`NativeString` used to be mainly implemented by the engines, but in the last few years it became gradually a normal extern class. As such, its instances are now C strings (`char *`). Most of its methods are extern and implemented in the library instead of the engines. It is also widely used by extern methods implemented in C as `char *`, the type appears 300+ times in the general lib and 67 times in `lib/core/text`.
This PR renames `NativeString` to `CString`. This change makes it clear to beginner programmers that its instances are pointers to C strings and how they are passed to C code. Plus, it fits better next to `CppString`, `JavaString` and `NSString`.
The only remaining engine not using it as a C string is the Java compiler, which implements it as a Java string. This still works and as long as it behaves like a C string there is no problem.
This PR also updates the related doc and attempts to update all indirect references to the new `CString`.
As discussed with @privat and @R4PaSs.
Pull-Request: #2347
Reviewed-by: Jean Privat <jean@pryen.org>
# Decode `self` from percent (or URL) encoding to a clear string
#
- # Replace invalid use of '%' with '?'.
+ # Invalid '%' are not decoded.
#
# assert "aBc09-._~".to_bytes.from_percent_encoding == "aBc09-._~".to_bytes
# assert "%25%28%29%3c%20%3e".to_bytes.from_percent_encoding == "%()< >".to_bytes
# assert ".com%2fpost%3fe%3dasdf%26f%3d123".to_bytes.from_percent_encoding == ".com/post?e=asdf&f=123".to_bytes
# assert "%25%28%29%3C%20%3E".to_bytes.from_percent_encoding == "%()< >".to_bytes
- # assert "incomplete %".to_bytes.from_percent_encoding == "incomplete ?".to_bytes
- # assert "invalid % usage".to_bytes.from_percent_encoding == "invalid ? usage".to_bytes
+ # assert "incomplete %".to_bytes.from_percent_encoding == "incomplete %".to_bytes
+ # assert "invalid % usage".to_bytes.from_percent_encoding == "invalid % usage".to_bytes
# assert "%c3%a9%e3%81%82%e3%81%84%e3%81%86".to_bytes.from_percent_encoding == "éあいう".to_bytes
+ # assert "%1 %A %C3%A9A9".to_bytes.from_percent_encoding == "%1 %A éA9".to_bytes
fun from_percent_encoding: Bytes do
var tmp = new Bytes.with_capacity(length)
var pos = 0
continue
end
if length - pos < 2 then
- tmp.add '?'.ascii
+ tmp.add '%'.ascii
pos += 1
continue
end
var bn = self[pos + 1]
var bnn = self[pos + 2]
if not bn.is_valid_hexdigit or not bnn.is_valid_hexdigit then
- tmp.add '?'.ascii
+ tmp.add '%'.ascii
pos += 1
continue
end
# Decode `self` from percent (or URL) encoding to a clear string
#
- # Replace invalid use of '%' with '?'.
+ # Invalid '%' are not decoded.
#
# assert "aBc09-._~".from_percent_encoding == "aBc09-._~"
# assert "%25%28%29%3c%20%3e".from_percent_encoding == "%()< >"
# assert ".com%2fpost%3fe%3dasdf%26f%3d123".from_percent_encoding == ".com/post?e=asdf&f=123"
# assert "%25%28%29%3C%20%3E".from_percent_encoding == "%()< >"
- # assert "incomplete %".from_percent_encoding == "incomplete ?"
- # assert "invalid % usage".from_percent_encoding == "invalid ? usage"
+ # assert "incomplete %".from_percent_encoding == "incomplete %"
+ # assert "invalid % usage".from_percent_encoding == "invalid % usage"
# assert "%c3%a9%e3%81%82%e3%81%84%e3%81%86".from_percent_encoding == "éあいう"
+ # assert "%1 %A %C3%A9A9".from_percent_encoding == "%1 %A éA9"
fun from_percent_encoding: String
do
var len = byte_length
if c == '%' then
if i + 2 >= length then
# What follows % has been cut off
- buf[l] = '?'.ascii
+ buf[l] = '%'.ascii
else
i += 1
var hex_s = substring(i, 2)
i += 1
else
# What follows a % is not Hex
- buf[l] = '?'.ascii
+ buf[l] = '%'.ascii
i -= 1
end
end
printn("* ", i or else "null", " = ", self[i], " => occurences ", self[i].to_f / sum.to_f * 100.0, "%, cumulative ", subtotal.to_f / sum.to_f * 100.0, "% \n")
end
end
+
+ # Packs elements into separate arrays based on their occurences
+ #
+ # ~~~nit
+ # var x = "aaaabbbeeecccddhhgjt"
+ # var c = new Counter[Char]
+ # for i in x do c.inc i
+ # var ret = c.pack
+ # assert ret.join(", ") == """[t,g,j], [d,h], [c,b,e], [a]"""
+ # ~~~
+ fun pack: Array[Array[E]] do
+ var ret = new Array[Array[E]]
+ var base = self.sort
+ if base.is_empty then return ret
+ var curr = new Array[E]
+ curr.push base.first
+ var curr_score = self[base.first]
+ base.shift
+ for i in base do
+ if self[i] == curr_score then
+ curr.push i
+ continue
+ end
+ curr_score = self[i]
+ ret.push curr
+ curr = new Array[E]
+ curr.push i
+ end
+ if not curr.is_empty then ret.push curr
+ return ret
+ end
end
redef class Collection[E]
# You are allowed to redistribute it and sell it, alone or is a part of
# another product.
-# Service management trough the `for` control structure.
+# Service management through the `for` control structure.
#
# The module is a proof-of-concept to investigate the abuse of
# the `for` structure to implement various services.
end
redef class Array[E]
- # Sort an array trough a `for` abuse.
+ # Sort an array through a `for` abuse.
# The user uses the provided query (item) to implements its own comparison
#
# var a = [1, 3, 2]
####
-# Open and read a file trough a `for` abuse.
+# Open and read a file through a `for` abuse.
# The abuse just ensures that the file is closed after the reading.
#
# for f in file_open("/etc/issue") do
# # Opens the connexion with the Mongo server.
# var client = new MongoClient("mongodb://localhost:27017/")
#
+# # Select the database.
+# var db_suffix = "NIT_TESTING_ID".environ
+# var db_name = "test_{db_suffix}"
+# var db = client.database(db_name)
+#
# # Retrieve a collection.
-# var col = client.database("test").collection("test")
+# var col = db.collection("test")
#
# # Insert a document in the collection.
# var doc = new JsonObject
#
# ~~~
# var client = new MongoClient("mongodb://localhost:27017/")
- # var db = client.database("test")
+ # var db_suffix = "NIT_TESTING_ID".environ
+ # var db_name = "test_{db_suffix}"
+ # var db = client.database(db_name)
# db.collection("test").insert(new JsonObject)
# assert client.database_names.has("test")
# ~~~
#
# ~~~
# var client = new MongoClient("mongodb://localhost:27017/")
- # assert client.database("test").name == "test"
+ # var db_suffix = "NIT_TESTING_ID".environ
+ # var db_name = "test_{db_suffix}"
+ # var db = client.database(db_name)
+ # assert db.name == db_name
# ~~~
fun database(name: String): MongoDb do return new MongoDb(self, name)
#
# ~~~
# var client = new MongoClient("mongodb://localhost:27017/")
- # var db = client.database("test")
+ # var db_suffix = "NIT_TESTING_ID".environ
+ # var db_name = "test_{db_suffix}"
+ # var db = client.database(db_name)
# db.collection("test").insert(new JsonObject)
# assert db.collection_names.has("test")
# ~~~
#
# ~~~
# var client = new MongoClient("mongodb://localhost:27017/")
- # var db = client.database("test")
+ # var db_suffix = "NIT_TESTING_ID".environ
+ # var db_name = "test_{db_suffix}"
+ # var db = client.database(db_name)
# var col = db.collection("test")
# assert col.name == "test"
# ~~~
#
# ~~~
# var client = new MongoClient("mongodb://localhost:27017/")
- # var db = client.database("test")
+ # var db_suffix = "NIT_TESTING_ID".environ
+ # var db_name = "test_{db_suffix}"
+ # var db = client.database(db_name)
# assert not db.has_collection("qwerty")
# ~~~
fun has_collection(name: String): Bool do
#
# ~~~
# var client = new MongoClient("mongodb://localhost:27017/")
- # var col = client.database("test").collection("test")
+ # var db_suffix = "NIT_TESTING_ID".environ
+ # var db_name = "test_{db_suffix}"
+ # var db = client.database(db_name)
+ # var col = db.collection("test")
# var doc = new JsonObject
# doc["foo"] = 10
# doc["bar"] = "bar"
#
# ~~~
# var client = new MongoClient("mongodb://localhost:27017/")
- # var col = client.database("test").collection("test")
+ # var db_suffix = "NIT_TESTING_ID".environ
+ # var db_name = "test_{db_suffix}"
+ # var db = client.database(db_name)
+ # var col = db.collection("test")
#
# var doc = new JsonObject
# doc["foo"] = 10
#
# ~~~
# var client = new MongoClient("mongodb://localhost:27017/")
- # var col = client.database("test").collection("test")
+ # var db_suffix = "NIT_TESTING_ID".environ
+ # var db_name = "test_{db_suffix}"
+ # var db = client.database(db_name)
+ # var col = db.collection("test")
# var sel = new JsonObject
# sel["foo"] = 10
# assert col.remove(sel)
#
# ~~~
# var client = new MongoClient("mongodb://localhost:27017/")
- # var col = client.database("test").collection("test")
+ # var db_suffix = "NIT_TESTING_ID".environ
+ # var db_name = "test_{db_suffix}"
+ # var db = client.database(db_name)
+ # var col = db.collection("test")
# var sel = new JsonObject
# sel["foo"] = 10
# var upd = new JsonObject
#
# ~~~
# var client = new MongoClient("mongodb://localhost:27017/")
- # var col = client.database("test").collection("test")
+ # var db_suffix = "NIT_TESTING_ID".environ
+ # var db_name = "test_{db_suffix}"
+ # var db = client.database(db_name)
+ # var col = db.collection("test")
# var query = new JsonObject
# query["foo"] = 10
# assert col.count(query) > 0
#
# ~~~
# var client = new MongoClient("mongodb://localhost:27017/")
- # var col = client.database("test").collection("test")
+ # var db_suffix = "NIT_TESTING_ID".environ
+ # var db_name = "test_{db_suffix}"
+ # var db = client.database(db_name)
+ # var col = db.collection("test")
# var query = new JsonObject
# query["foo"] = 10
# var doc = col.find(query)
#
# ~~~
# var client = new MongoClient("mongodb://localhost:27017/")
- # var col = client.database("test").collection("test")
+ # var db_suffix = "NIT_TESTING_ID".environ
+ # var db_name = "test_{db_suffix}"
+ # var db = client.database(db_name)
+ # var col = db.collection("test")
# var query = new JsonObject
# query["foo"] = 10
# assert col.find_all(query).length > 0
#
# ~~~
# var client = new MongoClient("mongodb://localhost:27017/")
- # var col = client.database("test").collection("test_aggregate")
+ # var db_suffix = "NIT_TESTING_ID".environ
+ # var db_name = "test_{db_suffix}"
+ # var db = client.database(db_name)
+ # var col = db.collection("test_aggregate")
#
# col.drop
#
#
# ~~~
# var client = new MongoClient("mongodb://localhost:27017/")
- # var col = client.database("test").collection("test")
- # assert col.stats["ns"] == "test.test"
+ # var db_suffix = "NIT_TESTING_ID".environ
+ # var db_name = "test_{db_suffix}"
+ # var db = client.database(db_name)
+ # var col = db.collection("test")
+ # assert col.stats["ns"] == "{db_name}.test"
# ~~~
fun stats: nullable JsonObject do
var bson = native.stats
# animals.add(cat)
# animals.add(turtle)
#
+# var db_suffix = "NIT_TESTING_ID".environ
# var db = new Postgres.open("dbname=postgres")
#
# assert db_is_open: not db.is_closed
-# assert create_table: db.create_table("IF NOT EXISTS animals (aname TEXT PRIMARY KEY, kind TEXT NOT NULL, age INT NOT NULL)") else print db.error
+# assert create_table: db.create_table("IF NOT EXISTS animals_{db_suffix} (aname TEXT PRIMARY KEY, kind TEXT NOT NULL, age INT NOT NULL)") else print db.error
#
# for animal in animals do
-# assert insert: db.insert("INTO animals VALUES('{animal.name}', '{animal.kind}', {animal.age})") else print db.error
+# assert insert: db.insert("INTO animals_{db_suffix} VALUES('{animal.name}', '{animal.kind}', {animal.age})") else print db.error
# end
#
-# var result = db.raw_execute("SELECT * FROM animals")
+# var result = db.raw_execute("SELECT * FROM animals_{db_suffix}")
# assert result.is_ok
-# assert drop_table: db.execute("DROP TABLE animals")
+# assert drop_table: db.execute("DROP TABLE animals_{db_suffix}")
# db.finish
# assert db_is_closed: db.is_closed
# ~~~
class Postgres
private var native_connection: NativePostgres
+ # Is the connection closed?
var is_closed = true
# Open the connnection with the database using the `conninfo`
native_connection.finish
end
+ # Prepares the statement `query` with `stmt_name` to be executed later
+ #
+ # `num_params` specifies the number of parameters expected at the statement
+ # execution.
+ #
+ # See `exec_prepared` for execution.
fun prepare(stmt_name:String, query:String, num_params: Int):PGResult do return new PGResult(native_connection.prepare(stmt_name, query, num_params))
+ # Execute prepared statement named `stmt_name` with `values`
+ #
+ # * `num_params` specifies the number of parameters given to the prepared statement
+ # * `param_lengths` specifies the length of each parameters
+ # * `param_formats` and `result_format` specifies the format used as input/output.
+ # Should be 0 for text results, 1 for binary.
+ #
+ # See `prepare`.
fun exec_prepared(stmt_name: String, num_params: Int, values: Array[String], param_lengths: Array[Int], param_formats: Array[Int], result_format: Int):PGResult do
return new PGResult(native_connection.exec_prepared(stmt_name, num_params, values, param_lengths, param_formats, result_format))
end
class PGResult
private var pg_result: NativePGResult
+ # Clears the result object and frees the memory allocated to the underlying C struct
fun clear do pg_result.clear
# Returns the number of rows in the query result
<div class='card'>
<div class='card-body'>
- <div class='card-heading'>
- <h4 class='card-title'>{{listTitle}}</h4>
- </div>
+ <h4 class='card-heading'>{{listTitle}}</h4>
<table class='table'>
<tr>
<th></th>
--- /dev/null
+<div>
+ <h4>Summary</h4>
+ <div ng-repeat='entry in headings' class='summary'>
+ <h1 ng-if='entry.level == 1'>
+ <a ng-click='goTo(entry)'>{{entry.text}}</a>
+ </h1>
+ <h2 ng-if='entry.level == 2'>
+ <a ng-click='goTo(entry)'>{{entry.text}}</a>
+ </h2>
+ <h3 ng-if='entry.level == 3'>
+ <a ng-click='goTo(entry)'>{{entry.text}}</a>
+ </h3>
+ <h4 ng-if='entry.level == 4'>
+ <a ng-click='goTo(entry)'>{{entry.text}}</a>
+ </h4>
+ <h5 ng-if='entry.level == 5'>
+ <a ng-click='goTo(entry)'>{{entry.text}}</a>
+ </h5>
+ <h6 ng-if='entry.level == 6'>
+ <a ng-click='goTo(entry)'>{{entry.text}}</a>
+ </h6>
+ </div>
+</div>
--- /dev/null
+<div>
+ <img class='avatar' width='100%' src='{{user.avatar_url}}' />
+ <h1>{{user.login}}</h1>
+ <h3>{{user.name}}</h3>
+ <ul class='list-unstyled'>
+ <li>
+ <span class='glyphicon glyphicon-envelope' />
+ <a href='mailto:{{user.email}}'>{{user.email}}</a>
+ </li>
+ <li>
+ <span class='glyphicon glyphicon-link' />
+ <a href='{{user.blog}}'>{{user.blog}}</a>
+ </li>
+ </ul>
+</div>
<img class='avatar avatar-icon' ng-src='{{user.avatar_url}}' />
</a>
<ul class="dropdown-menu dropdown-menu-right">
- <li><a href="/user">Profile</a></li>
+ <li>
+ <a href="/user"><span class='glyphicon glyphicon-user' /> Profile</a>
+ </li>
<li role="separator" class="divider"></li>
- <li><a href="/logout">Logout</a></li>
+ <li>
+ <a href="/logout"><span class='glyphicon glyphicon-log-out' /> Logout</a>
+ </li>
</ul>
</li>
</ul>
<span class='glyphicon glyphicon-menu-hamburger' />
</a>
<ul class='dropdown-menu'>
- <li><a href='/docdown'>DocDown</a></li>
- <li><a href='/grades'>Grades</a></li>
+ <li><a href='/docdown?edit'><span class='glyphicon glyphicon-edit'></span> DocDown</a></li>
+ <li><a href='/grades'><span class='glyphicon glyphicon-stats'></span> Grades</a></li>
</ul>
</li>
</ul>
</script>
<script src='https://cdnjs.cloudflare.com/ajax/libs/angular.js/1.5.5/angular-sanitize.js'>
</script>
- <script type='text/javascript'
- src='//cdnjs.cloudflare.com/ajax/libs/angular-loading-bar/0.9.0/loading-bar.min.js'>
+ <script src='//cdnjs.cloudflare.com/ajax/libs/angular-loading-bar/0.9.0/loading-bar.min.js'>
</script>
<script src='/javascripts/nitweb.js'></script>
.when('/doc/:id', {
templateUrl: 'views/doc.html',
controller: 'EntityCtrl',
- controllerAs: 'entityCtrl'
+ controllerAs: 'entityCtrl',
+ reloadOnSearch: false
})
.otherwise({
templateUrl: 'views/error.html'
};
})
+ .directive('uiSummary', function($rootScope, $location, $anchorScroll) {
+ return {
+ restrict: 'E',
+ scope: {
+ target: '@'
+ },
+ replace: true,
+ templateUrl: '/directives/ui-summary.html',
+ link: function ($scope, element, attrs) {
+ $scope.goTo = function(entity) {
+ $location.hash(entity.id);
+ }
+
+ $scope.textToId = function(text) {
+ return text.replace(/ /g, '-').replace(/[^A-Za-z_-]/g, '');
+ }
+
+ $rootScope.reloadSummary = function() {
+ var h = angular.element(document.querySelectorAll(
+ $scope.target + ' h1, ' +
+ $scope.target + ' h2, ' +
+ $scope.target + ' h3, ' +
+ $scope.target + ' h4, ' +
+ $scope.target + ' h5, ' +
+ $scope.target + ' h6 '));
+
+ $scope.headings = [];
+ angular.forEach(h, function(heading) {
+ var head = angular.element(heading);
+ if(!head.is(':visible')) { return ; }
+ var text = head.text().trim();
+ var id = $scope.textToId(text);
+ if(!head.attr('id')) {
+ head.attr('id', id);
+ } else {
+ id = head.attr('id');
+ }
+ $scope.headings.push({
+ id: id,
+ text: text,
+ level: parseInt(head[0].nodeName[1])
+ });
+ });
+ $anchorScroll();
+ }
+
+ $scope.$watch('target', function() {
+ setTimeout(function() {
+ $rootScope.reloadSummary();
+ }, 100);
+ });
+ }
+ };
+ })
+
.directive('uiFilterForm', function() {
return {
restrict: 'E',
this.loadGrades();
}])
- .directive('userMenu', ['User', function(User) {
+ .directive('userMenu', ['User', '$rootScope', function(User, $rootScope) {
return {
restrict: 'E',
templateUrl: '/directives/user/user-menu.html',
$scope.loadUser = function() {
User.loadUser(
function(data) {
- $scope.user = data;
+ $rootScope.user = data;
}, function(err) {
//$scope.error = err;
});
}
};
}])
+
+ .directive('userSidebar', ['User', '$rootScope', function(User, $rootScope) {
+ return {
+ restrict: 'E',
+ templateUrl: '/directives/user/sidebar.html',
+ };
+ }])
})();
/* doc */
.nitdoc .synopsys {
- font-size: 2em;
+ margin-top: 0;
}
.signature {
margin-bottom: 0px;
}
+/* Summary */
+
+.summary h1, .summary h2, .summary h3, .summary h4, .summary h5, .summary h6 {
+ margin: 5px 0;
+}
+
+.summary h1 a, .summary h2 a, .summary h3 a, .summary h4 a, .summary h5 a, .summary h6 a {
+ color: #555;
+}
+
+.summary h1 { font-size: 14px; margin-left: 0px; font-weight: bold; }
+.summary h2 { font-size: 13px; margin-left: 5px; font-weight: bold; }
+.summary h3 { font-size: 12px; margin-left: 10px; }
+.summary h4 { font-size: 11px; margin-left: 15px; }
+.summary h5 { font-size: 10px; margin-left: 20px; }
+.summary h6 { font-size: 9px; margin-left: 25px; }
+
/*
* Ratings
*/
<div class='tab-content'>
<div role='tabpanel' class='tab-pane fade in active' id='doc'>
- <entity-card mentity='mentity' default-tab='doc' no-synopsis='true' />
+ <div class='col-xs-3'>
+ <ui-summary target='#summary-content' />
+ </div>
+ <div id='summary-content' class='col-xs-9'>
+ <entity-card mentity='mentity' default-tab='doc' no-synopsis='true' />
- <entity-list list-title='Parents'
- list-entities='mentity.parents'
- list-object-filter='{}' />
+ <entity-list list-title='Parents'
+ list-entities='mentity.parents'
+ list-object-filter='{}' />
- <entity-list list-title='Constructors'
- list-entities='mentity.all_mproperties'
- list-object-filter='{is_init: true}' />
+ <entity-list list-title='Constructors'
+ list-entities='mentity.all_mproperties'
+ list-object-filter='{is_init: true}' />
- <entity-list list-title='Introduced properties'
- list-entities='mentity.intro_mproperties'
- list-object-filter='{is_init: "!true"}' />
+ <entity-list list-title='Introduced properties'
+ list-entities='mentity.intro_mproperties'
+ list-object-filter='{is_init: "!true"}' />
- <entity-list list-title='Redefined properties'
- list-entities='mentity.redef_mproperties'
- list-object-filter='{is_init: "!true"}' />
+ <entity-list list-title='Redefined properties'
+ list-entities='mentity.redef_mproperties'
+ list-object-filter='{is_init: "!true"}' />
+ </div>
</div>
<div role='tabpanel' class='tab-pane fade' id='all_props'>
<entity-list list-title='All properties' list-entities='mentity.all_mproperties'
</div>
<div role='tabpanel' class='tab-pane fade' id='metrics'>
<div class='card'>
- <div class='card-heading'>
- <h3 class='card-title'>Class inheritance</h3>
- </div>
<div class='card-body container-fluid'>
+ <h3 class='card-heading'>Class inheritance</h3>
<div class='col-sm-6'>
<h4>
Inheritance kind
</div>
</div>
<div class='card'>
- <div class='card-heading'>
- <h3 class='card-title'>Class properties</h3>
- </div>
<div class='card-body container-fluid'>
+ <h3 class='card-heading'>Class properties</h3>
<div class='col-sm-6'>
<h4>
Properties kind
<div class='tab-content'>
<div role='tabpanel' class='tab-pane fade in active' id='doc'>
- <entity-card mentity='mentity' default-tab='doc' no-synopsis='true' />
+ <div class='col-xs-3'>
+ <ui-summary target='#summary-content' />
+ </div>
+ <div class='col-xs-9' id='summary-content'>
+ <entity-card mentity='mentity' default-tab='doc' no-synopsis='true' />
- <entity-list list-title='Parent group' list-entities='[mentity.parent]'
- list-object-filter='{}' ng-if='mentity.parent' />
+ <entity-list list-title='Parent group' list-entities='[mentity.parent]'
+ list-object-filter='{}' ng-if='mentity.parent' />
- <entity-list list-title='Subgroups' list-entities='mentity.mgroups'
- list-object-filter='{}' />
+ <entity-list list-title='Subgroups' list-entities='mentity.mgroups'
+ list-object-filter='{}' />
- <entity-list list-title='Modules' list-entities='mentity.mmodules'
- list-object-filter='{}' />
+ <entity-list list-title='Modules' list-entities='mentity.mmodules'
+ list-object-filter='{}' />
+ </div>
</div>
<div role='tabpanel' class='tab-pane fade' id='graph'>
<div class='card'>
<div class='tab-content'>
<div role='tabpanel' class='tab-pane fade in active' id='doc'>
- <entity-card mentity='mentity' default-tab='doc' no-synopsis='true' />
-
- <entity-list list-title='Imported modules' list-entities='mentity.imports'
- list-object-filter='{}' />
+ <div class='col-xs-3'>
+ <ui-summary target='#summary-content' />
+ </div>
+ <div class='col-xs-9' id='summary-content'>
+ <entity-card mentity='mentity' default-tab='doc' no-synopsis='true' />
- <entity-list list-title='Introduced classes' list-entities='mentity.intro_mclasses'
- list-object-filter='{}' />
+ <entity-list list-title='Imported modules' list-entities='mentity.imports'
+ list-object-filter='{}' />
- <entity-list list-title='Class redefinitions' list-entities='mentity.redef_mclassdefs'
- list-object-filter='{}' />
+ <entity-list list-title='Introduced classes' list-entities='mentity.intro_mclasses'
+ list-object-filter='{}' />
+ <entity-list list-title='Class redefinitions' list-entities='mentity.redef_mclassdefs'
+ list-object-filter='{}' />
+ </div>
</div>
<div role='tabpanel' class='tab-pane fade' id='code'>
<div class='card'>
</div>
<div role='tabpanel' class='tab-pane fade' id='metrics'>
<div class='card'>
- <div class='card-heading'>
- <h3 class='card-title'>Module importation</h3>
- </div>
<div class='card-body container-fluid'>
+ <h3 class='card-heading'>Module importation</h3>
<div class='col-sm-6'>
<h4>
Importation metrics
</div>
</div>
<div class='card'>
- <div class='card-heading'>
- <h3 class='card-title'>Module definitions</h3>
- </div>
<div class='card-body container-fluid'>
+ <h3 class='card-heading'>Module definitions</h3>
<div class='col-sm-6'>
<h4>
Class definition kinds
<div class='tab-content'>
<div role='tabpanel' class='tab-pane fade in active' id='doc'>
- <entity-card mentity='mentity' default-tab='doc' no-synopsis='true' />
+ <div class='col-xs-3'>
+ <ui-summary target='#summary-content' />
+ </div>
+ <div class='col-xs-9' id='summary-content'>
+ <entity-card mentity='mentity' default-tab='doc' no-synopsis='true' />
- <entity-list list-title='Groups' list-entities='mentity.mgroups'
- list-object-filter='{}' />
+ <entity-list list-title='Groups' list-entities='mentity.mgroups'
+ list-object-filter='{}' />
+ </div>
</div>
<div role='tabpanel' class='tab-pane fade' id='graph'>
<div class='card'>
<div class='tab-content'>
<div role='tabpanel' class='tab-pane fade in active' id='doc'>
- <entity-card mentity='mentity' default-tab='doc' no-synopsis='true' />
+ <div class='col-xs-3'>
+ <ui-summary target='#summary-content' />
+ </div>
+ <div class='col-xs-9' id='summary-content'>
+ <entity-card mentity='mentity' default-tab='doc' no-synopsis='true' />
+ </div>
</div>
<div role='tabpanel' class='tab-pane fade' id='linearization'>
<entity-linearization
-<div class='container'>
- <div class='col-xs-4'>
- <img class='avatar' width='100%' src='{{user.avatar_url}}' />
- <h1>{{user.login}}</h1>
- <h3>{{user.name}}</h3>
- <ul class='list-unstyled'>
- <li>
- <span class='glyphicon glyphicon-envelope' />
- <a href='mailto:{{user.email}}'>{{user.email}}</a>
- </li>
- <li>
- <span class='glyphicon glyphicon-link' />
- <a href='{{user.blog}}'>{{user.blog}}</a>
- </li>
- </ul>
+<div class='container-fluid'>
+ <div class='col-xs-3'>
+ <user-sidebar />
</div>
<div class='col-xs-8'>
<h4>Your grades</h4>
not lines.first.has_prefix("\t") then
# parse synopsys
var syn = inline_proc.process(lines.shift)
- res.add "<p class=\"synopsys\">{syn}</p>"
+ res.add "<h1 class=\"synopsys\">{syn}</h1>"
end
end
# check for annotations
var name = mpackage.name.html_escape
res.more_head.add """<title>{{{name}}}</title>"""
- res.add """
-<div class="content">
-<h1 class="package-name">{{{name}}}</h1>
-"""
+ res.add """<div class="content">"""
+
var mdoc = mpackage.mdoc_or_fallback
- if mdoc != null then res.add mdoc.html_documentation
+ if mdoc == null then
+ res.add """<h1 class="package-name">{{{name}}}</h1>"""
+ else
+ res.add """
+<div style="float: left">
+ <h1 class="package-name">{{{name}}} - </h1>
+</div>
+"""
+ res.add mdoc.html_documentation
+ end
res.add "<h2>Content</h2>"
var ot = new OrderedTree[MConcern]
# Runs a webserver based on nitcorn that render things from model.
module nitweb
-import popcorn::pop_auth
import frontend
import web
import doc::doc_down
-redef class NitwebConfig
-
- # Github client id used for Github OAuth login.
- #
- # * key: `github.client_id`
- # * default: ``
- fun github_client_id: String do return ini["github.client.id"] or else ""
-
- # Github client secret used for Github OAuth login.
- #
- # * key: `github.client_secret`
- # * default: ``
- fun github_client_secret: String do return ini["github.client.secret"] or else ""
-end
-
redef class ToolContext
# Path to app config file.
import model
import frontend
-var test_name = "test_{get_time.to_s}"
+var test_id = "NIT_TESTING_ID".environ
+var test_name = "test_{test_id}"
# init tool
var toolcontext = new ToolContext
--- /dev/null
+# This file is part of NIT ( http://www.nitlanguage.org ).
+#
+# Licensed under the Apache License, Version 2.0 (the "License");
+# you may not use this file except in compliance with the License.
+# You may obtain a copy of the License at
+#
+# http://www.apache.org/licenses/LICENSE-2.0
+#
+# Unless required by applicable law or agreed to in writing, software
+# distributed under the License is distributed on an "AS IS" BASIS,
+# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+# See the License for the specific language governing permissions and
+# limitations under the License.
+
+module api_auth
+
+import web_base
+import popcorn::pop_auth
+
+redef class NitwebConfig
+
+ # Github client id used for Github OAuth login.
+ #
+ # * key: `github.client_id`
+ # * default: ``
+ fun github_client_id: String do return ini["github.client.id"] or else ""
+
+ # Github client secret used for Github OAuth login.
+ #
+ # * key: `github.client_secret`
+ # * default: ``
+ fun github_client_secret: String do return ini["github.client.secret"] or else ""
+end
+
+redef class APIRouter
+ redef init do
+ super
+ use("/user", new GithubUser)
+ end
+end
# Components required to build a web server about the nit model.
module web
+import api_auth
import api_model
import api_catalog
import api_graph
</div>
</nav>
</div>
-<div class="content">
-<h1 class="package-name">test_prog</h1>
-<div class="nitdoc"><p class="synopsys">Test program for model tools.</p><p>This program creates a fake model that can be used to test tools like:</p>
+<div class="content"><div style="float: left">
+ <h1 class="package-name">test_prog - </h1>
+</div>
+<div class="nitdoc"><h1 class="synopsys">Test program for model tools.</h1><p>This program creates a fake model that can be used to test tools like:</p>
<ul>
<li><code class="nitcode"><span class="nitcode"><span class="line"><span class="nc_i">nitdoc</span></span></span></code></li>
<li><code class="nitcode"><span class="nitcode"><span class="line"><span class="nc_i">nitmetrics</span></span></span></code></li>
import neo4j
-var key = get_time
+var key = "NIT_TESTING_ID".environ.to_i
var srv = new Neo4jServer
srv.start_quiet
var srv = new Neo4jServer
srv.start_quiet
-var key = get_time
+var key = "NIT_TESTING_ID".environ.to_i
var andres = new NeoNode
andres.labels.add_all(["PERSON", "MALE"])
import postgresql::native_postgres
+var db_suffix = "NIT_TESTING_ID".environ
var db = new NativePostgres.connectdb("dbname=postgres")
assert postgres_open: db.status.is_ok else print_error db.error
-var result = db.exec("CREATE TABLE IF NOT EXISTS animals (aname TEXT PRIMARY KEY, class TEXT NOT NULL, sex INTEGER)")
+var result = db.exec("CREATE TABLE IF NOT EXISTS animals_{db_suffix} (aname TEXT PRIMARY KEY, class TEXT NOT NULL, sex INTEGER)")
assert postgres_create_table: result.status.is_ok else print_error db.error
-result = db.exec("INSERT INTO animals VALUES('Whale', 'mammal', 1)")
+result = db.exec("INSERT INTO animals_{db_suffix} VALUES('Whale', 'mammal', 1)")
assert postgres_insert_1: result.status.is_ok else print_error db.error
-result = db.exec("INSERT INTO animals VALUES('Snake', 'reptile', 0)")
+result = db.exec("INSERT INTO animals_{db_suffix} VALUES('Snake', 'reptile', 0)")
assert postgres_insert_2: result.status.is_ok else print_error db.error
-result = db.exec("SELECT * FROM animals")
+result = db.exec("SELECT * FROM animals_{db_suffix}")
assert postgres_select: result.status.is_ok else print_error db.error
assert postgres_ntuples: result.ntuples == 2 else print_error db.error
print fields
end
-result = db.exec("DELETE FROM animals WHERE aname = 'Lioness'")
+result = db.exec("DELETE FROM animals_{db_suffix} WHERE aname = 'Lioness'")
assert postgres_delete_1: result.status.is_ok else print_error db.error
-result = db.exec("DELETE FROM animals WHERE aname = 'Snake'")
+result = db.exec("DELETE FROM animals_{db_suffix} WHERE aname = 'Snake'")
assert postgres_delete_2: result.status.is_ok else print_error db.error
-result = db.prepare("PREPARED_INSERT", "INSERT INTO animals(aname, class, sex) VALUES ($1, $2, $3)", 3)
+result = db.prepare("PREPARED_INSERT", "INSERT INTO animals_{db_suffix}(aname, class, sex) VALUES ($1, $2, $3)", 3)
assert postgres_prepare: result.status.is_ok else print_error db.error
-result = db.exec("DELETE FROM animals WHERE aname = 'Frog'")
+result = db.exec("DELETE FROM animals_{db_suffix} WHERE aname = 'Frog'")
assert postgres_delete_3: result.status.is_ok else print_error db.error
var values = ["Frog", "Anphibian", "1"]
result = db.exec_prepared("PREPARED_INSERT", 3, values, lengths, formats,0)
assert postgres_exec_prepared: result.status.is_ok else print_error db.error
-result = db.exec("DROP TABLE animals")
+result = db.exec("DROP TABLE animals_{db_suffix}")
assert postgres_drop_table: result.status.is_ok else print_error db.error
db.finish
import postgresql::postgres
+var db_suffix = "NIT_TESTING_ID".environ
var db = new Postgres.open("dbname=postgres")
assert open_db: not db.is_closed else print db.error
-assert create_table: db.create_table("IF NOT EXISTS users (uname TEXT PRIMARY KEY, pass TEXT NOT NULL, activated INTEGER, perc FLOAT)") else
+assert create_table: db.create_table("IF NOT EXISTS users_{db_suffix} (uname TEXT PRIMARY KEY, pass TEXT NOT NULL, activated INTEGER, perc FLOAT)") else
print db.error
end
-assert insert1: db.insert("INTO users VALUES('Bob', 'zzz', 1, 77.7)") else
+assert insert1: db.insert("INTO users_{db_suffix} VALUES('Bob', 'zzz', 1, 77.7)") else
print db.error
end
-assert insert2: db.insert("INTO users VALUES('Guilherme', 'xxx', 1, 88)") else
+assert insert2: db.insert("INTO users_{db_suffix} VALUES('Guilherme', 'xxx', 1, 88)") else
print db.error
end
-var result = db.raw_execute("SELECT * FROM users")
+var result = db.raw_execute("SELECT * FROM users_{db_suffix}")
assert raw_exec: result.is_ok else print db.error
assert postgres_isnull: result.is_null(0,0) == false else print_error db.error
assert postgres_value: result.value(0,0) == "Bob" else print_error db.error
-assert drop_table: db.execute("DROP TABLE users") else print db.error
+assert drop_table: db.execute("DROP TABLE users_{db_suffix}") else print db.error
db.finish