
- -1, 3, 1600,
- 98, 0, 1677
+ -1, 3, 1558,
+ 98, 0, 1635
};
-static int parser_action_row1602[] = {
+static int parser_action_row1560[] = {
2,
- -1, 1, 461,
- 97, 0, 1678
+ -1, 1, 454,
+ 97, 0, 1636
};
-static int parser_action_row1603[] = {
+static int parser_action_row1561[] = {
3,
- -1, 1, 463,
+ -1, 1, 456,
96, 0, 53,
- 97, 0, 1679
+ 97, 0, 1637
};
-static int parser_action_row1604[] = {
+static int parser_action_row1562[] = {
1,
- -1, 1, 590
+ -1, 1, 583
};
-static int parser_action_row1605[] = {
+static int parser_action_row1563[] = {
4,
- -1, 3, 1604,
- 6, 0, 816,
- 17, 0, 817,
- 97, 0, 818
+ -1, 3, 1562,
+ 6, 0, 788,
+ 17, 0, 789,
+ 97, 0, 790
};
-static int parser_action_row1606[] = {
+static int parser_action_row1564[] = {
1,
-1, 1, 121
};
-static int parser_action_row1607[] = {
+static int parser_action_row1565[] = {
1,
-1, 1, 109
};
-static int parser_action_row1608[] = {
+static int parser_action_row1566[] = {
1,
-1, 1, 116
};
-static int parser_action_row1609[] = {
+static int parser_action_row1567[] = {
25,
- -1, 3, 1608,
- 41, 0, 1349,
- 47, 0, 420,
- 54, 0, 664,
- 74, 0, 665,
- 75, 0, 666,
- 76, 0, 667,
- 77, 0, 668,
- 78, 0, 669,
- 79, 0, 670,
- 80, 0, 671,
- 81, 0, 672,
- 82, 0, 673,
- 83, 0, 674,
- 84, 0, 675,
- 85, 0, 676,
- 86, 0, 677,
- 87, 0, 678,
- 88, 0, 679,
- 89, 0, 680,
- 90, 0, 681,
- 91, 0, 682,
- 92, 0, 683,
- 96, 0, 448,
- 97, 0, 684
+ -1, 3, 1566,
+ 41, 0, 1307,
+ 47, 0, 392,
+ 54, 0, 636,
+ 74, 0, 637,
+ 75, 0, 638,
+ 76, 0, 639,
+ 77, 0, 640,
+ 78, 0, 641,
+ 79, 0, 642,
+ 80, 0, 643,
+ 81, 0, 644,
+ 82, 0, 645,
+ 83, 0, 646,
+ 84, 0, 647,
+ 85, 0, 648,
+ 86, 0, 649,
+ 87, 0, 650,
+ 88, 0, 651,
+ 89, 0, 652,
+ 90, 0, 653,
+ 91, 0, 654,
+ 92, 0, 655,
+ 96, 0, 420,
+ 97, 0, 656
};
-static int parser_action_row1610[] = {
+static int parser_action_row1568[] = {
1,
- -1, 1, 1093
+ -1, 1, 1065
};
-static int parser_action_row1611[] = {
+static int parser_action_row1569[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1612[] = {
+static int parser_action_row1570[] = {
1,
-1, 1, 130
};
-static int parser_action_row1613[] = {
+static int parser_action_row1571[] = {
1,
-1, 1, 41
};
-static int parser_action_row1614[] = {
+static int parser_action_row1572[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1615[] = {
+static int parser_action_row1573[] = {
2,
- -1, 3, 1614,
- 9, 0, 1685
+ -1, 3, 1572,
+ 9, 0, 1643
};
-static int parser_action_row1616[] = {
+static int parser_action_row1574[] = {
4,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
95, 0, 3
};
-static int parser_action_row1617[] = {
+static int parser_action_row1575[] = {
2,
- -1, 3, 1616,
- 96, 0, 1360
+ -1, 3, 1574,
+ 96, 0, 1318
};
-static int parser_action_row1618[] = {
+static int parser_action_row1576[] = {
1,
- -1, 1, 1085
+ -1, 1, 1057
};
-static int parser_action_row1619[] = {
+static int parser_action_row1577[] = {
5,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2,
- 52, 0, 852,
- 57, 0, 853
+ 52, 0, 824,
+ 57, 0, 825
};
-static int parser_action_row1620[] = {
+static int parser_action_row1578[] = {
2,
- -1, 3, 1619,
- 57, 0, 853
+ -1, 3, 1577,
+ 57, 0, 825
};
-static int parser_action_row1621[] = {
+static int parser_action_row1579[] = {
3,
- -1, 3, 1620,
- 14, 0, 1690,
- 15, 0, 1691
+ -1, 3, 1578,
+ 14, 0, 1648,
+ 15, 0, 1649
};
-static int parser_action_row1622[] = {
+static int parser_action_row1580[] = {
5,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2,
- 52, 0, 852,
- 57, 0, 853
+ 52, 0, 824,
+ 57, 0, 825
};
-static int parser_action_row1623[] = {
+static int parser_action_row1581[] = {
2,
-1, 1, 155,
- 57, 0, 357
+ 57, 0, 329
};
-static int parser_action_row1624[] = {
+static int parser_action_row1582[] = {
4,
-1, 1, 124,
- 4, 0, 1001,
- 14, 0, 1002,
- 15, 0, 1695
+ 4, 0, 973,
+ 14, 0, 974,
+ 15, 0, 1653
};
-static int parser_action_row1625[] = {
+static int parser_action_row1583[] = {
5,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2,
- 52, 0, 852,
- 57, 0, 853
+ 52, 0, 824,
+ 57, 0, 825
};
-static int parser_action_row1626[] = {
+static int parser_action_row1584[] = {
3,
- -1, 3, 1625,
- 47, 0, 420,
- 96, 0, 421
+ -1, 3, 1583,
+ 47, 0, 392,
+ 96, 0, 393
};
-static int parser_action_row1627[] = {
+static int parser_action_row1585[] = {
2,
- -1, 3, 1626,
- 57, 0, 1701
+ -1, 3, 1584,
+ 57, 0, 1659
};
-static int parser_action_row1628[] = {
+static int parser_action_row1586[] = {
2,
- -1, 3, 1627,
- 53, 0, 1702
+ -1, 3, 1585,
+ 53, 0, 1660
};
-static int parser_action_row1629[] = {
+static int parser_action_row1587[] = {
1,
- -1, 1, 683
+ -1, 1, 669
};
-static int parser_action_row1630[] = {
+static int parser_action_row1588[] = {
1,
- -1, 1, 702
+ -1, 1, 688
};
-static int parser_action_row1631[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1589[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1632[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1590[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1633[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1591[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1634[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1592[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1635[] = {
- 32,
- -1, 1, 524,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+static int parser_action_row1593[] = {
+ 25,
+ -1, 1, 517,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1636[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1594[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1637[] = {
+static int parser_action_row1595[] = {
13,
- -1, 1, 769,
- 59, 0, 1709,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ -1, 1, 755,
+ 59, 0, 1667,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row1638[] = {
+static int parser_action_row1596[] = {
25,
- -1, 1, 464,
- 12, 0, 754,
- 46, 0, 755,
- 54, 0, 643,
- 74, 0, 644,
- 75, 0, 645,
- 76, 0, 431,
- 77, 0, 432,
- 78, 0, 433,
- 79, 0, 434,
- 80, 0, 435,
- 81, 0, 436,
- 82, 0, 437,
- 83, 0, 646,
- 84, 0, 439,
- 85, 0, 440,
- 86, 0, 441,
- 87, 0, 442,
- 88, 0, 443,
- 89, 0, 444,
- 90, 0, 445,
- 91, 0, 446,
- 92, 0, 447,
- 96, 0, 53,
- 97, 0, 1711
+ -1, 1, 457,
+ 12, 0, 726,
+ 46, 0, 727,
+ 54, 0, 615,
+ 74, 0, 616,
+ 75, 0, 617,
+ 76, 0, 403,
+ 77, 0, 404,
+ 78, 0, 405,
+ 79, 0, 406,
+ 80, 0, 407,
+ 81, 0, 408,
+ 82, 0, 409,
+ 83, 0, 618,
+ 84, 0, 411,
+ 85, 0, 412,
+ 86, 0, 413,
+ 87, 0, 414,
+ 88, 0, 415,
+ 89, 0, 416,
+ 90, 0, 417,
+ 91, 0, 418,
+ 92, 0, 419,
+ 96, 0, 53,
+ 97, 0, 1669
};
-static int parser_action_row1639[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1597[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1640[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1598[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1641[] = {
- 32,
- -1, 1, 524,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+static int parser_action_row1599[] = {
+ 25,
+ -1, 1, 517,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1642[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1600[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1643[] = {
+static int parser_action_row1601[] = {
13,
- -1, 1, 773,
- 59, 0, 1720,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ -1, 1, 759,
+ 59, 0, 1678,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row1644[] = {
+static int parser_action_row1602[] = {
14,
- -1, 1, 772,
- 52, 0, 295,
- 59, 0, 1722,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ -1, 1, 758,
+ 52, 0, 274,
+ 59, 0, 1680,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row1645[] = {
+static int parser_action_row1603[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1646[] = {
+static int parser_action_row1604[] = {
1,
-1, 1, 363
};
-static int parser_action_row1647[] = {
- 28,
- -1, 1, 464,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row1605[] = {
+ 21,
+ -1, 1, 457,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row1648[] = {
+static int parser_action_row1606[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1649[] = {
+static int parser_action_row1607[] = {
1,
- -1, 1, 790
+ -1, 1, 776
};
-static int parser_action_row1650[] = {
+static int parser_action_row1608[] = {
2,
- -1, 3, 1649,
- 24, 0, 1728
+ -1, 3, 1607,
+ 24, 0, 1686
};
-static int parser_action_row1651[] = {
+static int parser_action_row1609[] = {
1,
- -1, 1, 962
+ -1, 1, 934
};
-static int parser_action_row1652[] = {
+static int parser_action_row1610[] = {
2,
- -1, 3, 1651,
- 49, 0, 209
+ -1, 3, 1609,
+ 49, 0, 195
};
-static int parser_action_row1653[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1611[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1654[] = {
+static int parser_action_row1612[] = {
1,
- -1, 1, 966
+ -1, 1, 938
};
-static int parser_action_row1655[] = {
+static int parser_action_row1613[] = {
2,
- -1, 3, 1654,
- 49, 0, 209
+ -1, 3, 1612,
+ 49, 0, 195
};
-static int parser_action_row1656[] = {
+static int parser_action_row1614[] = {
2,
-1, 1, 194,
- 24, 1, 949
+ 24, 1, 921
};
-static int parser_action_row1657[] = {
+static int parser_action_row1615[] = {
2,
-1, 1, 184,
- 24, 1, 939
+ 24, 1, 911
};
-static int parser_action_row1658[] = {
+static int parser_action_row1616[] = {
2,
-1, 1, 196,
- 24, 1, 951
+ 24, 1, 923
};
-static int parser_action_row1659[] = {
+static int parser_action_row1617[] = {
2,
-1, 1, 186,
- 24, 1, 941
+ 24, 1, 913
};
-static int parser_action_row1660[] = {
- 31,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 510,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+static int parser_action_row1618[] = {
+ 24,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 482,
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row1661[] = {
- 45,
- -1, 1, 448,
- 12, 0, 122,
- 22, 0, 123,
- 31, 0, 124,
- 38, 0, 125,
- 40, 0, 126,
- 41, 1, 464,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 48, 0, 131,
- 52, 0, 132,
+static int parser_action_row1619[] = {
+ 38,
+ -1, 1, 441,
+ 12, 0, 115,
+ 22, 0, 116,
+ 31, 0, 117,
+ 38, 0, 118,
+ 40, 0, 119,
+ 41, 1, 457,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 48, 0, 124,
+ 52, 0, 125,
54, 1, 337,
- 59, 0, 1217,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239,
+ 59, 0, 1182,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225,
73, 1, 337,
- 74, 0, 133,
- 75, 0, 134,
- 83, 0, 135,
- 96, 0, 53,
- 97, 0, 136,
- 98, 1, 464,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+ 74, 0, 126,
+ 75, 0, 127,
+ 83, 0, 128,
+ 96, 0, 53,
+ 97, 0, 129,
+ 98, 1, 457,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row1662[] = {
+static int parser_action_row1620[] = {
1,
-1, 1, 271
};
-static int parser_action_row1663[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1621[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1664[] = {
+static int parser_action_row1622[] = {
2,
- -1, 3, 1663,
- 53, 0, 1735
+ -1, 3, 1621,
+ 53, 0, 1693
};
-static int parser_action_row1665[] = {
+static int parser_action_row1623[] = {
1,
- -1, 1, 413
+ -1, 1, 406
};
-static int parser_action_row1666[] = {
+static int parser_action_row1624[] = {
1,
- -1, 1, 433
+ -1, 1, 426
};
-static int parser_action_row1667[] = {
- 31,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 470,
- 27, 0, 471,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1625[] = {
+ 24,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 442,
+ 27, 0, 443,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1668[] = {
+static int parser_action_row1626[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1669[] = {
+static int parser_action_row1627[] = {
1,
- -1, 1, 826
+ -1, 1, 805
};
-static int parser_action_row1670[] = {
+static int parser_action_row1628[] = {
3,
- -1, 3, 1669,
+ -1, 3, 1627,
96, 0, 53,
- 97, 0, 1738
+ 97, 0, 1696
};
-static int parser_action_row1671[] = {
+static int parser_action_row1629[] = {
2,
- -1, 3, 1670,
- 98, 0, 1741
+ -1, 3, 1628,
+ 98, 0, 1699
};
-static int parser_action_row1672[] = {
+static int parser_action_row1630[] = {
1,
- -1, 1, 537
+ -1, 1, 530
};
-static int parser_action_row1673[] = {
+static int parser_action_row1631[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row1674[] = {
+static int parser_action_row1632[] = {
1,
- -1, 1, 530
+ -1, 1, 523
};
-static int parser_action_row1675[] = {
+static int parser_action_row1633[] = {
1,
- -1, 1, 599
+ -1, 1, 592
};
-static int parser_action_row1676[] = {
+static int parser_action_row1634[] = {
3,
- -1, 3, 1675,
- 31, 0, 1743,
- 52, 0, 1744
+ -1, 3, 1633,
+ 31, 0, 1701,
+ 52, 0, 1702
};
-static int parser_action_row1677[] = {
+static int parser_action_row1635[] = {
1,
- -1, 1, 581
+ -1, 1, 574
};
-static int parser_action_row1678[] = {
+static int parser_action_row1636[] = {
1,
- -1, 1, 579
+ -1, 1, 572
};
-static int parser_action_row1679[] = {
+static int parser_action_row1637[] = {
2,
- -1, 1, 587,
- 52, 0, 295
+ -1, 1, 580,
+ 52, 0, 274
};
-static int parser_action_row1680[] = {
+static int parser_action_row1638[] = {
3,
- -1, 1, 595,
- 52, 0, 295,
- 58, 0, 227
+ -1, 1, 588,
+ 52, 0, 274,
+ 58, 0, 213
};
-static int parser_action_row1681[] = {
+static int parser_action_row1639[] = {
2,
- -1, 1, 462,
- 97, 0, 1747
+ -1, 1, 455,
+ 97, 0, 1705
};
-static int parser_action_row1682[] = {
- 63,
- -1, 1, 464,
- 0, 0, 94,
- 1, 0, 95,
- 12, 0, 122,
+static int parser_action_row1640[] = {
+ 56,
+ -1, 1, 457,
+ 0, 0, 87,
+ 1, 0, 88,
+ 12, 0, 115,
15, 0, 33,
16, 0, 34,
- 22, 0, 123,
+ 22, 0, 116,
25, 0, 36,
26, 0, 37,
27, 0, 38,
- 31, 0, 124,
- 33, 0, 1365,
- 34, 0, 1366,
- 35, 0, 1367,
- 36, 0, 1368,
+ 31, 0, 117,
+ 33, 0, 1323,
+ 34, 0, 1324,
+ 35, 0, 1325,
+ 36, 0, 1326,
37, 0, 43,
- 38, 0, 125,
- 40, 0, 126,
- 42, 0, 127,
- 43, 0, 128,
- 44, 0, 129,
- 45, 0, 130,
- 47, 0, 420,
- 48, 0, 131,
+ 38, 0, 118,
+ 40, 0, 119,
+ 42, 0, 120,
+ 43, 0, 121,
+ 44, 0, 122,
+ 45, 0, 123,
+ 47, 0, 392,
+ 48, 0, 124,
50, 0, 49,
- 51, 0, 1369,
- 52, 0, 1748,
- 54, 0, 643,
- 74, 0, 1371,
- 75, 0, 1372,
- 76, 0, 431,
- 77, 0, 432,
- 78, 0, 433,
- 79, 0, 434,
- 80, 0, 435,
- 81, 0, 436,
- 82, 0, 437,
- 83, 0, 1373,
- 84, 0, 439,
- 85, 0, 440,
- 86, 0, 441,
- 87, 0, 442,
- 88, 0, 443,
- 89, 0, 444,
- 90, 0, 445,
- 91, 0, 446,
- 92, 0, 447,
- 94, 0, 216,
- 95, 0, 96,
- 96, 0, 448,
- 97, 0, 1374,
- 99, 0, 137,
- 100, 0, 138,
- 101, 0, 139,
- 102, 0, 140,
- 103, 0, 141,
- 104, 0, 142,
- 105, 0, 143,
- 106, 0, 144,
- 107, 0, 145,
- 108, 0, 146,
- 109, 0, 65,
- 112, 0, 147
+ 51, 0, 1327,
+ 52, 0, 1706,
+ 54, 0, 615,
+ 74, 0, 1329,
+ 75, 0, 1330,
+ 76, 0, 403,
+ 77, 0, 404,
+ 78, 0, 405,
+ 79, 0, 406,
+ 80, 0, 407,
+ 81, 0, 408,
+ 82, 0, 409,
+ 83, 0, 1331,
+ 84, 0, 411,
+ 85, 0, 412,
+ 86, 0, 413,
+ 87, 0, 414,
+ 88, 0, 415,
+ 89, 0, 416,
+ 90, 0, 417,
+ 91, 0, 418,
+ 92, 0, 419,
+ 94, 0, 202,
+ 95, 0, 89,
+ 96, 0, 420,
+ 97, 0, 1332,
+ 99, 0, 130,
+ 100, 0, 131,
+ 101, 0, 132,
+ 102, 0, 58,
+ 105, 0, 133
};
-static int parser_action_row1683[] = {
+static int parser_action_row1641[] = {
1,
-1, 1, 125
};
-static int parser_action_row1684[] = {
+static int parser_action_row1642[] = {
5,
- -1, 3, 1683,
- 31, 0, 1752,
- 47, 0, 1753,
- 52, 0, 1754,
- 96, 0, 421
+ -1, 3, 1641,
+ 31, 0, 1710,
+ 47, 0, 1711,
+ 52, 0, 1712,
+ 96, 0, 393
};
-static int parser_action_row1685[] = {
+static int parser_action_row1643[] = {
1,
-1, 1, 42
};
-static int parser_action_row1686[] = {
+static int parser_action_row1644[] = {
1,
-1, 1, 28
};
-static int parser_action_row1687[] = {
+static int parser_action_row1645[] = {
2,
- -1, 3, 1686,
- 9, 0, 1756
+ -1, 3, 1644,
+ 9, 0, 1714
};
-static int parser_action_row1688[] = {
+static int parser_action_row1646[] = {
1,
-1, 1, 40
};
-static int parser_action_row1689[] = {
+static int parser_action_row1647[] = {
4,
-1, 1, 124,
- 4, 0, 1001,
- 14, 0, 1002,
- 15, 0, 1757
+ 4, 0, 973,
+ 14, 0, 974,
+ 15, 0, 1715
};
-static int parser_action_row1690[] = {
+static int parser_action_row1648[] = {
2,
-1, 1, 78,
- 14, 0, 993
+ 14, 0, 965
};
-static int parser_action_row1691[] = {
+static int parser_action_row1649[] = {
5,
-1, 1, 30,
- 0, 0, 94,
- 1, 0, 95,
+ 0, 0, 87,
+ 1, 0, 88,
13, 0, 32,
- 95, 0, 96
+ 95, 0, 89
};
-static int parser_action_row1692[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row1650[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 613,
+ 9, 0, 585,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1693[] = {
+static int parser_action_row1651[] = {
2,
- -1, 3, 1692,
- 15, 0, 1765
+ -1, 3, 1650,
+ 15, 0, 1723
};
-static int parser_action_row1694[] = {
+static int parser_action_row1652[] = {
3,
- -1, 3, 1693,
- 14, 0, 1690,
- 15, 0, 1766
+ -1, 3, 1651,
+ 14, 0, 1648,
+ 15, 0, 1724
};
-static int parser_action_row1695[] = {
+static int parser_action_row1653[] = {
4,
-1, 1, 78,
- 14, 0, 1768,
- 15, 0, 1769,
- 59, 0, 1770
+ 14, 0, 1726,
+ 15, 0, 1727,
+ 59, 0, 1728
};
-static int parser_action_row1696[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row1654[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 613,
+ 9, 0, 585,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1697[] = {
+static int parser_action_row1655[] = {
3,
-1, 1, 124,
- 4, 0, 1001,
- 15, 0, 1774
+ 4, 0, 973,
+ 15, 0, 1732
};
-static int parser_action_row1698[] = {
+static int parser_action_row1656[] = {
3,
- -1, 3, 1697,
- 28, 0, 90,
- 115, 0, 91
+ -1, 3, 1655,
+ 28, 0, 83,
+ 108, 0, 84
};
-static int parser_action_row1699[] = {
+static int parser_action_row1657[] = {
1,
-1, 1, 51
};
-static int parser_action_row1700[] = {
+static int parser_action_row1658[] = {
4,
-1, 1, 124,
- 4, 0, 1001,
- 14, 0, 1002,
- 15, 0, 1777
+ 4, 0, 973,
+ 14, 0, 974,
+ 15, 0, 1735
};
-static int parser_action_row1701[] = {
+static int parser_action_row1659[] = {
2,
-1, 1, 78,
- 14, 0, 993
+ 14, 0, 965
};
-static int parser_action_row1702[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1660[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1703[] = {
+static int parser_action_row1661[] = {
2,
- -1, 1, 428,
- 94, 0, 216
+ -1, 1, 421,
+ 94, 0, 202
};
-static int parser_action_row1704[] = {
+static int parser_action_row1662[] = {
1,
- -1, 1, 682
+ -1, 1, 668
};
-static int parser_action_row1705[] = {
+static int parser_action_row1663[] = {
1,
- -1, 1, 701
+ -1, 1, 687
};
-static int parser_action_row1706[] = {
+static int parser_action_row1664[] = {
1,
- -1, 1, 673
+ -1, 1, 659
};
-static int parser_action_row1707[] = {
+static int parser_action_row1665[] = {
1,
- -1, 1, 692
+ -1, 1, 678
};
-static int parser_action_row1708[] = {
+static int parser_action_row1666[] = {
1,
- -1, 1, 685
+ -1, 1, 671
};
-static int parser_action_row1709[] = {
+static int parser_action_row1667[] = {
1,
- -1, 1, 704
+ -1, 1, 690
};
-static int parser_action_row1710[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1668[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1711[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1669[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1712[] = {
+static int parser_action_row1670[] = {
15,
- -1, 1, 760,
- 52, 0, 295,
- 58, 0, 227,
- 59, 0, 1786,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ -1, 1, 746,
+ 52, 0, 274,
+ 58, 0, 213,
+ 59, 0, 1744,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row1713[] = {
+static int parser_action_row1671[] = {
2,
- -1, 3, 1712,
- 98, 0, 1789
+ -1, 3, 1670,
+ 98, 0, 1747
};
-static int parser_action_row1714[] = {
+static int parser_action_row1672[] = {
22,
- -1, 1, 461,
- 54, 0, 643,
- 74, 0, 644,
- 75, 0, 645,
- 76, 0, 431,
- 77, 0, 432,
- 78, 0, 433,
- 79, 0, 434,
- 80, 0, 435,
- 81, 0, 436,
- 82, 0, 437,
- 83, 0, 646,
- 84, 0, 439,
- 85, 0, 440,
- 86, 0, 441,
- 87, 0, 442,
- 88, 0, 443,
- 89, 0, 444,
- 90, 0, 445,
- 91, 0, 446,
- 92, 0, 447,
- 97, 0, 1790
+ -1, 1, 454,
+ 54, 0, 615,
+ 74, 0, 616,
+ 75, 0, 617,
+ 76, 0, 403,
+ 77, 0, 404,
+ 78, 0, 405,
+ 79, 0, 406,
+ 80, 0, 407,
+ 81, 0, 408,
+ 82, 0, 409,
+ 83, 0, 618,
+ 84, 0, 411,
+ 85, 0, 412,
+ 86, 0, 413,
+ 87, 0, 414,
+ 88, 0, 415,
+ 89, 0, 416,
+ 90, 0, 417,
+ 91, 0, 418,
+ 92, 0, 419,
+ 97, 0, 1748
};
-static int parser_action_row1715[] = {
+static int parser_action_row1673[] = {
1,
- -1, 1, 823
+ -1, 1, 802
};
-static int parser_action_row1716[] = {
+static int parser_action_row1674[] = {
23,
- -1, 1, 463,
- 54, 0, 643,
- 74, 0, 644,
- 75, 0, 645,
- 76, 0, 431,
- 77, 0, 432,
- 78, 0, 433,
- 79, 0, 434,
- 80, 0, 435,
- 81, 0, 436,
- 82, 0, 437,
- 83, 0, 646,
- 84, 0, 439,
- 85, 0, 440,
- 86, 0, 441,
- 87, 0, 442,
- 88, 0, 443,
- 89, 0, 444,
- 90, 0, 445,
- 91, 0, 446,
- 92, 0, 447,
- 96, 0, 53,
- 97, 0, 1791
+ -1, 1, 456,
+ 54, 0, 615,
+ 74, 0, 616,
+ 75, 0, 617,
+ 76, 0, 403,
+ 77, 0, 404,
+ 78, 0, 405,
+ 79, 0, 406,
+ 80, 0, 407,
+ 81, 0, 408,
+ 82, 0, 409,
+ 83, 0, 618,
+ 84, 0, 411,
+ 85, 0, 412,
+ 86, 0, 413,
+ 87, 0, 414,
+ 88, 0, 415,
+ 89, 0, 416,
+ 90, 0, 417,
+ 91, 0, 418,
+ 92, 0, 419,
+ 96, 0, 53,
+ 97, 0, 1749
};
-static int parser_action_row1717[] = {
+static int parser_action_row1675[] = {
1,
- -1, 1, 690
+ -1, 1, 676
};
-static int parser_action_row1718[] = {
+static int parser_action_row1676[] = {
1,
- -1, 1, 709
+ -1, 1, 695
};
-static int parser_action_row1719[] = {
+static int parser_action_row1677[] = {
1,
- -1, 1, 689
+ -1, 1, 675
};
-static int parser_action_row1720[] = {
+static int parser_action_row1678[] = {
1,
- -1, 1, 708
+ -1, 1, 694
};
-static int parser_action_row1721[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1679[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1722[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1680[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1723[] = {
- 32,
- -1, 1, 524,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+static int parser_action_row1681[] = {
+ 25,
+ -1, 1, 517,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1724[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1682[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1725[] = {
+static int parser_action_row1683[] = {
13,
- -1, 1, 771,
- 59, 0, 1797,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ -1, 1, 757,
+ 59, 0, 1755,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row1726[] = {
+static int parser_action_row1684[] = {
2,
- -1, 3, 1725,
- 53, 0, 1799
+ -1, 3, 1683,
+ 53, 0, 1757
};
-static int parser_action_row1727[] = {
+static int parser_action_row1685[] = {
1,
- -1, 1, 711
+ -1, 1, 697
};
-static int parser_action_row1728[] = {
+static int parser_action_row1686[] = {
2,
- -1, 3, 1727,
- 53, 0, 1800
+ -1, 3, 1685,
+ 53, 0, 1758
};
-static int parser_action_row1729[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row1687[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 1417,
- 12, 0, 911,
- 15, 0, 912,
+ 9, 0, 1375,
+ 12, 0, 883,
+ 15, 0, 884,
16, 0, 34,
- 22, 0, 913,
- 25, 0, 915,
- 26, 0, 916,
- 27, 0, 917,
- 33, 0, 918,
- 34, 0, 919,
- 35, 0, 920,
- 36, 0, 921,
- 37, 0, 922,
+ 22, 0, 885,
+ 25, 0, 887,
+ 26, 0, 888,
+ 27, 0, 889,
+ 33, 0, 890,
+ 34, 0, 891,
+ 35, 0, 892,
+ 36, 0, 893,
+ 37, 0, 894,
38, 0, 44,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 50, 0, 923,
- 51, 0, 924,
+ 50, 0, 895,
+ 51, 0, 896,
52, 0, 51,
54, 0, 52,
95, 0, 3,
96, 0, 53,
- 97, 0, 925,
+ 97, 0, 897,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1730[] = {
+static int parser_action_row1688[] = {
2,
-1, 1, 269,
- 24, 1, 961
+ 24, 1, 933
};
-static int parser_action_row1731[] = {
+static int parser_action_row1689[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1732[] = {
+static int parser_action_row1690[] = {
2,
-1, 1, 273,
- 24, 1, 965
+ 24, 1, 937
};
-static int parser_action_row1733[] = {
+static int parser_action_row1691[] = {
2,
-1, 1, 195,
- 24, 1, 950
+ 24, 1, 922
};
-static int parser_action_row1734[] = {
+static int parser_action_row1692[] = {
2,
-1, 1, 185,
- 24, 1, 940
+ 24, 1, 912
};
-static int parser_action_row1735[] = {
+static int parser_action_row1693[] = {
1,
-1, 1, 284
};
-static int parser_action_row1736[] = {
+static int parser_action_row1694[] = {
2,
- -1, 1, 411,
- 94, 0, 216
+ -1, 1, 404,
+ 94, 0, 202
};
-static int parser_action_row1737[] = {
+static int parser_action_row1695[] = {
1,
- -1, 1, 397
+ -1, 1, 390
};
-static int parser_action_row1738[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1696[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1739[] = {
+static int parser_action_row1697[] = {
3,
- -1, 1, 604,
- 52, 0, 295,
- 58, 0, 227
+ -1, 1, 597,
+ 52, 0, 274,
+ 58, 0, 213
};
-static int parser_action_row1740[] = {
+static int parser_action_row1698[] = {
2,
- -1, 3, 1739,
- 97, 0, 1806
+ -1, 3, 1697,
+ 97, 0, 1764
};
-static int parser_action_row1741[] = {
+static int parser_action_row1699[] = {
3,
- -1, 3, 1740,
+ -1, 3, 1698,
96, 0, 53,
- 97, 0, 1807
+ 97, 0, 1765
};
-static int parser_action_row1742[] = {
+static int parser_action_row1700[] = {
2,
- -1, 1, 576,
- 73, 1, 579
+ -1, 1, 569,
+ 73, 1, 572
};
-static int parser_action_row1743[] = {
+static int parser_action_row1701[] = {
1,
- -1, 1, 531
+ -1, 1, 524
};
-static int parser_action_row1744[] = {
+static int parser_action_row1702[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1745[] = {
+static int parser_action_row1703[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1746[] = {
+static int parser_action_row1704[] = {
1,
- -1, 1, 585
+ -1, 1, 578
};
-static int parser_action_row1747[] = {
+static int parser_action_row1705[] = {
1,
- -1, 1, 593
+ -1, 1, 586
};
-static int parser_action_row1748[] = {
+static int parser_action_row1706[] = {
2,
- -1, 1, 591,
- 52, 0, 295
+ -1, 1, 584,
+ 52, 0, 274
};
-static int parser_action_row1749[] = {
+static int parser_action_row1707[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1750[] = {
+static int parser_action_row1708[] = {
4,
- -1, 3, 1749,
- 0, 0, 94,
- 1, 0, 95,
- 95, 0, 96
+ -1, 3, 1707,
+ 0, 0, 87,
+ 1, 0, 88,
+ 95, 0, 89
};
-static int parser_action_row1751[] = {
+static int parser_action_row1709[] = {
1,
- -1, 1, 421
+ -1, 1, 414
};
-static int parser_action_row1752[] = {
+static int parser_action_row1710[] = {
4,
- -1, 3, 1751,
- 0, 0, 94,
- 1, 0, 95,
- 95, 0, 96
+ -1, 3, 1709,
+ 0, 0, 87,
+ 1, 0, 88,
+ 95, 0, 89
};
-static int parser_action_row1753[] = {
+static int parser_action_row1711[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1754[] = {
+static int parser_action_row1712[] = {
2,
-1, 1, 135,
- 96, 0, 627
+ 96, 0, 599
};
-static int parser_action_row1755[] = {
+static int parser_action_row1713[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1756[] = {
+static int parser_action_row1714[] = {
1,
-1, 1, 133
};
-static int parser_action_row1757[] = {
+static int parser_action_row1715[] = {
1,
-1, 1, 29
};
-static int parser_action_row1758[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row1716[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 613,
+ 9, 0, 585,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1759[] = {
+static int parser_action_row1717[] = {
3,
-1, 1, 124,
- 4, 0, 1001,
- 15, 0, 1818
+ 4, 0, 973,
+ 15, 0, 1776
};
-static int parser_action_row1760[] = {
+static int parser_action_row1718[] = {
3,
- -1, 3, 1759,
- 28, 0, 90,
- 115, 0, 91
+ -1, 3, 1717,
+ 28, 0, 83,
+ 108, 0, 84
};
-static int parser_action_row1761[] = {
+static int parser_action_row1719[] = {
1,
-1, 1, 50
};
-static int parser_action_row1762[] = {
+static int parser_action_row1720[] = {
1,
-1, 1, 69
};
-static int parser_action_row1763[] = {
+static int parser_action_row1721[] = {
1,
-1, 1, 79
};
-static int parser_action_row1764[] = {
+static int parser_action_row1722[] = {
4,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
95, 0, 3
};
-static int parser_action_row1765[] = {
+static int parser_action_row1723[] = {
2,
- -1, 1, 475,
- 9, 0, 1356
+ -1, 1, 468,
+ 9, 0, 1314
};
-static int parser_action_row1766[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row1724[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 613,
+ 9, 0, 585,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1767[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row1725[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 613,
+ 9, 0, 585,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1768[] = {
+static int parser_action_row1726[] = {
2,
- -1, 3, 1767,
- 15, 0, 1825
+ -1, 3, 1725,
+ 15, 0, 1783
};
-static int parser_action_row1769[] = {
+static int parser_action_row1727[] = {
5,
-1, 1, 30,
- 0, 0, 94,
- 1, 0, 95,
+ 0, 0, 87,
+ 1, 0, 88,
13, 0, 32,
- 95, 0, 96
+ 95, 0, 89
};
-static int parser_action_row1770[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row1728[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 613,
+ 9, 0, 585,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1771[] = {
+static int parser_action_row1729[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1772[] = {
+static int parser_action_row1730[] = {
1,
-1, 1, 59
};
-static int parser_action_row1773[] = {
+static int parser_action_row1731[] = {
2,
- -1, 3, 1772,
- 15, 0, 1830
+ -1, 3, 1730,
+ 15, 0, 1788
};
-static int parser_action_row1774[] = {
+static int parser_action_row1732[] = {
2,
- -1, 1, 475,
- 9, 0, 1356
+ -1, 1, 468,
+ 9, 0, 1314
};
-static int parser_action_row1775[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row1733[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 613,
+ 9, 0, 585,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1776[] = {
+static int parser_action_row1734[] = {
3,
- -1, 3, 1775,
- 28, 0, 90,
- 115, 0, 91
+ -1, 3, 1733,
+ 28, 0, 83,
+ 108, 0, 84
};
-static int parser_action_row1777[] = {
+static int parser_action_row1735[] = {
1,
-1, 1, 70
};
-static int parser_action_row1778[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row1736[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 613,
+ 9, 0, 585,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1779[] = {
+static int parser_action_row1737[] = {
3,
-1, 1, 124,
- 4, 0, 1001,
- 15, 0, 1835
+ 4, 0, 973,
+ 15, 0, 1793
};
-static int parser_action_row1780[] = {
+static int parser_action_row1738[] = {
3,
- -1, 3, 1779,
- 28, 0, 90,
- 115, 0, 91
+ -1, 3, 1737,
+ 28, 0, 83,
+ 108, 0, 84
};
-static int parser_action_row1781[] = {
+static int parser_action_row1739[] = {
1,
-1, 1, 52
};
-static int parser_action_row1782[] = {
+static int parser_action_row1740[] = {
1,
-1, 1, 43
};
-static int parser_action_row1783[] = {
+static int parser_action_row1741[] = {
1,
- -1, 1, 1040
+ -1, 1, 1012
};
-static int parser_action_row1784[] = {
+static int parser_action_row1742[] = {
1,
- -1, 1, 429
+ -1, 1, 422
};
-static int parser_action_row1785[] = {
+static int parser_action_row1743[] = {
1,
- -1, 1, 684
+ -1, 1, 670
};
-static int parser_action_row1786[] = {
+static int parser_action_row1744[] = {
1,
- -1, 1, 703
+ -1, 1, 689
};
-static int parser_action_row1787[] = {
- 32,
- -1, 1, 524,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+static int parser_action_row1745[] = {
+ 25,
+ -1, 1, 517,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1788[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1746[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1789[] = {
+static int parser_action_row1747[] = {
13,
- -1, 1, 759,
- 59, 0, 1840,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ -1, 1, 745,
+ 59, 0, 1798,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row1790[] = {
+static int parser_action_row1748[] = {
13,
- -1, 1, 757,
- 59, 0, 1842,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ -1, 1, 743,
+ 59, 0, 1800,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row1791[] = {
+static int parser_action_row1749[] = {
14,
- -1, 1, 762,
- 52, 0, 295,
- 59, 0, 1844,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ -1, 1, 748,
+ 52, 0, 274,
+ 59, 0, 1802,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row1792[] = {
+static int parser_action_row1750[] = {
15,
- -1, 1, 766,
- 52, 0, 295,
- 58, 0, 227,
- 59, 0, 1847,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ -1, 1, 752,
+ 52, 0, 274,
+ 58, 0, 213,
+ 59, 0, 1805,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row1793[] = {
+static int parser_action_row1751[] = {
22,
- -1, 1, 462,
- 54, 0, 643,
- 74, 0, 644,
- 75, 0, 645,
- 76, 0, 431,
- 77, 0, 432,
- 78, 0, 433,
- 79, 0, 434,
- 80, 0, 435,
- 81, 0, 436,
- 82, 0, 437,
- 83, 0, 646,
- 84, 0, 439,
- 85, 0, 440,
- 86, 0, 441,
- 87, 0, 442,
- 88, 0, 443,
- 89, 0, 444,
- 90, 0, 445,
- 91, 0, 446,
- 92, 0, 447,
- 97, 0, 1850
+ -1, 1, 455,
+ 54, 0, 615,
+ 74, 0, 616,
+ 75, 0, 617,
+ 76, 0, 403,
+ 77, 0, 404,
+ 78, 0, 405,
+ 79, 0, 406,
+ 80, 0, 407,
+ 81, 0, 408,
+ 82, 0, 409,
+ 83, 0, 618,
+ 84, 0, 411,
+ 85, 0, 412,
+ 86, 0, 413,
+ 87, 0, 414,
+ 88, 0, 415,
+ 89, 0, 416,
+ 90, 0, 417,
+ 91, 0, 418,
+ 92, 0, 419,
+ 97, 0, 1808
};
-static int parser_action_row1794[] = {
+static int parser_action_row1752[] = {
1,
- -1, 1, 688
+ -1, 1, 674
};
-static int parser_action_row1795[] = {
+static int parser_action_row1753[] = {
1,
- -1, 1, 707
+ -1, 1, 693
};
-static int parser_action_row1796[] = {
+static int parser_action_row1754[] = {
1,
- -1, 1, 687
+ -1, 1, 673
};
-static int parser_action_row1797[] = {
+static int parser_action_row1755[] = {
1,
- -1, 1, 706
+ -1, 1, 692
};
-static int parser_action_row1798[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1756[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1799[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1757[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1800[] = {
+static int parser_action_row1758[] = {
1,
-1, 1, 364
};
-static int parser_action_row1801[] = {
+static int parser_action_row1759[] = {
1,
- -1, 1, 791
+ -1, 1, 777
};
-static int parser_action_row1802[] = {
+static int parser_action_row1760[] = {
1,
- -1, 1, 958
+ -1, 1, 930
};
-static int parser_action_row1803[] = {
+static int parser_action_row1761[] = {
2,
- -1, 3, 1802,
- 15, 0, 1853
+ -1, 3, 1760,
+ 15, 0, 1811
};
-static int parser_action_row1804[] = {
+static int parser_action_row1762[] = {
1,
- -1, 1, 417
+ -1, 1, 410
};
-static int parser_action_row1805[] = {
+static int parser_action_row1763[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1806[] = {
+static int parser_action_row1764[] = {
1,
- -1, 1, 603
+ -1, 1, 596
};
-static int parser_action_row1807[] = {
+static int parser_action_row1765[] = {
2,
- -1, 1, 606,
- 52, 0, 295
+ -1, 1, 599,
+ 52, 0, 274
};
-static int parser_action_row1808[] = {
+static int parser_action_row1766[] = {
3,
- -1, 1, 610,
- 52, 0, 295,
- 58, 0, 227
+ -1, 1, 603,
+ 52, 0, 274,
+ 58, 0, 213
};
-static int parser_action_row1809[] = {
+static int parser_action_row1767[] = {
2,
- -1, 3, 1808,
- 97, 0, 1857
+ -1, 3, 1766,
+ 97, 0, 1815
};
-static int parser_action_row1810[] = {
+static int parser_action_row1768[] = {
2,
- -1, 3, 1809,
- 45, 0, 1858
+ -1, 3, 1767,
+ 45, 0, 1816
};
-static int parser_action_row1811[] = {
+static int parser_action_row1769[] = {
4,
- -1, 3, 1810,
- 31, 0, 1859,
- 47, 0, 420,
- 96, 0, 421
+ -1, 3, 1768,
+ 31, 0, 1817,
+ 47, 0, 392,
+ 96, 0, 393
};
-static int parser_action_row1812[] = {
+static int parser_action_row1770[] = {
1,
- -1, 1, 589
+ -1, 1, 582
};
-static int parser_action_row1813[] = {
- 60,
- -1, 1, 464,
- 12, 0, 182,
+static int parser_action_row1771[] = {
+ 53,
+ -1, 1, 457,
+ 12, 0, 168,
15, 0, 33,
16, 0, 34,
- 22, 0, 183,
+ 22, 0, 169,
25, 0, 36,
26, 0, 37,
27, 0, 38,
- 31, 0, 184,
- 33, 0, 423,
- 34, 0, 424,
- 35, 0, 425,
- 36, 0, 426,
+ 31, 0, 170,
+ 33, 0, 395,
+ 34, 0, 396,
+ 35, 0, 397,
+ 36, 0, 398,
37, 0, 43,
- 38, 0, 185,
- 40, 0, 186,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 47, 0, 420,
- 48, 0, 187,
+ 47, 0, 392,
+ 48, 0, 173,
50, 0, 49,
- 51, 0, 427,
+ 51, 0, 399,
52, 0, 51,
- 54, 0, 428,
- 74, 0, 429,
- 75, 0, 430,
- 76, 0, 431,
- 77, 0, 432,
- 78, 0, 433,
- 79, 0, 434,
- 80, 0, 435,
- 81, 0, 436,
- 82, 0, 437,
- 83, 0, 438,
- 84, 0, 439,
- 85, 0, 440,
- 86, 0, 441,
- 87, 0, 442,
- 88, 0, 443,
- 89, 0, 444,
- 90, 0, 445,
- 91, 0, 446,
- 92, 0, 447,
- 94, 0, 216,
- 96, 0, 448,
- 97, 0, 449,
+ 54, 0, 400,
+ 74, 0, 401,
+ 75, 0, 402,
+ 76, 0, 403,
+ 77, 0, 404,
+ 78, 0, 405,
+ 79, 0, 406,
+ 80, 0, 407,
+ 81, 0, 408,
+ 82, 0, 409,
+ 83, 0, 410,
+ 84, 0, 411,
+ 85, 0, 412,
+ 86, 0, 413,
+ 87, 0, 414,
+ 88, 0, 415,
+ 89, 0, 416,
+ 90, 0, 417,
+ 91, 0, 418,
+ 92, 0, 419,
+ 94, 0, 202,
+ 96, 0, 420,
+ 97, 0, 421,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1814[] = {
+static int parser_action_row1772[] = {
1,
- -1, 1, 422
+ -1, 1, 415
};
-static int parser_action_row1815[] = {
+static int parser_action_row1773[] = {
1,
- -1, 1, 425
+ -1, 1, 418
};
-static int parser_action_row1816[] = {
+static int parser_action_row1774[] = {
2,
- -1, 3, 1815,
- 47, 0, 1862
+ -1, 3, 1773,
+ 47, 0, 1820
};
-static int parser_action_row1817[] = {
+static int parser_action_row1775[] = {
4,
- -1, 3, 1816,
- 31, 0, 1863,
- 47, 0, 1864,
- 96, 0, 421
+ -1, 3, 1774,
+ 31, 0, 1821,
+ 47, 0, 1822,
+ 96, 0, 393
};
-static int parser_action_row1818[] = {
+static int parser_action_row1776[] = {
2,
- -1, 1, 475,
- 9, 0, 1356
+ -1, 1, 468,
+ 9, 0, 1314
};
-static int parser_action_row1819[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row1777[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 613,
+ 9, 0, 585,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1820[] = {
+static int parser_action_row1778[] = {
3,
- -1, 3, 1819,
- 28, 0, 90,
- 115, 0, 91
+ -1, 3, 1777,
+ 28, 0, 83,
+ 108, 0, 84
};
-static int parser_action_row1821[] = {
+static int parser_action_row1779[] = {
1,
-1, 1, 57
};
-static int parser_action_row1822[] = {
+static int parser_action_row1780[] = {
5,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
15, 1, 80,
95, 0, 3
};
-static int parser_action_row1823[] = {
+static int parser_action_row1781[] = {
1,
-1, 1, 65
};
-static int parser_action_row1824[] = {
+static int parser_action_row1782[] = {
2,
- -1, 1, 475,
- 9, 0, 1356
+ -1, 1, 468,
+ 9, 0, 1314
};
-static int parser_action_row1825[] = {
+static int parser_action_row1783[] = {
2,
- -1, 1, 475,
- 9, 0, 1356
+ -1, 1, 468,
+ 9, 0, 1314
};
-static int parser_action_row1826[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row1784[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 613,
+ 9, 0, 585,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1827[] = {
+static int parser_action_row1785[] = {
2,
-1, 1, 76,
15, 1, 79
};
-static int parser_action_row1828[] = {
+static int parser_action_row1786[] = {
4,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
95, 0, 3
};
-static int parser_action_row1829[] = {
+static int parser_action_row1787[] = {
2,
-1, 1, 61,
- 9, 0, 1873
+ 9, 0, 1831
};
-static int parser_action_row1830[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1788[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1831[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row1789[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 613,
+ 9, 0, 585,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1832[] = {
+static int parser_action_row1790[] = {
1,
-1, 1, 53
};
-static int parser_action_row1833[] = {
+static int parser_action_row1791[] = {
2,
- -1, 1, 475,
- 9, 0, 1356
+ -1, 1, 468,
+ 9, 0, 1314
};
-static int parser_action_row1834[] = {
+static int parser_action_row1792[] = {
1,
-1, 1, 72
};
-static int parser_action_row1835[] = {
+static int parser_action_row1793[] = {
2,
- -1, 1, 475,
- 9, 0, 1356
+ -1, 1, 468,
+ 9, 0, 1314
};
-static int parser_action_row1836[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row1794[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 613,
+ 9, 0, 585,
12, 0, 31,
15, 0, 33,
16, 0, 34,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1837[] = {
+static int parser_action_row1795[] = {
3,
- -1, 3, 1836,
- 28, 0, 90,
- 115, 0, 91
+ -1, 3, 1794,
+ 28, 0, 83,
+ 108, 0, 84
};
-static int parser_action_row1838[] = {
+static int parser_action_row1796[] = {
1,
-1, 1, 71
};
-static int parser_action_row1839[] = {
+static int parser_action_row1797[] = {
1,
- -1, 1, 675
+ -1, 1, 661
};
-static int parser_action_row1840[] = {
+static int parser_action_row1798[] = {
1,
- -1, 1, 694
+ -1, 1, 680
};
-static int parser_action_row1841[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1799[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1842[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1800[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1843[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1801[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1844[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1802[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1845[] = {
- 32,
- -1, 1, 524,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+static int parser_action_row1803[] = {
+ 25,
+ -1, 1, 517,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1846[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1804[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1847[] = {
+static int parser_action_row1805[] = {
13,
- -1, 1, 761,
- 59, 0, 1886,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ -1, 1, 747,
+ 59, 0, 1844,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row1848[] = {
- 32,
- -1, 1, 524,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+static int parser_action_row1806[] = {
+ 25,
+ -1, 1, 517,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1849[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1807[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1850[] = {
+static int parser_action_row1808[] = {
13,
- -1, 1, 765,
- 59, 0, 1890,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ -1, 1, 751,
+ 59, 0, 1848,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row1851[] = {
+static int parser_action_row1809[] = {
14,
- -1, 1, 764,
- 52, 0, 295,
- 59, 0, 1892,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ -1, 1, 750,
+ 52, 0, 274,
+ 59, 0, 1850,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row1852[] = {
+static int parser_action_row1810[] = {
1,
- -1, 1, 686
+ -1, 1, 672
};
-static int parser_action_row1853[] = {
+static int parser_action_row1811[] = {
1,
- -1, 1, 705
+ -1, 1, 691
};
-static int parser_action_row1854[] = {
- 40,
- -1, 1, 464,
+static int parser_action_row1812[] = {
+ 33,
+ -1, 1, 457,
0, 0, 1,
1, 0, 2,
- 9, 0, 1059,
- 12, 0, 911,
- 15, 0, 912,
+ 9, 0, 1031,
+ 12, 0, 883,
+ 15, 0, 884,
16, 0, 34,
- 22, 0, 913,
- 25, 0, 915,
- 26, 0, 916,
- 27, 0, 917,
- 33, 0, 918,
- 34, 0, 919,
- 35, 0, 920,
- 36, 0, 921,
- 37, 0, 922,
+ 22, 0, 885,
+ 25, 0, 887,
+ 26, 0, 888,
+ 27, 0, 889,
+ 33, 0, 890,
+ 34, 0, 891,
+ 35, 0, 892,
+ 36, 0, 893,
+ 37, 0, 894,
38, 0, 44,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 50, 0, 923,
- 51, 0, 924,
+ 50, 0, 895,
+ 51, 0, 896,
52, 0, 51,
54, 0, 52,
95, 0, 3,
96, 0, 53,
- 97, 0, 925,
+ 97, 0, 897,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1855[] = {
+static int parser_action_row1813[] = {
2,
- -1, 3, 1854,
- 24, 0, 1897
+ -1, 3, 1812,
+ 24, 0, 1855
};
-static int parser_action_row1856[] = {
+static int parser_action_row1814[] = {
1,
- -1, 1, 605
+ -1, 1, 598
};
-static int parser_action_row1857[] = {
+static int parser_action_row1815[] = {
1,
- -1, 1, 609
+ -1, 1, 602
};
-static int parser_action_row1858[] = {
+static int parser_action_row1816[] = {
2,
- -1, 1, 608,
- 52, 0, 295
+ -1, 1, 601,
+ 52, 0, 274
};
-static int parser_action_row1859[] = {
+static int parser_action_row1817[] = {
1,
- -1, 1, 613
+ -1, 1, 606
};
-static int parser_action_row1860[] = {
+static int parser_action_row1818[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1861[] = {
+static int parser_action_row1819[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1862[] = {
+static int parser_action_row1820[] = {
2,
- -1, 3, 1861,
- 53, 0, 1901
+ -1, 3, 1819,
+ 53, 0, 1859
};
-static int parser_action_row1863[] = {
+static int parser_action_row1821[] = {
1,
-1, 1, 137
};
-static int parser_action_row1864[] = {
+static int parser_action_row1822[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1865[] = {
+static int parser_action_row1823[] = {
4,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2,
- 96, 0, 627
+ 96, 0, 599
};
-static int parser_action_row1866[] = {
+static int parser_action_row1824[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1867[] = {
+static int parser_action_row1825[] = {
1,
-1, 1, 48
};
-static int parser_action_row1868[] = {
+static int parser_action_row1826[] = {
2,
- -1, 1, 475,
- 9, 0, 1356
+ -1, 1, 468,
+ 9, 0, 1314
};
-static int parser_action_row1869[] = {
+static int parser_action_row1827[] = {
1,
-1, 1, 58
};
-static int parser_action_row1870[] = {
+static int parser_action_row1828[] = {
1,
-1, 1, 67
};
-static int parser_action_row1871[] = {
+static int parser_action_row1829[] = {
1,
-1, 1, 66
};
-static int parser_action_row1872[] = {
+static int parser_action_row1830[] = {
2,
- -1, 1, 475,
- 9, 0, 1356
+ -1, 1, 468,
+ 9, 0, 1314
};
-static int parser_action_row1873[] = {
+static int parser_action_row1831[] = {
6,
- -1, 1, 491,
+ -1, 1, 484,
0, 0, 1,
1, 0, 2,
- 9, 0, 1487,
+ 9, 0, 1445,
15, 1, 80,
95, 0, 3
};
-static int parser_action_row1874[] = {
+static int parser_action_row1832[] = {
1,
-1, 1, 63
};
-static int parser_action_row1875[] = {
+static int parser_action_row1833[] = {
2,
-1, 1, 78,
- 14, 0, 993
+ 14, 0, 965
};
-static int parser_action_row1876[] = {
+static int parser_action_row1834[] = {
2,
-1, 1, 62,
- 9, 0, 1908
+ 9, 0, 1866
};
-static int parser_action_row1877[] = {
+static int parser_action_row1835[] = {
1,
-1, 1, 55
};
-static int parser_action_row1878[] = {
+static int parser_action_row1836[] = {
1,
-1, 1, 54
};
-static int parser_action_row1879[] = {
+static int parser_action_row1837[] = {
2,
- -1, 1, 475,
- 9, 0, 1356
+ -1, 1, 468,
+ 9, 0, 1314
};
-static int parser_action_row1880[] = {
+static int parser_action_row1838[] = {
1,
-1, 1, 73
};
-static int parser_action_row1881[] = {
+static int parser_action_row1839[] = {
1,
- -1, 1, 674
+ -1, 1, 660
};
-static int parser_action_row1882[] = {
+static int parser_action_row1840[] = {
1,
- -1, 1, 693
+ -1, 1, 679
};
-static int parser_action_row1883[] = {
+static int parser_action_row1841[] = {
1,
- -1, 1, 672
+ -1, 1, 658
};
-static int parser_action_row1884[] = {
+static int parser_action_row1842[] = {
1,
- -1, 1, 691
+ -1, 1, 677
};
-static int parser_action_row1885[] = {
+static int parser_action_row1843[] = {
1,
- -1, 1, 677
+ -1, 1, 663
};
-static int parser_action_row1886[] = {
+static int parser_action_row1844[] = {
1,
- -1, 1, 696
+ -1, 1, 682
};
-static int parser_action_row1887[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1845[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1888[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1846[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1889[] = {
+static int parser_action_row1847[] = {
1,
- -1, 1, 681
+ -1, 1, 667
};
-static int parser_action_row1890[] = {
+static int parser_action_row1848[] = {
1,
- -1, 1, 700
+ -1, 1, 686
};
-static int parser_action_row1891[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1849[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1892[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1850[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1893[] = {
- 32,
- -1, 1, 524,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
- 41, 1, 464,
+static int parser_action_row1851[] = {
+ 25,
+ -1, 1, 517,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
+ 41, 1, 457,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
- 98, 1, 464,
+ 97, 0, 177,
+ 98, 1, 457,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1894[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1852[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1895[] = {
+static int parser_action_row1853[] = {
13,
- -1, 1, 763,
- 59, 0, 1916,
- 60, 0, 229,
- 61, 0, 230,
- 62, 0, 231,
- 63, 0, 232,
- 64, 0, 233,
- 65, 0, 234,
- 66, 0, 235,
- 67, 0, 236,
- 68, 0, 237,
- 69, 0, 238,
- 70, 0, 239
+ -1, 1, 749,
+ 59, 0, 1874,
+ 60, 0, 215,
+ 61, 0, 216,
+ 62, 0, 217,
+ 63, 0, 218,
+ 64, 0, 219,
+ 65, 0, 220,
+ 66, 0, 221,
+ 67, 0, 222,
+ 68, 0, 223,
+ 69, 0, 224,
+ 70, 0, 225
};
-static int parser_action_row1896[] = {
+static int parser_action_row1854[] = {
1,
- -1, 1, 964
+ -1, 1, 936
};
-static int parser_action_row1897[] = {
+static int parser_action_row1855[] = {
2,
- -1, 3, 1896,
- 49, 0, 209
+ -1, 3, 1854,
+ 49, 0, 195
};
-static int parser_action_row1898[] = {
+static int parser_action_row1856[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1899[] = {
+static int parser_action_row1857[] = {
1,
- -1, 1, 607
+ -1, 1, 600
};
-static int parser_action_row1900[] = {
+static int parser_action_row1858[] = {
2,
- -1, 3, 1899,
- 45, 0, 1920
+ -1, 3, 1857,
+ 45, 0, 1878
};
-static int parser_action_row1901[] = {
+static int parser_action_row1859[] = {
2,
- -1, 3, 1900,
- 53, 0, 1921
+ -1, 3, 1858,
+ 53, 0, 1879
};
-static int parser_action_row1902[] = {
+static int parser_action_row1860[] = {
5,
- -1, 3, 1901,
- 0, 0, 94,
- 1, 0, 95,
- 94, 0, 216,
- 95, 0, 96
+ -1, 3, 1859,
+ 0, 0, 87,
+ 1, 0, 88,
+ 94, 0, 202,
+ 95, 0, 89
};
-static int parser_action_row1903[] = {
+static int parser_action_row1861[] = {
2,
- -1, 3, 1902,
- 47, 0, 1924
+ -1, 3, 1860,
+ 47, 0, 1882
};
-static int parser_action_row1904[] = {
+static int parser_action_row1862[] = {
2,
- -1, 3, 1903,
- 53, 0, 1925
+ -1, 3, 1861,
+ 53, 0, 1883
};
-static int parser_action_row1905[] = {
+static int parser_action_row1863[] = {
2,
- -1, 3, 1904,
- 53, 0, 1926
+ -1, 3, 1862,
+ 53, 0, 1884
};
-static int parser_action_row1906[] = {
+static int parser_action_row1864[] = {
1,
-1, 1, 49
};
-static int parser_action_row1907[] = {
+static int parser_action_row1865[] = {
1,
-1, 1, 68
};
-static int parser_action_row1908[] = {
+static int parser_action_row1866[] = {
1,
-1, 1, 60
};
-static int parser_action_row1909[] = {
+static int parser_action_row1867[] = {
1,
-1, 1, 64
};
-static int parser_action_row1910[] = {
+static int parser_action_row1868[] = {
1,
-1, 1, 56
};
-static int parser_action_row1911[] = {
+static int parser_action_row1869[] = {
1,
- -1, 1, 676
+ -1, 1, 662
};
-static int parser_action_row1912[] = {
+static int parser_action_row1870[] = {
1,
- -1, 1, 695
+ -1, 1, 681
};
-static int parser_action_row1913[] = {
+static int parser_action_row1871[] = {
1,
- -1, 1, 680
+ -1, 1, 666
};
-static int parser_action_row1914[] = {
+static int parser_action_row1872[] = {
1,
- -1, 1, 699
+ -1, 1, 685
};
-static int parser_action_row1915[] = {
+static int parser_action_row1873[] = {
1,
- -1, 1, 679
+ -1, 1, 665
};
-static int parser_action_row1916[] = {
+static int parser_action_row1874[] = {
1,
- -1, 1, 698
+ -1, 1, 684
};
-static int parser_action_row1917[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1875[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1918[] = {
- 30,
- -1, 1, 464,
- 12, 0, 182,
- 22, 0, 183,
- 31, 0, 184,
- 38, 0, 185,
- 40, 0, 186,
+static int parser_action_row1876[] = {
+ 23,
+ -1, 1, 457,
+ 12, 0, 168,
+ 22, 0, 169,
+ 31, 0, 170,
+ 38, 0, 171,
+ 40, 0, 172,
42, 0, 45,
43, 0, 46,
44, 0, 47,
45, 0, 48,
- 48, 0, 187,
+ 48, 0, 173,
52, 0, 51,
54, 0, 52,
- 74, 0, 188,
- 75, 0, 189,
- 83, 0, 190,
+ 74, 0, 174,
+ 75, 0, 175,
+ 83, 0, 176,
96, 0, 53,
- 97, 0, 191,
+ 97, 0, 177,
99, 0, 55,
100, 0, 56,
101, 0, 57,
102, 0, 58,
- 103, 0, 59,
- 104, 0, 60,
- 105, 0, 61,
- 106, 0, 62,
- 107, 0, 63,
- 108, 0, 64,
- 109, 0, 65,
- 112, 0, 66
+ 105, 0, 59
};
-static int parser_action_row1919[] = {
+static int parser_action_row1877[] = {
2,
-1, 1, 271,
- 24, 1, 963
-};
-static int parser_action_row1920[] = {
- 29,
- -1, 1, 464,
- 12, 0, 1126,
- 22, 0, 1127,
- 31, 0, 1128,
- 38, 0, 1129,
- 40, 0, 1130,
- 42, 0, 1131,
- 43, 0, 1132,
- 44, 0, 1133,
- 45, 0, 1134,
- 48, 0, 1135,
+ 24, 1, 935
+};
+static int parser_action_row1878[] = {
+ 22,
+ -1, 1, 457,
+ 12, 0, 1098,
+ 22, 0, 1099,
+ 31, 0, 1100,
+ 38, 0, 1101,
+ 40, 0, 1102,
+ 42, 0, 1103,
+ 43, 0, 1104,
+ 44, 0, 1105,
+ 45, 0, 1106,
+ 48, 0, 1107,
52, 0, 51,
- 74, 0, 1136,
- 75, 0, 1137,
- 83, 0, 1138,
- 96, 0, 53,
- 97, 0, 1139,
- 99, 0, 1140,
- 100, 0, 1141,
- 101, 0, 1142,
- 102, 0, 1143,
- 103, 0, 1144,
- 104, 0, 1145,
- 105, 0, 1146,
- 106, 0, 1147,
- 107, 0, 1148,
- 108, 0, 1149,
- 109, 0, 65,
- 112, 0, 1150
-};
-static int parser_action_row1921[] = {
- 3,
- -1, 1, 493,
+ 74, 0, 1108,
+ 75, 0, 1109,
+ 83, 0, 1110,
+ 96, 0, 53,
+ 97, 0, 1111,
+ 99, 0, 1112,
+ 100, 0, 1113,
+ 101, 0, 1114,
+ 102, 0, 58,
+ 105, 0, 1115
+};
+static int parser_action_row1879[] = {
+ 3,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1922[] = {
+static int parser_action_row1880[] = {
1,
- -1, 1, 611
+ -1, 1, 604
};
-static int parser_action_row1923[] = {
+static int parser_action_row1881[] = {
4,
- -1, 3, 1922,
- 0, 0, 94,
- 1, 0, 95,
- 95, 0, 96
+ -1, 3, 1880,
+ 0, 0, 87,
+ 1, 0, 88,
+ 95, 0, 89
};
-static int parser_action_row1924[] = {
+static int parser_action_row1882[] = {
1,
- -1, 1, 423
+ -1, 1, 416
};
-static int parser_action_row1925[] = {
+static int parser_action_row1883[] = {
3,
- -1, 1, 493,
+ -1, 1, 486,
0, 0, 1,
1, 0, 2
};
-static int parser_action_row1926[] = {
+static int parser_action_row1884[] = {
1,
-1, 1, 134
};
-static int parser_action_row1927[] = {
+static int parser_action_row1885[] = {
1,
-1, 1, 132
};
-static int parser_action_row1928[] = {
+static int parser_action_row1886[] = {
1,
- -1, 1, 678
+ -1, 1, 664
};
-static int parser_action_row1929[] = {
+static int parser_action_row1887[] = {
1,
- -1, 1, 697
+ -1, 1, 683
};
-static int parser_action_row1930[] = {
+static int parser_action_row1888[] = {
1,
- -1, 1, 533
+ -1, 1, 526
};
-static int parser_action_row1931[] = {
+static int parser_action_row1889[] = {
2,
- -1, 3, 1930,
- 53, 0, 1933
+ -1, 3, 1888,
+ 53, 0, 1891
};
-static int parser_action_row1932[] = {
+static int parser_action_row1890[] = {
1,
- -1, 1, 424
+ -1, 1, 417
};
-static int parser_action_row1933[] = {
+static int parser_action_row1891[] = {
2,
- -1, 3, 1932,
- 53, 0, 1934
+ -1, 3, 1890,
+ 53, 0, 1892
};
-static int parser_action_row1934[] = {
+static int parser_action_row1892[] = {
1,
- -1, 1, 612
+ -1, 1, 605
};
-static int parser_action_row1935[] = {
+static int parser_action_row1893[] = {
1,
-1, 1, 136
};
parser_action_row1890,
parser_action_row1891,
parser_action_row1892,
- parser_action_row1893,
- parser_action_row1894,
- parser_action_row1895,
- parser_action_row1896,
- parser_action_row1897,
- parser_action_row1898,
- parser_action_row1899,
- parser_action_row1900,
- parser_action_row1901,
- parser_action_row1902,
- parser_action_row1903,
- parser_action_row1904,
- parser_action_row1905,
- parser_action_row1906,
- parser_action_row1907,
- parser_action_row1908,
- parser_action_row1909,
- parser_action_row1910,
- parser_action_row1911,
- parser_action_row1912,
- parser_action_row1913,
- parser_action_row1914,
- parser_action_row1915,
- parser_action_row1916,
- parser_action_row1917,
- parser_action_row1918,
- parser_action_row1919,
- parser_action_row1920,
- parser_action_row1921,
- parser_action_row1922,
- parser_action_row1923,
- parser_action_row1924,
- parser_action_row1925,
- parser_action_row1926,
- parser_action_row1927,
- parser_action_row1928,
- parser_action_row1929,
- parser_action_row1930,
- parser_action_row1931,
- parser_action_row1932,
- parser_action_row1933,
- parser_action_row1934,
- parser_action_row1935
+ parser_action_row1893
};
static int parser_goto_row1[] = {
static int parser_goto_row3[] = {
3,
-1, 6,
- 18, 98,
- 28, 98
+ 18, 91,
+ 28, 91
};
static int parser_goto_row4[] = {
9,
-1, 7,
- 20, 106,
- 30, 106,
- 101, 106,
- 105, 106,
- 118, 106,
- 120, 106,
- 283, 106,
- 292, 106
+ 20, 99,
+ 30, 99,
+ 94, 99,
+ 98, 99,
+ 111, 99,
+ 113, 99,
+ 262, 99,
+ 271, 99
};
static int parser_goto_row5[] = {
16,
-1, 8,
5, 26,
- 18, 99,
- 19, 102,
- 20, 107,
- 28, 116,
- 29, 119,
- 30, 121,
- 100, 282,
- 101, 284,
- 105, 286,
- 117, 291,
- 118, 293,
- 120, 294,
- 283, 524,
- 292, 527
+ 18, 92,
+ 19, 95,
+ 20, 100,
+ 28, 109,
+ 29, 112,
+ 30, 114,
+ 93, 261,
+ 94, 263,
+ 98, 265,
+ 110, 270,
+ 111, 272,
+ 113, 273,
+ 262, 496,
+ 271, 499
};
static int parser_goto_row6[] = {
1,
};
static int parser_goto_row8[] = {
9,
- -1, 813,
- 13, 67,
- 27, 115,
- 104, 285,
- 216, 415,
- 618, 810,
- 1017, 1195,
- 1199, 1195,
- 1339, 1486
+ -1, 785,
+ 13, 60,
+ 27, 108,
+ 97, 264,
+ 202, 387,
+ 590, 782,
+ 989, 1160,
+ 1164, 1160,
+ 1297, 1444
};
static int parser_goto_row9[] = {
1,
- -1, 493
+ -1, 465
};
static int parser_goto_row10[] = {
1,
- -1, 1361
+ -1, 1319
};
static int parser_goto_row11[] = {
2,
- -1, 1506,
- 1507, 1617
+ -1, 1464,
+ 1465, 1575
};
static int parser_goto_row12[] = {
2,
- -1, 1362,
- 1616, 1687
+ -1, 1320,
+ 1574, 1645
};
static int parser_goto_row13[] = {
2,
- -1, 1010,
- 1018, 1197
+ -1, 982,
+ 990, 1162
};
static int parser_goto_row14[] = {
4,
- -1, 1011,
- 1014, 1192,
- 1504, 1614,
- 1615, 1686
+ -1, 983,
+ 986, 1157,
+ 1462, 1572,
+ 1573, 1644
};
static int parser_goto_row15[] = {
2,
- -1, 1012,
- 1018, 1198
+ -1, 984,
+ 990, 1163
};
static int parser_goto_row16[] = {
1,
- -1, 1013
+ -1, 985
};
static int parser_goto_row17[] = {
6,
- -1, 994,
- 849, 997,
- 1689, 1761,
- 1694, 1771,
- 1700, 1781,
- 1874, 1907
+ -1, 966,
+ 821, 969,
+ 1647, 1719,
+ 1652, 1729,
+ 1658, 1739,
+ 1832, 1865
};
static int parser_goto_row18[] = {
7,
- -1, 1004,
- 1620, 1692,
- 1623, 1696,
- 1688, 1758,
- 1693, 1767,
- 1694, 1772,
- 1699, 1778
+ -1, 976,
+ 1578, 1650,
+ 1581, 1654,
+ 1646, 1716,
+ 1651, 1725,
+ 1652, 1730,
+ 1657, 1736
};
static int parser_goto_row19[] = {
8,
- -1, 258,
- 115, 290,
- 285, 525,
- 415, 623,
- 810, 960,
- 813, 964,
- 1195, 1364,
- 1486, 1604
+ -1, 237,
+ 108, 269,
+ 264, 497,
+ 387, 595,
+ 782, 932,
+ 785, 936,
+ 1160, 1322,
+ 1444, 1562
};
static int parser_goto_row20[] = {
4,
- -1, 685,
- 687, 858,
- 688, 859,
- 860, 1008
+ -1, 657,
+ 659, 830,
+ 660, 831,
+ 832, 980
};
static int parser_goto_row21[] = {
6,
- -1, 854,
- 1510, 1620,
- 1512, 1623,
- 1618, 1688,
- 1621, 1693,
- 1624, 1699
+ -1, 826,
+ 1468, 1578,
+ 1470, 1581,
+ 1576, 1646,
+ 1579, 1651,
+ 1582, 1657
};
static int parser_goto_row22[] = {
1,
- -1, 1179
+ -1, 1144
};
static int parser_goto_row23[] = {
2,
- -1, 1346,
- 1348, 1494
+ -1, 1304,
+ 1306, 1452
};
static int parser_goto_row24[] = {
2,
- -1, 1180,
- 1493, 1607
+ -1, 1145,
+ 1451, 1565
};
static int parser_goto_row25[] = {
8,
- -1, 1005,
- 1004, 1187,
- 1623, 1697,
- 1688, 1759,
- 1696, 1775,
- 1699, 1779,
- 1758, 1819,
- 1778, 1836
+ -1, 977,
+ 976, 1152,
+ 1581, 1655,
+ 1646, 1717,
+ 1654, 1733,
+ 1657, 1737,
+ 1716, 1777,
+ 1736, 1794
};
static int parser_goto_row26[] = {
2,
- -1, 1497,
- 1498, 1609
+ -1, 1455,
+ 1456, 1567
};
static int parser_goto_row27[] = {
2,
- -1, 1350,
- 1608, 1682
+ -1, 1308,
+ 1566, 1640
};
static int parser_goto_row28[] = {
1,
- -1, 1351
+ -1, 1309
};
static int parser_goto_row29[] = {
1,
- -1, 1352
+ -1, 1310
};
static int parser_goto_row30[] = {
1,
};
static int parser_goto_row31[] = {
1,
- -1, 92
+ -1, 85
};
static int parser_goto_row32[] = {
11,
- -1, 93,
- 863, 1014,
- 1005, 1188,
- 1187, 1359,
- 1504, 1615,
- 1697, 1776,
- 1759, 1820,
- 1775, 1833,
- 1779, 1837,
- 1819, 1868,
- 1836, 1879
+ -1, 86,
+ 835, 986,
+ 977, 1153,
+ 1152, 1317,
+ 1462, 1573,
+ 1655, 1734,
+ 1717, 1778,
+ 1733, 1791,
+ 1737, 1795,
+ 1777, 1826,
+ 1794, 1837
};
static int parser_goto_row33[] = {
1,
static int parser_goto_row34[] = {
5,
-1, 11,
- 19, 103,
- 29, 103,
- 100, 103,
- 117, 103
+ 19, 96,
+ 29, 96,
+ 93, 96,
+ 110, 96
};
static int parser_goto_row35[] = {
24,
- -1, 450,
- 223, 422,
- 547, 735,
- 571, 763,
- 589, 778,
- 634, 827,
- 808, 957,
- 825, 957,
- 956, 957,
- 975, 957,
- 1000, 1181,
- 1076, 1240,
- 1182, 1353,
- 1196, 1375,
- 1203, 1396,
- 1228, 1412,
- 1258, 1432,
- 1517, 1626,
- 1608, 1353,
- 1625, 1700,
- 1681, 1375,
- 1683, 1755,
- 1810, 1860,
- 1816, 1865
+ -1, 422,
+ 209, 394,
+ 519, 707,
+ 543, 735,
+ 561, 750,
+ 606, 799,
+ 780, 929,
+ 797, 929,
+ 928, 929,
+ 947, 929,
+ 972, 1146,
+ 1048, 1205,
+ 1147, 1311,
+ 1161, 1333,
+ 1168, 1354,
+ 1193, 1370,
+ 1223, 1390,
+ 1475, 1584,
+ 1566, 1311,
+ 1583, 1658,
+ 1639, 1333,
+ 1641, 1713,
+ 1768, 1818,
+ 1774, 1823
};
static int parser_goto_row36[] = {
4,
- -1, 958,
- 825, 976,
- 956, 1098,
- 975, 1117
+ -1, 930,
+ 797, 948,
+ 928, 1070,
+ 947, 1089
};
static int parser_goto_row37[] = {
2,
- -1, 1100,
- 1101, 1259
+ -1, 1072,
+ 1073, 1224
};
static int parser_goto_row38[] = {
5,
- -1, 855,
- 1178, 1341,
- 1342, 1490,
- 1344, 1491,
- 1619, 1689
+ -1, 827,
+ 1143, 1299,
+ 1300, 1448,
+ 1302, 1449,
+ 1577, 1647
};
static int parser_goto_row39[] = {
8,
- -1, 358,
- 359, 573,
- 417, 624,
- 473, 655,
- 625, 821,
- 1360, 1502,
- 1503, 1613,
- 1622, 1694
+ -1, 330,
+ 331, 545,
+ 389, 596,
+ 445, 627,
+ 597, 793,
+ 1318, 1460,
+ 1461, 1571,
+ 1580, 1652
};
static int parser_goto_row40[] = {
32,
- -1, 170,
- 37, 179,
- 410, 614,
- 612, 803,
- 767, 943,
- 822, 973,
- 914, 1065,
- 916, 179,
- 1003, 1185,
- 1082, 1245,
- 1086, 1249,
- 1186, 1358,
- 1238, 614,
- 1246, 1426,
- 1416, 803,
- 1429, 1552,
- 1538, 943,
- 1543, 973,
- 1691, 1764,
- 1695, 1773,
- 1728, 1249,
- 1757, 1817,
- 1765, 1823,
- 1766, 1824,
- 1769, 1828,
- 1774, 1832,
- 1777, 1834,
- 1818, 1867,
- 1825, 1871,
- 1830, 1875,
- 1835, 1878,
- 1853, 1552
+ -1, 156,
+ 37, 165,
+ 382, 586,
+ 584, 775,
+ 739, 915,
+ 794, 945,
+ 886, 1037,
+ 888, 165,
+ 975, 1150,
+ 1054, 1210,
+ 1058, 1214,
+ 1151, 1316,
+ 1203, 586,
+ 1211, 1384,
+ 1374, 775,
+ 1387, 1510,
+ 1496, 915,
+ 1501, 945,
+ 1649, 1722,
+ 1653, 1731,
+ 1686, 1214,
+ 1715, 1775,
+ 1723, 1781,
+ 1724, 1782,
+ 1727, 1786,
+ 1732, 1790,
+ 1735, 1792,
+ 1776, 1825,
+ 1783, 1829,
+ 1788, 1833,
+ 1793, 1836,
+ 1811, 1510
};
static int parser_goto_row41[] = {
1,
- -1, 68
+ -1, 61
};
static int parser_goto_row42[] = {
2,
- -1, 69,
- 933, 1083
+ -1, 62,
+ 905, 1055
};
static int parser_goto_row43[] = {
4,
- -1, 354,
- 615, 805,
- 1060, 1231,
- 1418, 1542
+ -1, 326,
+ 587, 777,
+ 1032, 1196,
+ 1376, 1500
};
static int parser_goto_row44[] = {
4,
- -1, 259,
- 261, 495,
- 570, 495,
- 1248, 495
+ -1, 238,
+ 240, 467,
+ 542, 467,
+ 1213, 467
};
static int parser_goto_row45[] = {
15,
- -1, 171,
- 13, 70,
- 27, 70,
- 104, 70,
- 172, 355,
- 260, 494,
- 496, 494,
- 569, 494,
- 615, 355,
- 762, 494,
- 766, 926,
- 933, 1084,
- 1060, 355,
- 1418, 355,
- 1537, 926
+ -1, 157,
+ 13, 63,
+ 27, 63,
+ 97, 63,
+ 158, 327,
+ 239, 466,
+ 468, 466,
+ 541, 466,
+ 587, 327,
+ 734, 466,
+ 738, 898,
+ 905, 1056,
+ 1032, 327,
+ 1376, 327,
+ 1495, 898
};
static int parser_goto_row46[] = {
18,
- -1, 210,
- 41, 211,
- 173, 356,
- 180, 363,
- 424, 632,
- 425, 633,
- 919, 1071,
- 920, 1072,
- 944, 1090,
- 974, 1116,
- 1063, 1232,
- 1068, 1235,
- 1366, 1515,
- 1367, 1516,
- 1553, 1661,
- 1651, 1729,
- 1654, 1731,
- 1896, 1918
+ -1, 196,
+ 41, 197,
+ 159, 328,
+ 166, 335,
+ 396, 604,
+ 397, 605,
+ 891, 1043,
+ 892, 1044,
+ 916, 1062,
+ 946, 1088,
+ 1035, 1197,
+ 1040, 1200,
+ 1324, 1473,
+ 1325, 1474,
+ 1511, 1619,
+ 1609, 1687,
+ 1612, 1689,
+ 1854, 1876
};
static int parser_goto_row47[] = {
20,
- -1, 71,
- 224, 451,
- 766, 927,
- 831, 451,
- 912, 927,
- 916, 927,
- 1113, 451,
- 1196, 1376,
- 1238, 927,
- 1416, 927,
- 1436, 451,
- 1518, 451,
- 1537, 927,
- 1538, 927,
- 1543, 927,
- 1558, 451,
- 1681, 1376,
- 1728, 927,
- 1812, 451,
- 1853, 927
+ -1, 64,
+ 210, 423,
+ 738, 899,
+ 803, 423,
+ 884, 899,
+ 888, 899,
+ 1085, 423,
+ 1161, 1334,
+ 1203, 899,
+ 1374, 899,
+ 1394, 423,
+ 1476, 423,
+ 1495, 899,
+ 1496, 899,
+ 1501, 899,
+ 1516, 423,
+ 1639, 1334,
+ 1686, 899,
+ 1770, 423,
+ 1811, 899
};
static int parser_goto_row48[] = {
18,
- -1, 72,
- 224, 452,
- 766, 928,
- 831, 452,
- 912, 928,
- 916, 928,
- 1113, 452,
- 1238, 928,
- 1416, 928,
- 1436, 452,
- 1518, 452,
- 1537, 928,
- 1538, 928,
- 1543, 928,
- 1558, 452,
- 1728, 928,
- 1812, 452,
- 1853, 928
+ -1, 65,
+ 210, 424,
+ 738, 900,
+ 803, 424,
+ 884, 900,
+ 888, 900,
+ 1085, 424,
+ 1203, 900,
+ 1374, 900,
+ 1394, 424,
+ 1476, 424,
+ 1495, 900,
+ 1496, 900,
+ 1501, 900,
+ 1516, 424,
+ 1686, 900,
+ 1770, 424,
+ 1811, 900
};
static int parser_goto_row49[] = {
52,
- -1, 240,
- 241, 480,
- 264, 500,
- 273, 509,
- 275, 513,
- 277, 518,
- 514, 709,
- 519, 713,
- 522, 716,
- 647, 513,
- 649, 518,
- 694, 871,
- 717, 890,
- 836, 716,
- 872, 1027,
- 874, 1029,
- 876, 1032,
- 878, 1037,
- 978, 871,
- 1033, 1211,
- 1038, 1215,
- 1041, 1218,
- 1081, 513,
- 1088, 518,
- 1121, 1032,
- 1122, 1037,
- 1219, 1404,
- 1253, 716,
- 1278, 1218,
- 1374, 1520,
- 1423, 871,
- 1521, 1631,
- 1522, 1633,
- 1523, 1635,
- 1525, 1639,
- 1527, 1641,
- 1548, 1032,
- 1550, 1037,
- 1636, 1710,
- 1642, 1721,
- 1643, 1723,
- 1660, 1218,
- 1711, 1787,
- 1724, 1798,
- 1788, 1841,
- 1789, 1843,
- 1790, 1845,
- 1791, 1848,
- 1846, 1887,
- 1849, 1891,
- 1850, 1893,
- 1894, 1917
+ -1, 226,
+ 227, 452,
+ 243, 472,
+ 252, 481,
+ 254, 485,
+ 256, 490,
+ 486, 681,
+ 491, 685,
+ 494, 688,
+ 619, 485,
+ 621, 490,
+ 666, 843,
+ 689, 862,
+ 808, 688,
+ 844, 999,
+ 846, 1001,
+ 848, 1004,
+ 850, 1009,
+ 950, 843,
+ 1005, 1176,
+ 1010, 1180,
+ 1013, 1183,
+ 1053, 485,
+ 1060, 490,
+ 1093, 1004,
+ 1094, 1009,
+ 1184, 1362,
+ 1218, 688,
+ 1243, 1183,
+ 1332, 1478,
+ 1381, 843,
+ 1479, 1589,
+ 1480, 1591,
+ 1481, 1593,
+ 1483, 1597,
+ 1485, 1599,
+ 1506, 1004,
+ 1508, 1009,
+ 1594, 1668,
+ 1600, 1679,
+ 1601, 1681,
+ 1618, 1183,
+ 1669, 1745,
+ 1682, 1756,
+ 1746, 1799,
+ 1747, 1801,
+ 1748, 1803,
+ 1749, 1806,
+ 1804, 1845,
+ 1807, 1849,
+ 1808, 1851,
+ 1852, 1875
};
static int parser_goto_row50[] = {
10,
- -1, 73,
- 224, 453,
- 831, 453,
- 1113, 453,
- 1196, 1377,
- 1436, 453,
- 1518, 453,
- 1558, 453,
- 1681, 1377,
- 1812, 453
+ -1, 66,
+ 210, 425,
+ 803, 425,
+ 1085, 425,
+ 1161, 1335,
+ 1394, 425,
+ 1476, 425,
+ 1516, 425,
+ 1639, 1335,
+ 1770, 425
};
static int parser_goto_row51[] = {
1,
- -1, 74
+ -1, 67
};
static int parser_goto_row52[] = {
3,
- -1, 929,
- 933, 1085,
- 1083, 1247
+ -1, 901,
+ 905, 1057,
+ 1055, 1212
};
static int parser_goto_row53[] = {
10,
- -1, 75,
- 224, 454,
- 831, 454,
- 1113, 454,
- 1196, 1378,
- 1436, 454,
- 1518, 454,
- 1558, 454,
- 1681, 1378,
- 1812, 454
+ -1, 68,
+ 210, 426,
+ 803, 426,
+ 1085, 426,
+ 1161, 1336,
+ 1394, 426,
+ 1476, 426,
+ 1516, 426,
+ 1639, 1336,
+ 1770, 426
};
static int parser_goto_row54[] = {
10,
- -1, 76,
- 224, 455,
- 831, 455,
- 1113, 455,
- 1196, 1379,
- 1436, 455,
- 1518, 455,
- 1558, 455,
- 1681, 1379,
- 1812, 455
+ -1, 69,
+ 210, 427,
+ 803, 427,
+ 1085, 427,
+ 1161, 1337,
+ 1394, 427,
+ 1476, 427,
+ 1516, 427,
+ 1639, 1337,
+ 1770, 427
};
static int parser_goto_row55[] = {
10,
- -1, 77,
- 224, 456,
- 831, 456,
- 1113, 456,
- 1196, 1380,
- 1436, 456,
- 1518, 456,
- 1558, 456,
- 1681, 1380,
- 1812, 456
+ -1, 70,
+ 210, 428,
+ 803, 428,
+ 1085, 428,
+ 1161, 1338,
+ 1394, 428,
+ 1476, 428,
+ 1516, 428,
+ 1639, 1338,
+ 1770, 428
};
static int parser_goto_row56[] = {
10,
- -1, 78,
- 224, 457,
- 831, 457,
- 1113, 457,
- 1196, 1381,
- 1436, 457,
- 1518, 457,
- 1558, 457,
- 1681, 1381,
- 1812, 457
+ -1, 71,
+ 210, 429,
+ 803, 429,
+ 1085, 429,
+ 1161, 1339,
+ 1394, 429,
+ 1476, 429,
+ 1516, 429,
+ 1639, 1339,
+ 1770, 429
};
static int parser_goto_row57[] = {
2,
- -1, 418,
- 1075, 1239
+ -1, 390,
+ 1047, 1204
};
static int parser_goto_row58[] = {
10,
- -1, 79,
- 224, 458,
- 831, 458,
- 1113, 458,
- 1196, 1382,
- 1436, 458,
- 1518, 458,
- 1558, 458,
- 1681, 1382,
- 1812, 458
+ -1, 72,
+ 210, 430,
+ 803, 430,
+ 1085, 430,
+ 1161, 1340,
+ 1394, 430,
+ 1476, 430,
+ 1516, 430,
+ 1639, 1340,
+ 1770, 430
};
static int parser_goto_row59[] = {
2,
- -1, 213,
- 922, 1073
+ -1, 199,
+ 894, 1045
};
static int parser_goto_row60[] = {
131,
- -1, 459,
- 39, 192,
- 43, 214,
- 175, 360,
- 178, 362,
- 213, 409,
- 222, 419,
- 225, 472,
- 228, 477,
- 240, 478,
- 271, 505,
- 297, 529,
- 308, 538,
- 368, 579,
- 423, 631,
- 479, 659,
- 480, 660,
- 497, 538,
- 499, 698,
- 500, 699,
- 501, 700,
- 508, 703,
- 509, 704,
- 512, 706,
- 513, 707,
- 517, 710,
- 518, 711,
- 528, 538,
- 630, 826,
- 636, 477,
- 652, 838,
- 705, 538,
- 708, 883,
- 709, 884,
- 712, 885,
- 713, 886,
- 715, 887,
- 716, 888,
- 727, 895,
- 764, 908,
- 834, 706,
- 835, 710,
- 842, 990,
- 870, 1024,
- 871, 1025,
- 889, 1043,
- 890, 1044,
- 909, 1057,
- 918, 1070,
- 922, 1074,
- 946, 1092,
- 971, 1114,
- 977, 1119,
- 985, 887,
- 1026, 1204,
- 1027, 1205,
- 1028, 1206,
- 1029, 1207,
- 1031, 1208,
- 1032, 1209,
- 1036, 1212,
- 1037, 1213,
- 1045, 1221,
- 1050, 538,
- 1064, 1233,
- 1066, 1234,
- 1073, 1237,
- 1075, 419,
- 1093, 1255,
- 1115, 1273,
- 1120, 1024,
- 1210, 1397,
- 1211, 1398,
- 1214, 1399,
- 1215, 1400,
- 1217, 1401,
- 1218, 1402,
- 1276, 1208,
- 1277, 1212,
- 1279, 1444,
- 1280, 1446,
- 1282, 1447,
- 1365, 1514,
- 1403, 1531,
- 1404, 1532,
- 1421, 1544,
- 1443, 1401,
- 1519, 1628,
- 1520, 1629,
- 1630, 1703,
- 1631, 1704,
- 1632, 1705,
- 1633, 1706,
- 1634, 1707,
- 1635, 1708,
- 1638, 1716,
- 1639, 1717,
- 1640, 1718,
- 1641, 1719,
- 1652, 1730,
- 1662, 1734,
- 1666, 990,
- 1701, 1782,
- 1709, 1784,
- 1710, 1785,
- 1720, 1793,
- 1721, 1794,
- 1722, 1795,
- 1723, 1796,
- 1737, 1804,
- 1786, 1838,
- 1787, 1839,
- 1797, 1851,
- 1798, 1852,
- 1829, 1874,
- 1840, 1880,
- 1841, 1881,
- 1842, 1882,
- 1843, 1883,
- 1844, 1884,
- 1845, 1885,
- 1847, 1888,
- 1848, 1889,
- 1886, 1910,
- 1887, 1911,
- 1890, 1912,
- 1891, 1913,
- 1892, 1914,
- 1893, 1915,
- 1916, 1927,
- 1917, 1928
+ -1, 431,
+ 39, 178,
+ 43, 200,
+ 161, 332,
+ 164, 334,
+ 199, 381,
+ 208, 391,
+ 211, 444,
+ 214, 449,
+ 226, 450,
+ 250, 477,
+ 276, 501,
+ 287, 510,
+ 340, 551,
+ 395, 603,
+ 451, 631,
+ 452, 632,
+ 469, 510,
+ 471, 670,
+ 472, 671,
+ 473, 672,
+ 480, 675,
+ 481, 676,
+ 484, 678,
+ 485, 679,
+ 489, 682,
+ 490, 683,
+ 500, 510,
+ 602, 798,
+ 608, 449,
+ 624, 810,
+ 677, 510,
+ 680, 855,
+ 681, 856,
+ 684, 857,
+ 685, 858,
+ 687, 859,
+ 688, 860,
+ 699, 867,
+ 736, 880,
+ 806, 678,
+ 807, 682,
+ 814, 962,
+ 842, 996,
+ 843, 997,
+ 861, 1015,
+ 862, 1016,
+ 881, 1029,
+ 890, 1042,
+ 894, 1046,
+ 918, 1064,
+ 943, 1086,
+ 949, 1091,
+ 957, 859,
+ 998, 1169,
+ 999, 1170,
+ 1000, 1171,
+ 1001, 1172,
+ 1003, 1173,
+ 1004, 1174,
+ 1008, 1177,
+ 1009, 1178,
+ 1017, 1186,
+ 1022, 510,
+ 1036, 1198,
+ 1038, 1199,
+ 1045, 1202,
+ 1047, 391,
+ 1065, 1220,
+ 1087, 1238,
+ 1092, 996,
+ 1175, 1355,
+ 1176, 1356,
+ 1179, 1357,
+ 1180, 1358,
+ 1182, 1359,
+ 1183, 1360,
+ 1241, 1173,
+ 1242, 1177,
+ 1244, 1402,
+ 1245, 1404,
+ 1247, 1405,
+ 1323, 1472,
+ 1361, 1489,
+ 1362, 1490,
+ 1379, 1502,
+ 1401, 1359,
+ 1477, 1586,
+ 1478, 1587,
+ 1588, 1661,
+ 1589, 1662,
+ 1590, 1663,
+ 1591, 1664,
+ 1592, 1665,
+ 1593, 1666,
+ 1596, 1674,
+ 1597, 1675,
+ 1598, 1676,
+ 1599, 1677,
+ 1610, 1688,
+ 1620, 1692,
+ 1624, 962,
+ 1659, 1740,
+ 1667, 1742,
+ 1668, 1743,
+ 1678, 1751,
+ 1679, 1752,
+ 1680, 1753,
+ 1681, 1754,
+ 1695, 1762,
+ 1744, 1796,
+ 1745, 1797,
+ 1755, 1809,
+ 1756, 1810,
+ 1787, 1832,
+ 1798, 1838,
+ 1799, 1839,
+ 1800, 1840,
+ 1801, 1841,
+ 1802, 1842,
+ 1803, 1843,
+ 1805, 1846,
+ 1806, 1847,
+ 1844, 1868,
+ 1845, 1869,
+ 1848, 1870,
+ 1849, 1871,
+ 1850, 1872,
+ 1851, 1873,
+ 1874, 1885,
+ 1875, 1886
};
static int parser_goto_row61[] = {
1,
- -1, 193
+ -1, 179
};
static int parser_goto_row62[] = {
6,
- -1, 194,
- 369, 580,
- 585, 774,
- 587, 776,
- 588, 777,
- 775, 950
+ -1, 180,
+ 341, 552,
+ 557, 746,
+ 559, 748,
+ 560, 749,
+ 747, 922
};
static int parser_goto_row63[] = {
1,
- -1, 195
+ -1, 181
};
static int parser_goto_row64[] = {
8,
- -1, 196,
- 591, 780,
- 592, 781,
- 593, 782,
- 594, 783,
- 595, 784,
- 596, 785,
- 597, 786
+ -1, 182,
+ 563, 752,
+ 564, 753,
+ 565, 754,
+ 566, 755,
+ 567, 756,
+ 568, 757,
+ 569, 758
};
static int parser_goto_row65[] = {
2,
- -1, 197,
- 590, 779
+ -1, 183,
+ 562, 751
};
static int parser_goto_row66[] = {
2,
- -1, 198,
- 598, 787
+ -1, 184,
+ 570, 759
};
static int parser_goto_row67[] = {
2,
- -1, 199,
- 599, 788
+ -1, 185,
+ 571, 760
};
static int parser_goto_row68[] = {
3,
- -1, 200,
- 600, 789,
- 601, 790
+ -1, 186,
+ 572, 761,
+ 573, 762
};
static int parser_goto_row69[] = {
3,
- -1, 201,
- 602, 791,
- 603, 792
+ -1, 187,
+ 574, 763,
+ 575, 764
};
static int parser_goto_row70[] = {
5,
- -1, 202,
- 604, 793,
- 605, 794,
- 606, 795,
- 607, 796
+ -1, 188,
+ 576, 765,
+ 577, 766,
+ 578, 767,
+ 579, 768
};
static int parser_goto_row71[] = {
15,
- -1, 203,
- 133, 309,
- 134, 310,
- 135, 311,
- 188, 374,
- 189, 375,
- 190, 376,
- 300, 532,
- 371, 582,
- 429, 374,
- 430, 375,
- 438, 376,
- 1371, 309,
- 1372, 310,
- 1373, 311
+ -1, 189,
+ 126, 288,
+ 127, 289,
+ 128, 290,
+ 174, 346,
+ 175, 347,
+ 176, 348,
+ 279, 504,
+ 343, 554,
+ 401, 346,
+ 402, 347,
+ 410, 348,
+ 1329, 288,
+ 1330, 289,
+ 1331, 290
};
static int parser_goto_row72[] = {
1,
- -1, 204
+ -1, 190
};
static int parser_goto_row73[] = {
56,
- -1, 205,
- 13, 80,
- 27, 80,
- 33, 80,
- 37, 80,
- 104, 80,
- 172, 80,
- 187, 372,
- 224, 460,
- 260, 80,
- 410, 80,
- 496, 80,
- 569, 80,
- 612, 80,
- 615, 80,
- 762, 80,
- 766, 930,
- 767, 80,
- 822, 80,
- 831, 460,
- 912, 930,
- 914, 80,
- 916, 930,
- 933, 80,
- 1003, 80,
- 1060, 80,
- 1082, 80,
- 1086, 80,
- 1113, 460,
- 1186, 80,
- 1238, 930,
- 1246, 80,
- 1416, 930,
- 1418, 80,
- 1429, 80,
- 1436, 460,
- 1518, 460,
- 1537, 930,
- 1538, 930,
- 1543, 930,
- 1558, 460,
- 1691, 80,
- 1695, 80,
- 1728, 930,
- 1757, 80,
- 1765, 80,
- 1766, 80,
- 1769, 80,
- 1774, 80,
- 1777, 80,
- 1812, 460,
- 1818, 80,
- 1825, 80,
- 1830, 80,
- 1835, 80,
- 1853, 930
+ -1, 191,
+ 13, 73,
+ 27, 73,
+ 33, 73,
+ 37, 73,
+ 97, 73,
+ 158, 73,
+ 173, 344,
+ 210, 432,
+ 239, 73,
+ 382, 73,
+ 468, 73,
+ 541, 73,
+ 584, 73,
+ 587, 73,
+ 734, 73,
+ 738, 902,
+ 739, 73,
+ 794, 73,
+ 803, 432,
+ 884, 902,
+ 886, 73,
+ 888, 902,
+ 905, 73,
+ 975, 73,
+ 1032, 73,
+ 1054, 73,
+ 1058, 73,
+ 1085, 432,
+ 1151, 73,
+ 1203, 902,
+ 1211, 73,
+ 1374, 902,
+ 1376, 73,
+ 1387, 73,
+ 1394, 432,
+ 1476, 432,
+ 1495, 902,
+ 1496, 902,
+ 1501, 902,
+ 1516, 432,
+ 1649, 73,
+ 1653, 73,
+ 1686, 902,
+ 1715, 73,
+ 1723, 73,
+ 1724, 73,
+ 1727, 73,
+ 1732, 73,
+ 1735, 73,
+ 1770, 432,
+ 1776, 73,
+ 1783, 73,
+ 1788, 73,
+ 1793, 73,
+ 1811, 902
};
static int parser_goto_row74[] = {
2,
- -1, 539,
- 1050, 1226
+ -1, 511,
+ 1022, 1191
};
static int parser_goto_row75[] = {
1,
- -1, 81
+ -1, 74
};
static int parser_goto_row76[] = {
31,
- -1, 82,
- 988, 1151,
- 1135, 1151,
- 1136, 1151,
- 1137, 1151,
- 1138, 1151,
- 1283, 1151,
- 1285, 1151,
- 1460, 1151,
- 1462, 1151,
- 1463, 1151,
- 1465, 1151,
- 1466, 1151,
- 1467, 1151,
- 1468, 1151,
- 1469, 1151,
- 1470, 1151,
- 1471, 1151,
- 1472, 1151,
- 1473, 1151,
- 1474, 1151,
- 1475, 1151,
- 1476, 1151,
- 1477, 1151,
- 1478, 1151,
- 1479, 1151,
- 1480, 1151,
- 1481, 1151,
- 1482, 1151,
- 1573, 1151,
- 1919, 1151
+ -1, 75,
+ 960, 1116,
+ 1107, 1116,
+ 1108, 1116,
+ 1109, 1116,
+ 1110, 1116,
+ 1248, 1116,
+ 1250, 1116,
+ 1418, 1116,
+ 1420, 1116,
+ 1421, 1116,
+ 1423, 1116,
+ 1424, 1116,
+ 1425, 1116,
+ 1426, 1116,
+ 1427, 1116,
+ 1428, 1116,
+ 1429, 1116,
+ 1430, 1116,
+ 1431, 1116,
+ 1432, 1116,
+ 1433, 1116,
+ 1434, 1116,
+ 1435, 1116,
+ 1436, 1116,
+ 1437, 1116,
+ 1438, 1116,
+ 1439, 1116,
+ 1440, 1116,
+ 1531, 1116,
+ 1877, 1116
};
static int parser_goto_row77[] = {
1,
- -1, 461
+ -1, 433
};
static int parser_goto_row78[] = {
2,
- -1, 640,
- 642, 833
+ -1, 612,
+ 614, 805
};
static int parser_goto_row79[] = {
1,
- -1, 473
+ -1, 445
};
static int parser_goto_row80[] = {
2,
- -1, 657,
- 658, 843
+ -1, 629,
+ 630, 815
};
static int parser_goto_row81[] = {
4,
- -1, 474,
- 842, 991,
- 1279, 1445,
- 1666, 1736
+ -1, 446,
+ 814, 963,
+ 1244, 1403,
+ 1624, 1694
};
static int parser_goto_row82[] = {
93,
- -1, 83,
- 31, 148,
- 54, 148,
- 131, 148,
- 272, 148,
- 274, 148,
- 275, 148,
- 276, 148,
- 277, 148,
- 298, 148,
- 521, 148,
- 522, 148,
- 543, 148,
- 545, 148,
- 546, 148,
- 548, 148,
- 549, 148,
- 550, 148,
- 551, 148,
- 552, 148,
- 553, 148,
- 554, 148,
- 555, 148,
- 556, 148,
- 557, 148,
- 558, 148,
- 559, 148,
- 560, 148,
- 561, 148,
- 562, 148,
- 563, 148,
- 564, 148,
- 565, 148,
- 692, 148,
- 694, 148,
- 732, 148,
- 875, 148,
- 876, 148,
- 877, 148,
- 878, 148,
- 911, 148,
- 925, 148,
- 988, 1152,
- 1040, 148,
- 1041, 148,
- 1079, 148,
- 1080, 148,
- 1081, 148,
- 1087, 148,
- 1088, 148,
- 1109, 148,
- 1135, 1152,
- 1136, 1152,
- 1137, 1152,
- 1138, 1152,
- 1196, 148,
- 1252, 148,
- 1253, 148,
- 1283, 1152,
- 1285, 1152,
- 1422, 148,
- 1423, 148,
- 1460, 1152,
- 1462, 1152,
- 1463, 1152,
- 1465, 1152,
- 1466, 1152,
- 1467, 1152,
- 1468, 1152,
- 1469, 1152,
- 1470, 1152,
- 1471, 1152,
- 1472, 1152,
- 1473, 1152,
- 1474, 1152,
- 1475, 1152,
- 1476, 1152,
- 1477, 1152,
- 1478, 1152,
- 1479, 1152,
- 1480, 1152,
- 1481, 1152,
- 1482, 1152,
- 1547, 148,
- 1548, 148,
- 1549, 148,
- 1550, 148,
- 1573, 1152,
- 1646, 148,
- 1659, 148,
- 1660, 148,
- 1681, 148,
- 1919, 1152
+ -1, 76,
+ 31, 134,
+ 54, 134,
+ 124, 134,
+ 251, 134,
+ 253, 134,
+ 254, 134,
+ 255, 134,
+ 256, 134,
+ 277, 134,
+ 493, 134,
+ 494, 134,
+ 515, 134,
+ 517, 134,
+ 518, 134,
+ 520, 134,
+ 521, 134,
+ 522, 134,
+ 523, 134,
+ 524, 134,
+ 525, 134,
+ 526, 134,
+ 527, 134,
+ 528, 134,
+ 529, 134,
+ 530, 134,
+ 531, 134,
+ 532, 134,
+ 533, 134,
+ 534, 134,
+ 535, 134,
+ 536, 134,
+ 537, 134,
+ 664, 134,
+ 666, 134,
+ 704, 134,
+ 847, 134,
+ 848, 134,
+ 849, 134,
+ 850, 134,
+ 883, 134,
+ 897, 134,
+ 960, 1117,
+ 1012, 134,
+ 1013, 134,
+ 1051, 134,
+ 1052, 134,
+ 1053, 134,
+ 1059, 134,
+ 1060, 134,
+ 1081, 134,
+ 1107, 1117,
+ 1108, 1117,
+ 1109, 1117,
+ 1110, 1117,
+ 1161, 134,
+ 1217, 134,
+ 1218, 134,
+ 1248, 1117,
+ 1250, 1117,
+ 1380, 134,
+ 1381, 134,
+ 1418, 1117,
+ 1420, 1117,
+ 1421, 1117,
+ 1423, 1117,
+ 1424, 1117,
+ 1425, 1117,
+ 1426, 1117,
+ 1427, 1117,
+ 1428, 1117,
+ 1429, 1117,
+ 1430, 1117,
+ 1431, 1117,
+ 1432, 1117,
+ 1433, 1117,
+ 1434, 1117,
+ 1435, 1117,
+ 1436, 1117,
+ 1437, 1117,
+ 1438, 1117,
+ 1439, 1117,
+ 1440, 1117,
+ 1505, 134,
+ 1506, 134,
+ 1507, 134,
+ 1508, 134,
+ 1531, 1117,
+ 1604, 134,
+ 1617, 134,
+ 1618, 134,
+ 1639, 134,
+ 1877, 1117
};
static int parser_goto_row83[] = {
1,
- -1, 84
+ -1, 77
};
static int parser_goto_row84[] = {
1,
- -1, 85
+ -1, 78
};
static int parser_goto_row85[] = {
2,
- -1, 267,
- 270, 503
+ -1, 246,
+ 249, 475
};
static int parser_goto_row86[] = {
1,
- -1, 268
+ -1, 247
};
static int parser_goto_row87[] = {
2,
- -1, 269,
- 270, 504
+ -1, 248,
+ 249, 476
};
static int parser_goto_row88[] = {
16,
- -1, 217,
- 174, 359,
- 224, 462,
- 417, 625,
- 831, 462,
- 1113, 462,
- 1178, 1342,
- 1196, 1383,
- 1360, 1503,
- 1436, 462,
- 1518, 462,
- 1558, 462,
- 1681, 1749,
- 1702, 1783,
- 1812, 462,
- 1901, 1922
+ -1, 203,
+ 160, 331,
+ 210, 434,
+ 389, 597,
+ 803, 434,
+ 1085, 434,
+ 1143, 1300,
+ 1161, 1341,
+ 1318, 1461,
+ 1394, 434,
+ 1476, 434,
+ 1516, 434,
+ 1639, 1707,
+ 1660, 1741,
+ 1770, 434,
+ 1859, 1880
};
static int parser_goto_row89[] = {
- 63,
- -1, 629,
- 45, 218,
- 46, 219,
- 47, 220,
- 48, 221,
- 55, 243,
- 56, 244,
- 57, 245,
- 58, 246,
- 59, 247,
- 60, 248,
- 61, 249,
- 62, 250,
- 63, 251,
- 64, 252,
- 66, 253,
- 127, 301,
- 128, 302,
- 129, 303,
- 130, 304,
- 137, 313,
- 138, 314,
- 139, 315,
- 140, 316,
- 141, 317,
- 142, 318,
- 143, 319,
- 144, 320,
- 145, 321,
- 146, 322,
- 147, 323,
- 269, 502,
- 504, 701,
- 627, 824,
- 819, 970,
- 830, 982,
- 832, 984,
- 841, 989,
- 1109, 1267,
- 1131, 1286,
- 1132, 1287,
- 1133, 1288,
- 1134, 1289,
- 1140, 1297,
- 1141, 1298,
- 1142, 1299,
- 1143, 1300,
- 1144, 1301,
- 1145, 1302,
- 1146, 1303,
- 1147, 1304,
- 1148, 1305,
- 1149, 1306,
- 1150, 1307,
- 1178, 1343,
- 1275, 1442,
- 1441, 1560,
- 1458, 1570,
- 1459, 1571,
- 1557, 1664,
- 1577, 1673,
- 1672, 1742,
- 1735, 1803
+ 42,
+ -1, 601,
+ 45, 204,
+ 46, 205,
+ 47, 206,
+ 48, 207,
+ 55, 229,
+ 56, 230,
+ 57, 231,
+ 59, 232,
+ 120, 280,
+ 121, 281,
+ 122, 282,
+ 123, 283,
+ 130, 292,
+ 131, 293,
+ 132, 294,
+ 133, 295,
+ 248, 474,
+ 476, 673,
+ 599, 796,
+ 791, 942,
+ 802, 954,
+ 804, 956,
+ 813, 961,
+ 1081, 1232,
+ 1103, 1251,
+ 1104, 1252,
+ 1105, 1253,
+ 1106, 1254,
+ 1112, 1262,
+ 1113, 1263,
+ 1114, 1264,
+ 1115, 1265,
+ 1143, 1301,
+ 1240, 1400,
+ 1399, 1518,
+ 1416, 1528,
+ 1417, 1529,
+ 1515, 1622,
+ 1535, 1631,
+ 1630, 1700,
+ 1693, 1761
};
static int parser_goto_row90[] = {
1,
- -1, 416
+ -1, 388
};
static int parser_goto_row91[] = {
6,
- -1, 814,
- 959, 1103,
- 993, 1174,
- 1002, 1183,
- 1690, 1762,
- 1768, 1826
+ -1, 786,
+ 931, 1075,
+ 965, 1139,
+ 974, 1148,
+ 1648, 1720,
+ 1726, 1784
};
static int parser_goto_row92[] = {
2,
- -1, 815,
- 1111, 1270
+ -1, 787,
+ 1083, 1235
};
static int parser_goto_row93[] = {
1,
- -1, 1268
+ -1, 1233
};
static int parser_goto_row94[] = {
2,
- -1, 967,
- 968, 1112
+ -1, 939,
+ 940, 1084
};
static int parser_goto_row95[] = {
5,
- -1, 1338,
- 1340, 1488,
- 1355, 1488,
- 1821, 1488,
- 1872, 1488
+ -1, 1296,
+ 1298, 1446,
+ 1313, 1446,
+ 1779, 1446,
+ 1830, 1446
};
static int parser_goto_row96[] = {
1,
- -1, 1015
+ -1, 987
};
static int parser_goto_row97[] = {
4,
- -1, 1271,
- 1436, 1556,
- 1518, 1627,
- 1812, 1861
+ -1, 1236,
+ 1394, 1514,
+ 1476, 1585,
+ 1770, 1819
};
static int parser_goto_row98[] = {
3,
- -1, 1439,
- 1440, 1559,
- 1526, 1559
+ -1, 1397,
+ 1398, 1517,
+ 1484, 1517
};
static int parser_goto_row99[] = {
4,
- -1, 1272,
- 224, 463,
- 831, 983,
- 1558, 1665
+ -1, 1237,
+ 210, 435,
+ 803, 955,
+ 1516, 1623
};
static int parser_goto_row100[] = {
4,
- -1, 819,
- 960, 1104,
- 964, 1109,
- 1604, 1681
+ -1, 791,
+ 932, 1076,
+ 936, 1081,
+ 1562, 1639
};
static int parser_goto_row101[] = {
86,
- -1, 377,
- 31, 149,
- 54, 241,
- 122, 296,
- 136, 312,
- 182, 149,
- 272, 506,
- 275, 514,
- 277, 519,
- 324, 541,
- 326, 542,
- 351, 567,
- 402, 506,
- 404, 609,
- 405, 610,
- 449, 241,
- 522, 717,
- 531, 724,
- 568, 760,
- 581, 772,
- 611, 802,
- 647, 514,
- 649, 519,
- 692, 867,
- 694, 872,
- 754, 900,
- 756, 902,
- 797, 867,
- 798, 951,
- 836, 717,
- 876, 1033,
- 878, 1038,
- 904, 1054,
- 905, 1055,
- 911, 149,
- 925, 241,
- 953, 1095,
- 954, 1096,
- 961, 1105,
- 978, 872,
- 1041, 1219,
- 1046, 1222,
- 1056, 1229,
- 1079, 506,
- 1081, 514,
- 1088, 519,
- 1097, 1256,
- 1106, 1263,
- 1107, 1264,
- 1121, 1033,
- 1122, 1038,
- 1126, 1281,
- 1139, 1296,
- 1223, 1406,
- 1224, 1407,
- 1253, 717,
- 1265, 1435,
- 1278, 1219,
- 1308, 1456,
- 1310, 1457,
- 1335, 1484,
- 1374, 1521,
- 1408, 1534,
- 1422, 867,
- 1423, 872,
- 1451, 1567,
- 1485, 1603,
- 1523, 1636,
- 1527, 1642,
- 1548, 1033,
- 1550, 1038,
- 1597, 1674,
- 1599, 1676,
- 1643, 1724,
- 1660, 1219,
- 1678, 1745,
- 1679, 1746,
- 1711, 1788,
- 1738, 1805,
- 1747, 1811,
- 1790, 1846,
- 1791, 1849,
- 1806, 1855,
- 1807, 1856,
- 1850, 1894,
- 1857, 1898
+ -1, 349,
+ 31, 135,
+ 54, 227,
+ 115, 275,
+ 129, 291,
+ 168, 135,
+ 251, 478,
+ 254, 486,
+ 256, 491,
+ 296, 513,
+ 298, 514,
+ 323, 539,
+ 374, 478,
+ 376, 581,
+ 377, 582,
+ 421, 227,
+ 494, 689,
+ 503, 696,
+ 540, 732,
+ 553, 744,
+ 583, 774,
+ 619, 486,
+ 621, 491,
+ 664, 839,
+ 666, 844,
+ 726, 872,
+ 728, 874,
+ 769, 839,
+ 770, 923,
+ 808, 689,
+ 848, 1005,
+ 850, 1010,
+ 876, 1026,
+ 877, 1027,
+ 883, 135,
+ 897, 227,
+ 925, 1067,
+ 926, 1068,
+ 933, 1077,
+ 950, 844,
+ 1013, 1184,
+ 1018, 1187,
+ 1028, 1194,
+ 1051, 478,
+ 1053, 486,
+ 1060, 491,
+ 1069, 1221,
+ 1078, 1228,
+ 1079, 1229,
+ 1093, 1005,
+ 1094, 1010,
+ 1098, 1246,
+ 1111, 1261,
+ 1188, 1364,
+ 1189, 1365,
+ 1218, 689,
+ 1230, 1393,
+ 1243, 1184,
+ 1266, 1414,
+ 1268, 1415,
+ 1293, 1442,
+ 1332, 1479,
+ 1366, 1492,
+ 1380, 839,
+ 1381, 844,
+ 1409, 1525,
+ 1443, 1561,
+ 1481, 1594,
+ 1485, 1600,
+ 1506, 1005,
+ 1508, 1010,
+ 1555, 1632,
+ 1557, 1634,
+ 1601, 1682,
+ 1618, 1184,
+ 1636, 1703,
+ 1637, 1704,
+ 1669, 1746,
+ 1696, 1763,
+ 1705, 1769,
+ 1748, 1804,
+ 1749, 1807,
+ 1764, 1813,
+ 1765, 1814,
+ 1808, 1852,
+ 1815, 1856
};
static int parser_goto_row102[] = {
34,
- -1, 150,
- 54, 242,
- 272, 507,
- 274, 511,
- 275, 515,
- 276, 516,
- 277, 520,
- 521, 714,
- 522, 718,
- 692, 868,
- 694, 873,
- 875, 1030,
- 876, 1034,
- 877, 1035,
- 878, 1039,
- 911, 1058,
- 925, 1077,
- 1040, 1216,
- 1041, 1220,
- 1079, 1242,
- 1080, 1243,
- 1081, 1244,
- 1087, 1250,
- 1088, 1251,
- 1252, 1427,
- 1253, 1428,
- 1422, 1545,
- 1423, 1546,
- 1547, 1655,
- 1548, 1656,
- 1549, 1657,
- 1550, 1658,
- 1659, 1732,
- 1660, 1733
+ -1, 136,
+ 54, 228,
+ 251, 479,
+ 253, 483,
+ 254, 487,
+ 255, 488,
+ 256, 492,
+ 493, 686,
+ 494, 690,
+ 664, 840,
+ 666, 845,
+ 847, 1002,
+ 848, 1006,
+ 849, 1007,
+ 850, 1011,
+ 883, 1030,
+ 897, 1049,
+ 1012, 1181,
+ 1013, 1185,
+ 1051, 1207,
+ 1052, 1208,
+ 1053, 1209,
+ 1059, 1215,
+ 1060, 1216,
+ 1217, 1385,
+ 1218, 1386,
+ 1380, 1503,
+ 1381, 1504,
+ 1505, 1613,
+ 1506, 1614,
+ 1507, 1615,
+ 1508, 1616,
+ 1617, 1690,
+ 1618, 1691
};
static int parser_goto_row103[] = {
6,
- -1, 264,
- 166, 350,
- 205, 401,
- 307, 350,
- 372, 401,
- 1389, 1525
+ -1, 243,
+ 152, 322,
+ 191, 373,
+ 286, 322,
+ 344, 373,
+ 1347, 1483
};
static int parser_goto_row104[] = {
4,
- -1, 540,
- 497, 691,
- 528, 721,
- 705, 882
+ -1, 512,
+ 469, 663,
+ 500, 693,
+ 677, 854
};
static int parser_goto_row105[] = {
2,
- -1, 897,
- 898, 1051
+ -1, 869,
+ 870, 1023
};
static int parser_goto_row106[] = {
3,
- -1, 366,
- 653, 839,
- 1069, 1236
+ -1, 338,
+ 625, 811,
+ 1041, 1201
};
static int parser_goto_row107[] = {
2,
- -1, 367,
- 576, 768
+ -1, 339,
+ 548, 740
};
static int parser_goto_row108[] = {
2,
- -1, 846,
- 662, 849
+ -1, 818,
+ 634, 821
};
static int parser_goto_row109[] = {
157,
- -1, 206,
- 13, 86,
- 27, 86,
- 31, 151,
- 33, 86,
- 37, 86,
- 54, 151,
- 104, 86,
- 131, 306,
- 172, 86,
- 187, 373,
- 224, 464,
- 260, 86,
- 272, 151,
- 274, 151,
- 275, 151,
- 276, 151,
- 277, 151,
- 298, 151,
- 410, 86,
- 496, 86,
- 498, 695,
- 521, 151,
- 522, 151,
- 543, 151,
- 545, 151,
- 546, 151,
- 548, 151,
- 549, 151,
- 550, 151,
- 551, 151,
- 552, 151,
- 553, 151,
- 554, 151,
- 555, 151,
- 556, 151,
- 557, 151,
- 558, 151,
- 559, 151,
- 560, 151,
- 561, 151,
- 562, 151,
- 563, 151,
- 564, 151,
- 565, 151,
- 566, 757,
- 569, 86,
- 608, 799,
- 612, 86,
- 615, 86,
- 692, 151,
- 694, 151,
- 726, 894,
- 732, 151,
- 762, 86,
- 766, 931,
- 767, 86,
- 773, 949,
- 822, 86,
- 829, 695,
- 831, 464,
- 875, 151,
- 876, 151,
- 877, 151,
- 878, 151,
- 911, 151,
- 912, 931,
- 914, 86,
- 916, 931,
- 925, 151,
- 933, 86,
- 988, 1153,
- 1003, 86,
- 1040, 151,
- 1041, 151,
- 1060, 86,
- 1079, 151,
- 1080, 151,
- 1081, 151,
- 1082, 86,
- 1086, 86,
- 1087, 151,
- 1088, 151,
- 1113, 464,
- 1135, 1291,
- 1136, 1153,
- 1137, 1153,
- 1138, 1153,
- 1186, 86,
- 1196, 1384,
- 1238, 931,
- 1241, 695,
- 1246, 86,
- 1252, 151,
- 1253, 151,
- 1283, 1153,
- 1285, 1153,
- 1416, 931,
- 1418, 86,
- 1422, 151,
- 1423, 151,
- 1429, 86,
- 1436, 464,
- 1460, 1153,
- 1462, 1153,
- 1463, 1153,
- 1465, 1153,
- 1466, 1153,
- 1467, 1153,
- 1468, 1153,
- 1469, 1153,
- 1470, 1153,
- 1471, 1153,
- 1472, 1153,
- 1473, 1153,
- 1474, 1153,
- 1475, 1153,
- 1476, 1153,
- 1477, 1153,
- 1478, 1153,
- 1479, 1153,
- 1480, 1153,
- 1481, 1153,
- 1482, 1153,
- 1483, 1600,
- 1518, 464,
- 1537, 931,
- 1538, 931,
- 1543, 931,
- 1547, 151,
- 1548, 151,
- 1549, 151,
- 1550, 151,
- 1558, 464,
- 1569, 1670,
- 1573, 1153,
- 1637, 1712,
- 1646, 151,
- 1659, 151,
- 1660, 151,
- 1681, 1384,
- 1691, 86,
- 1695, 86,
- 1728, 931,
- 1757, 86,
- 1765, 86,
- 1766, 86,
- 1769, 86,
- 1774, 86,
- 1777, 86,
- 1812, 464,
- 1818, 86,
- 1825, 86,
- 1830, 86,
- 1835, 86,
- 1853, 931,
- 1919, 1153
+ -1, 192,
+ 13, 79,
+ 27, 79,
+ 31, 137,
+ 33, 79,
+ 37, 79,
+ 54, 137,
+ 97, 79,
+ 124, 285,
+ 158, 79,
+ 173, 345,
+ 210, 436,
+ 239, 79,
+ 251, 137,
+ 253, 137,
+ 254, 137,
+ 255, 137,
+ 256, 137,
+ 277, 137,
+ 382, 79,
+ 468, 79,
+ 470, 667,
+ 493, 137,
+ 494, 137,
+ 515, 137,
+ 517, 137,
+ 518, 137,
+ 520, 137,
+ 521, 137,
+ 522, 137,
+ 523, 137,
+ 524, 137,
+ 525, 137,
+ 526, 137,
+ 527, 137,
+ 528, 137,
+ 529, 137,
+ 530, 137,
+ 531, 137,
+ 532, 137,
+ 533, 137,
+ 534, 137,
+ 535, 137,
+ 536, 137,
+ 537, 137,
+ 538, 729,
+ 541, 79,
+ 580, 771,
+ 584, 79,
+ 587, 79,
+ 664, 137,
+ 666, 137,
+ 698, 866,
+ 704, 137,
+ 734, 79,
+ 738, 903,
+ 739, 79,
+ 745, 921,
+ 794, 79,
+ 801, 667,
+ 803, 436,
+ 847, 137,
+ 848, 137,
+ 849, 137,
+ 850, 137,
+ 883, 137,
+ 884, 903,
+ 886, 79,
+ 888, 903,
+ 897, 137,
+ 905, 79,
+ 960, 1118,
+ 975, 79,
+ 1012, 137,
+ 1013, 137,
+ 1032, 79,
+ 1051, 137,
+ 1052, 137,
+ 1053, 137,
+ 1054, 79,
+ 1058, 79,
+ 1059, 137,
+ 1060, 137,
+ 1085, 436,
+ 1107, 1256,
+ 1108, 1118,
+ 1109, 1118,
+ 1110, 1118,
+ 1151, 79,
+ 1161, 1342,
+ 1203, 903,
+ 1206, 667,
+ 1211, 79,
+ 1217, 137,
+ 1218, 137,
+ 1248, 1118,
+ 1250, 1118,
+ 1374, 903,
+ 1376, 79,
+ 1380, 137,
+ 1381, 137,
+ 1387, 79,
+ 1394, 436,
+ 1418, 1118,
+ 1420, 1118,
+ 1421, 1118,
+ 1423, 1118,
+ 1424, 1118,
+ 1425, 1118,
+ 1426, 1118,
+ 1427, 1118,
+ 1428, 1118,
+ 1429, 1118,
+ 1430, 1118,
+ 1431, 1118,
+ 1432, 1118,
+ 1433, 1118,
+ 1434, 1118,
+ 1435, 1118,
+ 1436, 1118,
+ 1437, 1118,
+ 1438, 1118,
+ 1439, 1118,
+ 1440, 1118,
+ 1441, 1558,
+ 1476, 436,
+ 1495, 903,
+ 1496, 903,
+ 1501, 903,
+ 1505, 137,
+ 1506, 137,
+ 1507, 137,
+ 1508, 137,
+ 1516, 436,
+ 1527, 1628,
+ 1531, 1118,
+ 1595, 1670,
+ 1604, 137,
+ 1617, 137,
+ 1618, 137,
+ 1639, 1342,
+ 1649, 79,
+ 1653, 79,
+ 1686, 903,
+ 1715, 79,
+ 1723, 79,
+ 1724, 79,
+ 1727, 79,
+ 1732, 79,
+ 1735, 79,
+ 1770, 436,
+ 1776, 79,
+ 1783, 79,
+ 1788, 79,
+ 1793, 79,
+ 1811, 903,
+ 1877, 1118
};
static int parser_goto_row110[] = {
1,
- -1, 863
+ -1, 835
};
static int parser_goto_row111[] = {
6,
- -1, 1354,
- 491, 686,
- 1499, 1611,
- 1508, 1618,
- 1510, 1621,
- 1512, 1624
+ -1, 1312,
+ 463, 658,
+ 1457, 1569,
+ 1466, 1576,
+ 1468, 1579,
+ 1470, 1582
};
static int parser_goto_row112[] = {
22,
- -1, 87,
- 89, 278,
- 168, 278,
- 208, 278,
- 469, 278,
- 688, 278,
- 697, 278,
- 759, 278,
- 801, 278,
- 847, 278,
- 865, 278,
- 942, 278,
- 963, 278,
- 981, 278,
- 1048, 278,
- 1170, 278,
- 1173, 278,
- 1393, 278,
- 1425, 278,
- 1602, 278,
- 1715, 278,
- 1740, 278
+ -1, 80,
+ 82, 257,
+ 154, 257,
+ 194, 257,
+ 441, 257,
+ 660, 257,
+ 669, 257,
+ 731, 257,
+ 773, 257,
+ 819, 257,
+ 837, 257,
+ 914, 257,
+ 935, 257,
+ 953, 257,
+ 1020, 257,
+ 1135, 257,
+ 1138, 257,
+ 1351, 257,
+ 1383, 257,
+ 1560, 257,
+ 1673, 257,
+ 1698, 257
};
static int parser_goto_row113[] = {
186,
- -1, 207,
- 13, 88,
- 27, 88,
- 31, 152,
- 33, 88,
- 37, 88,
- 54, 152,
- 89, 279,
- 104, 88,
- 131, 152,
- 168, 352,
- 172, 88,
- 208, 406,
- 224, 465,
- 260, 88,
- 272, 152,
- 274, 152,
- 275, 152,
- 276, 152,
- 277, 152,
- 298, 152,
- 410, 88,
- 469, 650,
- 491, 687,
- 496, 88,
- 498, 696,
- 521, 152,
- 522, 152,
- 543, 152,
- 545, 152,
- 546, 152,
- 548, 152,
- 549, 152,
- 550, 152,
- 551, 152,
- 552, 152,
- 553, 152,
- 554, 152,
- 555, 152,
- 556, 152,
- 557, 152,
- 558, 152,
- 559, 152,
- 560, 152,
- 561, 152,
- 562, 152,
- 563, 152,
- 564, 152,
- 565, 152,
- 566, 758,
- 569, 88,
- 608, 800,
- 612, 88,
- 615, 88,
- 688, 860,
- 690, 864,
- 692, 152,
- 694, 152,
- 697, 879,
- 726, 758,
- 732, 152,
- 759, 906,
- 762, 88,
- 766, 932,
- 767, 88,
- 773, 800,
- 801, 955,
- 812, 962,
- 822, 88,
- 829, 979,
- 831, 465,
- 865, 1021,
- 875, 152,
- 876, 152,
- 877, 152,
- 878, 152,
- 893, 1047,
- 911, 152,
- 912, 932,
- 914, 88,
- 916, 932,
- 925, 152,
- 933, 88,
- 942, 1089,
- 963, 1108,
- 981, 1123,
- 988, 1154,
- 1003, 88,
- 1040, 152,
- 1041, 152,
- 1048, 1225,
- 1060, 88,
- 1079, 152,
- 1080, 152,
- 1081, 152,
- 1082, 88,
- 1086, 88,
- 1087, 152,
- 1088, 152,
- 1113, 465,
- 1135, 1154,
- 1136, 1154,
- 1137, 1154,
- 1138, 1154,
- 1170, 1336,
- 1182, 687,
- 1186, 88,
- 1196, 1385,
- 1238, 932,
- 1241, 1424,
- 1246, 88,
- 1252, 152,
- 1253, 152,
- 1283, 1154,
- 1285, 1154,
- 1393, 1528,
- 1416, 932,
- 1418, 88,
- 1422, 152,
- 1423, 152,
- 1425, 1551,
- 1429, 88,
- 1436, 465,
- 1460, 1154,
- 1462, 1154,
- 1463, 1154,
- 1465, 1154,
- 1466, 1154,
- 1467, 1154,
- 1468, 1154,
- 1469, 1154,
- 1470, 1154,
- 1471, 1154,
- 1472, 1154,
- 1473, 1154,
- 1474, 1154,
- 1475, 1154,
- 1476, 1154,
- 1477, 1154,
- 1478, 1154,
- 1479, 1154,
- 1480, 1154,
- 1481, 1154,
- 1482, 1154,
- 1483, 1601,
- 1499, 687,
- 1508, 687,
- 1510, 687,
- 1512, 687,
- 1518, 465,
- 1537, 932,
- 1538, 932,
- 1543, 932,
- 1547, 152,
- 1548, 152,
- 1549, 152,
- 1550, 152,
- 1558, 465,
- 1569, 1601,
- 1573, 1154,
- 1602, 1680,
- 1608, 687,
- 1637, 1713,
- 1646, 152,
- 1659, 152,
- 1660, 152,
- 1669, 1739,
- 1681, 1385,
- 1691, 88,
- 1695, 88,
- 1715, 1792,
- 1728, 932,
- 1740, 1808,
- 1757, 88,
- 1765, 88,
- 1766, 88,
- 1769, 88,
- 1774, 88,
- 1777, 88,
- 1812, 465,
- 1818, 88,
- 1825, 88,
- 1830, 88,
- 1835, 88,
- 1853, 932,
- 1919, 1154
+ -1, 193,
+ 13, 81,
+ 27, 81,
+ 31, 138,
+ 33, 81,
+ 37, 81,
+ 54, 138,
+ 82, 258,
+ 97, 81,
+ 124, 138,
+ 154, 324,
+ 158, 81,
+ 194, 378,
+ 210, 437,
+ 239, 81,
+ 251, 138,
+ 253, 138,
+ 254, 138,
+ 255, 138,
+ 256, 138,
+ 277, 138,
+ 382, 81,
+ 441, 622,
+ 463, 659,
+ 468, 81,
+ 470, 668,
+ 493, 138,
+ 494, 138,
+ 515, 138,
+ 517, 138,
+ 518, 138,
+ 520, 138,
+ 521, 138,
+ 522, 138,
+ 523, 138,
+ 524, 138,
+ 525, 138,
+ 526, 138,
+ 527, 138,
+ 528, 138,
+ 529, 138,
+ 530, 138,
+ 531, 138,
+ 532, 138,
+ 533, 138,
+ 534, 138,
+ 535, 138,
+ 536, 138,
+ 537, 138,
+ 538, 730,
+ 541, 81,
+ 580, 772,
+ 584, 81,
+ 587, 81,
+ 660, 832,
+ 662, 836,
+ 664, 138,
+ 666, 138,
+ 669, 851,
+ 698, 730,
+ 704, 138,
+ 731, 878,
+ 734, 81,
+ 738, 904,
+ 739, 81,
+ 745, 772,
+ 773, 927,
+ 784, 934,
+ 794, 81,
+ 801, 951,
+ 803, 437,
+ 837, 993,
+ 847, 138,
+ 848, 138,
+ 849, 138,
+ 850, 138,
+ 865, 1019,
+ 883, 138,
+ 884, 904,
+ 886, 81,
+ 888, 904,
+ 897, 138,
+ 905, 81,
+ 914, 1061,
+ 935, 1080,
+ 953, 1095,
+ 960, 1119,
+ 975, 81,
+ 1012, 138,
+ 1013, 138,
+ 1020, 1190,
+ 1032, 81,
+ 1051, 138,
+ 1052, 138,
+ 1053, 138,
+ 1054, 81,
+ 1058, 81,
+ 1059, 138,
+ 1060, 138,
+ 1085, 437,
+ 1107, 1119,
+ 1108, 1119,
+ 1109, 1119,
+ 1110, 1119,
+ 1135, 1294,
+ 1147, 659,
+ 1151, 81,
+ 1161, 1343,
+ 1203, 904,
+ 1206, 1382,
+ 1211, 81,
+ 1217, 138,
+ 1218, 138,
+ 1248, 1119,
+ 1250, 1119,
+ 1351, 1486,
+ 1374, 904,
+ 1376, 81,
+ 1380, 138,
+ 1381, 138,
+ 1383, 1509,
+ 1387, 81,
+ 1394, 437,
+ 1418, 1119,
+ 1420, 1119,
+ 1421, 1119,
+ 1423, 1119,
+ 1424, 1119,
+ 1425, 1119,
+ 1426, 1119,
+ 1427, 1119,
+ 1428, 1119,
+ 1429, 1119,
+ 1430, 1119,
+ 1431, 1119,
+ 1432, 1119,
+ 1433, 1119,
+ 1434, 1119,
+ 1435, 1119,
+ 1436, 1119,
+ 1437, 1119,
+ 1438, 1119,
+ 1439, 1119,
+ 1440, 1119,
+ 1441, 1559,
+ 1457, 659,
+ 1466, 659,
+ 1468, 659,
+ 1470, 659,
+ 1476, 437,
+ 1495, 904,
+ 1496, 904,
+ 1501, 904,
+ 1505, 138,
+ 1506, 138,
+ 1507, 138,
+ 1508, 138,
+ 1516, 437,
+ 1527, 1559,
+ 1531, 1119,
+ 1560, 1638,
+ 1566, 659,
+ 1595, 1671,
+ 1604, 138,
+ 1617, 138,
+ 1618, 138,
+ 1627, 1697,
+ 1639, 1343,
+ 1649, 81,
+ 1653, 81,
+ 1673, 1750,
+ 1686, 904,
+ 1698, 1766,
+ 1715, 81,
+ 1723, 81,
+ 1724, 81,
+ 1727, 81,
+ 1732, 81,
+ 1735, 81,
+ 1770, 437,
+ 1776, 81,
+ 1783, 81,
+ 1788, 81,
+ 1793, 81,
+ 1811, 904,
+ 1877, 1119
};
static int parser_goto_row114[] = {
12,
- -1, 1357,
- 1358, 1501,
- 1764, 1822,
- 1773, 1831,
- 1817, 1866,
- 1823, 1869,
- 1824, 1870,
- 1832, 1876,
- 1834, 1877,
- 1867, 1905,
- 1871, 1906,
- 1878, 1909
+ -1, 1315,
+ 1316, 1459,
+ 1722, 1780,
+ 1731, 1789,
+ 1775, 1824,
+ 1781, 1827,
+ 1782, 1828,
+ 1790, 1834,
+ 1792, 1835,
+ 1825, 1863,
+ 1829, 1864,
+ 1836, 1867
};
static int parser_goto_row115[] = {
14,
- -1, 97,
- 848, 996,
- 993, 1175,
- 994, 1176,
- 997, 1177,
- 1002, 1184,
- 1013, 1191,
- 1681, 1750,
- 1690, 1763,
- 1749, 1813,
- 1751, 1814,
- 1768, 1827,
- 1901, 1923,
- 1922, 1931
+ -1, 90,
+ 820, 968,
+ 965, 1140,
+ 966, 1141,
+ 969, 1142,
+ 974, 1149,
+ 985, 1156,
+ 1639, 1708,
+ 1648, 1721,
+ 1707, 1771,
+ 1709, 1772,
+ 1726, 1785,
+ 1859, 1881,
+ 1880, 1889
};
static int parser_goto_row116[] = {
55,
- -1, 615,
+ -1, 587,
0, 12,
3, 23,
5, 12,
28, 12,
29, 12,
30, 12,
- 33, 172,
- 37, 172,
- 70, 260,
- 100, 12,
- 101, 12,
- 105, 12,
- 110, 287,
- 111, 288,
- 117, 12,
- 118, 12,
- 120, 12,
- 261, 496,
- 283, 12,
- 289, 526,
- 292, 12,
- 355, 569,
- 570, 762,
- 766, 933,
- 767, 172,
- 822, 172,
- 863, 1016,
- 912, 1060,
- 916, 1060,
- 1014, 1016,
- 1018, 1016,
- 1084, 260,
- 1175, 1016,
- 1184, 1016,
- 1238, 1418,
- 1248, 496,
- 1340, 1016,
- 1355, 1016,
- 1416, 1418,
- 1429, 172,
- 1504, 1016,
- 1537, 933,
- 1538, 1060,
- 1543, 1060,
- 1615, 1016,
- 1728, 1418,
- 1763, 1016,
- 1821, 1016,
- 1827, 1016,
- 1853, 1060,
- 1872, 1016
+ 33, 158,
+ 37, 158,
+ 63, 239,
+ 93, 12,
+ 94, 12,
+ 98, 12,
+ 103, 266,
+ 104, 267,
+ 110, 12,
+ 111, 12,
+ 113, 12,
+ 240, 468,
+ 262, 12,
+ 268, 498,
+ 271, 12,
+ 327, 541,
+ 542, 734,
+ 738, 905,
+ 739, 158,
+ 794, 158,
+ 835, 988,
+ 884, 1032,
+ 888, 1032,
+ 986, 988,
+ 990, 988,
+ 1056, 239,
+ 1140, 988,
+ 1149, 988,
+ 1203, 1376,
+ 1213, 468,
+ 1298, 988,
+ 1313, 988,
+ 1374, 1376,
+ 1387, 158,
+ 1462, 988,
+ 1495, 905,
+ 1496, 1032,
+ 1501, 1032,
+ 1573, 988,
+ 1686, 1376,
+ 1721, 988,
+ 1779, 988,
+ 1785, 988,
+ 1811, 1032,
+ 1830, 988
};
static int parser_goto_row117[] = {
18,
- -1, 104,
+ -1, 97,
0, 13,
5, 27,
18, 27,
28, 27,
- 863, 1017,
- 1014, 1017,
- 1018, 1199,
- 1175, 1339,
- 1184, 1339,
- 1340, 1339,
- 1355, 1339,
- 1504, 1017,
- 1615, 1017,
- 1763, 1339,
- 1821, 1339,
- 1827, 1339,
- 1872, 1339
+ 835, 989,
+ 986, 989,
+ 990, 1164,
+ 1140, 1297,
+ 1149, 1297,
+ 1298, 1297,
+ 1313, 1297,
+ 1462, 989,
+ 1573, 989,
+ 1721, 1297,
+ 1779, 1297,
+ 1785, 1297,
+ 1830, 1297
};
static int parser_goto_row118[] = {
249,
-1, 14,
- 35, 175,
- 36, 178,
- 38, 181,
- 44, 215,
- 49, 222,
- 51, 224,
- 52, 225,
- 85, 271,
- 90, 280,
- 123, 297,
- 124, 298,
- 125, 299,
- 126, 300,
- 132, 308,
- 183, 368,
- 184, 369,
- 185, 370,
- 186, 371,
- 226, 475,
- 227, 476,
- 254, 481,
- 255, 482,
- 256, 483,
- 257, 484,
- 262, 497,
- 263, 498,
- 268, 501,
- 295, 528,
- 305, 533,
- 327, 543,
- 328, 545,
- 329, 546,
- 330, 547,
- 331, 548,
- 332, 549,
- 333, 550,
- 334, 551,
- 335, 552,
- 336, 553,
- 337, 554,
- 338, 555,
- 339, 556,
- 340, 557,
- 341, 558,
- 342, 559,
- 343, 560,
- 344, 561,
- 345, 562,
- 346, 563,
- 347, 564,
- 348, 565,
- 349, 566,
- 357, 571,
- 360, 574,
- 362, 575,
- 364, 576,
- 366, 577,
- 378, 585,
- 379, 587,
- 380, 588,
- 381, 589,
- 382, 590,
- 383, 591,
- 384, 592,
- 385, 593,
+ 35, 161,
+ 36, 164,
+ 38, 167,
+ 44, 201,
+ 49, 208,
+ 51, 210,
+ 52, 211,
+ 78, 250,
+ 83, 259,
+ 116, 276,
+ 117, 277,
+ 118, 278,
+ 119, 279,
+ 125, 287,
+ 169, 340,
+ 170, 341,
+ 171, 342,
+ 172, 343,
+ 212, 447,
+ 213, 448,
+ 233, 453,
+ 234, 454,
+ 235, 455,
+ 236, 456,
+ 241, 469,
+ 242, 470,
+ 247, 473,
+ 274, 500,
+ 284, 505,
+ 299, 515,
+ 300, 517,
+ 301, 518,
+ 302, 519,
+ 303, 520,
+ 304, 521,
+ 305, 522,
+ 306, 523,
+ 307, 524,
+ 308, 525,
+ 309, 526,
+ 310, 527,
+ 311, 528,
+ 312, 529,
+ 313, 530,
+ 314, 531,
+ 315, 532,
+ 316, 533,
+ 317, 534,
+ 318, 535,
+ 319, 536,
+ 320, 537,
+ 321, 538,
+ 329, 543,
+ 332, 546,
+ 334, 547,
+ 336, 548,
+ 338, 549,
+ 350, 557,
+ 351, 559,
+ 352, 560,
+ 353, 561,
+ 354, 562,
+ 355, 563,
+ 356, 564,
+ 357, 565,
+ 358, 566,
+ 359, 567,
+ 360, 568,
+ 361, 569,
+ 362, 570,
+ 363, 571,
+ 364, 572,
+ 365, 573,
+ 366, 574,
+ 367, 575,
+ 368, 576,
+ 369, 577,
+ 370, 578,
+ 371, 579,
+ 372, 580,
386, 594,
- 387, 595,
- 388, 596,
- 389, 597,
390, 598,
- 391, 599,
- 392, 600,
- 393, 601,
- 394, 602,
- 395, 603,
- 396, 604,
- 397, 605,
- 398, 606,
- 399, 607,
- 400, 608,
- 414, 622,
- 418, 626,
- 428, 225,
- 461, 638,
- 463, 641,
- 470, 652,
- 471, 653,
- 472, 654,
- 485, 661,
- 486, 662,
- 493, 690,
- 505, 702,
- 510, 705,
- 523, 719,
- 529, 722,
- 535, 726,
- 539, 729,
- 544, 732,
- 572, 764,
- 578, 770,
- 579, 771,
- 583, 773,
- 586, 775,
- 617, 808,
- 621, 812,
- 628, 825,
- 637, 829,
- 639, 831,
- 656, 842,
- 686, 856,
- 693, 869,
- 700, 880,
- 723, 893,
- 755, 901,
- 765, 909,
- 768, 945,
- 769, 946,
- 806, 956,
- 809, 959,
- 814, 965,
- 820, 971,
- 823, 975,
- 838, 986,
- 839, 987,
- 840, 988,
- 844, 992,
- 852, 999,
- 853, 1000,
- 855, 1007,
- 892, 1045,
- 896, 1050,
- 913, 1064,
- 915, 1066,
- 917, 1069,
- 923, 1075,
- 948, 1093,
- 958, 1102,
- 966, 1111,
- 969, 1113,
- 972, 1115,
- 976, 1118,
- 990, 1171,
- 1001, 1182,
- 1009, 1189,
- 1018, 1200,
- 1022, 1202,
- 1023, 1203,
- 1052, 1227,
- 1053, 1228,
- 1078, 1241,
- 1092, 1254,
- 1098, 1257,
- 1099, 1258,
- 1103, 1261,
- 1117, 1274,
- 1124, 1279,
- 1125, 1280,
- 1127, 1282,
- 1128, 1283,
- 1129, 1284,
- 1130, 1285,
- 1155, 1311,
- 1180, 1347,
- 1221, 1405,
- 1226, 1409,
- 1233, 1413,
- 1234, 1414,
- 1236, 1415,
- 1239, 1420,
- 1255, 1430,
- 1266, 1436,
- 1271, 1437,
- 1290, 1453,
- 1312, 1460,
- 1313, 1462,
- 1314, 1463,
- 1315, 1464,
- 1316, 1465,
- 1317, 1466,
- 1318, 1467,
- 1319, 1468,
- 1320, 1469,
- 1321, 1470,
- 1322, 1471,
- 1323, 1472,
- 1324, 1473,
- 1325, 1474,
- 1326, 1475,
- 1327, 1476,
- 1328, 1477,
- 1329, 1478,
- 1330, 1479,
- 1331, 1480,
- 1332, 1481,
- 1333, 1482,
- 1334, 1483,
- 1344, 1492,
- 1345, 1493,
- 1348, 1495,
- 1370, 1518,
- 1395, 1529,
- 1396, 1530,
- 1411, 1535,
- 1412, 1536,
- 1438, 1558,
- 1444, 1561,
- 1446, 1562,
- 1447, 1563,
- 1455, 1569,
- 1461, 1573,
- 1491, 1606,
- 1496, 1608,
- 1502, 1612,
- 1505, 1616,
- 1510, 856,
- 1512, 856,
- 1513, 1625,
- 1524, 1637,
- 1533, 1646,
- 1539, 1652,
- 1554, 1662,
- 1556, 1663,
- 1566, 1669,
- 1598, 1675,
- 1610, 1683,
- 1613, 1684,
- 1618, 856,
- 1621, 856,
- 1624, 856,
- 1644, 1725,
- 1647, 1727,
- 1667, 1737,
- 1730, 1802,
- 1743, 1809,
- 1744, 1810,
- 1748, 1812,
- 1752, 1815,
- 1754, 1816,
- 1770, 1829,
- 1804, 1854,
- 1859, 1899,
- 1860, 1900,
- 1863, 1902,
- 1864, 1903,
- 1865, 1904,
- 1897, 1919,
- 1920, 1930,
- 1924, 1932
+ 400, 211,
+ 433, 610,
+ 435, 613,
+ 442, 624,
+ 443, 625,
+ 444, 626,
+ 457, 633,
+ 458, 634,
+ 465, 662,
+ 477, 674,
+ 482, 677,
+ 495, 691,
+ 501, 694,
+ 507, 698,
+ 511, 701,
+ 516, 704,
+ 544, 736,
+ 550, 742,
+ 551, 743,
+ 555, 745,
+ 558, 747,
+ 589, 780,
+ 593, 784,
+ 600, 797,
+ 609, 801,
+ 611, 803,
+ 628, 814,
+ 658, 828,
+ 665, 841,
+ 672, 852,
+ 695, 865,
+ 727, 873,
+ 737, 881,
+ 740, 917,
+ 741, 918,
+ 778, 928,
+ 781, 931,
+ 786, 937,
+ 792, 943,
+ 795, 947,
+ 810, 958,
+ 811, 959,
+ 812, 960,
+ 816, 964,
+ 824, 971,
+ 825, 972,
+ 827, 979,
+ 864, 1017,
+ 868, 1022,
+ 885, 1036,
+ 887, 1038,
+ 889, 1041,
+ 895, 1047,
+ 920, 1065,
+ 930, 1074,
+ 938, 1083,
+ 941, 1085,
+ 944, 1087,
+ 948, 1090,
+ 962, 1136,
+ 973, 1147,
+ 981, 1154,
+ 990, 1165,
+ 994, 1167,
+ 995, 1168,
+ 1024, 1192,
+ 1025, 1193,
+ 1050, 1206,
+ 1064, 1219,
+ 1070, 1222,
+ 1071, 1223,
+ 1075, 1226,
+ 1089, 1239,
+ 1096, 1244,
+ 1097, 1245,
+ 1099, 1247,
+ 1100, 1248,
+ 1101, 1249,
+ 1102, 1250,
+ 1120, 1269,
+ 1145, 1305,
+ 1186, 1363,
+ 1191, 1367,
+ 1198, 1371,
+ 1199, 1372,
+ 1201, 1373,
+ 1204, 1378,
+ 1220, 1388,
+ 1231, 1394,
+ 1236, 1395,
+ 1255, 1411,
+ 1270, 1418,
+ 1271, 1420,
+ 1272, 1421,
+ 1273, 1422,
+ 1274, 1423,
+ 1275, 1424,
+ 1276, 1425,
+ 1277, 1426,
+ 1278, 1427,
+ 1279, 1428,
+ 1280, 1429,
+ 1281, 1430,
+ 1282, 1431,
+ 1283, 1432,
+ 1284, 1433,
+ 1285, 1434,
+ 1286, 1435,
+ 1287, 1436,
+ 1288, 1437,
+ 1289, 1438,
+ 1290, 1439,
+ 1291, 1440,
+ 1292, 1441,
+ 1302, 1450,
+ 1303, 1451,
+ 1306, 1453,
+ 1328, 1476,
+ 1353, 1487,
+ 1354, 1488,
+ 1369, 1493,
+ 1370, 1494,
+ 1396, 1516,
+ 1402, 1519,
+ 1404, 1520,
+ 1405, 1521,
+ 1413, 1527,
+ 1419, 1531,
+ 1449, 1564,
+ 1454, 1566,
+ 1460, 1570,
+ 1463, 1574,
+ 1468, 828,
+ 1470, 828,
+ 1471, 1583,
+ 1482, 1595,
+ 1491, 1604,
+ 1497, 1610,
+ 1512, 1620,
+ 1514, 1621,
+ 1524, 1627,
+ 1556, 1633,
+ 1568, 1641,
+ 1571, 1642,
+ 1576, 828,
+ 1579, 828,
+ 1582, 828,
+ 1602, 1683,
+ 1605, 1685,
+ 1625, 1695,
+ 1688, 1760,
+ 1701, 1767,
+ 1702, 1768,
+ 1706, 1770,
+ 1710, 1773,
+ 1712, 1774,
+ 1728, 1787,
+ 1762, 1812,
+ 1817, 1857,
+ 1818, 1858,
+ 1821, 1860,
+ 1822, 1861,
+ 1823, 1862,
+ 1855, 1877,
+ 1878, 1888,
+ 1882, 1890
};
static int parser_goto_row119[] = {
4,
-1, 15,
- 22, 112,
- 25, 112,
- 177, 112
+ 22, 105,
+ 25, 105,
+ 163, 105
};
static int parser_goto_row120[] = {
1,
};
static int parser_goto_row121[] = {
4,
- -1, 1006,
- 1623, 1698,
- 1688, 1760,
- 1699, 1780
+ -1, 978,
+ 1581, 1656,
+ 1646, 1718,
+ 1657, 1738
};
static int parser_goto_row122[] = {
13,
- -1, 466,
- 465, 648,
- 469, 651,
- 650, 837,
- 979, 648,
- 981, 651,
- 1123, 837,
- 1385, 648,
- 1393, 651,
- 1528, 837,
- 1713, 648,
- 1715, 651,
- 1792, 837
+ -1, 438,
+ 437, 620,
+ 441, 623,
+ 622, 809,
+ 951, 620,
+ 953, 623,
+ 1095, 809,
+ 1343, 620,
+ 1351, 623,
+ 1486, 809,
+ 1671, 620,
+ 1673, 623,
+ 1750, 809
};
static int parser_goto_row123[] = {
5,
- -1, 467,
- 829, 980,
- 1196, 1386,
- 1637, 1714,
- 1681, 1386
+ -1, 439,
+ 801, 952,
+ 1161, 1344,
+ 1595, 1672,
+ 1639, 1344
};
static int parser_goto_row124[] = {
1,
- -1, 1578
+ -1, 1536
};
static int parser_goto_row125[] = {
2,
- -1, 1155,
- 1919, 1929
+ -1, 1120,
+ 1877, 1887
};
static int parser_goto_row126[] = {
1,
- -1, 1156
+ -1, 1121
};
static int parser_goto_row127[] = {
6,
- -1, 1157,
- 1283, 1448,
- 1460, 1572,
- 1462, 1574,
- 1463, 1575,
- 1573, 1671
+ -1, 1122,
+ 1248, 1406,
+ 1418, 1530,
+ 1420, 1532,
+ 1421, 1533,
+ 1531, 1629
};
static int parser_goto_row128[] = {
1,
- -1, 1158
+ -1, 1123
};
static int parser_goto_row129[] = {
8,
- -1, 1159,
- 1466, 1580,
- 1467, 1581,
- 1468, 1582,
- 1469, 1583,
- 1470, 1584,
- 1471, 1585,
- 1472, 1586
+ -1, 1124,
+ 1424, 1538,
+ 1425, 1539,
+ 1426, 1540,
+ 1427, 1541,
+ 1428, 1542,
+ 1429, 1543,
+ 1430, 1544
};
static int parser_goto_row130[] = {
2,
- -1, 1160,
- 1465, 1579
+ -1, 1125,
+ 1423, 1537
};
static int parser_goto_row131[] = {
2,
- -1, 1161,
- 1473, 1587
+ -1, 1126,
+ 1431, 1545
};
static int parser_goto_row132[] = {
2,
- -1, 1162,
- 1474, 1588
+ -1, 1127,
+ 1432, 1546
};
static int parser_goto_row133[] = {
3,
- -1, 1163,
- 1475, 1589,
- 1476, 1590
+ -1, 1128,
+ 1433, 1547,
+ 1434, 1548
};
static int parser_goto_row134[] = {
3,
- -1, 1164,
- 1477, 1591,
- 1478, 1592
+ -1, 1129,
+ 1435, 1549,
+ 1436, 1550
};
static int parser_goto_row135[] = {
5,
- -1, 1165,
- 1479, 1593,
- 1480, 1594,
- 1481, 1595,
- 1482, 1596
+ -1, 1130,
+ 1437, 1551,
+ 1438, 1552,
+ 1439, 1553,
+ 1440, 1554
};
static int parser_goto_row136[] = {
5,
- -1, 1166,
- 1136, 1293,
- 1137, 1294,
- 1138, 1295,
- 1285, 1452
+ -1, 1131,
+ 1108, 1258,
+ 1109, 1259,
+ 1110, 1260,
+ 1250, 1410
};
static int parser_goto_row137[] = {
1,
- -1, 1167
+ -1, 1132
};
static int parser_goto_row138[] = {
2,
- -1, 1168,
- 1135, 1292
+ -1, 1133,
+ 1107, 1257
};
static int parser_goto_row139[] = {
1,
};
static int parser_goto_row140[] = {
1,
- -1, 1169
+ -1, 1134
};
static int parser_goto_row141[] = {
4,
- -1, 413,
- 299, 531,
- 370, 581,
- 533, 725
+ -1, 385,
+ 278, 503,
+ 342, 553,
+ 505, 697
};
static int parser_goto_row142[] = {
1,
};
static int parser_goto_row143[] = {
1,
- -1, 1387
+ -1, 1345
};
static int parser_goto_row144[] = {
4,
- -1, 153,
- 1196, 1388,
- 1646, 1726,
- 1681, 1388
+ -1, 139,
+ 1161, 1346,
+ 1604, 1684,
+ 1639, 1346
};
static int parser_goto_row145[] = {
1,
- -1, 154
+ -1, 140
};
static int parser_goto_row146[] = {
6,
- -1, 155,
- 298, 530,
- 543, 731,
- 545, 733,
- 546, 734,
- 732, 899
+ -1, 141,
+ 277, 502,
+ 515, 703,
+ 517, 705,
+ 518, 706,
+ 704, 871
};
static int parser_goto_row147[] = {
1,
- -1, 156
+ -1, 142
};
static int parser_goto_row148[] = {
8,
- -1, 157,
- 549, 737,
- 550, 738,
- 551, 739,
- 552, 740,
- 553, 741,
- 554, 742,
- 555, 743
+ -1, 143,
+ 521, 709,
+ 522, 710,
+ 523, 711,
+ 524, 712,
+ 525, 713,
+ 526, 714,
+ 527, 715
};
static int parser_goto_row149[] = {
2,
- -1, 158,
- 548, 736
+ -1, 144,
+ 520, 708
};
static int parser_goto_row150[] = {
2,
- -1, 159,
- 556, 744
+ -1, 145,
+ 528, 716
};
static int parser_goto_row151[] = {
2,
- -1, 160,
- 557, 745
+ -1, 146,
+ 529, 717
};
static int parser_goto_row152[] = {
3,
- -1, 161,
- 558, 746,
- 559, 747
+ -1, 147,
+ 530, 718,
+ 531, 719
};
static int parser_goto_row153[] = {
3,
- -1, 162,
- 560, 748,
- 561, 749
+ -1, 148,
+ 532, 720,
+ 533, 721
};
static int parser_goto_row154[] = {
5,
- -1, 163,
- 562, 750,
- 563, 751,
- 564, 752,
- 565, 753
+ -1, 149,
+ 534, 722,
+ 535, 723,
+ 536, 724,
+ 537, 725
};
static int parser_goto_row155[] = {
1,
- -1, 164
+ -1, 150
};
static int parser_goto_row156[] = {
1,
- -1, 165
+ -1, 151
};
static int parser_goto_row157[] = {
4,
- -1, 166,
- 131, 307,
- 1196, 1389,
- 1681, 1389
+ -1, 152,
+ 124, 286,
+ 1161, 1347,
+ 1639, 1347
};
static int parser_goto_row158[] = {
1,
};
static int parser_goto_row159[] = {
2,
- -1, 167,
- 1109, 1269
+ -1, 153,
+ 1081, 1234
};
static int parser_goto_row160[] = {
1,
- -1, 619
+ -1, 591
};
static int parser_goto_row161[] = {
7,
- -1, 620,
- 616, 807,
- 1104, 1262,
- 1260, 1433,
- 1431, 1555,
- 1450, 1565,
- 1564, 1668
+ -1, 592,
+ 588, 779,
+ 1076, 1227,
+ 1225, 1391,
+ 1389, 1513,
+ 1408, 1523,
+ 1522, 1626
};
static int parser_goto_row162[] = {
1,
- -1, 811
+ -1, 783
};
static int parser_goto_row163[] = {
1,
};
static int parser_goto_row164[] = {
2,
- -1, 1390,
- 1681, 1751
+ -1, 1348,
+ 1639, 1709
};
static int parser_goto_row165[] = {
1,
- -1, 1391
+ -1, 1349
};
static int parser_goto_row166[] = {
2,
- -1, 1451,
- 1453, 1568
+ -1, 1409,
+ 1411, 1526
};
static int parser_goto_row167[] = {
1,
};
static int parser_goto_row184[] = {
8,
- -1, 1061,
- 916, 1067,
- 1238, 1419,
- 1416, 1540,
- 1538, 1650,
- 1543, 1653,
- 1728, 1801,
- 1853, 1895
+ -1, 1033,
+ 888, 1039,
+ 1203, 1377,
+ 1374, 1498,
+ 1496, 1608,
+ 1501, 1611,
+ 1686, 1759,
+ 1811, 1853
};
static int parser_goto_row185[] = {
3,
- -1, 1062,
- 766, 934,
- 1537, 1649
+ -1, 1034,
+ 738, 906,
+ 1495, 1607
};
static int parser_goto_row186[] = {
1,
- -1, 935
+ -1, 907
};
static int parser_goto_row187[] = {
1,
- -1, 936
+ -1, 908
};
static int parser_goto_row188[] = {
1,
- -1, 937
+ -1, 909
};
static int parser_goto_row189[] = {
1,
- -1, 938
+ -1, 910
};
static int parser_goto_row190[] = {
1,
- -1, 939
+ -1, 911
};
static int parser_goto_row191[] = {
1,
- -1, 940
+ -1, 912
};
static int parser_goto_row192[] = {
1,
- -1, 941
+ -1, 913
};
static int parser_goto_row193[] = {
1,
};
static int parser_goto_row194[] = {
10,
- -1, 173,
- 37, 180,
- 767, 944,
- 822, 974,
- 912, 1063,
- 916, 1068,
- 1429, 1553,
- 1538, 1651,
- 1543, 1654,
- 1853, 1896
+ -1, 159,
+ 37, 166,
+ 739, 916,
+ 794, 946,
+ 884, 1035,
+ 888, 1040,
+ 1387, 1511,
+ 1496, 1609,
+ 1501, 1612,
+ 1811, 1854
};
static int parser_goto_row195[] = {
1,
};
static int parser_goto_row196[] = {
1,
- -1, 468
+ -1, 440
};
static int parser_goto_row197[] = {
1,
- -1, 1392
+ -1, 1350
};
static int parser_goto_row198[] = {
1,
};
static int parser_goto_row200[] = {
1,
- -1, 1196
+ -1, 1161
};
static int parser_goto_row201[] = {
1,
4,
-1, 19,
5, 29,
- 18, 100,
- 28, 117
+ 18, 93,
+ 28, 110
};
static int parser_goto_row204[] = {
8,
-1, 20,
5, 30,
- 18, 101,
- 19, 105,
- 28, 118,
- 29, 120,
- 100, 283,
- 117, 292
+ 18, 94,
+ 19, 98,
+ 28, 111,
+ 29, 113,
+ 93, 262,
+ 110, 271
};
static int parser_goto_row205[] = {
1,
- -1, 1507
+ -1, 1465
};
static int parser_goto_row206[] = {
1,
- -1, 1018
+ -1, 990
};
static int parser_goto_row207[] = {
4,
- -1, 1340,
- 1184, 1355,
- 1763, 1821,
- 1827, 1872
+ -1, 1298,
+ 1149, 1313,
+ 1721, 1779,
+ 1785, 1830
};
static int parser_goto_row208[] = {
1,
- -1, 1348
+ -1, 1306
};
static int parser_goto_row209[] = {
1,
- -1, 1498
+ -1, 1456
};
static int parser_goto_row210[] = {
1,
- -1, 1101
+ -1, 1073
};
static int parser_goto_row211[] = {
3,
- -1, 261,
- 355, 570,
- 1084, 1248
+ -1, 240,
+ 327, 542,
+ 1056, 1213
};
static int parser_goto_row212[] = {
1,
- -1, 642
+ -1, 614
};
static int parser_goto_row213[] = {
1,
- -1, 658
+ -1, 630
};
static int parser_goto_row214[] = {
1,
- -1, 270
+ -1, 249
};
static int parser_goto_row215[] = {
1,
- -1, 968
+ -1, 940
};
static int parser_goto_row216[] = {
2,
- -1, 1440,
- 1391, 1526
+ -1, 1398,
+ 1349, 1484
};
static int parser_goto_row217[] = {
1,
- -1, 898
+ -1, 870
};
static int parser_goto_row218[] = {
170,
- -1, 208,
- 13, 89,
- 27, 89,
- 31, 168,
- 33, 89,
- 37, 89,
- 54, 168,
- 104, 89,
- 131, 168,
- 172, 89,
- 224, 469,
- 260, 89,
- 272, 168,
- 274, 168,
- 275, 168,
- 276, 168,
- 277, 168,
- 298, 168,
- 410, 89,
- 491, 688,
- 496, 89,
- 498, 697,
- 521, 168,
- 522, 168,
- 543, 168,
- 545, 168,
- 546, 168,
- 548, 168,
- 549, 168,
- 550, 168,
- 551, 168,
- 552, 168,
- 553, 168,
- 554, 168,
- 555, 168,
- 556, 168,
- 557, 168,
- 558, 168,
- 559, 168,
- 560, 168,
- 561, 168,
- 562, 168,
- 563, 168,
- 564, 168,
- 565, 168,
- 566, 759,
- 569, 89,
- 608, 801,
- 612, 89,
- 615, 89,
- 661, 847,
- 662, 847,
- 690, 865,
- 692, 168,
- 694, 168,
- 726, 759,
- 732, 168,
- 762, 89,
- 766, 942,
- 767, 89,
- 773, 801,
- 812, 963,
- 822, 89,
- 829, 981,
- 831, 469,
- 875, 168,
- 876, 168,
- 877, 168,
- 878, 168,
- 893, 1048,
- 911, 168,
- 912, 942,
- 914, 89,
- 916, 942,
- 925, 168,
- 933, 89,
- 988, 1170,
- 992, 1173,
- 1003, 89,
- 1040, 168,
- 1041, 168,
- 1060, 89,
- 1079, 168,
- 1080, 168,
- 1081, 168,
- 1082, 89,
- 1086, 89,
- 1087, 168,
- 1088, 168,
- 1113, 469,
- 1135, 1170,
- 1136, 1170,
- 1137, 1170,
- 1138, 1170,
- 1182, 688,
- 1186, 89,
- 1196, 1393,
- 1238, 942,
- 1241, 1425,
- 1246, 89,
- 1252, 168,
- 1253, 168,
- 1283, 1170,
- 1285, 1170,
- 1416, 942,
- 1418, 89,
- 1422, 168,
- 1423, 168,
- 1429, 89,
- 1436, 469,
- 1460, 1170,
- 1462, 1170,
- 1463, 1170,
- 1465, 1170,
- 1466, 1170,
- 1467, 1170,
- 1468, 1170,
- 1469, 1170,
- 1470, 1170,
- 1471, 1170,
- 1472, 1170,
- 1473, 1170,
- 1474, 1170,
- 1475, 1170,
- 1476, 1170,
- 1477, 1170,
- 1478, 1170,
- 1479, 1170,
- 1480, 1170,
- 1481, 1170,
- 1482, 1170,
- 1483, 1602,
- 1499, 688,
- 1508, 688,
- 1510, 688,
- 1512, 688,
- 1518, 469,
- 1537, 942,
- 1538, 942,
- 1543, 942,
- 1547, 168,
- 1548, 168,
- 1549, 168,
- 1550, 168,
- 1558, 469,
- 1569, 1602,
- 1573, 1170,
- 1608, 688,
- 1637, 1715,
- 1646, 168,
- 1659, 168,
- 1660, 168,
- 1669, 1740,
- 1681, 1393,
- 1691, 89,
- 1695, 89,
- 1728, 942,
- 1757, 89,
- 1765, 89,
- 1766, 89,
- 1769, 89,
- 1774, 89,
- 1777, 89,
- 1812, 469,
- 1818, 89,
- 1825, 89,
- 1830, 89,
- 1835, 89,
- 1853, 942,
- 1919, 1170
+ -1, 194,
+ 13, 82,
+ 27, 82,
+ 31, 154,
+ 33, 82,
+ 37, 82,
+ 54, 154,
+ 97, 82,
+ 124, 154,
+ 158, 82,
+ 210, 441,
+ 239, 82,
+ 251, 154,
+ 253, 154,
+ 254, 154,
+ 255, 154,
+ 256, 154,
+ 277, 154,
+ 382, 82,
+ 463, 660,
+ 468, 82,
+ 470, 669,
+ 493, 154,
+ 494, 154,
+ 515, 154,
+ 517, 154,
+ 518, 154,
+ 520, 154,
+ 521, 154,
+ 522, 154,
+ 523, 154,
+ 524, 154,
+ 525, 154,
+ 526, 154,
+ 527, 154,
+ 528, 154,
+ 529, 154,
+ 530, 154,
+ 531, 154,
+ 532, 154,
+ 533, 154,
+ 534, 154,
+ 535, 154,
+ 536, 154,
+ 537, 154,
+ 538, 731,
+ 541, 82,
+ 580, 773,
+ 584, 82,
+ 587, 82,
+ 633, 819,
+ 634, 819,
+ 662, 837,
+ 664, 154,
+ 666, 154,
+ 698, 731,
+ 704, 154,
+ 734, 82,
+ 738, 914,
+ 739, 82,
+ 745, 773,
+ 784, 935,
+ 794, 82,
+ 801, 953,
+ 803, 441,
+ 847, 154,
+ 848, 154,
+ 849, 154,
+ 850, 154,
+ 865, 1020,
+ 883, 154,
+ 884, 914,
+ 886, 82,
+ 888, 914,
+ 897, 154,
+ 905, 82,
+ 960, 1135,
+ 964, 1138,
+ 975, 82,
+ 1012, 154,
+ 1013, 154,
+ 1032, 82,
+ 1051, 154,
+ 1052, 154,
+ 1053, 154,
+ 1054, 82,
+ 1058, 82,
+ 1059, 154,
+ 1060, 154,
+ 1085, 441,
+ 1107, 1135,
+ 1108, 1135,
+ 1109, 1135,
+ 1110, 1135,
+ 1147, 660,
+ 1151, 82,
+ 1161, 1351,
+ 1203, 914,
+ 1206, 1383,
+ 1211, 82,
+ 1217, 154,
+ 1218, 154,
+ 1248, 1135,
+ 1250, 1135,
+ 1374, 914,
+ 1376, 82,
+ 1380, 154,
+ 1381, 154,
+ 1387, 82,
+ 1394, 441,
+ 1418, 1135,
+ 1420, 1135,
+ 1421, 1135,
+ 1423, 1135,
+ 1424, 1135,
+ 1425, 1135,
+ 1426, 1135,
+ 1427, 1135,
+ 1428, 1135,
+ 1429, 1135,
+ 1430, 1135,
+ 1431, 1135,
+ 1432, 1135,
+ 1433, 1135,
+ 1434, 1135,
+ 1435, 1135,
+ 1436, 1135,
+ 1437, 1135,
+ 1438, 1135,
+ 1439, 1135,
+ 1440, 1135,
+ 1441, 1560,
+ 1457, 660,
+ 1466, 660,
+ 1468, 660,
+ 1470, 660,
+ 1476, 441,
+ 1495, 914,
+ 1496, 914,
+ 1501, 914,
+ 1505, 154,
+ 1506, 154,
+ 1507, 154,
+ 1508, 154,
+ 1516, 441,
+ 1527, 1560,
+ 1531, 1135,
+ 1566, 660,
+ 1595, 1673,
+ 1604, 154,
+ 1617, 154,
+ 1618, 154,
+ 1627, 1698,
+ 1639, 1351,
+ 1649, 82,
+ 1653, 82,
+ 1686, 914,
+ 1715, 82,
+ 1723, 82,
+ 1724, 82,
+ 1727, 82,
+ 1732, 82,
+ 1735, 82,
+ 1770, 441,
+ 1776, 82,
+ 1783, 82,
+ 1788, 82,
+ 1793, 82,
+ 1811, 914,
+ 1877, 1135
};
static int parser_goto_row219[] = {
78,
- -1, 176,
+ -1, 162,
0, 21,
3, 24,
5, 21,
18, 21,
19, 21,
20, 24,
- 22, 113,
- 25, 114,
+ 22, 106,
+ 25, 107,
28, 21,
29, 21,
30, 24,
33, 24,
37, 24,
- 70, 24,
- 100, 21,
- 101, 24,
- 105, 24,
- 110, 24,
+ 63, 24,
+ 93, 21,
+ 94, 24,
+ 98, 24,
+ 103, 24,
+ 104, 24,
+ 110, 21,
111, 24,
- 117, 21,
- 118, 24,
- 120, 24,
- 177, 361,
- 261, 24,
- 283, 24,
- 289, 24,
- 292, 24,
- 355, 24,
- 410, 24,
- 570, 24,
- 612, 24,
- 766, 24,
- 767, 24,
- 822, 24,
- 863, 24,
- 912, 24,
- 914, 24,
- 916, 24,
- 1003, 24,
- 1014, 24,
- 1018, 21,
- 1082, 24,
- 1084, 24,
- 1086, 24,
- 1175, 24,
- 1184, 24,
- 1186, 24,
- 1238, 24,
- 1246, 24,
- 1248, 24,
- 1340, 24,
- 1355, 24,
- 1416, 24,
- 1429, 24,
- 1504, 24,
- 1537, 24,
- 1538, 24,
- 1543, 24,
- 1615, 24,
- 1691, 24,
- 1695, 24,
- 1728, 24,
- 1757, 24,
- 1763, 24,
- 1765, 24,
- 1766, 24,
- 1769, 24,
- 1774, 24,
- 1777, 24,
- 1818, 24,
- 1821, 24,
- 1825, 24,
- 1827, 24,
- 1830, 24,
- 1835, 24,
- 1853, 24,
- 1872, 24
+ 113, 24,
+ 163, 333,
+ 240, 24,
+ 262, 24,
+ 268, 24,
+ 271, 24,
+ 327, 24,
+ 382, 24,
+ 542, 24,
+ 584, 24,
+ 738, 24,
+ 739, 24,
+ 794, 24,
+ 835, 24,
+ 884, 24,
+ 886, 24,
+ 888, 24,
+ 975, 24,
+ 986, 24,
+ 990, 21,
+ 1054, 24,
+ 1056, 24,
+ 1058, 24,
+ 1140, 24,
+ 1149, 24,
+ 1151, 24,
+ 1203, 24,
+ 1211, 24,
+ 1213, 24,
+ 1298, 24,
+ 1313, 24,
+ 1374, 24,
+ 1387, 24,
+ 1462, 24,
+ 1495, 24,
+ 1496, 24,
+ 1501, 24,
+ 1573, 24,
+ 1649, 24,
+ 1653, 24,
+ 1686, 24,
+ 1715, 24,
+ 1721, 24,
+ 1723, 24,
+ 1724, 24,
+ 1727, 24,
+ 1732, 24,
+ 1735, 24,
+ 1776, 24,
+ 1779, 24,
+ 1783, 24,
+ 1785, 24,
+ 1788, 24,
+ 1793, 24,
+ 1811, 24,
+ 1830, 24
};
static int parser_goto_row220[] = {
75,
- -1, 177,
+ -1, 163,
0, 22,
3, 25,
5, 22,
30, 25,
33, 25,
37, 25,
- 70, 25,
- 100, 22,
- 101, 25,
- 105, 25,
- 110, 25,
+ 63, 25,
+ 93, 22,
+ 94, 25,
+ 98, 25,
+ 103, 25,
+ 104, 25,
+ 110, 22,
111, 25,
- 117, 22,
- 118, 25,
- 120, 25,
- 261, 25,
- 283, 25,
- 289, 25,
- 292, 25,
- 355, 25,
- 410, 25,
- 570, 25,
- 612, 25,
- 766, 25,
- 767, 25,
- 822, 25,
- 863, 25,
- 912, 25,
- 914, 25,
- 916, 25,
- 1003, 25,
- 1014, 25,
- 1018, 22,
- 1082, 25,
- 1084, 25,
- 1086, 25,
- 1175, 25,
- 1184, 25,
- 1186, 25,
- 1238, 25,
- 1246, 25,
- 1248, 25,
- 1340, 25,
- 1355, 25,
- 1416, 25,
- 1429, 25,
- 1504, 25,
- 1537, 25,
- 1538, 25,
- 1543, 25,
- 1615, 25,
- 1691, 25,
- 1695, 25,
- 1728, 25,
- 1757, 25,
- 1763, 25,
- 1765, 25,
- 1766, 25,
- 1769, 25,
- 1774, 25,
- 1777, 25,
- 1818, 25,
- 1821, 25,
- 1825, 25,
- 1827, 25,
- 1830, 25,
- 1835, 25,
- 1853, 25,
- 1872, 25
+ 113, 25,
+ 240, 25,
+ 262, 25,
+ 268, 25,
+ 271, 25,
+ 327, 25,
+ 382, 25,
+ 542, 25,
+ 584, 25,
+ 738, 25,
+ 739, 25,
+ 794, 25,
+ 835, 25,
+ 884, 25,
+ 886, 25,
+ 888, 25,
+ 975, 25,
+ 986, 25,
+ 990, 22,
+ 1054, 25,
+ 1056, 25,
+ 1058, 25,
+ 1140, 25,
+ 1149, 25,
+ 1151, 25,
+ 1203, 25,
+ 1211, 25,
+ 1213, 25,
+ 1298, 25,
+ 1313, 25,
+ 1374, 25,
+ 1387, 25,
+ 1462, 25,
+ 1495, 25,
+ 1496, 25,
+ 1501, 25,
+ 1573, 25,
+ 1649, 25,
+ 1653, 25,
+ 1686, 25,
+ 1715, 25,
+ 1721, 25,
+ 1723, 25,
+ 1724, 25,
+ 1727, 25,
+ 1732, 25,
+ 1735, 25,
+ 1776, 25,
+ 1779, 25,
+ 1783, 25,
+ 1785, 25,
+ 1788, 25,
+ 1793, 25,
+ 1811, 25,
+ 1830, 25
};
const int* const parser_goto_table[] = {
# Gather extra C files generated elsewhere than in super
for f in compiler.extern_bodies do
- if f isa ExternCFile then cfiles.add(f.filename.basename(""))
+ if f isa ExternCFile then cfiles.add(f.filename.basename)
end
# Is there an icon?
var extra_java_files = mmodule.extra_java_files
if extra_java_files != null then for file in extra_java_files do
var path = file.filename
- path.file_copy_to(dir/path.basename(""))
+ path.file_copy_to(dir/path.basename)
end
end
toolcontext.exec_and_check(["ln", "-s", "{share_dir}/libgc/arm/include/gc/",
"{compile_dir}/gc"], "Android project error")
- ### Link to assets (for mnit and others)
- # This will be accessed from `android_project_root`
- var assets_dir
- if compiler.mainmodule.location.file != null then
- # it is a real file, use "{file}/../assets"
- assets_dir = "{compiler.mainmodule.location.file.filename.dirname}/../assets"
- else
- # probably used -m, use "."
- assets_dir = "assets"
+ # Copy assets, resources and libs where expected by the SDK
+
+ var project_root = "."
+ var mproject = compiler.mainmodule.first_real_mmodule.mproject
+ if mproject != null then
+ var root = mproject.root
+ if root != null then
+ var filepath = root.filepath
+ if filepath != null then
+ project_root = filepath / ".."
+ end
+ end
end
+
+ # Link to assets (for mnit and others)
+ var assets_dir = project_root / "assets"
if assets_dir.file_exists then
assets_dir = assets_dir.realpath
var target_assets_dir = "{android_project_root}/assets"
end
end
- ### Copy resources and libs where expected by the SDK
- var project_root
- if compiler.mainmodule.location.file != null then
- # it is a real file, use "{file}/../res"
- project_root = "{compiler.mainmodule.location.file.filename.dirname}/.."
- else
- # probably used -m, use "."
- project_root = "."
- end
-
- # Android resources folder
+ # Copy the res folder
var res_dir = project_root / "res"
if res_dir.file_exists then
# copy the res folder to the compile dir
</resources>""".write_to_file "{android_project_root}/res/values/strings.xml"
end
- # Android libs folder
+ # Copy the libs folder
var libs_dir = project_root / "libs"
if libs_dir.file_exists then
toolcontext.exec_and_check(["cp", "-r", libs_dir, android_project_root], "Android project error")
## Register all source files
for file in cfiles do pbx.add_file new PbxFile(file)
for file in compiler.extern_bodies do
- pbx.add_file new PbxFile(file.filename.basename(""))
+ pbx.add_file new PbxFile(file.filename.basename)
end
## TODO Register asset files
# Gather extra C files generated elsewhere than in super
for f in compiler.extern_bodies do
- if f isa ExternCFile then cfiles.add(f.filename.basename(""))
+ if f isa ExternCFile then cfiles.add(f.filename.basename)
end
# Outname
end
end
-redef class AIntExpr
- redef fun accept_rapid_type_visitor(v)
- do
- allocate_mtype(v)
- end
-end
-
-redef class AByteExpr
+redef class AIntegerExpr
redef fun accept_rapid_type_visitor(v)
do
allocate_mtype(v)
return
end
- # Do we inherit for a constructor?
- var skip = true
- for cd in mclassdef.in_hierarchy.direct_greaters do
- if cd.mclass.kind.need_init then skip = false
- end
- if skip then return
-
# Now we search for the absence of any explicit super-init invocation
# * via a "super"
# * via a call of an other init
import modelize
import local_var_init
+import literal
redef class ToolContext
var typing_phase: Phase = new TypingPhase(self, [flow_phase, modelize_property_phase, local_var_init_phase])
redef class AMethPropdef
redef fun do_typing(modelbuilder: ModelBuilder)
do
- var nblock = self.n_block
- if nblock == null then return
-
var mpropdef = self.mpropdef
if mpropdef == null then return # skip error
variable.declared_type = mtype
end
+ var nblock = self.n_block
+ if nblock == null then return
+
loop
v.dirty = false
v.visit_stmt(nblock)
end
end
-redef class AIntExpr
- redef fun accept_typing(v)
- do
- var mclass = v.get_mclass(self, "Int")
- if mclass == null then return # Forward error
- self.mtype = mclass.mclass_type
- end
-end
-
-redef class AByteExpr
+redef class AIntegerExpr
redef fun accept_typing(v)
do
- var mclass = v.get_mclass(self, "Byte")
+ var mclass: nullable MClass = null
+ if value isa Byte then
+ mclass = v.get_mclass(self, "Byte")
+ else if value isa Int then
+ mclass = v.get_mclass(self, "Int")
+ end
if mclass == null then return # Forward error
self.mtype = mclass.mclass_type
end
if opt_set_dummy_tool.value then
return "DUMMY_TOOL"
end
- return sys.program_name.basename("")
+ return sys.program_name.basename
end
# The identified root directory of the Nit project
class D
super B
super C
- #alt3#var b: Int
+ #alt3,5#var b: Int
#alt4#var b = 11
init do 'd'.output #alt2#
end
super D
super E
init do 'f'.output #alt1,2#
+ #alt5#autoinit c=, e=
end
class G
super E
var g: Int
init do 'g'.output #alt2#
+ #alt5#autoinit c=, e=, g=
end
class H
fun maybe: Bool do return true
-var a = new Container[Int](1)
+var a = new Ref[Int](1)
1.output
for i in a do
2.output
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+import module_0
+import module_1 is conditional(module_2)
+#alt1#import module_1 is conditional
+#alt1#import module_1 is conditional("foo")
+#alt1#import module_1 is conditional(fail)
+#alt1#import fail is conditional(module_2)
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+import module_2 #alt1#
+import base_module_conditional #alt2#
assert 0b1001 == 0x09
assert 0o715 == 0x1CD
-assert 461 == 0o715
+assert 46_1 == 0o715
assert 0b111001101 == 0o715
-assert 256 == 0x100
-assert 0o400 == 256
+assert 2_56 == 0x100
+assert 0o400 == 2_56
assert 0b1_1100_1101 == 0o715
assert 0b1_1100_1101 == 0x1_CD
assert 0b1000_1001 == 0x89
assert 0b1000_1001u8 == 0x89u8
assert 0o151u8 == 0b0110_1001u8
assert 0x69u8 == 0o151u8
+assert 12_125 == 0x2F5D
+assert 0o27_535 == 1212_5
+assert 2_55u8 == 0xFFu8
s = "Je dis «{s}» et redis «{s}» et trois fois de plus : «{s}{s}{s}».\n"
i = i + 1
end
-print(s.length)
+print s.bytelen
s = ["Je dis «", s, "» et redis «", s, "» et trois fois de plus : «", s, s, s, "».\n"].plain_to_s
i = i + 1
end
-print(s.length)
+print(s.bytelen)
end
end
- var t: Array[Int] # The stack of discus (only the diameter is stored).
+ var t = new Array[Int] # The stack of discus (only the diameter is stored).
init full(n: Int)
# Build a new tower with `n' discus.
do
assert positive: n >= 0
- _t = new Array[Int].with_capacity(n)
+ t.enlarge(n)
for i in [0..n[ do
push(n-i)
end
init empty
# Build a empty tower.
do
- _t = new Array[Int]
end
end
# Fiveth way: Join arrays.
# Pro: Sometime efficient on complex concatenation.
# Con: Crazy.
-printn(["The value of a is: ", a.to_s, ".\n"].join(""))
+printn(["The value of a is: ", a.to_s, ".\n"].join)
class Sys
fun main
do
+ print(0)
end
end
a123
end
end
+
+var a = new A
+a.a1
+a.a12
+a.a13
+a.a123
+
+var b = new B
+b.a1
+b.a12
+b.a13
+b.a123
+
+b.all2
+b.all25
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+import module_0
blink
input
first_letter_last_letter
+fibonacci_word
+shootout_nsieve
+test_ropebuffer
--no-color -W test_advice_repeated_types.nit
+--no-color base_simple3.nit; echo $?
+--no-color error_mod_unk.nit; echo $?
blink
input
first_letter_last_letter
+fibonacci_word
+shootout_nsieve
+test_ropebuffer
-alt/base_attr3_alt1.nit:22,3--4: Error: method or variable `a1=` unknown in `B`.
-alt/base_attr3_alt1.nit:24,3--4: Error: method or variable `a2=` unknown in `B`.
alt/base_attr3_alt1.nit:25,3--4: Error: method or variable `a3` unknown in `B`.
alt/base_attr3_alt1.nit:26,3--4: Error: method or variable `a3=` unknown in `B`.
alt/base_attr3_alt1.nit:31,3--4: Error: method or variable `a6` unknown in `B`.
-alt/base_attr3_alt2.nit:49,5--6: Error: method `a1=` does not exists in `A`.
+alt/base_attr3_alt2.nit:49,5--6: Error: method `a1=` is protected and can only accessed by `self`.
alt/base_attr3_alt2.nit:50,5--6: Error: method `a2` is protected and can only accessed by `self`.
-alt/base_attr3_alt2.nit:51,5--6: Error: method `a2=` does not exists in `A`.
+alt/base_attr3_alt2.nit:51,5--6: Error: method `a2=` is protected and can only accessed by `self`.
alt/base_attr3_alt2.nit:52,5--6: Error: method `a3` does not exists in `A`.
alt/base_attr3_alt2.nit:53,5--6: Error: method `a3=` does not exists in `A`.
alt/base_attr3_alt2.nit:56,5--6: Error: method `a5` is protected and can only accessed by `self`.
-alt/base_attr3_alt3.nit:80,4--5: Error: method `a1=` does not exists in `A`.
+alt/base_attr3_alt3.nit:80,4--5: Error: method `a1=` is protected and can only accessed by `self`.
alt/base_attr3_alt3.nit:81,4--5: Error: method `a2` is protected and can only accessed by `self`.
-alt/base_attr3_alt3.nit:82,4--5: Error: method `a2=` does not exists in `A`.
+alt/base_attr3_alt3.nit:82,4--5: Error: method `a2=` is protected and can only accessed by `self`.
alt/base_attr3_alt3.nit:83,4--5: Error: method `a3` does not exists in `A`.
alt/base_attr3_alt3.nit:84,4--5: Error: method `a3=` does not exists in `A`.
alt/base_attr3_alt3.nit:87,4--5: Error: method `a5` is protected and can only accessed by `self`.
-alt/base_attr3_alt4.nit:110,4--5: Error: method `a1=` does not exists in `B`.
+alt/base_attr3_alt4.nit:110,4--5: Error: method `a1=` is protected and can only accessed by `self`.
alt/base_attr3_alt4.nit:111,4--5: Error: method `a2` is protected and can only accessed by `self`.
-alt/base_attr3_alt4.nit:112,4--5: Error: method `a2=` does not exists in `B`.
+alt/base_attr3_alt4.nit:112,4--5: Error: method `a2=` is protected and can only accessed by `self`.
alt/base_attr3_alt4.nit:113,4--5: Error: method `a3` does not exists in `B`.
alt/base_attr3_alt4.nit:114,4--5: Error: method `a3=` does not exists in `B`.
alt/base_attr3_alt4.nit:117,4--5: Error: method `a5` is protected and can only accessed by `self`.
-base_error_literal.nit:17,9--11: Error: invalid binary literal
-base_error_literal.nit:18,9--11: Error: invalid hexadecimal literal
-base_error_literal.nit:19,9--11: Error: invalid octal literal
+base_error_literal.nit:17,9--11: Error: invalid literal `0b_`
+base_error_literal.nit:18,9--11: Error: invalid literal `0x_`
+base_error_literal.nit:19,9--11: Error: invalid literal `0o_`
-alt/base_init_basic_alt3.nit:47,7: Error: conflict for inherited inits base_init_basic_alt3#E#init(c=, e=) and base_init_basic_alt3#D#init(c=, b=)
-alt/base_init_basic_alt3.nit:53,7: Error: conflict for inherited inits base_init_basic_alt3#E#init(c=, e=) and base_init_basic_alt3#D#init(c=, b=)
+alt/base_init_basic_alt3.nit:47,7: Error: cannot generate automatic init for class F. Conflict in the order in inherited initializers base_init_basic_alt3#E#init(c=, e=) and base_init_basic_alt3#D#init(c=, b=). Use `autoinit` to order initializers. eg `autoinit c=, b=, e=`
+alt/base_init_basic_alt3.nit:54,7: Error: cannot generate automatic init for class G. Conflict in the order in inherited initializers base_init_basic_alt3#E#init(c=, e=) and base_init_basic_alt3#D#init(c=, b=). Use `autoinit` to order initializers. eg `autoinit c=, b=, e=, g=`
--- /dev/null
+alt/base_init_basic_alt5.nit:79,9--11: Error: expected 2 argument(s) for `init(c: Int, b: Int)`; got 1. See introduction at `standard::Object::init`.
1
2
+1
2
3
+1
2
+1
2
5
+1
2
6
1
2
+1
2
3
+1
2
+1
2
5
+1
2
6
A B3
A B4y
C1 C2
-A2z C3z
-D1 B1 A B2 D2 D3
+C1 C2 A2z C3z
+D1 B1 C1 C2 A B2 D2 D3
A B3
A B4y
C1 C2
-A2z C3z
+C1 C2 A2z C3z
C1 C2 D1 D2 D3
A B3
A B4y
C1 C2
-A2z C3z
-D1 B1 A B2 D2 C1 C2 D3
+C1 C2 A2z C3z
+D1 B1 C1 C2 A B2 D2 C1 C2 D3
A B3
A B4y
C1 C2
-A2z C3z
-D1 C1 C2 B1 A B2 D2 D3
+C1 C2 A2z C3z
+D1 C1 C2 B1 C1 C2 A B2 D2 D3
A B3
A B4y
C1 C2
-A2z C3z
-D1 B1 A B2 D2 B1 A B2 D3
+C1 C2 A2z C3z
+D1 B1 C1 C2 A B2 D2 B1 C1 C2 A B2 D3
A
-a
+Aa
A1
-a2
+A1a2
A13
--- /dev/null
+alt/base_module_conditional_alt1.nit:17,20--30: Syntax Error: `conditional` expects module identifiers as arguments.
+alt/base_module_conditional_alt1.nit:18,32--36: Syntax Error: `conditional` expects module identifier as arguments.
+alt/base_module_conditional_alt1.nit:19,32--35: Error: cannot find module `fail` from `base_module_conditional_alt1`. Tried: ., ../lib/standard, ../lib/standard/collection, alt, ../lib, ../contrib.
+alt/base_module_conditional_alt1.nit:20,8--11: Error: cannot find module `fail` from `base_module_conditional_alt1`. Tried: ., ../lib/standard, ../lib/standard/collection, alt, ../lib, ../contrib.
--- /dev/null
+1
+1
+12
+1
+13
+1
+123
+1
+1
+1
+12
+2
+13
+1
+123
+2
+1
+1
+12
+2
+13
+1
+123
+2
+250
+2
+1
+1
+12
+2
+13
+1
+123
+2
--- /dev/null
+Usage: checker xml_file
--- /dev/null
+1.846
+1.846
-../lib/standard/kernel.nit:29,1--100,3: Error: `kernel#Object` does not specialize `module_0#Object`. Possible duplication of the root class `Object`?
-../lib/standard/kernel.nit:102,1--116,3: Error: `kernel#Sys` does not specialize `module_0#Object`. Possible duplication of the root class `Object`?
-../lib/standard/kernel.nit:129,1--187,3: Error: `kernel#Comparable` does not specialize `module_0#Object`. Possible duplication of the root class `Object`?
-../lib/standard/kernel.nit:189,1--226,3: Error: `kernel#Discrete` does not specialize `module_0#Object`. Possible duplication of the root class `Object`?
-../lib/standard/kernel.nit:228,1--245,3: Error: `kernel#Cloneable` does not specialize `module_0#Object`. Possible duplication of the root class `Object`?
-../lib/standard/kernel.nit:247,1--302,3: Error: `kernel#Numeric` does not specialize `module_0#Object`. Possible duplication of the root class `Object`?
-../lib/standard/kernel.nit:308,1--331,3: Error: `kernel#Bool` does not specialize `module_0#Object`. Possible duplication of the root class `Object`?
-../lib/standard/kernel.nit:333,1--415,3: Error: `kernel#Float` does not specialize `module_0#Object`. Possible duplication of the root class `Object`?
-../lib/standard/kernel.nit:417,1--519,3: Error: `kernel#Byte` does not specialize `module_0#Object`. Possible duplication of the root class `Object`?
-../lib/standard/kernel.nit:521,1--712,3: Error: `kernel#Int` does not specialize `module_0#Object`. Possible duplication of the root class `Object`?
-../lib/standard/kernel.nit:714,1--854,3: Error: `kernel#Char` does not specialize `module_0#Object`. Possible duplication of the root class `Object`?
-../lib/standard/kernel.nit:856,1--863,3: Error: `kernel#Pointer` does not specialize `module_0#Object`. Possible duplication of the root class `Object`?
+../lib/standard/kernel.nit:32,1--225,3: Error: `kernel#Object` does not specialize `module_0#Object`. Possible duplication of the root class `Object`?
+../lib/standard/kernel.nit:227,1--300,3: Error: `kernel#Sys` does not specialize `module_0#Object`. Possible duplication of the root class `Object`?
+../lib/standard/kernel.nit:313,1--371,3: Error: `kernel#Comparable` does not specialize `module_0#Object`. Possible duplication of the root class `Object`?
+../lib/standard/kernel.nit:373,1--410,3: Error: `kernel#Discrete` does not specialize `module_0#Object`. Possible duplication of the root class `Object`?
+../lib/standard/kernel.nit:412,1--429,3: Error: `kernel#Cloneable` does not specialize `module_0#Object`. Possible duplication of the root class `Object`?
+../lib/standard/kernel.nit:431,1--486,3: Error: `kernel#Numeric` does not specialize `module_0#Object`. Possible duplication of the root class `Object`?
+../lib/standard/kernel.nit:492,1--515,3: Error: `kernel#Bool` does not specialize `module_0#Object`. Possible duplication of the root class `Object`?
+../lib/standard/kernel.nit:517,1--599,3: Error: `kernel#Float` does not specialize `module_0#Object`. Possible duplication of the root class `Object`?
+../lib/standard/kernel.nit:601,1--703,3: Error: `kernel#Byte` does not specialize `module_0#Object`. Possible duplication of the root class `Object`?
+../lib/standard/kernel.nit:705,1--896,3: Error: `kernel#Int` does not specialize `module_0#Object`. Possible duplication of the root class `Object`?
+../lib/standard/kernel.nit:898,1--1051,3: Error: `kernel#Char` does not specialize `module_0#Object`. Possible duplication of the root class `Object`?
+../lib/standard/kernel.nit:1053,1--1060,3: Error: `kernel#Pointer` does not specialize `module_0#Object`. Possible duplication of the root class `Object`?
error_ref_attr.nit:20,15--17: Redef Error: expected `B` return type; got `Int`.
+error_ref_attr.nit:20,15--17: Redef Error: expected `B` type for parameter `a'; got `Int`.
Montpellier
-*** Entrepôt Lunel ***
-L'entrepôt est vide
+*** Entrep�t Lunel ***
+L'entrep�t est vide
Carotte:15
Carotte:20
-* Rayon : Légumes
+* Rayon : L�gumes
-* Rayon : Légumes
+* Rayon : L�gumes
Carotte:15
Navet:10
Chou:3
-* Rayon : Légumes
+* Rayon : L�gumes
Carotte:15
Navet:10
Chou:13
Courge:1
-*** Entrepôt Lunel ***
-* Rayon : Légumes
+*** Entrep�t Lunel ***
+* Rayon : L�gumes
Carotte:15
Navet:10
Chou:13
Courge:1
-* Rayon Réfrigéré : Surgelés - t° max : -5
+* Rayon R�frig�r� : Surgel�s - t� max : -5
Pizza:12
-Poisson pané:4
+Poisson pan�:4
--- /dev/null
+1 1 0.0000000000000000 1
+2 1 0.0000000000000000 0
+3 2 1.0000000000000000 01
+4 3 0.9182958340544894 010
+5 5 0.9709505944546686 01001
+6 8 0.9544340029249650 01001010
+7 13 0.9612366047228760 0100101001001
+8 21 0.9587118829771316 010010100100101001010
+9 34 0.9596868937742170 0100101001001010010100100101001001
+10 55 0.9593160320543778 ...
+11 89 0.9594579158386696 ...
+12 144 0.9594037542210228 ...
+13 233 0.9594244469559864 ...
+14 377 0.9594165437404406 ...
+15 610 0.9594195626031440 ...
+16 987 0.9594184095152248 ...
+17 1597 0.9594188499578102 ...
+18 2584 0.9594186817240320 ...
+19 4181 0.9594187459836638 ...
+20 6765 0.9594187214386752 ...
+21 10946 0.9594187308140276 ...
+22 17711 0.9594187272329618 ...
+23 28657 0.9594187286008076 ...
+24 46368 0.9594187280783368 ...
+25 75025 0.9594187282779028 ...
+26 121393 0.9594187282016752 ...
+27 196418 0.9594187282307916 ...
+28 317811 0.9594187282196702 ...
+29 514229 0.9594187282239182 ...
+30 832040 0.9594187282222962 ...
+31 1346269 0.9594187282229156 ...
+32 2178309 0.9594187282226794 ...
+33 3524578 0.9594187282227690 ...
+34 5702887 0.9594187282227344 ...
+35 9227465 0.9594187282227478 ...
+36 14930352 0.9594187282227430 ...
+37 24157817 0.9594187282227448 ...
--- /dev/null
+1
+1
+12
+1
+13
+1
+123
+1
+1
+1
+12
+2
+13
+1
+123
+2
+1
+1
+12
+2
+13
+1
+123
+2
+250
+2
+1
+1
+12
+2
+13
+1
+123
+2
-Runtime error: Cast failed. Expected `OTHER`, got `Float` (../lib/standard/kernel.nit:542)
+Runtime error: Cast failed. Expected `OTHER`, got `Float` (../lib/standard/kernel.nit:726)
11
21
31
-Runtime error: Cast failed. Expected `OTHER`, got `Float` (../lib/standard/kernel.nit:542)
+Runtime error: Cast failed. Expected `OTHER`, got `Float` (../lib/standard/kernel.nit:726)
11
21
31
-Runtime error: Cast failed. Expected `OTHER`, got `Float` (../lib/standard/kernel.nit:542)
+Runtime error: Cast failed. Expected `OTHER`, got `Float` (../lib/standard/kernel.nit:726)
11
21
31
--- /dev/null
+# Src:
+<A: true a 0.123 1234 asdf false p4ssw0rd>
+# Dst:
+<A: true a 0.123 1234 asdf false p4ssw0rd>
+
+# Src:
+<B: <A: false b 123.123 2345 hjkl false p4ssw0rd> 1111 qwer>
+# Dst:
+<B: <A: false b 123.123 2345 hjkl false p4ssw0rd> 1111 qwer>
+
+# Src:
+<C: <A: true a 0.123 1234 asdf false p4ssw0rd> <B: <A: false b 123.123 2345 hjkl false p4ssw0rd> 1111 qwer>>
+# Dst:
+<C: <A: true a 0.123 1234 asdf false p4ssw0rd> <B: <A: false b 123.123 2345 hjkl false p4ssw0rd> 1111 qwer>>
+
+# Src:
+<D: <B: <A: false b 123.123 2345 new line ->
+<- false p4ssw0rd> 1111 f"\r\/> true>
+# Dst:
+<D: <B: <A: false b 123.123 2345 new line ->
+<- false p4ssw0rd> 1111 f"\r\/> true>
+
+Deserialization Error: Doesn't know how to deserialize class "Array", Deserialization Error: Wrong type on `E::a` expected `PlaceHolderTypeWhichShouldNotExist`, got `null`, Deserialization Error: Doesn't know how to deserialize class "Array", Deserialization Error: Wrong type on `E::b` expected `PlaceHolderTypeWhichShouldNotExist`, got `null`
+# Src:
+<E: a: hello, 1234, 123.4; b: hella, 2345, 234.5>
+# Dst:
+<E: a: hello, 1234, 123.4; b: hella, 2345, 234.5>
+
+Deserialization Error: Doesn't know how to deserialize class "F"
+Deserialization Error: Doesn't know how to deserialize class "F"
+Deserialization Error: Doesn't know how to deserialize class "HashSet", Deserialization Error: Wrong type on `G::hs` expected `PlaceHolderTypeWhichShouldNotExist`, got `null`, Deserialization Error: Doesn't know how to deserialize class "ArraySet", Deserialization Error: Wrong type on `G::s` expected `Set[String]`, got `null`, Deserialization Error: Doesn't know how to deserialize class "HashMap", Deserialization Error: Wrong type on `G::hm` expected `PlaceHolderTypeWhichShouldNotExist`, got `null`, Deserialization Error: Doesn't know how to deserialize class "ArrayMap", Deserialization Error: Wrong type on `G::am` expected `PlaceHolderTypeWhichShouldNotExist`, got `null`
+# Src:
+<G: hs: -1, 0; s: one, two; hm: one. 1, two. 2; am: three. 3, four. 4>
+# Dst:
+<G: hs: -1, 0; s: one, two; hm: one. 1, two. 2; am: three. 3, four. 4>
+
-Runtime error: Aborted (../lib/serialization/serialization.nit:120)
# Nit:
<A: true a 0.123 1234 asdf false p4ssw0rd>
<D: <B: <A: false b 123.123 2345 new line ->
<- false p4ssw0rd> 1111 f"\r\/> true>
-Error: doesn't know how to deserialize class "Array"
+# Nit:
+<E: a: hello, 1234, 123.4; b: hella, 2345, 234.5>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "E", "a": {"__kind": "obj", "__id": 1, "__class": "Array", "__items": ["hello", 1234, 123.4]}, "b": {"__kind": "obj", "__id": 2, "__class": "Array", "__items": ["hella", 2345, 234.5]}}
+
+# Back in Nit:
+<E: a: hello, 1234, 123.4; b: hella, 2345, 234.5>
+
+# Nit:
+<E: 2222>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "F", "n": 2222}
+
+# Back in Nit:
+null
+
+# Nit:
+<E: 33.33>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "F", "n": 33.33}
+
+# Back in Nit:
+null
+
+# Nit:
+<G: hs: -1, 0; s: one, two; hm: one. 1, two. 2; am: three. 3, four. 4>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "G", "hs": {"__kind": "obj", "__id": 1, "__class": "HashSet", "__items": [-1, 0]}, "s": {"__kind": "obj", "__id": 2, "__class": "ArraySet", "__items": ["one", "two"]}, "hm": {"__kind": "obj", "__id": 3, "__class": "HashMap", "__length": 2, "__keys": ["one", "two"], "__values": [1, 2]}, "am": {"__kind": "obj", "__id": 4, "__class": "ArrayMap", "__length": 2, "__keys": ["three", "four"], "__values": ["3", "4"]}}
+
+# Back in Nit:
+<G: hs: -1, 0; s: one, two; hm: one. 1, two. 2; am: three. 3, four. 4>
+
NativeString
-N
+0x4e
Nit
NativeArray
3
NativeString
-N
+0x4e
Nit
NativeArray
3
+Empty README for group `module_1` (readme-warning)
+Empty README for group `module_0` (readme-warning)
+Errors: 0. Warnings: 2.
class_module_95d0-__Int.html
class_module_95d0-__Object.html
class_module_95d0-__Sys.html
class_module_95d1-__B.html
css/
dep_class_module_95d0-__Int.dot
-dep_class_module_95d0-__Int.map
-dep_class_module_95d0-__Int.png
-dep_class_module_95d0-__Int.s.dot
dep_class_module_95d0-__Object.dot
-dep_class_module_95d0-__Object.map
-dep_class_module_95d0-__Object.png
-dep_class_module_95d0-__Object.s.dot
dep_class_module_95d0-__Sys.dot
-dep_class_module_95d0-__Sys.map
-dep_class_module_95d0-__Sys.png
-dep_class_module_95d0-__Sys.s.dot
dep_class_module_95d1-__A.dot
-dep_class_module_95d1-__A.map
-dep_class_module_95d1-__A.png
-dep_class_module_95d1-__A.s.dot
dep_class_module_95d1-__B.dot
-dep_class_module_95d1-__B.map
-dep_class_module_95d1-__B.png
-dep_class_module_95d1-__B.s.dot
dep_module_module_95d0-.dot
-dep_module_module_95d0-.map
-dep_module_module_95d0-.png
-dep_module_module_95d0-.s.dot
dep_module_module_95d1-.dot
-dep_module_module_95d1-.map
-dep_module_module_95d1-.png
-dep_module_module_95d1-.s.dot
group_module_95d0.html
group_module_95d1.html
index.html
+Empty README for group `base_attr_nullable` (readme-warning)
+Errors: 0. Warnings: 1.
class_base_attr_nullable-__Bar.html
class_base_attr_nullable-__Bool.html
class_base_attr_nullable-__Foo.html
class_base_attr_nullable-__Sys.html
css/
dep_class_base_attr_nullable-__Bar.dot
-dep_class_base_attr_nullable-__Bar.map
-dep_class_base_attr_nullable-__Bar.png
-dep_class_base_attr_nullable-__Bar.s.dot
dep_class_base_attr_nullable-__Bool.dot
-dep_class_base_attr_nullable-__Bool.map
-dep_class_base_attr_nullable-__Bool.png
-dep_class_base_attr_nullable-__Bool.s.dot
dep_class_base_attr_nullable-__Foo.dot
-dep_class_base_attr_nullable-__Foo.map
-dep_class_base_attr_nullable-__Foo.png
-dep_class_base_attr_nullable-__Foo.s.dot
dep_class_base_attr_nullable-__Int.dot
-dep_class_base_attr_nullable-__Int.map
-dep_class_base_attr_nullable-__Int.png
-dep_class_base_attr_nullable-__Int.s.dot
dep_class_base_attr_nullable-__Integer.dot
-dep_class_base_attr_nullable-__Integer.map
-dep_class_base_attr_nullable-__Integer.png
-dep_class_base_attr_nullable-__Integer.s.dot
dep_class_base_attr_nullable-__Object.dot
-dep_class_base_attr_nullable-__Object.map
-dep_class_base_attr_nullable-__Object.png
-dep_class_base_attr_nullable-__Object.s.dot
dep_class_base_attr_nullable-__Sys.dot
-dep_class_base_attr_nullable-__Sys.map
-dep_class_base_attr_nullable-__Sys.png
-dep_class_base_attr_nullable-__Sys.s.dot
dep_module_base_attr_nullable-.dot
-dep_module_base_attr_nullable-.map
-dep_module_base_attr_nullable-.png
-dep_module_base_attr_nullable-.s.dot
group_base_attr_nullable.html
index.html
js/
less/
module_base_attr_nullable-.html
property_base_attr_nullable-__Bar__a3.html
+property_base_attr_nullable-__Bar__a3_61d.html
property_base_attr_nullable-__Foo__a1.html
+property_base_attr_nullable-__Foo__a1_61d.html
property_base_attr_nullable-__Foo__a2.html
+property_base_attr_nullable-__Foo__a2_61d.html
property_base_attr_nullable-__Foo__nop.html
property_base_attr_nullable-__Foo__run.html
property_base_attr_nullable-__Foo__run_other.html
property_base_attr_nullable-__Integer__init.html
property_base_attr_nullable-__Integer__output.html
property_base_attr_nullable-__Integer__val.html
+property_base_attr_nullable-__Integer__val_61d.html
property_base_attr_nullable-__Object__init.html
property_base_attr_nullable-__Sys__main.html
quicksearch-list.js
+Empty README for group `base_attr_nullable` (readme-warning)
+Errors: 0. Warnings: 1.
class_base_attr_nullable-__Bar.html
class_base_attr_nullable-__Bool.html
class_base_attr_nullable-__Foo.html
class_base_attr_nullable-__Sys.html
css/
dep_class_base_attr_nullable-__Bar.dot
-dep_class_base_attr_nullable-__Bar.map
-dep_class_base_attr_nullable-__Bar.png
-dep_class_base_attr_nullable-__Bar.s.dot
dep_class_base_attr_nullable-__Bool.dot
-dep_class_base_attr_nullable-__Bool.map
-dep_class_base_attr_nullable-__Bool.png
-dep_class_base_attr_nullable-__Bool.s.dot
dep_class_base_attr_nullable-__Foo.dot
-dep_class_base_attr_nullable-__Foo.map
-dep_class_base_attr_nullable-__Foo.png
-dep_class_base_attr_nullable-__Foo.s.dot
dep_class_base_attr_nullable-__Int.dot
-dep_class_base_attr_nullable-__Int.map
-dep_class_base_attr_nullable-__Int.png
-dep_class_base_attr_nullable-__Int.s.dot
dep_class_base_attr_nullable-__Integer.dot
-dep_class_base_attr_nullable-__Integer.map
-dep_class_base_attr_nullable-__Integer.png
-dep_class_base_attr_nullable-__Integer.s.dot
dep_class_base_attr_nullable-__Object.dot
-dep_class_base_attr_nullable-__Object.map
-dep_class_base_attr_nullable-__Object.png
-dep_class_base_attr_nullable-__Object.s.dot
dep_class_base_attr_nullable-__Sys.dot
-dep_class_base_attr_nullable-__Sys.map
-dep_class_base_attr_nullable-__Sys.png
-dep_class_base_attr_nullable-__Sys.s.dot
dep_module_base_attr_nullable-.dot
-dep_module_base_attr_nullable-.map
-dep_module_base_attr_nullable-.png
-dep_module_base_attr_nullable-.s.dot
group_base_attr_nullable.html
index.html
js/
## projects.section
### test_prog.definition
+ReadmePage test_prog
+ # mdarticle-0
+
+ReadmePage game
+ # mdarticle-0
+
+ReadmePage platform
+ # mdarticle-0
+
+ReadmePage rpg
+ # mdarticle-0
+
SearchPage Index
# index.article
## test_prog__rpg.concern
## test_prog__rpg__careers.concern
### test_prog__rpg__careers__Career__endurance_bonus.definition
+ ### test_prog__rpg__careers__Career__endurance_bonus_61d.definition
### test_prog__rpg__careers__Career__intelligence_bonus.definition
+ ### test_prog__rpg__careers__Career__intelligence_bonus_61d.definition
### test_prog__rpg__careers__Career__strength_bonus.definition
+ ### test_prog__rpg__careers__Career__strength_bonus_61d.definition
MPropertyPage endurance_bonus
# endurance_bonus.section
## test_prog__rpg__careers__Career__endurance_bonus.intro
+MPropertyPage endurance_bonus=
+ # endurance_bonus=.section
+ ## test_prog__rpg__careers__Career__endurance_bonus_61d.intro
+
MPropertyPage intelligence_bonus
# intelligence_bonus.section
## test_prog__rpg__careers__Career__intelligence_bonus.intro
+MPropertyPage intelligence_bonus=
+ # intelligence_bonus=.section
+ ## test_prog__rpg__careers__Career__intelligence_bonus_61d.intro
+
MPropertyPage strength_bonus
# strength_bonus.section
## test_prog__rpg__careers__Career__strength_bonus.intro
+MPropertyPage strength_bonus=
+ # strength_bonus=.section
+ ## test_prog__rpg__careers__Career__strength_bonus_61d.intro
+
MClassPage Magician
# Magician.section
## test_prog__rpg__careers__Magician.intro
## test_prog__rpg.concern
## test_prog__rpg__character.concern
### test_prog__rpg__character__Character__age.definition
+ ### test_prog__rpg__character__Character__age_61d.definition
### test_prog__rpg__character__Character__career.definition
### test_prog__rpg__character__Character__career_61d.definition
### test_prog__rpg__character__Character__health.definition
+ ### test_prog__rpg__character__Character__health_61d.definition
### test_prog__rpg__character__Character__max_health.definition
### test_prog__rpg__character__Character__name.definition
+ ### test_prog__rpg__character__Character__name_61d.definition
### test_prog__rpg__character__Character__quit.definition
### test_prog__rpg__character__Character__race.definition
+ ### test_prog__rpg__character__Character__race_61d.definition
### test_prog__rpg__character__Character__sex.definition
+ ### test_prog__rpg__character__Character__sex_61d.definition
### test_prog__rpg__character__Character__total_endurance.definition
### test_prog__rpg__character__Character__total_intelligence.definition
### test_prog__rpg__character__Character__total_strengh.definition
# age.section
## test_prog__rpg__character__Character__age.intro
+MPropertyPage age=
+ # age=.section
+ ## test_prog__rpg__character__Character__age_61d.intro
+
MPropertyPage career
# career.section
## test_prog__rpg__character__Character__career.intro
# health.section
## test_prog__rpg__character__Character__health.intro
+MPropertyPage health=
+ # health=.section
+ ## test_prog__rpg__character__Character__health_61d.intro
+
MPropertyPage max_health
# max_health.section
## test_prog__rpg__character__Character__max_health.intro
# name.section
## test_prog__rpg__character__Character__name.intro
+MPropertyPage name=
+ # name=.section
+ ## test_prog__rpg__character__Character__name_61d.intro
+
MPropertyPage quit
# quit.section
## test_prog__rpg__character__Character__quit.intro
# race.section
## test_prog__rpg__character__Character__race.intro
+MPropertyPage race=
+ # race=.section
+ ## test_prog__rpg__character__Character__race_61d.intro
+
MPropertyPage sex
# sex.section
## test_prog__rpg__character__Character__sex.intro
+MPropertyPage sex=
+ # sex=.section
+ ## test_prog__rpg__character__Character__sex_61d.intro
+
MPropertyPage total_endurance
# total_endurance.section
## test_prog__rpg__character__Character__total_endurance.intro
## test_prog__rpg.concern
## test_prog__rpg__races.concern
### test_prog__rpg__races__Race__base_endurance.definition
+ ### test_prog__rpg__races__Race__base_endurance_61d.definition
### test_prog__rpg__races__Race__base_intelligence.definition
+ ### test_prog__rpg__races__Race__base_intelligence_61d.definition
### test_prog__rpg__races__Race__base_strength.definition
+ ### test_prog__rpg__races__Race__base_strength_61d.definition
MPropertyPage base_endurance
# base_endurance.section
## test_prog__rpg__races__Race__base_endurance.intro
+MPropertyPage base_endurance=
+ # base_endurance=.section
+ ## test_prog__rpg__races__Race__base_endurance_61d.intro
+
MPropertyPage base_intelligence
# base_intelligence.section
## test_prog__rpg__races__Race__base_intelligence.intro
+MPropertyPage base_intelligence=
+ # base_intelligence=.section
+ ## test_prog__rpg__races__Race__base_intelligence_61d.intro
+
MPropertyPage base_strength
# base_strength.section
## test_prog__rpg__races__Race__base_strength.intro
+MPropertyPage base_strength=
+ # base_strength=.section
+ ## test_prog__rpg__races__Race__base_strength_61d.intro
+
MModulePage rpg
# rpg.section
## test_prog__rpg__rpg.intro
#### test_prog__rpg__rpg.imports
#### test_prog__rpg__rpg.clients
-Generated 81 pages
+Generated 96 pages
list:
- MPropertyPage: 47 (58.02%)
- MClassPage: 20 (24.69%)
- MModulePage: 8 (9.87%)
- MGroupPage: 4 (4.93%)
- SearchPage: 1 (1.23%)
- OverviewPage: 1 (1.23%)
-Found 160 mentities
+ MPropertyPage: 58 (60.41%)
+ MClassPage: 20 (20.83%)
+ MModulePage: 8 (8.33%)
+ MGroupPage: 4 (4.16%)
+ ReadmePage: 4 (4.16%)
+ SearchPage: 1 (1.04%)
+ OverviewPage: 1 (1.04%)
+Found 182 mentities
list:
- MMethodDef: 57 (35.62%)
- MMethod: 46 (28.75%)
- MClassDef: 22 (13.75%)
- MClass: 20 (12.50%)
- MModule: 8 (5.00%)
- MGroup: 4 (2.50%)
- MVirtualTypeDef: 1 (0.62%)
- MVirtualTypeProp: 1 (0.62%)
- MProject: 1 (0.62%)
+ MMethodDef: 68 (37.36%)
+ MMethod: 57 (31.31%)
+ MClassDef: 22 (12.08%)
+ MClass: 20 (10.98%)
+ MModule: 8 (4.39%)
+ MGroup: 4 (2.19%)
+ MVirtualTypeDef: 1 (0.54%)
+ MVirtualTypeProp: 1 (0.54%)
+ MProject: 1 (0.54%)
quicksearch-list.js
nitiWiki
name: wiki2
config: ../contrib/nitiwiki/tests/wiki1/config2.ini
-url: http://localhost/
There is modified files:
+ pages
-Render section out
+Render section pages -> out
+Render article index -> ../contrib/nitiwiki/tests/wiki1/out/index.html
+Render article sitemap -> ../contrib/nitiwiki/tests/wiki1/out/sitemap.html
--- /dev/null
+Usage: [OPTION]... [ARG]...
+Use --help for help
--- /dev/null
+1
+2
+1
+2
--- /dev/null
+Runtime error: Cast failed (alt/base_autocast_array_alt2.nit:45)
+10
+10
--- /dev/null
+FlatString
+Int
+Test
+Test
+MyArray
+TotoToto
--- /dev/null
+alt/base_dead_code_alt1.nit:23,3: Warning: expression is not null, since it is a `Array[Int]`.
+alt/base_dead_code_alt1.nit:34,10--21: Warning: expression is already a `String`.
+Runtime error: Cast failed. Expected `String`, got `Array` (alt/base_dead_code_alt1.nit:22)
+0
+1
+1
--- /dev/null
+3
+2
+!3
+!2
+!100
--- /dev/null
+3
+100
+!3
+!2
+!100
--- /dev/null
+Runtime error: Cast failed (alt/base_gen_variance_alt3.nit:66)
+2
+20
+2
+20
+20
--- /dev/null
+Runtime error: Cast failed (alt/base_gen_variance_alt5.nit:99)
+2
+20
+2
+20
+2
+20
+2
+20
--- /dev/null
+Runtime error: Cast failed (alt/base_gen_variance_alt6.nit:105)
+2
+20
+2
+20
+2
+20
+2
+20
--- /dev/null
+2
+20
+2
+20
+2
+20
+2
+20
+2
+20
--- /dev/null
+2
+20
+2
+20
+2
+20
+2
+20
+2
+20
--- /dev/null
+base_isa_gen1.nit:62,8--14: Warning: expression is already a `A` since it is a `F`.
+base_isa_gen1.nit:65,8--30: Warning: expression is already a `D[Object, Object]` since it is a `G[Object]`.
+base_isa_gen1.nit:66,8--30: Warning: expression is already a `D[Object, Object]` since it is a `E[F]`.
+Runtime error: Assert failed (base_isa_gen1.nit:68)
--- /dev/null
+base_isa_gen4.nit:34,8--15: Warning: expression is already a `A` since it is a `B[Canard]`.
+base_isa_gen4.nit:36,8--23: Warning: expression is already a `B[Animal]` since it is a `B[Canard]`.
+base_isa_gen4.nit:40,8--26: Warning: expression is already a `B[B[Canard]]`.
+base_isa_gen4.nit:42,8--26: Warning: expression is already a `B[B[Animal]]` since it is a `B[B[Canard]]`.
+Runtime error: Assert failed (base_isa_gen4.nit:37)
--- /dev/null
+base_isa_gen5.nit:39,8--15: Warning: expression is already a `A` since it is a `B[Canard]`.
+base_isa_gen5.nit:41,8--23: Warning: expression is already a `B[Animal]` since it is a `B[Canard]`.
+base_isa_gen5.nit:46,8--26: Warning: expression is already a `B[B[Canard]]`.
+base_isa_gen5.nit:48,8--26: Warning: expression is already a `B[B[Animal]]` since it is a `B[B[Canard]]`.
+Runtime error: Assert failed (base_isa_gen5.nit:42)
--- /dev/null
+Runtime error: Assert failed (base_isa_gen7.nit:49)
--- /dev/null
+base_isa_nullable1.nit:39,8--15: Warning: expression is already a `A` since it is a `B[Integer]`.
+base_isa_nullable1.nit:41,8--25: Warning: expression is already a `B[Discrete]` since it is a `B[Integer]`.
+base_isa_nullable1.nit:46,8--27: Warning: expression is already a `B[B[Integer]]`.
+base_isa_nullable1.nit:48,8--28: Warning: expression is already a `B[B[Discrete]]` since it is a `B[B[Integer]]`.
+base_isa_nullable1.nit:50,8--34: Warning: expression is already a `B[nullable Discrete]` since it is a `B[Discrete]`.
+Runtime error: Assert failed (base_isa_nullable1.nit:42)
--- /dev/null
+base_isa_nullable2.nit:27,8--23: Warning: expression is already a `nullable A` since it is a `A`.
+base_isa_nullable2.nit:29,8--31: Warning: expression is already a `nullable B[Object]` since it is a `B[Object]`.
+base_isa_nullable2.nit:30,8--40: Warning: expression is already a `nullable B[nullable Object]` since it is a `nullable B[Object]`.
+base_isa_nullable2.nit:33,8--31: Warning: expression is already a `C[nullable Object]`.
+Runtime error: Assert failed (base_isa_nullable2.nit:32)
--- /dev/null
+Runtime error: Assert failed (base_isa_vt3.nit:42)
--- /dev/null
+Runtime error: Assert failed (base_isa_vt_ft.nit:55)
--- /dev/null
+Array
+[1,5,6]
+Range
+[1,2,3,4,5]
--- /dev/null
+Char
+Int
+Test
+Test
+MyArray
+0
--- /dev/null
+X
+X
+X
+Y
+Y
+Y
+Y
+A
+G
+B
+G
--- /dev/null
+X
+X
+X
+Y
+Y
+Y
+Y
+A
+G
+B
+G
--- /dev/null
+Runtime error: Cast failed (alt/base_attr_gen_alt1.nit:26)
--- /dev/null
+1
+1
+a1
+a
--- /dev/null
+true
+true
+false
+true
+true
--- /dev/null
+true
+true
+true
+true
+true
--- /dev/null
+A
+true
+true
+false
+
+G
+true
+true
+false
+true
+false
+
+G
+A
+false
+true
+true
+false
+false
+false
+false
+true
+false
--- /dev/null
+Runtime error: Cast failed (alt/base_gen_reassign_alt1.nit:42)
+11
+21
+31
+12
+22
+32
--- /dev/null
+Runtime error: Cast failed (alt/base_gen_reassign_alt2.nit:45)
+11
+21
+31
+12
+22
+32
--- /dev/null
+Runtime error: Cast failed. Expected `OTHER`, got `Float` (../lib/standard/kernel.nit:542)
+11
+21
+31
+12
+22
+32
+12
+22
+32
--- /dev/null
+Runtime error: Cast failed. Expected `OTHER`, got `Float` (../lib/standard/kernel.nit:542)
+11
+21
+31
+12
+22
+32
+12
+22
+32
--- /dev/null
+Runtime error: Cast failed. Expected `OTHER`, got `Float` (../lib/standard/kernel.nit:542)
+11
+21
+31
+12
+22
+32
+12
+22
+32
--- /dev/null
+2
+100
+!2
+!100
--- /dev/null
+2
+2
+!2
+!100
--- /dev/null
+true
+true
+true
+true
+true
+true
+true
+true
+
+true
+true
+true
+true
+true
+true
+true
+true
+
+true
+true
+false
+true
+true
+true
+true
+true
+
+true
+true
+true
+true
+true
+true
+true
+true
+
+true
+true
+true
+true
+true
+true
+true
+true
+
+true
+true
+true
+true
+true
+true
+true
+true
+
+true
+true
+true
+true
+true
+true
+true
+true
+
--- /dev/null
+true
+true
+true
+true
+true
+true
+
+false
+true
+true
+true
+true
+true
+
+false
+true
+true
+true
+true
+true
+
+false
+true
+true
+true
+true
+true
+
+false
+true
+true
+true
+true
+true
+
+false
+true
+true
+true
+true
+true
+
+false
+false
+false
+false
+false
+false
+
--- /dev/null
+Array
+ Int
+ Bool
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Bool
+ Bool
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
--- /dev/null
+Array
+ Int
+ Bool
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Bool
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Bool
+ Bool
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
--- /dev/null
+Array
+ Int
+ Bool
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Bool
+ Bool
+Array
+ Bool
+ Bool
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
--- /dev/null
+Array
+ Int
+ Bool
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Bool
+ Bool
+Array
+ Bool
+ Bool
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
--- /dev/null
+Array
+ Int
+ Bool
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Bool
+ Bool
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
--- /dev/null
+Array
+ Int
+ Bool
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Bool
+ Bool
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Int
+ Int
+Array
+ Bool
+ Bool
+Array
+ Int
+ Int
--- /dev/null
+2
+2
+!2
+!100
--- /dev/null
+true
+true
+true
+
+true
+true
+true
+
+true
+true
+true
+
+true
+true
+true
+
+
+true
+true
+true
+
+true
+true
+true
+
+true
+true
+true
+
+true
+true
+true
+
+
+true
+true
+true
+
+true
+true
+true
+
+true
+true
+true
+
+true
+true
+true
+
+
--- /dev/null
+Runtime error: Aborted (../lib/serialization/serialization.nit:111)
+# Nit:
+<A: true a 0.123 1234 asdf false p4ssw0rd>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "A", "b": true, "c": {"__kind": "char", "__val": "a"}, "f": 0.123, "i": 1234, "s": "asdf", "n": null}
+
+# Back in Nit:
+<A: true a 0.123 1234 asdf false p4ssw0rd>
+
+# Nit:
+<B: <A: false b 123.123 2345 hjkl false p4ssw0rd> 1111 qwer>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "B", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "hjkl", "n": null, "ii": 1111, "ss": "qwer"}
+
+# Back in Nit:
+<B: <A: false b 123.123 2345 hjkl false p4ssw0rd> 1111 qwer>
+
+# Nit:
+<C: <A: true a 0.123 1234 asdf false p4ssw0rd> <B: <A: false b 123.123 2345 hjkl false p4ssw0rd> 1111 qwer>>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "C", "a": {"__kind": "obj", "__id": 1, "__class": "A", "b": true, "c": {"__kind": "char", "__val": "a"}, "f": 0.123, "i": 1234, "s": "asdf", "n": null}, "b": {"__kind": "obj", "__id": 2, "__class": "B", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "hjkl", "n": null, "ii": 1111, "ss": "qwer"}, "aa": {"__kind": "ref", "__id": 1}}
+
+# Back in Nit:
+<C: <A: true a 0.123 1234 asdf false p4ssw0rd> <B: <A: false b 123.123 2345 hjkl false p4ssw0rd> 1111 qwer>>
+
+# Nit:
+<D: <B: <A: false b 123.123 2345 new line ->
+<- false p4ssw0rd> 1111 f"\r\/> true>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "D", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "new line ->\n<-", "n": null, "ii": 1111, "ss": "\tf\"\r\\\/", "d": {"__kind": "ref", "__id": 0}}
+
+# Back in Nit:
+<D: <B: <A: false b 123.123 2345 new line ->
+<- false p4ssw0rd> 1111 f"\r\/> true>
+
+Error: doesn't know how to deserialize class "Array"
--- /dev/null
+FlatString
+FlatString
+Class
+Class
+
+XObject
+XObject
+XClass
+Class
+
+YObject
+YObject
+YClass
+YClass
--- /dev/null
+NativeString
+N
+Nit
+NativeArray
+3
+1
+1,10,100
+1
+1
--- /dev/null
+NativeString
+N
+Nit
+NativeArray
+3
+1
+1,true,100
+1
+1
--- /dev/null
+# Nit:
+<A: true a 0.123 1234 asdf false>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "A", "b": true, "c": {"__kind": "char", "__val": "a"}, "f": 0.123, "i": 1234, "s": "asdf", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}}
+
+# Nit:
+<B: <A: false b 123.123 2345 hjkl false> 1111 qwer>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "B", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "hjkl", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "ii": 1111, "ss": "qwer"}
+
+# Nit:
+<C: <A: true a 0.123 1234 asdf false> <B: <A: false b 123.123 2345 hjkl false> 1111 qwer>>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "C", "a": {"__kind": "obj", "__id": 1, "__class": "A", "b": true, "c": {"__kind": "char", "__val": "a"}, "f": 0.123, "i": 1234, "s": "asdf", "n": null, "array": {"__kind": "obj", "__id": 2, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}}, "b": {"__kind": "obj", "__id": 3, "__class": "B", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "hjkl", "n": null, "array": {"__kind": "obj", "__id": 4, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "ii": 1111, "ss": "qwer"}, "aa": {"__kind": "ref", "__id": 1}}
+
+# Nit:
+<D: <B: <A: false b 123.123 2345 new line ->
+<- false> 1111 f"\r\/> true>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "D", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "new line ->\n<-", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "ii": 1111, "ss": "\tf\"\r\\\/", "d": {"__kind": "ref", "__id": 0}}
+
--- /dev/null
+alt/test_serialization_alt2.nit:22,1--47,3: Warning: superfluous use of `serialize`.
+alt/test_serialization_alt2.nit:70,1--86,3: Warning: superfluous use of `auto_serializable`.
+alt/test_serialization_alt2.nit:88,1--96,3: Warning: superfluous use of `auto_serializable`.
+# Nit:
+<A: true a 0.123 1234 asdf false>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "A", "b": true, "f": 0.123, "i": 1234, "s": "asdf", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}}
+
+# Nit:
+<B: <A: false b 123.123 2345 hjkl false> 1111 qwer>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "B", "b": false, "f": 123.123, "i": 2345, "s": "hjkl", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}}
+
+# Nit:
+<C: <A: true a 0.123 1234 asdf false> <B: <A: false b 123.123 2345 hjkl false> 1111 qwer>>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "C", "a": {"__kind": "obj", "__id": 1, "__class": "A", "b": true, "f": 0.123, "i": 1234, "s": "asdf", "n": null, "array": {"__kind": "obj", "__id": 2, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}}, "b": {"__kind": "obj", "__id": 3, "__class": "B", "b": false, "f": 123.123, "i": 2345, "s": "hjkl", "n": null, "array": {"__kind": "obj", "__id": 4, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}}, "aa": {"__kind": "ref", "__id": 1}}
+
+# Nit:
+<D: <B: <A: false b 123.123 2345 new line ->
+<- false> 1111 f"\r\/> true>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "D", "b": false, "f": 123.123, "i": 2345, "s": "new line ->\n<-", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "d": {"__kind": "ref", "__id": 0}}
+
--- /dev/null
+alt/test_serialization_alt3.nit:49,1--68,3: Warning: superfluous use of `noserialize`.
+# Nit:
+<A: true a 0.123 1234 asdf false>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "A", "b": true, "c": {"__kind": "char", "__val": "a"}, "f": 0.123, "i": 1234, "s": "asdf", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}}
+
+# Nit:
+<B: <A: false b 123.123 2345 hjkl false> 1111 qwer>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "B", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "hjkl", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}}
+
+# Nit:
+<C: <A: true a 0.123 1234 asdf false> <B: <A: false b 123.123 2345 hjkl false> 1111 qwer>>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "C", "a": {"__kind": "obj", "__id": 1, "__class": "A", "b": true, "c": {"__kind": "char", "__val": "a"}, "f": 0.123, "i": 1234, "s": "asdf", "n": null, "array": {"__kind": "obj", "__id": 2, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}}, "b": {"__kind": "obj", "__id": 3, "__class": "B", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "hjkl", "n": null, "array": {"__kind": "obj", "__id": 4, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}}, "aa": {"__kind": "ref", "__id": 1}}
+
+# Nit:
+<D: <B: <A: false b 123.123 2345 new line ->
+<- false> 1111 f"\r\/> true>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "D", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "new line ->\n<-", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "d": {"__kind": "ref", "__id": 0}}
+
--- /dev/null
+alt/test_serialization_alt4.nit:29,2--31,26: Warning: superfluous use of `serialize`.
+# Nit:
+<A: true a 0.123 1234 asdf false>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "A", "b": true, "c": {"__kind": "char", "__val": "a"}, "f": 0.123, "i": 1234, "s": "asdf", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}}
+
+# Nit:
+<B: <A: false b 123.123 2345 hjkl false> 1111 qwer>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "B", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "hjkl", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "ii": 1111, "ss": "qwer"}
+
+# Nit:
+<C: <A: true a 0.123 1234 asdf false> <B: <A: false b 123.123 2345 hjkl false> 1111 qwer>>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "C", "a": {"__kind": "obj", "__id": 1, "__class": "A", "b": true, "c": {"__kind": "char", "__val": "a"}, "f": 0.123, "i": 1234, "s": "asdf", "n": null, "array": {"__kind": "obj", "__id": 2, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}}, "b": {"__kind": "obj", "__id": 3, "__class": "B", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "hjkl", "n": null, "array": {"__kind": "obj", "__id": 4, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "ii": 1111, "ss": "qwer"}, "aa": {"__kind": "ref", "__id": 1}}
+
+# Nit:
+<D: <B: <A: false b 123.123 2345 new line ->
+<- false> 1111 f"\r\/> true>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "D", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "new line ->\n<-", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "ii": 1111, "ss": "\tf\"\r\\\/", "d": {"__kind": "ref", "__id": 0}}
+
--- /dev/null
+alt/test_serialization_alt5.nit:22,1--47,3: Warning: duplicated annotation `serialize`.
+# Nit:
+<A: true a 0.123 1234 asdf false>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "A", "b": true, "c": {"__kind": "char", "__val": "a"}, "f": 0.123, "i": 1234, "s": "asdf", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}}
+
+# Nit:
+<B: <A: false b 123.123 2345 hjkl false> 1111 qwer>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "B", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "hjkl", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "ii": 1111, "ss": "qwer"}
+
+# Nit:
+<C: <A: true a 0.123 1234 asdf false> <B: <A: false b 123.123 2345 hjkl false> 1111 qwer>>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "C", "a": {"__kind": "obj", "__id": 1, "__class": "A", "b": true, "c": {"__kind": "char", "__val": "a"}, "f": 0.123, "i": 1234, "s": "asdf", "n": null, "array": {"__kind": "obj", "__id": 2, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}}, "b": {"__kind": "obj", "__id": 3, "__class": "B", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "hjkl", "n": null, "array": {"__kind": "obj", "__id": 4, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "ii": 1111, "ss": "qwer"}, "aa": {"__kind": "ref", "__id": 1}}
+
+# Nit:
+<D: <B: <A: false b 123.123 2345 new line ->
+<- false> 1111 f"\r\/> true>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "D", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "new line ->\n<-", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "ii": 1111, "ss": "\tf\"\r\\\/", "d": {"__kind": "ref", "__id": 0}}
+
--- /dev/null
+# Nit:
+<A: true a 0.123 1234 asdf false>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "A", "b": true, "c": {"__kind": "char", "__val": "a"}, "f": 0.123, "i": 1234, "s": "asdf", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}}
+
+# Nit:
+<B: <A: false b 123.123 2345 hjkl false> 1111 qwer>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "B", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "hjkl", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "ii": 1111, "ss": "qwer"}
+
+# Nit:
+<C: <A: true a 0.123 1234 asdf false> <B: <A: false b 123.123 2345 hjkl false> 1111 qwer>>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "C", "a": {"__kind": "obj", "__id": 1, "__class": "A", "b": true, "c": {"__kind": "char", "__val": "a"}, "f": 0.123, "i": 1234, "s": "asdf", "n": null, "array": {"__kind": "obj", "__id": 2, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}}, "b": {"__kind": "obj", "__id": 3, "__class": "B", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "hjkl", "n": null, "array": {"__kind": "obj", "__id": 4, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "ii": 1111, "ss": "qwer"}, "aa": {"__kind": "ref", "__id": 1}}
+
+# Nit:
+<D: <B: <A: false b 123.123 2345 new line ->
+<- false> 1111 f"\r\/> true>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "D", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "new line ->\n<-", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "ii": 1111, "ss": "\tf\"\r\\\/", "d": {"__kind": "ref", "__id": 0}}
+
--- /dev/null
+# Nit:
+<A: true a 0.123 1234 asdf false>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "A", "b": true, "c": {"__kind": "char", "__val": "a"}, "f": 0.123, "i": 1234, "s": "asdf", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "iii": 6789, "sss": "redef"}
+
+# Nit:
+<B: <A: false b 123.123 2345 hjkl false> 1111 qwer>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "B", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "hjkl", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "iii": 6789, "sss": "redef", "ii": 1111, "ss": "qwer"}
+
+# Nit:
+<C: <A: true a 0.123 1234 asdf false> <B: <A: false b 123.123 2345 hjkl false> 1111 qwer>>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "C", "a": {"__kind": "obj", "__id": 1, "__class": "A", "b": true, "c": {"__kind": "char", "__val": "a"}, "f": 0.123, "i": 1234, "s": "asdf", "n": null, "array": {"__kind": "obj", "__id": 2, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "iii": 6789, "sss": "redef"}, "b": {"__kind": "obj", "__id": 3, "__class": "B", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "hjkl", "n": null, "array": {"__kind": "obj", "__id": 4, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "iii": 6789, "sss": "redef", "ii": 1111, "ss": "qwer"}, "aa": {"__kind": "ref", "__id": 1}}
+
+# Nit:
+<D: <B: <A: false b 123.123 2345 new line ->
+<- false> 1111 f"\r\/> true>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "D", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "new line ->\n<-", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "iii": 6789, "sss": "redef", "ii": 1111, "ss": "\tf\"\r\\\/", "d": {"__kind": "ref", "__id": 0}}
+
--- /dev/null
+# Nit:
+<A: true a 0.123 1234 asdf false>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "A", "b": true, "c": {"__kind": "char", "__val": "a"}, "f": 0.123, "i": 1234, "s": "asdf", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}}
+
+# Nit:
+<B: <A: false b 123.123 2345 hjkl false> 1111 qwer>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "B", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "hjkl", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "ii": 1111, "ss": "qwer", "ffff": 6.789, "bbbb": false}
+
+# Nit:
+<C: <A: true a 0.123 1234 asdf false> <B: <A: false b 123.123 2345 hjkl false> 1111 qwer>>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "C", "a": {"__kind": "obj", "__id": 1, "__class": "A", "b": true, "c": {"__kind": "char", "__val": "a"}, "f": 0.123, "i": 1234, "s": "asdf", "n": null, "array": {"__kind": "obj", "__id": 2, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}}, "b": {"__kind": "obj", "__id": 3, "__class": "B", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "hjkl", "n": null, "array": {"__kind": "obj", "__id": 4, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "ii": 1111, "ss": "qwer", "ffff": 6.789, "bbbb": false}, "aa": {"__kind": "ref", "__id": 1}}
+
+# Nit:
+<D: <B: <A: false b 123.123 2345 new line ->
+<- false> 1111 f"\r\/> true>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "D", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "new line ->\n<-", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "ii": 1111, "ss": "\tf\"\r\\\/", "ffff": 6.789, "bbbb": false, "d": {"__kind": "ref", "__id": 0}}
+
--- /dev/null
+# Nit:
+<A: true a 0.123 1234 asdf false>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "A", "b": true, "c": {"__kind": "char", "__val": "a"}, "f": 0.123, "i": 1234, "s": "asdf", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "iii": 6789, "sss": "redef"}
+
+# Nit:
+<B: <A: false b 123.123 2345 hjkl false> 1111 qwer>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "B", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "hjkl", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "iii": 6789, "sss": "redef", "ii": 1111, "ss": "qwer", "ffff": 6.789, "bbbb": false}
+
+# Nit:
+<C: <A: true a 0.123 1234 asdf false> <B: <A: false b 123.123 2345 hjkl false> 1111 qwer>>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "C", "a": {"__kind": "obj", "__id": 1, "__class": "A", "b": true, "c": {"__kind": "char", "__val": "a"}, "f": 0.123, "i": 1234, "s": "asdf", "n": null, "array": {"__kind": "obj", "__id": 2, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "iii": 6789, "sss": "redef"}, "b": {"__kind": "obj", "__id": 3, "__class": "B", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "hjkl", "n": null, "array": {"__kind": "obj", "__id": 4, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "iii": 6789, "sss": "redef", "ii": 1111, "ss": "qwer", "ffff": 6.789, "bbbb": false}, "aa": {"__kind": "ref", "__id": 1}}
+
+# Nit:
+<D: <B: <A: false b 123.123 2345 new line ->
+<- false> 1111 f"\r\/> true>
+
+# Json:
+{"__kind": "obj", "__id": 0, "__class": "D", "b": false, "c": {"__kind": "char", "__val": "b"}, "f": 123.123, "i": 2345, "s": "new line ->\n<-", "n": null, "array": {"__kind": "obj", "__id": 1, "__class": "Array", "__length": 3, "__items": [88, "hello", null]}, "iii": 6789, "sss": "redef", "ii": 1111, "ss": "\tf\"\r\\\/", "ffff": 6.789, "bbbb": false, "d": {"__kind": "ref", "__id": 0}}
+
AListExprs: 19 (7.03%)
ACallExpr: 18 (6.66%)
TClassid: 15 (5.55%)
- TNumber: 10 (3.70%)
- ADecIntExpr: 10 (3.70%)
+ TInteger: 10 (3.70%)
+ AIntegerExpr: 10 (3.70%)
AType: 9 (3.33%)
TKwend: 8 (2.96%)
ASignature: 8 (2.96%)
A: 1 (11.11%)
# Mendel metrics
- large mclasses (threshold: 3.354)
+ large mclasses (threshold: 3.915)
+ C: 5
+ B: 4
Sys: 4
- budding mclasses (threshold: 4.177)
- Sys: 5.0
- blooming mclasses (threshold: 14.626)
- Sys: 20.0
+ budding mclasses (threshold: 5.033)
+ blooming mclasses (threshold: 21.874)
+ C: 25.0
--- Detection of the usage of covariance static type conformance ---
-- Total --
- Kinds of the subtype -
sum: 0
## Callsites
-* 22 live callsites
+* 23 live callsites
MMethodDef locally designated (by number of CallSites)
- population: 13
+ population: 14
minimum value: 1
maximum value: 10
- total value: 22
- average value: 1.69
+ total value: 23
+ average value: 1.64
distribution:
- <=1: sub-population=12 (92.30%); cumulated value=12 (54.54%)
- <=16: sub-population=1 (7.69%); cumulated value=10 (45.45%)
+ <=1: sub-population=13 (92.85%); cumulated value=13 (56.52%)
+ <=16: sub-population=1 (7.14%); cumulated value=10 (43.47%)
list:
- base_simple3#Int#output: 10 (45.45%)
- base_simple3#B#val: 1 (4.54%)
- base_simple3#B#val=: 1 (4.54%)
- base_simple3#C#val2: 1 (4.54%)
- base_simple3#C#val1: 1 (4.54%)
+ base_simple3#Int#output: 10 (43.47%)
+ base_simple3#B#val: 1 (4.34%)
+ base_simple3#B#val=: 1 (4.34%)
+ base_simple3#Object#init: 1 (4.34%)
+ base_simple3#C#val2: 1 (4.34%)
...
- base_simple3#A#init: 1 (4.54%)
- base_simple3#Sys#baz: 1 (4.54%)
- base_simple3#Sys#bar: 1 (4.54%)
- base_simple3#Sys#foo: 1 (4.54%)
- base_simple3#C#init: 1 (4.54%)
+ base_simple3#A#init: 1 (4.34%)
+ base_simple3#Sys#baz: 1 (4.34%)
+ base_simple3#Sys#bar: 1 (4.34%)
+ base_simple3#Sys#foo: 1 (4.34%)
+ base_simple3#C#init: 1 (4.34%)
MMethodDef possibly invoked at runtime (by number of CallSites)
- population: 13
+ population: 14
minimum value: 1
maximum value: 10
- total value: 22
- average value: 1.69
+ total value: 23
+ average value: 1.64
distribution:
- <=1: sub-population=12 (92.30%); cumulated value=12 (54.54%)
- <=16: sub-population=1 (7.69%); cumulated value=10 (45.45%)
+ <=1: sub-population=13 (92.85%); cumulated value=13 (56.52%)
+ <=16: sub-population=1 (7.14%); cumulated value=10 (43.47%)
list:
- base_simple3#Int#output: 10 (45.45%)
- base_simple3#B#val: 1 (4.54%)
- base_simple3#B#val=: 1 (4.54%)
- base_simple3#C#val2: 1 (4.54%)
- base_simple3#C#val1: 1 (4.54%)
+ base_simple3#Int#output: 10 (43.47%)
+ base_simple3#B#val: 1 (4.34%)
+ base_simple3#B#val=: 1 (4.34%)
+ base_simple3#Object#init: 1 (4.34%)
+ base_simple3#C#val2: 1 (4.34%)
...
- base_simple3#A#init: 1 (4.54%)
- base_simple3#Sys#baz: 1 (4.54%)
- base_simple3#Sys#bar: 1 (4.54%)
- base_simple3#Sys#foo: 1 (4.54%)
- base_simple3#C#init: 1 (4.54%)
+ base_simple3#A#init: 1 (4.34%)
+ base_simple3#Sys#baz: 1 (4.34%)
+ base_simple3#Sys#bar: 1 (4.34%)
+ base_simple3#Sys#foo: 1 (4.34%)
+ base_simple3#C#init: 1 (4.34%)
class_hierarchy.dot
classdef_hierarchy.dot
inheritance/
-../lib/standard/bytes.nit:51,7--19: Documentation warning: Undocumented property `with_capacity`
-../lib/standard/bytes.nit:164,6--13: Documentation warning: Undocumented property `to_bytes`
-../lib/standard/stream.nit:425,6--17: Documentation warning: Undocumented property `buffer_reset`
-../lib/standard/file.nit:455,6--19: Documentation warning: Undocumented property `read_all_bytes`
+../lib/standard/stream.nit:451,6--17: Documentation warning: Undocumented property `buffer_reset`
test_advice_repeated_types.nit:36,15--20: Warning: useless type repetition on redefined attribute `_a`
test_advice_repeated_types.nit:37,18--20: Warning: useless type repetition on parameter `b1` for redefined method `b`
test_advice_repeated_types.nit:38,18--20: Warning: useless type repetition on parameter `c1` for redefined method `c`
--- /dev/null
+error_mod_unk.nit:17,8--11: Error: cannot find module `dfgd` from `error_mod_unk`. Tried: ../lib, ../contrib, ..
+1
-test_nitunit3/README.md: Error: there is a block of invalid Nit code, thus not considered a nitunit. To suppress this warning, enclose the block with a fence tagged `nitish` or `raw` (see `man nitdoc`). At 1,2--4: Syntax Error: unexpected malformed character '\]..
-test_nitunit3/README.md: ERROR: nitunit.test_nitunit3.<group> (in .nitunit/test_nitunit3-0.nit): Runtime error: Assert failed (.nitunit/test_nitunit3-0.nit:7)
+test_nitunit3/README.md:1,0--13,0: Error: there is a block of invalid Nit code, thus not considered a nitunit. To suppress this warning, enclose the block with a fence tagged `nitish` or `raw` (see `man nitdoc`). At 1,2--4: Syntax Error: unexpected malformed character '\]..
+test_nitunit3/README.md:1,0--13,0: ERROR: nitunit.test_nitunit3.<group> (in .nitunit/test_nitunit3-0.nit): Runtime error: Assert failed (.nitunit/test_nitunit3-0.nit:7)
DocUnits:
Entities: 2; Documented ones: 2; With nitunits: 3; Failures: 2
TestSuites:
No test cases found
Class suites: 0; Test Cases: 0; Failures: 0
-<testsuites><testsuite package="test_nitunit3"><testcase classname="nitunit.test_nitunit3" name="<group>"><failure message="test_nitunit3/README.md: Invalid block of code. At 1,2--4: Syntax Error: unexpected malformed character '\].."></failure><system-err></system-err><system-out>assert false
+<testsuites><testsuite package="test_nitunit3"><testcase classname="nitunit.test_nitunit3" name="<group>"><failure message="test_nitunit3/README.md:1,0--13,0: Invalid block of code. At 1,2--4: Syntax Error: unexpected malformed character '\].."></failure><system-err></system-err><system-out>assert false
assert true
</system-out><error message="Runtime error: Assert failed (.nitunit/test_nitunit3-0.nit:7)
"></error></testcase></testsuite><testsuite package="test_nitunit3"><testcase classname="nitunit.test_nitunit3.<module>" name="<module>"><system-err></system-err><system-out>assert true
-test_nitunit_md.md: ERROR: nitunit.<file>.test_nitunit_md.md (in .nitunit/file-0.nit): Runtime error: Assert failed (.nitunit/file-0.nit:8)
+test_nitunit_md.md:1,0--15,0: ERROR: nitunit.<file>.test_nitunit_md.md:1,0--15,0 (in .nitunit/file-0.nit): Runtime error: Assert failed (.nitunit/file-0.nit:8)
DocUnits:
Entities: 1; Documented ones: 1; With nitunits: 1; Failures: 1
TestSuites:
No test cases found
Class suites: 0; Test Cases: 0; Failures: 0
-<testsuites><testsuite package="test_nitunit_md.md"><testcase classname="nitunit.<file>" name="test_nitunit_md.md"><system-err></system-err><system-out>var a = 1
+<testsuites><testsuite package="test_nitunit_md.md:1,0--15,0"><testcase classname="nitunit.<file>" name="test_nitunit_md.md:1,0--15,0"><system-err></system-err><system-out>var a = 1
assert 1 == 1
assert false
</system-out><error message="Runtime error: Assert failed (.nitunit/file-0.nit:8)
--- /dev/null
+((data "quoted data" 123.00 4.50) (data (!@# (4.50) "(more" "data)")))
+(
+ (
+ data
+ "quoted data"
+ 123.00
+ 4.50
+ )
+ (
+ data
+ (
+ !@#
+ (
+ 4.50
+ )
+ "(more"
+ "data)"
+ )
+ )
+)
--- /dev/null
+Primes up to 40000 4203
+Primes up to 20000 2262
+Primes up to 10000 1229
--- /dev/null
+Mine
+Default
+Other
+Default
+
+Mine
+Default
+Other
+Default
+Yet Another
+
+Mine
+Default
+Other
+Default
+
+Mine
+Default
+Other
+Default
+
+Mine
+Default
+Other
+Other
+Yet Another
no error
hello
-77
+0x4d
1.235
1.235
123456789
no error
hello
-77
+0x4d
144545136640.0
0.0
1571011930645069824
no error
hello
-77
+0x4d
144545136640.0
0.0
1571011930645069824
no error
hello
-77
+0x4d
1.235
1.235
123456789
--- /dev/null
+# Src:
+<A: true a 0.123 1234 asdf false p4ssw0rd>
+# Dst:
+<A: true a 0.123 1234 asdf false p4ssw0rd>
+
+# Src:
+<B: <A: false b 123.123 2345 hjkl false p4ssw0rd> 1111 qwer>
+# Dst:
+<B: <A: false b 123.123 2345 hjkl false p4ssw0rd> 1111 qwer>
+
+# Src:
+<C: <A: true a 0.123 1234 asdf false p4ssw0rd> <B: <A: false b 123.123 2345 hjkl false p4ssw0rd> 1111 qwer>>
+# Dst:
+<C: <A: true a 0.123 1234 asdf false p4ssw0rd> <B: <A: false b 123.123 2345 hjkl false p4ssw0rd> 1111 qwer>>
+
+# Src:
+<D: <B: <A: false b 123.123 2345 new line ->
+<- false p4ssw0rd> 1111 f"\r\/> true>
+# Dst:
+<D: <B: <A: false b 123.123 2345 new line ->
+<- false p4ssw0rd> 1111 f"\r\/> true>
+
--- /dev/null
+# Src:
+<A: true a 0.123 1234 asdf false p4ssw0rd>
+# Dst:
+<A: true a 0.123 1234 asdf false p4ssw0rd>
+
+# Src:
+<B: <A: false b 123.123 2345 hjkl false p4ssw0rd> 1111 qwer>
+# Dst:
+<B: <A: false b 123.123 2345 hjkl false p4ssw0rd> 1111 qwer>
+
+# Src:
+<C: <A: true a 0.123 1234 asdf false p4ssw0rd> <B: <A: false b 123.123 2345 hjkl false p4ssw0rd> 1111 qwer>>
+# Dst:
+<C: <A: true a 0.123 1234 asdf false p4ssw0rd> <B: <A: false b 123.123 2345 hjkl false p4ssw0rd> 1111 qwer>>
+
+# Src:
+<D: <B: <A: false b 123.123 2345 new line ->
+<- false p4ssw0rd> 1111 f"\r\/> true>
+# Dst:
+<D: <B: <A: false b 123.123 2345 new line ->
+<- false p4ssw0rd> 1111 f"\r\/> true>
+
+# Src:
+<E: a: hello, 1234, 123.4; b: hella, 2345, 234.5>
+# Dst:
+<E: a: hello, 1234, 123.4; b: hella, 2345, 234.5>
+
+# Src:
+<E: 2222>
+# Dst:
+<E: 2222>
+
+# Src:
+<E: 33.33>
+# Dst:
+<E: 33.33>
+
+# Src:
+<G: hs: -1, 0; s: one, two; hm: one. 1, two. 2; am: three. 3, four. 4>
+# Dst:
+<G: hs: -1, 0; s: one, two; hm: one. 1, two. 2; am: three. 3, four. 4>
+
--- /dev/null
+Deserialization Error: Doesn't know how to deserialize class "NoSerializeClass"
--- /dev/null
+Char 0 = 𐏓
+Char 1 = A
+Char 2 = A
+Char 3 = A
+Char 4 = A
+Char 5 = A
+Char 6 = A
+Char 7 = A
+Char 8 = A
+Char 9 = A
+Char 10 = A
+Char 11 = A
+Char 12 = A
+Char 13 = A
+Char 14 = A
+Char 15 = A
+Char 16 = A
+Char 17 = A
+Char 18 = A
+Char 19 = A
+Char 20 = A
+Char 21 = A
+Char 22 = A
+Char 23 = A
+Char 24 = A
+Char 25 = A
+Char 26 = A
+Char 27 = A
+Char 28 = A
+Char 29 = A
+Char 30 = A
+Char 31 = A
+Char 32 = Z
+Char 33 = A
+Char 34 = A
+Char 35 = A
+Char 36 = A
+Char 37 = A
+Char 38 = A
+Char 39 = A
+Char 40 = A
+Char 41 = A
+Char 42 = A
+Char 43 = A
+Char 44 = A
+Char 45 = A
+Char 46 = A
+Char 47 = A
+Char 48 = A
+Char 49 = A
+Char 50 = A
+Char 51 = A
+Char 52 = A
+Char 53 = A
+Char 54 = A
+Char 55 = A
+Char 56 = A
+Char 57 = A
+Char 58 = A
+Char 59 = A
+Char 60 = A
+Char 61 = A
+Char 62 = A
+Char 63 = あ
+Byte 0 = 0xf0
+Byte 1 = 0x90
+Byte 2 = 0x8f
+Byte 3 = 0x93
+Byte 4 = 0x41
+Byte 5 = 0x41
+Byte 6 = 0x41
+Byte 7 = 0x41
+Byte 8 = 0x41
+Byte 9 = 0x41
+Byte 10 = 0x41
+Byte 11 = 0x41
+Byte 12 = 0x41
+Byte 13 = 0x41
+Byte 14 = 0x41
+Byte 15 = 0x41
+Byte 16 = 0x41
+Byte 17 = 0x41
+Byte 18 = 0x41
+Byte 19 = 0x41
+Byte 20 = 0x41
+Byte 21 = 0x41
+Byte 22 = 0x41
+Byte 23 = 0x41
+Byte 24 = 0x41
+Byte 25 = 0x41
+Byte 26 = 0x41
+Byte 27 = 0x41
+Byte 28 = 0x41
+Byte 29 = 0x41
+Byte 30 = 0x41
+Byte 31 = 0x41
+Byte 32 = 0x41
+Byte 33 = 0x41
+Byte 34 = 0x41
+Byte 35 = 0x5a
+Byte 36 = 0x41
+Byte 37 = 0x41
+Byte 38 = 0x41
+Byte 39 = 0x41
+Byte 40 = 0x41
+Byte 41 = 0x41
+Byte 42 = 0x41
+Byte 43 = 0x41
+Byte 44 = 0x41
+Byte 45 = 0x41
+Byte 46 = 0x41
+Byte 47 = 0x41
+Byte 48 = 0x41
+Byte 49 = 0x41
+Byte 50 = 0x41
+Byte 51 = 0x41
+Byte 52 = 0x41
+Byte 53 = 0x41
+Byte 54 = 0x41
+Byte 55 = 0x41
+Byte 56 = 0x41
+Byte 57 = 0x41
+Byte 58 = 0x41
+Byte 59 = 0x41
+Byte 60 = 0x41
+Byte 61 = 0x41
+Byte 62 = 0x41
+Byte 63 = 0x41
+Byte 64 = 0x41
+Byte 65 = 0x41
+Byte 66 = 0xe3
+Byte 67 = 0x81
+Byte 68 = 0x82
+Char 63 = あ
+Char 62 = A
+Char 61 = A
+Char 60 = A
+Char 59 = A
+Char 58 = A
+Char 57 = A
+Char 56 = A
+Char 55 = A
+Char 54 = A
+Char 53 = A
+Char 52 = A
+Char 51 = A
+Char 50 = A
+Char 49 = A
+Char 48 = A
+Char 47 = A
+Char 46 = A
+Char 45 = A
+Char 44 = A
+Char 43 = A
+Char 42 = A
+Char 41 = A
+Char 40 = A
+Char 39 = A
+Char 38 = A
+Char 37 = A
+Char 36 = A
+Char 35 = A
+Char 34 = A
+Char 33 = A
+Char 32 = Z
+Char 31 = A
+Char 30 = A
+Char 29 = A
+Char 28 = A
+Char 27 = A
+Char 26 = A
+Char 25 = A
+Char 24 = A
+Char 23 = A
+Char 22 = A
+Char 21 = A
+Char 20 = A
+Char 19 = A
+Char 18 = A
+Char 17 = A
+Char 16 = A
+Char 15 = A
+Char 14 = A
+Char 13 = A
+Char 12 = A
+Char 11 = A
+Char 10 = A
+Char 9 = A
+Char 8 = A
+Char 7 = A
+Char 6 = A
+Char 5 = A
+Char 4 = A
+Char 3 = A
+Char 2 = A
+Char 1 = A
+Char 0 = 𐏓
+Byte 68 = 0x82
+Byte 67 = 0x81
+Byte 66 = 0xe3
+Byte 65 = 0x41
+Byte 64 = 0x41
+Byte 63 = 0x41
+Byte 62 = 0x41
+Byte 61 = 0x41
+Byte 60 = 0x41
+Byte 59 = 0x41
+Byte 58 = 0x41
+Byte 57 = 0x41
+Byte 56 = 0x41
+Byte 55 = 0x41
+Byte 54 = 0x41
+Byte 53 = 0x41
+Byte 52 = 0x41
+Byte 51 = 0x41
+Byte 50 = 0x41
+Byte 49 = 0x41
+Byte 48 = 0x41
+Byte 47 = 0x41
+Byte 46 = 0x41
+Byte 45 = 0x41
+Byte 44 = 0x41
+Byte 43 = 0x41
+Byte 42 = 0x41
+Byte 41 = 0x41
+Byte 40 = 0x41
+Byte 39 = 0x41
+Byte 38 = 0x41
+Byte 37 = 0x41
+Byte 36 = 0x41
+Byte 35 = 0x5a
+Byte 34 = 0x41
+Byte 33 = 0x41
+Byte 32 = 0x41
+Byte 31 = 0x41
+Byte 30 = 0x41
+Byte 29 = 0x41
+Byte 28 = 0x41
+Byte 27 = 0x41
+Byte 26 = 0x41
+Byte 25 = 0x41
+Byte 24 = 0x41
+Byte 23 = 0x41
+Byte 22 = 0x41
+Byte 21 = 0x41
+Byte 20 = 0x41
+Byte 19 = 0x41
+Byte 18 = 0x41
+Byte 17 = 0x41
+Byte 16 = 0x41
+Byte 15 = 0x41
+Byte 14 = 0x41
+Byte 13 = 0x41
+Byte 12 = 0x41
+Byte 11 = 0x41
+Byte 10 = 0x41
+Byte 9 = 0x41
+Byte 8 = 0x41
+Byte 7 = 0x41
+Byte 6 = 0x41
+Byte 5 = 0x41
+Byte 4 = 0x41
+Byte 3 = 0x93
+Byte 2 = 0x8f
+Byte 1 = 0x90
+Byte 0 = 0xf0
--- /dev/null
+Char 0 = 𐏓
+Char 1 = A
+Char 2 = A
+Char 3 = A
+Char 4 = A
+Char 5 = A
+Char 6 = A
+Char 7 = A
+Char 8 = A
+Char 9 = A
+Char 10 = A
+Char 11 = A
+Char 12 = A
+Char 13 = A
+Char 14 = A
+Char 15 = A
+Char 16 = A
+Char 17 = A
+Char 18 = A
+Char 19 = A
+Char 20 = A
+Char 21 = A
+Char 22 = A
+Char 23 = A
+Char 24 = A
+Char 25 = A
+Char 26 = A
+Char 27 = A
+Char 28 = A
+Char 29 = A
+Char 30 = A
+Char 31 = A
+Char 32 = Z
+Char 33 = A
+Char 34 = A
+Char 35 = A
+Char 36 = A
+Char 37 = A
+Char 38 = A
+Char 39 = A
+Char 40 = A
+Char 41 = A
+Char 42 = A
+Char 43 = A
+Char 44 = A
+Char 45 = A
+Char 46 = A
+Char 47 = A
+Char 48 = A
+Char 49 = A
+Char 50 = A
+Char 51 = A
+Char 52 = A
+Char 53 = A
+Char 54 = A
+Char 55 = A
+Char 56 = A
+Char 57 = A
+Char 58 = A
+Char 59 = A
+Char 60 = A
+Char 61 = A
+Char 62 = A
+Char 63 = あ
+Byte 0 = 0xf0
+Byte 1 = 0x90
+Byte 2 = 0x8f
+Byte 3 = 0x93
+Byte 4 = 0x41
+Byte 5 = 0x41
+Byte 6 = 0x41
+Byte 7 = 0x41
+Byte 8 = 0x41
+Byte 9 = 0x41
+Byte 10 = 0x41
+Byte 11 = 0x41
+Byte 12 = 0x41
+Byte 13 = 0x41
+Byte 14 = 0x41
+Byte 15 = 0x41
+Byte 16 = 0x41
+Byte 17 = 0x41
+Byte 18 = 0x41
+Byte 19 = 0x41
+Byte 20 = 0x41
+Byte 21 = 0x41
+Byte 22 = 0x41
+Byte 23 = 0x41
+Byte 24 = 0x41
+Byte 25 = 0x41
+Byte 26 = 0x41
+Byte 27 = 0x41
+Byte 28 = 0x41
+Byte 29 = 0x41
+Byte 30 = 0x41
+Byte 31 = 0x41
+Byte 32 = 0x41
+Byte 33 = 0x41
+Byte 34 = 0x41
+Byte 35 = 0x5a
+Byte 36 = 0x41
+Byte 37 = 0x41
+Byte 38 = 0x41
+Byte 39 = 0x41
+Byte 40 = 0x41
+Byte 41 = 0x41
+Byte 42 = 0x41
+Byte 43 = 0x41
+Byte 44 = 0x41
+Byte 45 = 0x41
+Byte 46 = 0x41
+Byte 47 = 0x41
+Byte 48 = 0x41
+Byte 49 = 0x41
+Byte 50 = 0x41
+Byte 51 = 0x41
+Byte 52 = 0x41
+Byte 53 = 0x41
+Byte 54 = 0x41
+Byte 55 = 0x41
+Byte 56 = 0x41
+Byte 57 = 0x41
+Byte 58 = 0x41
+Byte 59 = 0x41
+Byte 60 = 0x41
+Byte 61 = 0x41
+Byte 62 = 0x41
+Byte 63 = 0x41
+Byte 64 = 0x41
+Byte 65 = 0x41
+Byte 66 = 0xe3
+Byte 67 = 0x81
+Byte 68 = 0x82
+Char 63 = あ
+Char 62 = A
+Char 61 = A
+Char 60 = A
+Char 59 = A
+Char 58 = A
+Char 57 = A
+Char 56 = A
+Char 55 = A
+Char 54 = A
+Char 53 = A
+Char 52 = A
+Char 51 = A
+Char 50 = A
+Char 49 = A
+Char 48 = A
+Char 47 = A
+Char 46 = A
+Char 45 = A
+Char 44 = A
+Char 43 = A
+Char 42 = A
+Char 41 = A
+Char 40 = A
+Char 39 = A
+Char 38 = A
+Char 37 = A
+Char 36 = A
+Char 35 = A
+Char 34 = A
+Char 33 = A
+Char 32 = Z
+Char 31 = A
+Char 30 = A
+Char 29 = A
+Char 28 = A
+Char 27 = A
+Char 26 = A
+Char 25 = A
+Char 24 = A
+Char 23 = A
+Char 22 = A
+Char 21 = A
+Char 20 = A
+Char 19 = A
+Char 18 = A
+Char 17 = A
+Char 16 = A
+Char 15 = A
+Char 14 = A
+Char 13 = A
+Char 12 = A
+Char 11 = A
+Char 10 = A
+Char 9 = A
+Char 8 = A
+Char 7 = A
+Char 6 = A
+Char 5 = A
+Char 4 = A
+Char 3 = A
+Char 2 = A
+Char 1 = A
+Char 0 = 𐏓
+Byte 68 = 0x82
+Byte 67 = 0x81
+Byte 66 = 0xe3
+Byte 65 = 0x41
+Byte 64 = 0x41
+Byte 63 = 0x41
+Byte 62 = 0x41
+Byte 61 = 0x41
+Byte 60 = 0x41
+Byte 59 = 0x41
+Byte 58 = 0x41
+Byte 57 = 0x41
+Byte 56 = 0x41
+Byte 55 = 0x41
+Byte 54 = 0x41
+Byte 53 = 0x41
+Byte 52 = 0x41
+Byte 51 = 0x41
+Byte 50 = 0x41
+Byte 49 = 0x41
+Byte 48 = 0x41
+Byte 47 = 0x41
+Byte 46 = 0x41
+Byte 45 = 0x41
+Byte 44 = 0x41
+Byte 43 = 0x41
+Byte 42 = 0x41
+Byte 41 = 0x41
+Byte 40 = 0x41
+Byte 39 = 0x41
+Byte 38 = 0x41
+Byte 37 = 0x41
+Byte 36 = 0x41
+Byte 35 = 0x5a
+Byte 34 = 0x41
+Byte 33 = 0x41
+Byte 32 = 0x41
+Byte 31 = 0x41
+Byte 30 = 0x41
+Byte 29 = 0x41
+Byte 28 = 0x41
+Byte 27 = 0x41
+Byte 26 = 0x41
+Byte 25 = 0x41
+Byte 24 = 0x41
+Byte 23 = 0x41
+Byte 22 = 0x41
+Byte 21 = 0x41
+Byte 20 = 0x41
+Byte 19 = 0x41
+Byte 18 = 0x41
+Byte 17 = 0x41
+Byte 16 = 0x41
+Byte 15 = 0x41
+Byte 14 = 0x41
+Byte 13 = 0x41
+Byte 12 = 0x41
+Byte 11 = 0x41
+Byte 10 = 0x41
+Byte 9 = 0x41
+Byte 8 = 0x41
+Byte 7 = 0x41
+Byte 6 = 0x41
+Byte 5 = 0x41
+Byte 4 = 0x41
+Byte 3 = 0x93
+Byte 2 = 0x8f
+Byte 1 = 0x90
+Byte 0 = 0xf0
Read 4 chars: exis
Read 4 chars: Laf
Read 4 chars: erri
-Read 4 chars: ère
+Read 3 chars: ère
Read 4 chars: <al
Read 4 chars: exis
Read 4 chars: .laf
-Error: Opening file at 'donotcreate.bing' failed with 'No such file or directory'
-Error: Opening file at 'donotcreate.bing' failed with 'No such file or directory'
+Cannot open `donotcreate.bing`: No such file or directory
+Cannot open `donotcreate.bing`: No such file or directory
NativeString
-N
+0x4e
Nit
NativeArray[Int]
3
-Runtime error: Cast failed. Expected `E`, got `Bool` (../lib/standard/collection/array.nit:957)
+Runtime error: Cast failed. Expected `E`, got `Bool` (../lib/standard/collection/array.nit:960)
NativeString
-N
+0x4e
Nit
AType ../src/test_parser.nit:27,20--22
TClassid "Int" ../src/test_parser.nit:27,20--22
TAssign "=" ../src/test_parser.nit:27,24
- ADecIntExpr ../src/test_parser.nit:27,26
- TNumber "0" ../src/test_parser.nit:27,26
+ AIntegerExpr ../src/test_parser.nit:27,26
+ TInteger "0" ../src/test_parser.nit:27,26
AMethPropdef ../src/test_parser.nit:28,2--38,4
TKwredef "redef" ../src/test_parser.nit:28,2--6
APublicVisibility ../src/test_parser.nit:28,8
TId "rank" ../src/test_parser.nit:35,10--13
AListExprs ../src/test_parser.nit:35,13
TPlus "+" ../src/test_parser.nit:35,15
- ADecIntExpr ../src/test_parser.nit:35,17
- TNumber "1" ../src/test_parser.nit:35,17
+ AIntegerExpr ../src/test_parser.nit:35,17
+ TInteger "1" ../src/test_parser.nit:35,17
ACallExpr ../src/test_parser.nit:36,3--19
ACallExpr ../src/test_parser.nit:36,3
AImplicitSelfExpr ../src/test_parser.nit:36,3
TId "rank" ../src/test_parser.nit:37,10--13
AListExprs ../src/test_parser.nit:37,13
TMinus "-" ../src/test_parser.nit:37,15
- ADecIntExpr ../src/test_parser.nit:37,17
- TNumber "1" ../src/test_parser.nit:37,17
+ AIntegerExpr ../src/test_parser.nit:37,17
+ TInteger "1" ../src/test_parser.nit:37,17
TKwend "end" ../src/test_parser.nit:38,2--4
TKwend "end" ../src/test_parser.nit:39,1--3
AMainClassdef ../src/test_parser.nit:41,1--155,3
TId "exit" ../src/test_parser.nit:65,3--6
AParExprs ../src/test_parser.nit:65,7--9
TOpar "(" ../src/test_parser.nit:65,7
- ADecIntExpr ../src/test_parser.nit:65,8
- TNumber "0" ../src/test_parser.nit:65,8
+ AIntegerExpr ../src/test_parser.nit:65,8
+ TInteger "0" ../src/test_parser.nit:65,8
TCpar ")" ../src/test_parser.nit:65,9
TKwend "end" ../src/test_parser.nit:66,2--4
ACallExpr ../src/test_parser.nit:67,2--11
AImplicitSelfExpr ../src/test_parser.nit:86,3
TId "exit" ../src/test_parser.nit:86,3--6
AListExprs ../src/test_parser.nit:86,8
- ADecIntExpr ../src/test_parser.nit:86,8
- TNumber "1" ../src/test_parser.nit:86,8
+ AIntegerExpr ../src/test_parser.nit:86,8
+ TInteger "1" ../src/test_parser.nit:86,8
TKwelse "else" ../src/test_parser.nit:87,2--5
AIfExpr ../src/test_parser.nit:87,7--93,4
TKwif "if" ../src/test_parser.nit:87,7--8
AImplicitSelfExpr ../src/test_parser.nit:89,3
TId "exit" ../src/test_parser.nit:89,3--6
AListExprs ../src/test_parser.nit:89,8
- ADecIntExpr ../src/test_parser.nit:89,8
- TNumber "1" ../src/test_parser.nit:89,8
+ AIntegerExpr ../src/test_parser.nit:89,8
+ TInteger "1" ../src/test_parser.nit:89,8
TKwelse "else" ../src/test_parser.nit:90,2--5
AIfExpr ../src/test_parser.nit:90,7--93,4
TKwif "if" ../src/test_parser.nit:90,7--8
AImplicitSelfExpr ../src/test_parser.nit:92,3
TId "exit" ../src/test_parser.nit:92,3--6
AListExprs ../src/test_parser.nit:92,8
- ADecIntExpr ../src/test_parser.nit:92,8
- TNumber "1" ../src/test_parser.nit:92,8
+ AIntegerExpr ../src/test_parser.nit:92,8
+ TInteger "1" ../src/test_parser.nit:92,8
ABlockExpr ../src/test_parser.nit:93,2--4
TKwend "end" ../src/test_parser.nit:93,2--4
AVardeclExpr ../src/test_parser.nit:95,2--25
---> ADecIntExpr 1,1
- TNumber "1" 1,1
+--> AIntegerExpr 1,1
+ TInteger "1" 1,1
--> ABlockExpr 1,1--11
ACallExpr 1,1--11
AImplicitSelfExpr 1,1
--- /dev/null
+require the name of the output directory
--- /dev/null
+* out/test_path_args1.write
+simplified: out/test_path_args1.write
+filename: test_path_args1.write
+dir: out
+exists: true
+ error? nope
+stat: is_dir=true is_reg=false
+ error? nope
+open: out/test_path_args1.write
+ error? nope
+first_line:
+ error? Cannot read `out/test_path_args1.write`: Is a directory
+content: 0 chars
+ error? Cannot read `out/test_path_args1.write`: Is a directory
+content: 0 bytes
+ error? Cannot read `out/test_path_args1.write`: Is a directory
+content: 0 lines
+ error? Cannot read `out/test_path_args1.write`: Is a directory
+content: 0 files
+ error? nope
+* out/test_path_args1.write/file.txt
+simplified: out/test_path_args1.write/file.txt
+filename: file.txt
+dir: out/test_path_args1.write
+exists: false
+ error? Cannot open `out/test_path_args1.write/file.txt`: No such file or directory
+stat: nope
+ error? Cannot open `out/test_path_args1.write/file.txt`: No such file or directory
+open: out/test_path_args1.write/file.txt
+ error? Cannot open `out/test_path_args1.write/file.txt`: No such file or directory
+first_line:
+ error? Cannot open `out/test_path_args1.write/file.txt`: No such file or directory
+content: 0 chars
+ error? Cannot open `out/test_path_args1.write/file.txt`: No such file or directory
+content: 0 bytes
+ error? Cannot open `out/test_path_args1.write/file.txt`: No such file or directory
+content: 0 lines
+ error? Cannot open `out/test_path_args1.write/file.txt`: No such file or directory
+content: 0 files
+ error? Cannot list directory `out/test_path_args1.write/file.txt`: No such file or directory
+* out/test_path_args1.write/file.txt
+simplified: out/test_path_args1.write/file.txt
+filename: file.txt
+dir: out/test_path_args1.write
+exists: true
+ error? nope
+stat: is_dir=false is_reg=true
+ error? nope
+open: out/test_path_args1.write/file.txt
+ error? nope
+first_line: hello world!
+ error? nope
+content: 12 chars
+ error? nope
+content: 12 bytes
+ error? nope
+content: 1 lines
+ error? nope
+content: 0 files
+ error? Cannot list directory `out/test_path_args1.write/file.txt`: Not a directory
+* out/test_path_args1.write/dir
+simplified: out/test_path_args1.write/dir
+filename: dir
+dir: out/test_path_args1.write
+exists: true
+ error? nope
+stat: is_dir=true is_reg=false
+ error? nope
+open: out/test_path_args1.write/dir
+ error? nope
+first_line:
+ error? Cannot read `out/test_path_args1.write/dir`: Is a directory
+content: 0 chars
+ error? Cannot read `out/test_path_args1.write/dir`: Is a directory
+content: 0 bytes
+ error? Cannot read `out/test_path_args1.write/dir`: Is a directory
+content: 0 lines
+ error? Cannot read `out/test_path_args1.write/dir`: Is a directory
+content: 1 files
+ error? nope
+dir/
+file.txt
--- /dev/null
+[0x54,0x68,0x69,0x73,0x20,0x73,0x74,0x72,0x69,0x6e,0x67,0x20,0x69,0x73,0x20,0x63,0x6f,0x6f,0x6c]
+[0x54,0x68,0x69,0x73,0x20,0x73,0x74,0x72,0x69,0x6e,0x67,0x20,0x69,0x73,0x20,0x63,0x6f,0x6f,0x6c,0x54,0x68,0x69,0x73,0x20,0x73,0x74,0x72,0x69,0x6e,0x67,0x20,0x69,0x73,0x20,0x63,0x6f,0x6f,0x6c,0x54,0x68,0x69,0x73,0x20,0x73,0x74,0x72,0x69,0x6e,0x67,0x20,0x69,0x73,0x20,0x63,0x6f,0x6f,0x6c,0x54,0x68,0x69,0x73,0x20,0x73,0x74,0x72,0x69,0x6e,0x67,0x20,0x69,0x73,0x20,0x63,0x6f,0x6f,0x6c]
+[0x54,0x68,0x69,0x73,0x20,0x73,0x74,0x72,0x69,0x6e,0x67,0x20,0x69,0x73,0x20,0x63,0x6f,0x6f,0x6c,0x54,0x68,0x69,0x73,0x20,0x73,0x74,0x72,0x69,0x6e,0x67,0x20,0x69,0x73,0x20,0x63,0x6f,0x6f,0x6c,0x54,0x68,0x69,0x73,0x20,0x73,0x74,0x72,0x69,0x6e,0x67,0x20,0x69,0x73,0x20,0x63,0x6f,0x6f,0x6c,0x54,0x68,0x69,0x73,0x20,0x73,0x74,0x72,0x69,0x6e,0x67,0x20,0x69,0x73,0x20,0x63,0x6f,0x6f,0x6c]
+[0x6c,0x6f,0x6f,0x63,0x20,0x73,0x69,0x20,0x67,0x6e,0x69,0x72,0x74,0x73,0x20,0x73,0x69,0x68,0x54]
+[0x6c,0x6f,0x6f,0x63,0x20,0x73,0x69,0x20,0x67,0x6e,0x69,0x72,0x74,0x73,0x20,0x73,0x69,0x68,0x54,0x6c,0x6f,0x6f,0x63,0x20,0x73,0x69,0x20,0x67,0x6e,0x69,0x72,0x74,0x73,0x20,0x73,0x69,0x68,0x54,0x6c,0x6f,0x6f,0x63,0x20,0x73,0x69,0x20,0x67,0x6e,0x69,0x72,0x74,0x73,0x20,0x73,0x69,0x68,0x54,0x6c,0x6f,0x6f,0x63,0x20,0x73,0x69,0x20,0x67,0x6e,0x69,0x72,0x74,0x73,0x20,0x73,0x69,0x68,0x54]
+[0x6c,0x6f,0x6f,0x63,0x20,0x73,0x69,0x20,0x67,0x6e,0x69,0x72,0x74,0x73,0x20,0x73,0x69,0x68,0x54,0x6c,0x6f,0x6f,0x63,0x20,0x73,0x69,0x20,0x67,0x6e,0x69,0x72,0x74,0x73,0x20,0x73,0x69,0x68,0x54,0x6c,0x6f,0x6f,0x63,0x20,0x73,0x69,0x20,0x67,0x6e,0x69,0x72,0x74,0x73,0x20,0x73,0x69,0x68,0x54,0x6c,0x6f,0x6f,0x63,0x20,0x73,0x69,0x20,0x67,0x6e,0x69,0x72,0x74,0x73,0x20,0x73,0x69,0x68,0x54]
+This string is cool
+This string is coolA
+Ahis string is coolA
+This string is cool
+This string is coolA
+Ahis string is coolA
-4
-0 is à (195)
-1 is © (169)
-2 is à (195)
-3 is ¨ (168)
+2
+0 is é (233)
+1 is è (232)
--- /dev/null
+103d3
+10ffff
-XML Error: Malformatted attribute at line 7, position 7
+XML Error: Malformed attribute at line 7, position 7
-XML Error: Malformatted attribute at line 1, position 7
+XML Error: Malformed attribute at line 1, position 7
-XML Error: Malformatted attribute at line 1, position 7
+XML Error: Malformed attribute at line 1, position 7
-XML Error: Malformatted Processing Instruction tag at line 2, position 1
+XML Error: Malformed Processing Instruction tag at line 2, position 1
var w = args.first.to_i
var h = w
-var byte_acc = 0
+var byte_acc = 0u8
var bit_num = 0
print("P4\n{w} {h}")
if zr*zr+zi*zi > limit*limit then
byte_acc = (byte_acc.lshift(1))
else
- byte_acc = (byte_acc.lshift(1)) + 1
+ byte_acc = (byte_acc.lshift(1)) + 1u8
end
bit_num = bit_num + 1
if bit_num == 8 then
- printn(byte_acc.ascii)
- byte_acc = 0
+ stdout.write_byte(byte_acc)
+ byte_acc = 0u8
bit_num = 0
else if x == w - 1 then
byte_acc = byte_acc.lshift(8-w%8)
- printn(byte_acc.ascii)
- byte_acc = 0
+ stdout.write_byte(byte_acc)
+ byte_acc = 0u8
bit_num = 0
end
end
# See the License for the specific language governing permissions and
# limitations under the License.
+import c
+
+class Bitarray
+
+ var narr: CByteArray
+
+ init do
+ for x in [0 .. narr.length[ do narr[x] = 0xFFu8
+ end
+
+ fun [](pos: Int): Bool do
+ pos -= 2
+ return (narr[pos / 8] & (1u8 << (7 - pos % 8))) != 0u8
+ end
+
+ fun []=(pos: Int, val: Bool) do
+ pos -= 2
+ if val then
+ narr[pos / 8] |= 1u8 << (7 - pos % 8)
+ else
+ narr[pos / 8] &= 0xFFu8 - (1u8 << (7 - pos % 8))
+ end
+ end
+end
+
fun nsieve(n: Int): Int
do
var count = 0
- var array: Buffer = new FlatBuffer.with_capacity(n)
- for i in [0..n[ do
- array.chars[i] = 'o'
- end
- for i in [2..n[ do
- if array.chars[i] == 'o' then
- var j = i * 2
- while j < n do
- array.chars[j] = 'x'
- j = j + i
- end
- count = count + 1
+ var b_arrsz = ((n - 1).to_f / 8.0).ceil.to_i
+ var bitarr = new Bitarray(new CByteArray(b_arrsz))
+ for i in [2 .. n[ do
+ # If self is already false, then no need to check for multiples
+ if not bitarr[i] then continue
+ count += 1
+ var j = i * i
+ while j < n do
+ bitarr[j] = false
+ j += i
end
end
return count
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+class Bitarray
+
+ var narr: Bytes
+
+ init do
+ for x in [0 .. narr.length[ do narr[x] = 0xFFu8
+ end
+
+ fun [](pos: Int): Bool do
+ pos -= 2
+ return (narr[pos / 8] & (1u8 << (7 - pos % 8))) != 0u8
+ end
+
+ fun []=(pos: Int, val: Bool) do
+ pos -= 2
+ if val then
+ narr[pos / 8] |= 1u8 << (7 - pos % 8)
+ else
+ narr[pos / 8] &= 0xFFu8 - (1u8 << (7 - pos % 8))
+ end
+ end
+end
+
+fun nsieve(n: Int): Int
+do
+ var count = 0
+ var b_arrsz = ((n - 1).to_f / 8.0).ceil.to_i
+ var bitarr = new Bitarray(new Bytes(new NativeString(b_arrsz), b_arrsz, b_arrsz))
+ for i in [2 .. n[ do
+ # If self is already false, then no need to check for multiples
+ if not bitarr[i] then continue
+ count += 1
+ var j = i * i
+ while j < n do
+ bitarr[j] = false
+ j += i
+ end
+ end
+ return count
+end
+
+fun test(n: Int)
+do
+ var m = 10000.lshift(n)
+ print("Primes up to {m} {nsieve(m)}")
+end
+
+var n = 2
+if args.length == 1 then
+ n = args.first.to_i
+end
+
+test(n)
+if n >= 1 then
+ test(n-1)
+end
+if n >= 2 then
+ test(n-2)
+end
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+# This test provides variations on having an attribute with a default value but optionally settable with the constructor
+# The main points of variation here is what are the basic exposed services and behavior
+
+# The attribute is stored as not nullable but manual setter with a nullable signature is exposed
+# Setting with `null` invoke the real setter with the default value.
+# The manual setter is used as an initializer thus collected in the autoinit.
+#
+# Best option if one wants to allow the user to reset the default (with null) once the object is created
+class A
+ var s: String is noautoinit, private writable(real_s=)
+ fun s=(v: nullable String) is autoinit do self.real_s = v or else "Default"
+end
+
+# The attribute is stored as not nullable with standard automatic getter/setter
+# The initializer is a manual method that accepts the nullable value and assigns the default value if null is given.
+#
+# Best option if the default can only be set a construction time
+class B
+ var s: String is noautoinit
+ protected fun s_opt=(v: nullable String) is autoinit do self.s = v or else "Default"
+end
+
+# The attribute is stored as nullable.
+# A manual getter is used to return a default value if the attribute is null.
+#
+# Shortest solution without annotation.
+# Con: the default is determined by the getter and never stored (this could be an issue if the default is complex)
+class C
+ protected var s_opt: nullable String
+ fun s: String do return s_opt or else "Default"
+end
+
+# The attribute is stored as nullable.
+# A manual getter is used to return a default value if the attribute is null.
+#
+# Longer solution without annotation but the getter lazily computes and stores the default once
+class D
+ protected var s_opt: nullable String
+ fun s: String do
+ var res = s_opt
+ if res != null then return res
+ res = "Default"
+ s_opt = res
+ return res
+ end
+end
+
+# The attribute is stored as not nullable with standard automatic getter/setter
+# The initializer is manual method that accepts the nullable value and does nothing if null is given.
+#
+# This one has a tricky behavior if one accesses to `s` before `s_opt=` is executed
+class E
+ var s = "Default" is lazy
+ protected fun s_opt=(v: nullable String) is autoinit do if v != null then s = v
+end
+
+var a2 = new A("Mine")
+print a2.s
+var a1 = new A
+print a1.s
+a1.s = "Other"
+print a1.s
+a1.s = null
+print a1.s
+
+print ""
+
+var b2 = new B("Mine")
+print b2.s
+var b1 = new B
+print b1.s
+b1.s = "Other"
+print b1.s
+b1.s_opt = null
+print b1.s
+b1.s_opt = "Yet Another"
+print b1.s
+
+print ""
+
+var c2 = new C("Mine")
+print c2.s
+var c1 = new C
+print c1.s
+c1.s_opt = "Other"
+print c1.s
+c1.s_opt = null
+print c1.s
+
+print ""
+
+var d2 = new D("Mine")
+print d2.s
+var d1 = new D
+print d1.s
+d1.s_opt = "Other"
+print d1.s
+d1.s_opt = null
+print d1.s
+
+print ""
+
+var e2 = new E("Mine")
+print e2.s
+var e1 = new E
+print e1.s
+e1.s = "Other"
+print e1.s
+e1.s_opt = null
+print e1.s
+e1.s_opt = "Yet Another"
+print e1.s
#alt1# writer.big_endian = false
#alt3# writer.big_endian = false
writer.write "hello"
-writer.write_byte 77
+writer.write_byte 77u8
writer.write_float 1.23456789
writer.write_double 1.23456789
writer.write_int64 123456789
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+import test_deserialization
+import binary::serialization
+#alt1# import test_deserialization_serial
+
+class NoSerializeClass
+ super Serializable
+
+ var some_attribute: String
+end
+
+var entities = new TestEntities
+
+var tests = entities.without_generics#alt1##alt2#
+#alt1#var tests = entities.with_generics
+#alt2#var tests = [new NoSerializeClass("will not deserialize")]
+
+var dir = "out/test_binary_deserialization"
+if not dir.file_exists then dir.mkdir
+
+var path = dir / "alt0"#alt1##alt2#
+#alt1#var path = dir / "alt1"
+#alt2#var path = dir / "alt2"
+
+var writer = new FileWriter.open(path)
+var serializer = new BinarySerializer(writer)
+for o in tests do
+ serializer.serialize o
+end
+writer.close
+
+var reader = new FileReader.open(path)
+var deserializer = new BinaryDeserializer(reader)
+for o in tests do
+ var dst = deserializer.deserialize
+
+ if deserializer.errors.not_empty then
+ print deserializer.errors.join(", ")
+ end
+
+ if dst != null then
+ assert o.is_same_type(dst)
+
+ print "# Src:\n{o}"
+ print "# Dst:\n{dst}\n"
+ end
+end
+reader.close
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+var fb: Buffer = new RopeBuffer
+#alt1 fb = new FlatBuffer
+
+for i in [0 .. 64[ do fb.add 'A'
+
+fb[63] = 'あ'
+
+fb[32] = 'き'
+
+fb[0] = '𐏓'
+
+fb[32] = 'Z'
+
+var l = 0
+
+for i in fb.chars do
+ print "Char {l} = {i}"
+ l += 1
+end
+
+l = 0
+
+for i in fb.bytes do
+ print "Byte {l} = {i}"
+ l += 1
+end
+
+l = fb.length - 1
+
+for i in fb.chars.reverse_iterator do
+ print "Char {l} = {i}"
+ l -= 1
+end
+
+l = fb.bytelen - 1
+
+for i in fb.bytes.reverse_iterator do
+ print "Byte {l} = {i}"
+ l -= 1
+end
# limitations under the License.
var s = new NativeString(4)
-s[0] = 'N'
-s[2] = 't'
-s[1] = 'i'
-s[3] = '\0'
+s[0] = 0x4Eu8
+s[2] = 0x74u8
+s[1] = 0x69u8
+s[3] = 0u8
print s.class_name
print s[0]
print s.to_s
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+fun test_path(p: Path)
+do
+ print "* {p}"
+ print "simplified: {p.simplified}"
+ print "filename: {p.filename}"
+ print "dir: {p.dir}"
+ var e = p.exists
+ print "exists: {e}"
+ print " error? {p.last_error or else "nope"}"
+ var s = p.stat
+ if s == null then
+ print "stat: nope"
+ else
+ print "stat: is_dir={s.is_dir} is_reg={s.is_reg}"
+ end
+ print " error? {p.last_error or else "nope"}"
+ var stream = p.open_ro
+ print "open: {stream.path or else "-"}"
+ print " error? {p.last_error or else "nope"}"
+ print "first_line: {stream.read_line}"
+ stream.close
+ print " error? {stream.last_error or else "nope"}"
+ var txt = p.read_all
+ print "content: {txt.length} chars"
+ print " error? {p.last_error or else "nope"}"
+ var bin = p.read_all_bytes
+ print "content: {bin.length} bytes"
+ print " error? {p.last_error or else "nope"}"
+ var lines = p.read_lines
+ print "content: {lines.length} lines"
+ print " error? {p.last_error or else "nope"}"
+
+ var files = p.files
+ print "content: {files.length} files"
+ print " error? {p.last_error or else "nope"}"
+end
+
+if args.length != 1 then
+ print "require the name of the output directory"
+ return
+end
+
+var base = args.first
+base.mkdir
+test_path(base.to_path)
+
+var f = (base/"file.txt").to_path
+test_path(f)
+
+"hello world!".write_to_file(f.to_s)
+test_path(f)
+
+var dn = base / "dir"
+var d = dn.to_path
+dn.mkdir
+"goodby world!".write_to_file(dn/"file.txt")
+test_path(d)
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+var rb = new RopeBuffer
+
+for i in [0 .. 1000000[ do
+ rb.add 'S'
+ var s = rb.to_s
+end
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+var x = "This string is cool"
+
+var y = x + x + x + x
+
+var z = x * 4
+
+print x.bytes.iterator.to_a
+print y.bytes.iterator.to_a
+print z.bytes.iterator.to_a
+
+print x.bytes.reverse_iterator.to_a
+print y.bytes.reverse_iterator.to_a
+print z.bytes.reverse_iterator.to_a
+
+var b = new FlatBuffer.from(x)
+
+print b
+
+b.bytes.add 0x41u8
+
+print b
+
+b.bytes[0] = 0x41u8
+
+print b
+
+var c = new RopeBuffer.from(x)
+
+print c
+
+c.bytes.add 0x41u8
+
+print c
+
+c.bytes[0] = 0x41u8
+
+print c
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+intrude import standard::text::flat
+import standard
+
+var s = "𐏓".as(FlatString)
+print s.items.char_at(0).ascii.to_hex
+print s.items.char_at(4).ascii.to_hex
OPT="--vm $OPT"
savdirs="sav/niti/"
;;
+ nitj)
+ engine=nitj;
+ OPT="--compile-dir $compdir --ant"
+ enginebinname=nitj;
+ savdirs="sav/nitc-common/"
+ ;;
emscripten)
enginebinname=nitc
OPT="-m emscripten_nodejs.nit --semi-global $OPT --compile-dir $compdir"
nitlanguage / nit.git / commitdiff
